Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Quinaldine, 96%
CAS: 91-63-4 Molecular Formula: C10H9N Molecular Weight (g/mol): 143.19 MDL Number: MFCD00006756 InChI Key: SMUQFGGVLNAIOZ-UHFFFAOYSA-N Synonym: quinaldine,chinaldine,khinaldin,quinoline, 2-methyl,2-methyl-quinoline,methylquinoline,2-methylchinolin,ccris 1155,2-methylchinoline,2-methylchinolin czech PubChem CID: 7060 IUPAC Name: 2-methylquinoline SMILES: CC1=CC=C2C=CC=CC2=N1
| PubChem CID | 7060 |
|---|---|
| CAS | 91-63-4 |
| Molecular Weight (g/mol) | 143.19 |
| MDL Number | MFCD00006756 |
| SMILES | CC1=CC=C2C=CC=CC2=N1 |
| Synonym | quinaldine,chinaldine,khinaldin,quinoline, 2-methyl,2-methyl-quinoline,methylquinoline,2-methylchinolin,ccris 1155,2-methylchinoline,2-methylchinolin czech |
| IUPAC Name | 2-methylquinoline |
| InChI Key | SMUQFGGVLNAIOZ-UHFFFAOYSA-N |
| Molecular Formula | C10H9N |
4,4'-Dibromobiphenyl, 99%
CAS: 92-86-4 Molecular Formula: C12H8Br2 Molecular Weight (g/mol): 312.00 MDL Number: MFCD00000101 InChI Key: HQJQYILBCQPYBI-UHFFFAOYSA-N Synonym: 4,4'-dibromobiphenyl,1,1'-biphenyl, 4,4'-dibromo,p,p'-dibromobiphenyl,4,4'-dibromodiphenyl,1-bromo-4-4-bromophenyl benzene,4,4'-dibromo-biphenyl,unii-pou26v2xt2,4',4-dibromobiphenyl,biphenyl, 4,4'-dibromo,pou26v2xt2 PubChem CID: 7110 IUPAC Name: 1-bromo-4-(4-bromophenyl)benzene SMILES: BrC1=CC=C(C=C1)C1=CC=C(Br)C=C1
| PubChem CID | 7110 |
|---|---|
| CAS | 92-86-4 |
| Molecular Weight (g/mol) | 312.00 |
| MDL Number | MFCD00000101 |
| SMILES | BrC1=CC=C(C=C1)C1=CC=C(Br)C=C1 |
| Synonym | 4,4'-dibromobiphenyl,1,1'-biphenyl, 4,4'-dibromo,p,p'-dibromobiphenyl,4,4'-dibromodiphenyl,1-bromo-4-4-bromophenyl benzene,4,4'-dibromo-biphenyl,unii-pou26v2xt2,4',4-dibromobiphenyl,biphenyl, 4,4'-dibromo,pou26v2xt2 |
| IUPAC Name | 1-bromo-4-(4-bromophenyl)benzene |
| InChI Key | HQJQYILBCQPYBI-UHFFFAOYSA-N |
| Molecular Formula | C12H8Br2 |
Orcinol Monohydrate, 99%
CAS: 6153-39-5 Molecular Formula: C7H8O2·H2O Molecular Weight (g/mol): 142.15 MDL Number: MFCD00149092 InChI Key: NBKPNAMTHBIMLA-UHFFFAOYSA-N Synonym: 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate PubChem CID: 3083941 IUPAC Name: 5-methylbenzene-1,3-diol;hydrate SMILES: CC1=CC(=CC(=C1)O)O.O
| PubChem CID | 3083941 |
|---|---|
| CAS | 6153-39-5 |
| Molecular Weight (g/mol) | 142.15 |
| MDL Number | MFCD00149092 |
| SMILES | CC1=CC(=CC(=C1)O)O.O |
| Synonym | 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate |
| IUPAC Name | 5-methylbenzene-1,3-diol;hydrate |
| InChI Key | NBKPNAMTHBIMLA-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2·H2O |
Thiophene, 99%
CAS: 110-02-1 Molecular Formula: C4H4S Molecular Weight (g/mol): 84.14 MDL Number: MFCD00005413 InChI Key: YTPLMLYBLZKORZ-UHFFFAOYSA-N Synonym: thiofuran,thiole,thiophen,thiotetrole,thiacyclopentadiene,divinylene sulfide,thiaphene,thiofuram,thiofurfuran,furan, thio PubChem CID: 8030 ChEBI: CHEBI:30856 IUPAC Name: thiophene SMILES: S1C=CC=C1
| PubChem CID | 8030 |
|---|---|
| CAS | 110-02-1 |
| Molecular Weight (g/mol) | 84.14 |
| ChEBI | CHEBI:30856 |
| MDL Number | MFCD00005413 |
| SMILES | S1C=CC=C1 |
| Synonym | thiofuran,thiole,thiophen,thiotetrole,thiacyclopentadiene,divinylene sulfide,thiaphene,thiofuram,thiofurfuran,furan, thio |
| IUPAC Name | thiophene |
| InChI Key | YTPLMLYBLZKORZ-UHFFFAOYSA-N |
| Molecular Formula | C4H4S |
Pyridine hydrobromide perbromide, tech. 90%
CAS: 39416-48-3 Molecular Formula: C5H5N·HBr3 MDL Number: MFCD00013223 Synonym: Pyridinium bromide perbromide; Pyridinium tribromide
| CAS | 39416-48-3 |
|---|---|
| MDL Number | MFCD00013223 |
| Synonym | Pyridinium bromide perbromide; Pyridinium tribromide |
| Molecular Formula | C5H5N·HBr3 |
