Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Hexamethylenetetramine (Crystalline/USP), Fisher Chemical
CAS: 100-97-0 Molecular Formula: C6H12N4 Molecular Weight (g/mol): 140.19 MDL Number: MFCD00006895 InChI Key: VKYKSIONXSXAKP-UHFFFAOYSA-N Synonym: methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine PubChem CID: 4101 ChEBI: CHEBI:6824 SMILES: C1N2CN3CN1CN(C2)C3
| PubChem CID | 4101 |
|---|---|
| CAS | 100-97-0 |
| Molecular Weight (g/mol) | 140.19 |
| ChEBI | CHEBI:6824 |
| MDL Number | MFCD00006895 |
| SMILES | C1N2CN3CN1CN(C2)C3 |
| Synonym | methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine |
| InChI Key | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| Molecular Formula | C6H12N4 |
5-Sulfosalicylic Acid Dihydrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 5965-83-3 Molecular Formula: C9H14O6S Molecular Weight (g/mol): 250.27 MDL Number: MFCD00007508,MFCD00149540 InChI Key: NFYHZVWMQHQKRU-UHFFFAOYSA-N Synonym: 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd PubChem CID: 2723734 IUPAC Name: 2-hydroxy-5-sulfobenzoic acid; bis(methane) SMILES: C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O
| PubChem CID | 2723734 |
|---|---|
| CAS | 5965-83-3 |
| Molecular Weight (g/mol) | 250.27 |
| MDL Number | MFCD00007508,MFCD00149540 |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| IUPAC Name | 2-hydroxy-5-sulfobenzoic acid; bis(methane) |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| Molecular Formula | C9H14O6S |
Dibutylamine (Reagent), Fisher Chemical™
CAS: 111-92-2 Molecular Formula: C8H19N Molecular Weight (g/mol): 129.247 MDL Number: MFCD00009429 InChI Key: JQVDAXLFBXTEQA-UHFFFAOYSA-N Synonym: dibutylamine,di-n-butylamine,1-butanamine, n-butyl,n-butyl-1-butanamine,dibutilamina,n-dibutylamine,di-n-butyl amine,dibutyl amine,di-normal-butylamine,dibutyl-amine PubChem CID: 8148 IUPAC Name: N-butylbutan-1-amine SMILES: CCCCNCCCC
| PubChem CID | 8148 |
|---|---|
| CAS | 111-92-2 |
| Molecular Weight (g/mol) | 129.247 |
| MDL Number | MFCD00009429 |
| SMILES | CCCCNCCCC |
| Synonym | dibutylamine,di-n-butylamine,1-butanamine, n-butyl,n-butyl-1-butanamine,dibutilamina,n-dibutylamine,di-n-butyl amine,dibutyl amine,di-normal-butylamine,dibutyl-amine |
| IUPAC Name | N-butylbutan-1-amine |
| InChI Key | JQVDAXLFBXTEQA-UHFFFAOYSA-N |
| Molecular Formula | C8H19N |
n-Butyl Acetate (Reagent), Fisher Chemical™
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Saccharin Sodium (Powder/USP/FCC), Fisher Chemical™
CAS: 128-44-9 Molecular Formula: C7H9NNaO5S Molecular Weight (g/mol): 242.201 MDL Number: MFCD00013092 InChI Key: UQKRDMFNUSMUCB-UHFFFAOYSA-N Synonym: saccharin sodium dihydrate,saccharin sodium,sodium saccharin,saccharin soluble,saccharin sodium salt hydrate,1,2-benzisothiazol-3 2h-one, 1,1-dioxide, sodium salt, dihydrate,o-sulfobenzimide sodium salt,2-sulfobenzoic acid imide sodium salt,saccharin sodium salt dihydrate,c7h4nnao3s.2h2o PubChem CID: 46942257 IUPAC Name: 1,1-dioxo-1,2-benzothiazol-3-one;sodium;dihydrate SMILES: C1=CC=C2C(=C1)C(=O)NS2(=O)=O.O.O.[Na]
| PubChem CID | 46942257 |
|---|---|
| CAS | 128-44-9 |
| Molecular Weight (g/mol) | 242.201 |
| MDL Number | MFCD00013092 |
| SMILES | C1=CC=C2C(=C1)C(=O)NS2(=O)=O.O.O.[Na] |
| Synonym | saccharin sodium dihydrate,saccharin sodium,sodium saccharin,saccharin soluble,saccharin sodium salt hydrate,1,2-benzisothiazol-3 2h-one, 1,1-dioxide, sodium salt, dihydrate,o-sulfobenzimide sodium salt,2-sulfobenzoic acid imide sodium salt,saccharin sodium salt dihydrate,c7h4nnao3s.2h2o |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazol-3-one;sodium;dihydrate |
| InChI Key | UQKRDMFNUSMUCB-UHFFFAOYSA-N |
| Molecular Formula | C7H9NNaO5S |
Ascorbic Acid (Powder/USP/FCC), Fisher Chemical™
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 IUPAC Name: (5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2,5-dihydrofuran-2-one SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2,5-dihydrofuran-2-one |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
Pyruvic Acid Sodium Salt (Reagent), Fisher Chemical
