Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Hexamethylenetetramine, 99%
CAS: 100-97-0 Molecular Formula: C6H12N4 Molecular Weight (g/mol): 140.19 InChI Key: VKYKSIONXSXAKP-UHFFFAOYSA-N Synonym: methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine PubChem CID: 4101 ChEBI: CHEBI:6824 SMILES: C1N2CN3CN1CN(C2)C3
| PubChem CID | 4101 |
|---|---|
| CAS | 100-97-0 |
| Molecular Weight (g/mol) | 140.19 |
| ChEBI | CHEBI:6824 |
| SMILES | C1N2CN3CN1CN(C2)C3 |
| Synonym | methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine |
| InChI Key | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| Molecular Formula | C6H12N4 |
Dithizone, 98%
CAS: 60-10-6 Molecular Formula: C13H12N4S Molecular Weight (g/mol): 256.33 MDL Number: MFCD00003025 InChI Key: UOFGSWVZMUXXIY-UHFFFAOYSA-N Synonym: dithizone,dithizon,ditizon,carbazone, diphenylthio,usaf ek-3092,diazenecarbothioic acid, phenyl-, 2-phenylhydrazide,1,5-diphenyl-3-mercaptoformazan,3-formazanthiol, 1,5-diphenyl,unii-njz2cj4d6p,1,5-diphenyl-3-thiocarbazone PubChem CID: 657262 SMILES: S=C(NNC1=CC=CC=C1)N=NC1=CC=CC=C1
| PubChem CID | 657262 |
|---|---|
| CAS | 60-10-6 |
| Molecular Weight (g/mol) | 256.33 |
| MDL Number | MFCD00003025 |
| SMILES | S=C(NNC1=CC=CC=C1)N=NC1=CC=CC=C1 |
| Synonym | dithizone,dithizon,ditizon,carbazone, diphenylthio,usaf ek-3092,diazenecarbothioic acid, phenyl-, 2-phenylhydrazide,1,5-diphenyl-3-mercaptoformazan,3-formazanthiol, 1,5-diphenyl,unii-njz2cj4d6p,1,5-diphenyl-3-thiocarbazone |
| InChI Key | UOFGSWVZMUXXIY-UHFFFAOYSA-N |
| Molecular Formula | C13H12N4S |
n-Decylamine, 99%
CAS: 2016-57-1 Molecular Formula: C10H23N Molecular Weight (g/mol): 157.30 MDL Number: MFCD00008149 InChI Key: MHZGKXUYDGKKIU-UHFFFAOYSA-N Synonym: decylamine,1-aminodecane,1-decanamine,n-decylamine,1-decylamine,decanamine,monodecylamine,kemamine p 190d,aminodecane,decyl amine PubChem CID: 8916 IUPAC Name: decan-1-amine SMILES: CCCCCCCCCCN
| PubChem CID | 8916 |
|---|---|
| CAS | 2016-57-1 |
| Molecular Weight (g/mol) | 157.30 |
| MDL Number | MFCD00008149 |
| SMILES | CCCCCCCCCCN |
| Synonym | decylamine,1-aminodecane,1-decanamine,n-decylamine,1-decylamine,decanamine,monodecylamine,kemamine p 190d,aminodecane,decyl amine |
| IUPAC Name | decan-1-amine |
| InChI Key | MHZGKXUYDGKKIU-UHFFFAOYSA-N |
| Molecular Formula | C10H23N |
Acetamide, 99%
CAS: 60-35-5 Molecular Formula: C2H5NO Molecular Weight (g/mol): 59.068 MDL Number: MFCD00008023 InChI Key: DLFVBJFMPXGRIB-UHFFFAOYSA-N Synonym: ethanamide,acetic acid amide,methanecarboxamide,acetimidic acid,amide c2,ethanimidic acid,acetamid,amid kyseliny octove,caswell no. 003h,acetimidic acid van PubChem CID: 178 ChEBI: CHEBI:49028 IUPAC Name: acetamide SMILES: CC(=O)N
| PubChem CID | 178 |
|---|---|
| CAS | 60-35-5 |
| Molecular Weight (g/mol) | 59.068 |
| ChEBI | CHEBI:49028 |
| MDL Number | MFCD00008023 |
| SMILES | CC(=O)N |
| Synonym | ethanamide,acetic acid amide,methanecarboxamide,acetimidic acid,amide c2,ethanimidic acid,acetamid,amid kyseliny octove,caswell no. 003h,acetimidic acid van |
| IUPAC Name | acetamide |
| InChI Key | DLFVBJFMPXGRIB-UHFFFAOYSA-N |
| Molecular Formula | C2H5NO |
3-Methyl-1-butanol 99.0+%, TCI America™