Triphenylphosphine oxide, 99%
CAS: 791-28-6 Molecular Formula: C18H15OP Molecular Weight (g/mol): 278.29 MDL Number: MFCD00002080 MFCD03458802 InChI Key: FIQMHBFVRAXMOP-UHFFFAOYSA-N Synonym: triphenylphosphine oxide,phosphine oxide, triphenyl,triphenyl phosphorus oxide,triphenyl phosphine oxide,triphenylphosphane oxide,tppo,triphenylphosphineoxide,ph3po,diphenylphosphoroso benzene,triphenylphosphanoxid PubChem CID: 13097 ChEBI: CHEBI:36601 IUPAC Name: diphenylphosphorylbenzene SMILES: O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 13097 |
|---|---|
| CAS | 791-28-6 |
| Molecular Weight (g/mol) | 278.29 |
| ChEBI | CHEBI:36601 |
| MDL Number | MFCD00002080 MFCD03458802 |
| SMILES | O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine oxide,phosphine oxide, triphenyl,triphenyl phosphorus oxide,triphenyl phosphine oxide,triphenylphosphane oxide,tppo,triphenylphosphineoxide,ph3po,diphenylphosphoroso benzene,triphenylphosphanoxid |
| IUPAC Name | diphenylphosphorylbenzene |
| InChI Key | FIQMHBFVRAXMOP-UHFFFAOYSA-N |
| Molecular Formula | C18H15OP |
Citric acid, monosodium salt, 99%, pure, anhydrous
CAS: 18996-35-5 Molecular Formula: C6H7NaO7 Molecular Weight (g/mol): 214.11 MDL Number: MFCD00013067 InChI Key: SLWOXBQHKZPUNY-UHFFFAOYSA-N Synonym: bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? PubChem CID: 131675399 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium SMILES: [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na]
| PubChem CID | 131675399 |
|---|---|
| CAS | 18996-35-5 |
| Molecular Weight (g/mol) | 214.11 |
| MDL Number | MFCD00013067 |
| SMILES | [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na] |
| Synonym | bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium |
| InChI Key | SLWOXBQHKZPUNY-UHFFFAOYSA-N |
| Molecular Formula | C6H7NaO7 |
(+/-)-1,3-Butanediol, 99%
CAS: 107-88-0 Molecular Formula: C4H10O2 Molecular Weight (g/mol): 90.122 MDL Number: MFCD00004554 InChI Key: PUPZLCDOIYMWBV-UHFFFAOYSA-N Synonym: 1,3-butanediol,1,3-butylene glycol,1,3-dihydroxybutane,methyltrimethylene glycol,1,3-butandiol,1-methyl-1,3-propanediol,beta-butylene glycol,1,3 butylene glycol,1,3-butylenglykol,rs-1,3-butandiol PubChem CID: 7896 ChEBI: CHEBI:52683 IUPAC Name: butane-1,3-diol SMILES: CC(CCO)O
| PubChem CID | 7896 |
|---|---|
| CAS | 107-88-0 |
| Molecular Weight (g/mol) | 90.122 |
| ChEBI | CHEBI:52683 |
| MDL Number | MFCD00004554 |
| SMILES | CC(CCO)O |
| Synonym | 1,3-butanediol,1,3-butylene glycol,1,3-dihydroxybutane,methyltrimethylene glycol,1,3-butandiol,1-methyl-1,3-propanediol,beta-butylene glycol,1,3 butylene glycol,1,3-butylenglykol,rs-1,3-butandiol |
| IUPAC Name | butane-1,3-diol |
| InChI Key | PUPZLCDOIYMWBV-UHFFFAOYSA-N |
| Molecular Formula | C4H10O2 |
Tetrabutylammonium hydrogen sulfate, 99%, extra pure
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: hydrogen sulfate;tetrabutylazanium SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 94433 |
|---|---|
| CAS | 32503-27-8 |
| Molecular Weight (g/mol) | 339.54 |
| MDL Number | MFCD00011637 |
| SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
| IUPAC Name | hydrogen sulfate;tetrabutylazanium |
| InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO4S |
Hydroxypropyl cellulose, M.W. 100,000
CAS: 9004-64-2 Molecular Formula: (C24H44O16)n MDL Number: MFCD00132688 Synonym: 4-1-aminopropyl-n,n,3-trimethylaniline,4-dimethylamino-alpha,2-dimethylphenethylamine,benzeneethanamine, 4-dimethylamino-alpha,2-dimethyl,amiflamin,55875-51-9 di-hydrochloride,hydroxypropyl cellulose, m.w. 100,000,4-1-aminopropyl-n,n,3-trimethyl-aniline,hydroxypropyl cellulose 6-10 mpa?s in water at 20 ?c,hydroxypropyl cellulose, 3-6 mpa?s in water at 20 ?c