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.044 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Polyethylene Glycol 8000 (PEG), Fisher BioReagents™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000,Polyethylene Oxide,Carbowax™ IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000,Polyethylene Oxide,Carbowax™ |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Urea (USP), Fisher Chemical™
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Sodium Bitartrate Monohydrate (Crystalline/Certified), Fisher Chemical
CAS: 6131-98-2 Molecular Formula: C4H7NaO7 Molecular Weight (g/mol): 190.083 MDL Number: MFCD00150038 InChI Key: LLVQEXSQFBTIRD-UHFFFAOYSA-M Synonym: sodium bitartrate monohydrate,sodium hydrogen tartrate monohydrate,sodium bitartrate,monohydrate,tartaric acid monosodium salt,sodium 3-carboxy-2,3-dihydroxypropanoate hydrate,l-+-tartaric acid monosodium salt,sodium bitartrate, monohydrate,,sodium bitartrate monohydrate, bioultra t,sodium 3-carboxy-2,3-dihydroxypropanoate-water 1/1/1,sodium bitartrate monohydrate, purum p.a t PubChem CID: 23678966 IUPAC Name: sodium;2,3,4-trihydroxy-4-oxobutanoate;hydrate SMILES: C(C(C(=O)[O-])O)(C(=O)O)O.O.[Na+]
| PubChem CID | 23678966 |
|---|---|
| CAS | 6131-98-2 |
| Molecular Weight (g/mol) | 190.083 |
| MDL Number | MFCD00150038 |
| SMILES | C(C(C(=O)[O-])O)(C(=O)O)O.O.[Na+] |
| Synonym | sodium bitartrate monohydrate,sodium hydrogen tartrate monohydrate,sodium bitartrate,monohydrate,tartaric acid monosodium salt,sodium 3-carboxy-2,3-dihydroxypropanoate hydrate,l-+-tartaric acid monosodium salt,sodium bitartrate, monohydrate,,sodium bitartrate monohydrate, bioultra t,sodium 3-carboxy-2,3-dihydroxypropanoate-water 1/1/1,sodium bitartrate monohydrate, purum p.a t |
| IUPAC Name | sodium;2,3,4-trihydroxy-4-oxobutanoate;hydrate |
| InChI Key | LLVQEXSQFBTIRD-UHFFFAOYSA-M |
| Molecular Formula | C4H7NaO7 |
Decane, Fisher Chemical
CAS: 124-18-5 Molecular Formula: C10H22 Molecular Weight (g/mol): 142.286 MDL Number: MFCD00008954 InChI Key: DIOQZVSQGTUSAI-UHFFFAOYSA-N Synonym: n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 PubChem CID: 15600 ChEBI: CHEBI:41808 IUPAC Name: decane SMILES: CCCCCCCCCC
| PubChem CID | 15600 |
|---|---|
| CAS | 124-18-5 |
| Molecular Weight (g/mol) | 142.286 |
| ChEBI | CHEBI:41808 |
| MDL Number | MFCD00008954 |
| SMILES | CCCCCCCCCC |
| Synonym | n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 |
| IUPAC Name | decane |
| InChI Key | DIOQZVSQGTUSAI-UHFFFAOYSA-N |
| Molecular Formula | C10H22 |
[Ethylenebis-(oxyethylenenitrilo)]-Tetraacetic Acid, Fisher Chemical
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
Ethylenediaminetetraacetic Acid, Disodium Salt Dihydrate (Crystalline Powder/USP/FCC), Fisher Chemical™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Tetrabutylammonium Phosphate (White to Off-White Powder/HPLC Grade), Fisher Chemical™
CAS: 5574-97-0 Molecular Formula: C16H38NO4P Molecular Weight (g/mol): 339.46 MDL Number: MFCD00064526 InChI Key: ARRNBPCNZJXHRJ-UHFFFAOYSA-M PubChem CID: 2735142 IUPAC Name: tetrabutylazanium dihydrogen phosphate SMILES: OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2735142 |
|---|---|
| CAS | 5574-97-0 |
| Molecular Weight (g/mol) | 339.46 |
| MDL Number | MFCD00064526 |
| SMILES | OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC |
| IUPAC Name | tetrabutylazanium dihydrogen phosphate |
| InChI Key | ARRNBPCNZJXHRJ-UHFFFAOYSA-M |
| Molecular Formula | C16H38NO4P |
Propylene Glycol (USP/FCC), Fisher Chemical™
CAS: 57-55-6 Molecular Formula: C3H8O2 Molecular Weight (g/mol): 76.095 MDL Number: MFCD00064272 InChI Key: DNIAPMSPPWPWGF-UHFFFAOYSA-N Synonym: 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost PubChem CID: 1030 ChEBI: CHEBI:16997 IUPAC Name: propane-1,2-diol SMILES: CC(CO)O
| PubChem CID | 1030 |
|---|---|
| CAS | 57-55-6 |
| Molecular Weight (g/mol) | 76.095 |
| ChEBI | CHEBI:16997 |
| MDL Number | MFCD00064272 |
| SMILES | CC(CO)O |
| Synonym | 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost |
| IUPAC Name | propane-1,2-diol |
| InChI Key | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
| Molecular Formula | C3H8O2 |