CAS: 123-51-3 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00002934 InChI Key: PHTQWCKDNZKARW-UHFFFAOYSA-N Synonym: 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol PubChem CID: 31260 ChEBI: CHEBI:15837 IUPAC Name: 3-methylbutan-1-ol SMILES: CC(C)CCO
| PubChem CID | 31260 |
|---|---|
| CAS | 123-51-3 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:15837 |
| MDL Number | MFCD00002934 |
| SMILES | CC(C)CCO |
| Synonym | 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol |
| IUPAC Name | 3-methylbutan-1-ol |
| InChI Key | PHTQWCKDNZKARW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Thermo Scientific Chemicals Doxycycline hyclate, 98%
CAS: 24390-14-5 Molecular Formula: 0·5 C2H6O Molecular Weight (g/mol): 512.94 InChI Key: ISZOFWGVNMFENH-YDLUHMIOSA-N Synonym: doryx,doxycycline hyclate,doxycycline, hydrochloride, hemiethanolate, hemihydrate; PubChem CID: 131676157 IUPAC Name: (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethanol;dihydrate;hydrochloride SMILES: CCO.CCO.CC1C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.O.O.Cl
| PubChem CID | 131676157 |
|---|---|
| CAS | 24390-14-5 |
| Molecular Weight (g/mol) | 512.94 |
| SMILES | CCO.CCO.CC1C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.O.O.Cl |
| Synonym | doryx,doxycycline hyclate,doxycycline, hydrochloride, hemiethanolate, hemihydrate; |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethanol;dihydrate;hydrochloride |
| InChI Key | ISZOFWGVNMFENH-YDLUHMIOSA-N |
| Molecular Formula | 0·5 C2H6O |
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide hydrochloride, 98+%
CAS: 25952-53-8 Molecular Formula: C8H18ClN3 Molecular Weight (g/mol): 191.70 MDL Number: MFCD00012503 InChI Key: FPQQSJJWHUJYPU-UHFFFAOYSA-N Synonym: 1-3-dimethylaminopropyl-3-ethylcarbodiimide hydrochloride,edc.hcl,edci,edc hydrochloride,wsc hcl,edac hydrochloride,edac, hydrochloride,1-ethyl-3-3-dimethylaminopropyl carbodiimide hydrochloride,edcl,edac hcl PubChem CID: 2723939 IUPAC Name: 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride SMILES: Cl.CCN=C=NCCCN(C)C
| PubChem CID | 2723939 |
|---|---|
| CAS | 25952-53-8 |
| Molecular Weight (g/mol) | 191.70 |
| MDL Number | MFCD00012503 |
| SMILES | Cl.CCN=C=NCCCN(C)C |
| Synonym | 1-3-dimethylaminopropyl-3-ethylcarbodiimide hydrochloride,edc.hcl,edci,edc hydrochloride,wsc hcl,edac hydrochloride,edac, hydrochloride,1-ethyl-3-3-dimethylaminopropyl carbodiimide hydrochloride,edcl,edac hcl |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
| InChI Key | FPQQSJJWHUJYPU-UHFFFAOYSA-N |
| Molecular Formula | C8H18ClN3 |
Indole-3-butyric acid, 98%
CAS: 133-32-4 Molecular Formula: C12H13NO2 Molecular Weight (g/mol): 203.241 MDL Number: MFCD00005664 InChI Key: JTEDVYBZBROSJT-UHFFFAOYSA-N Synonym: indole-3-butyric acid,3-indolebutyric acid,4-1h-indol-3-yl butanoic acid,indolebutyric acid,hormodin,1h-indole-3-butanoic acid,seradix,indole-3-butanoic acid,jiffy grow,4-indol-3-yl butyric acid PubChem CID: 8617 ChEBI: CHEBI:33070 IUPAC Name: 4-(1H-indol-3-yl)butanoic acid SMILES: C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O
| PubChem CID | 8617 |
|---|---|
| CAS | 133-32-4 |
| Molecular Weight (g/mol) | 203.241 |
| ChEBI | CHEBI:33070 |