| CAS | 9004-64-2 |
|---|---|
| MDL Number | MFCD00132688 |
| Synonym | 4-1-aminopropyl-n,n,3-trimethylaniline,4-dimethylamino-alpha,2-dimethylphenethylamine,benzeneethanamine, 4-dimethylamino-alpha,2-dimethyl,amiflamin,55875-51-9 di-hydrochloride,hydroxypropyl cellulose, m.w. 100,000,4-1-aminopropyl-n,n,3-trimethyl-aniline,hydroxypropyl cellulose 6-10 mpa?s in water at 20 ?c,hydroxypropyl cellulose, 3-6 mpa?s in water at 20 ?c |
| Molecular Formula | (C24H44O16)n |
Diacetone acrylamide, 99%
CAS: 2873-97-4 Molecular Formula: C9H15NO2 Molecular Weight (g/mol): 169.22 MDL Number: MFCD00008788 InChI Key: OMNKZBIFPJNNIO-UHFFFAOYSA-N Synonym: diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 PubChem CID: 17888 IUPAC Name: N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide SMILES: CC(=O)CC(C)(C)NC(=O)C=C
| PubChem CID | 17888 |
|---|---|
| CAS | 2873-97-4 |
| Molecular Weight (g/mol) | 169.22 |
| MDL Number | MFCD00008788 |
| SMILES | CC(=O)CC(C)(C)NC(=O)C=C |
| Synonym | diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 |
| IUPAC Name | N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide |
| InChI Key | OMNKZBIFPJNNIO-UHFFFAOYSA-N |
| Molecular Formula | C9H15NO2 |
Berberine chloride
CAS: 633-65-8 Molecular Formula: C20H18ClNO4 Molecular Weight (g/mol): 371.817 MDL Number: MFCD00011939 InChI Key: VKJGBAJNNALVAV-UHFFFAOYSA-M Synonym: berberine chloride,berberine hydrochloride,natural yellow 18,benzodioxide,berberinium chloride,berberine hcl,unii-uot4o1byv8,berberine chloride jan,uot4o1byv8 PubChem CID: 12456 ChEBI: CHEBI:31271 SMILES: COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-]
| PubChem CID | 12456 |
|---|---|
| CAS | 633-65-8 |
| Molecular Weight (g/mol) | 371.817 |
| ChEBI | CHEBI:31271 |
| MDL Number | MFCD00011939 |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
| Synonym | berberine chloride,berberine hydrochloride,natural yellow 18,benzodioxide,berberinium chloride,berberine hcl,unii-uot4o1byv8,berberine chloride jan,uot4o1byv8 |
| InChI Key | VKJGBAJNNALVAV-UHFFFAOYSA-M |
| Molecular Formula | C20H18ClNO4 |
2-Bromobutane, 99+%
CAS: 78-76-2 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000156 InChI Key: UPSXAPQYNGXVBF-UHFFFAOYSA-N Synonym: sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 PubChem CID: 6554 IUPAC Name: 2-bromobutane SMILES: CCC(C)Br
| PubChem CID | 6554 |
|---|---|
| CAS | 78-76-2 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000156 |
| SMILES | CCC(C)Br |
| Synonym | sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 |
| IUPAC Name | 2-bromobutane |
| InChI Key | UPSXAPQYNGXVBF-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |
Fluoromethyl 1,1,1,3,3,3-hexafluoroisopropyl ether, 98+%
CAS: 28523-86-6 Molecular Formula: C4H3F7O Molecular Weight (g/mol): 200.056 MDL Number: MFCD00153189 InChI Key: DFEYYRMXOJXZRJ-UHFFFAOYSA-N Synonym: sevoflurane,sevofluran,ultane,1,1,1,3,3,3-hexafluoro-2-fluoromethoxy propane,sevoflurano,sevofluranum,sevorane,sojourn,mr6s4,sevofluranum inn-latin PubChem CID: 5206 ChEBI: CHEBI:9130 IUPAC Name: 1,1,1,3,3,3-hexafluoro-2-(fluoromethoxy)propane SMILES: C(OC(C(F)(F)F)C(F)(F)F)F
| PubChem CID | 5206 |
|---|---|
| CAS | 28523-86-6 |
| Molecular Weight (g/mol) | 200.056 |
| ChEBI | CHEBI:9130 |
| MDL Number | MFCD00153189 |
| SMILES | C(OC(C(F)(F)F)C(F)(F)F)F |
| Synonym | sevoflurane,sevofluran,ultane,1,1,1,3,3,3-hexafluoro-2-fluoromethoxy propane,sevoflurano,sevofluranum,sevorane,sojourn,mr6s4,sevofluranum inn-latin |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(fluoromethoxy)propane |
| InChI Key | DFEYYRMXOJXZRJ-UHFFFAOYSA-N |
| Molecular Formula | C4H3F7O |