| MDL Number | MFCD00005664 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
| Synonym | indole-3-butyric acid,3-indolebutyric acid,4-1h-indol-3-yl butanoic acid,indolebutyric acid,hormodin,1h-indole-3-butanoic acid,seradix,indole-3-butanoic acid,jiffy grow,4-indol-3-yl butyric acid |
| IUPAC Name | 4-(1H-indol-3-yl)butanoic acid |
| InChI Key | JTEDVYBZBROSJT-UHFFFAOYSA-N |
| Molecular Formula | C12H13NO2 |
2,2'-Bipyridine, 99+%
CAS: 366-18-7 Molecular Formula: C10H8N2 Molecular Weight (g/mol): 156.19 MDL Number: MFCD00006212 InChI Key: ROFVEXUMMXZLPA-UHFFFAOYSA-N Synonym: 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl PubChem CID: 1474 ChEBI: CHEBI:30351 SMILES: C1=CC=C(N=C1)C1=CC=CC=N1
| PubChem CID | 1474 |
|---|---|
| CAS | 366-18-7 |
| Molecular Weight (g/mol) | 156.19 |
| ChEBI | CHEBI:30351 |
| MDL Number | MFCD00006212 |
| SMILES | C1=CC=C(N=C1)C1=CC=CC=N1 |
| Synonym | 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl |
| InChI Key | ROFVEXUMMXZLPA-UHFFFAOYSA-N |
| Molecular Formula | C10H8N2 |
Tetrabutylammonium hydroxide, 40 wt.% (1.5M) solution in water
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9950g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 38 to 42% (Total base) |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Boiling Point | >100.0°C |
| Color | White to Yellow |
| Physical Form | Crystals or Powder |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.995 |
Benzophenone, 99+%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Spermidine trihydrochloride, 99+%
CAS: 334-50-9 Molecular Formula: C7H22Cl3N3 Molecular Weight (g/mol): 254.62 MDL Number: MFCD00012918 InChI Key: LCNBIHVSOPXFMR-UHFFFAOYSA-N Synonym: spermidine trihydrochloride,n-3-aminopropyl-1,4-butanediamine trihydrochloride,spermidine hydrochloride,n1-3-aminopropyl butane-1,4-diamine trihydrochloride,unii-1o14bed398,1,4-butanediamine, n-3-aminopropyl-, trihydrochloride,spermidine, trihydrochloride,1,4-butanediamine, n-3-aminopropyl , hydrochloride,n-3-aminopropyl butane-1,4-diamine trihydrochloride,4-azoniaoctamethylenediammonium trichloride PubChem CID: 9539 IUPAC Name: N'-(3-aminopropyl)butane-1,4-diamine;trihydrochloride SMILES: [H+].[H+].[H+].[Cl-].[Cl-].[Cl-].NCCCCNCCCN
| PubChem CID | 9539 |
|---|---|
| CAS | 334-50-9 |
| Molecular Weight (g/mol) | 254.62 |
| MDL Number | MFCD00012918 |
| SMILES | [H+].[H+].[H+].[Cl-].[Cl-].[Cl-].NCCCCNCCCN |
| Synonym | spermidine trihydrochloride,n-3-aminopropyl-1,4-butanediamine trihydrochloride,spermidine hydrochloride,n1-3-aminopropyl butane-1,4-diamine trihydrochloride,unii-1o14bed398,1,4-butanediamine, n-3-aminopropyl-, trihydrochloride,spermidine, trihydrochloride,1,4-butanediamine, n-3-aminopropyl , hydrochloride,n-3-aminopropyl butane-1,4-diamine trihydrochloride,4-azoniaoctamethylenediammonium trichloride |
| IUPAC Name | N'-(3-aminopropyl)butane-1,4-diamine;trihydrochloride |
| InChI Key | LCNBIHVSOPXFMR-UHFFFAOYSA-N |
| Molecular Formula | C7H22Cl3N3 |
3-Chloroperoxybenzoic Acid, 70-75%, balance 3-Chlorobenzoic Acid and water
3-Chloroperoxybenzoic acid, 70-75%, C7H5ClO3, CAS Number-937-14-4, 535-80-8, 7732-18-5 | CAS: 937-14-4 | C7H5ClO3 | 172.56 g/mol
| Linear Formula | ClC6H4CO3H |
|---|---|
| Molecular Weight (g/mol) | 172.56 |
| ChEBI | CHEBI:52091 |
| CAS Min % | 25.0 |
| InChI Key | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| Density | 0.5600g/mL |
| PubChem CID | 70297 |
| Name Note | 70 - 75% |
| Percent Purity | 70-75% |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| RTECS Number | SD9470000 |
| Formula Weight | 172.57 |
| Melting Point | 92.0°C to 94.0°C |
| CAS Max % | 30.0 |
| Color | White |
| Physical Form | Moist Powder |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| Assay Percent Range | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep/Store away from clothing/ combustible materials. IF SWALLOWED: rin |
| MDL Number | MFCD00002127 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. Heating may cause a fire. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid |
| Beilstein | 09,IV,972 |
| Molecular Formula | C7H5ClO3 |
| EINECS Number | 213-322-3 |
| Specific Gravity | 0.56 |
Chloroquine diphosphate salt, 98%
CAS: 50-63-5 Molecular Formula: C18H32ClN3O8P2 Molecular Weight (g/mol): 515.86 MDL Number: MFCD00069852 InChI Key: QKICWELGRMTQCR-UHFFFAOYNA-N Synonym: chloroquine diphosphate,chloroquine phosphate,aralen phosphate,chingamin phosphate,chloroquine bis phosphate,chingaminum,alermine,h-stadur,aralen diphosphate,miniquine PubChem CID: 64927 SMILES: OP(O)(O)=O.OP(O)(O)=O.CCN(CC)CCCC(C)NC1=C2C=CC(Cl)=CC2=NC=C1
| PubChem CID | 64927 |
|---|---|
| CAS | 50-63-5 |
| Molecular Weight (g/mol) | 515.86 |
| MDL Number | MFCD00069852 |
| SMILES | OP(O)(O)=O.OP(O)(O)=O.CCN(CC)CCCC(C)NC1=C2C=CC(Cl)=CC2=NC=C1 |
| Synonym | chloroquine diphosphate,chloroquine phosphate,aralen phosphate,chingamin phosphate,chloroquine bis phosphate,chingaminum,alermine,h-stadur,aralen diphosphate,miniquine |
| InChI Key | QKICWELGRMTQCR-UHFFFAOYNA-N |
| Molecular Formula | C18H32ClN3O8P2 |
1,10-Phenanthroline iron(II) sulfate, 0.025M aq. soln.
CAS: 14634-91-4 Molecular Formula: C36H24FeN6O4S Molecular Weight (g/mol): 692.53 MDL Number: MFCD00036428 InChI Key: CIWXFRVOSDNDJZ-UHFFFAOYSA-L Synonym: ferroin,ferroin indicator solution,iron 2+ , tris 1,10-phenanthroline-.kappa.n1,.kappa.n10-, oc-6-11-, sulfate 1:1,ferroin sulfate,ferroin solution,1,10-phenanthroline ferrous sulfate,tris 1,10-phenanthroline-n1,n10 iron sulphate,ferrous 1,10-phenanthroline sulfate,ferroin indicator solution, 25 mmol/l,iron 2+ , tris 1,10-phenanthroline-kappan1,kappan10-, oc-6-11-, sulfate 1:1 PubChem CID: 84567 SMILES: [Fe++].[O-]S([O-])(=O)=O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1
| PubChem CID | 84567 |
|---|---|
| CAS | 14634-91-4 |
| Molecular Weight (g/mol) | 692.53 |
| MDL Number | MFCD00036428 |
| SMILES | [Fe++].[O-]S([O-])(=O)=O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| Synonym | ferroin,ferroin indicator solution,iron 2+ , tris 1,10-phenanthroline-.kappa.n1,.kappa.n10-, oc-6-11-, sulfate 1:1,ferroin sulfate,ferroin solution,1,10-phenanthroline ferrous sulfate,tris 1,10-phenanthroline-n1,n10 iron sulphate,ferrous 1,10-phenanthroline sulfate,ferroin indicator solution, 25 mmol/l,iron 2+ , tris 1,10-phenanthroline-kappan1,kappan10-, oc-6-11-, sulfate 1:1 |
| InChI Key | CIWXFRVOSDNDJZ-UHFFFAOYSA-L |
| Molecular Formula | C36H24FeN6O4S |