Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2-n-Butoxyethyl acetate, 98%
CAS: 112-07-2 Molecular Formula: C8H16O3 Molecular Weight (g/mol): 160.21 MDL Number: MFCD00009457 InChI Key: NQBXSWAWVZHKBZ-UHFFFAOYSA-N Synonym: butoxyethyl acetate,butyl glycol acetate,butylglycol acetate,ethylene glycol monobutyl ether acetate,2-butoxyethanol acetate,butyl cellosolve acetate,ektasolve eb acetate,ethanol, 2-butoxy-, acetate,butylcelosolvacetat,1-acetoxy-2-butoxyethane PubChem CID: 8160 IUPAC Name: 2-butoxyethyl acetate SMILES: CCCCOCCOC(C)=O
| PubChem CID | 8160 |
|---|---|
| CAS | 112-07-2 |
| Molecular Weight (g/mol) | 160.21 |
| MDL Number | MFCD00009457 |
| SMILES | CCCCOCCOC(C)=O |
| Synonym | butoxyethyl acetate,butyl glycol acetate,butylglycol acetate,ethylene glycol monobutyl ether acetate,2-butoxyethanol acetate,butyl cellosolve acetate,ektasolve eb acetate,ethanol, 2-butoxy-, acetate,butylcelosolvacetat,1-acetoxy-2-butoxyethane |
| IUPAC Name | 2-butoxyethyl acetate |
| InChI Key | NQBXSWAWVZHKBZ-UHFFFAOYSA-N |
| Molecular Formula | C8H16O3 |
Poly(vinyl alcohol), 98.0%-98.8% hydrolyzed, M.W. approx. 50,000-85,000
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
1-Hexene, 97%
CAS: 592-41-6 Molecular Formula: C6H12 Molecular Weight (g/mol): 84.15 MDL Number: MFCD00009505 InChI Key: LIKMAJRDDDTEIG-UHFFFAOYSA-N Synonym: 1-hexene,hexene,butylethylene,hexylene,hexene-1,1-n-hexene,butyl ethylene,dialene 6,n-hexene,unii-b38zz8c206 PubChem CID: 11597 ChEBI: CHEBI:24579 IUPAC Name: hex-1-ene SMILES: CCCCC=C
| PubChem CID | 11597 |
|---|---|
| CAS | 592-41-6 |
| Molecular Weight (g/mol) | 84.15 |
| ChEBI | CHEBI:24579 |
| MDL Number | MFCD00009505 |
| SMILES | CCCCC=C |
| Synonym | 1-hexene,hexene,butylethylene,hexylene,hexene-1,1-n-hexene,butyl ethylene,dialene 6,n-hexene,unii-b38zz8c206 |
| IUPAC Name | hex-1-ene |
| InChI Key | LIKMAJRDDDTEIG-UHFFFAOYSA-N |
| Molecular Formula | C6H12 |
Sodium 1-Octanesulfonate Monohydrate, 99+%
CAS: 207596-29-0 Molecular Formula: C8H19NaO4S Molecular Weight (g/mol): 234.29 MDL Number: MFCD00149551 InChI Key: MBURIAHQXJQKRE-UHFFFAOYSA-M Synonym: sodium octane-1-sulfonate hydrate,1-octanesulfonic acid sodium salt monohydrate,sodium 1-octanesulfonate monohydrate,1-octanesulfonic acid, sodium salt, monohydrate,sodium 1-octanesulfonate hydrate,1-octane sulfonic acid, na,acmc-20p1dl,ksc496c2b,sodium1-octanesulfonatemonohydrate,potassium hydrate octane-1-sulfonate PubChem CID: 23666339 IUPAC Name: sodium;octane-1-sulfonate;hydrate SMILES: O.[Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23666339 |
|---|---|
| CAS | 207596-29-0 |
| Molecular Weight (g/mol) | 234.29 |
| MDL Number | MFCD00149551 |
| SMILES | O.[Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium octane-1-sulfonate hydrate,1-octanesulfonic acid sodium salt monohydrate,sodium 1-octanesulfonate monohydrate,1-octanesulfonic acid, sodium salt, monohydrate,sodium 1-octanesulfonate hydrate,1-octane sulfonic acid, na,acmc-20p1dl,ksc496c2b,sodium1-octanesulfonatemonohydrate,potassium hydrate octane-1-sulfonate |
| IUPAC Name | sodium;octane-1-sulfonate;hydrate |
| InChI Key | MBURIAHQXJQKRE-UHFFFAOYSA-M |
| Molecular Formula | C8H19NaO4S |
Dipropylene Glycol Monomethyl Ether (mixture of isomers) 98.0+%, TCI America™
CAS: 34590-94-8 Molecular Formula: C7H16O3 MDL Number: MFCD00059604
| CAS | 34590-94-8 |
|---|---|
| MDL Number | MFCD00059604 |
| Molecular Formula | C7H16O3 |
Chloroacetone, 95%, stab. with 0.1% epoxidized soybean oil
CAS: 78-95-5 Molecular Formula: C3H5ClO Molecular Weight (g/mol): 92.52 MDL Number: MFCD00000936 InChI Key: BULLHNJGPPOUOX-UHFFFAOYSA-N SMILES: CC(=O)CCl
| CAS | 78-95-5 |
|---|---|
| Molecular Weight (g/mol) | 92.52 |
| MDL Number | MFCD00000936 |
| SMILES | CC(=O)CCl |
| InChI Key | BULLHNJGPPOUOX-UHFFFAOYSA-N |
| Molecular Formula | C3H5ClO |
2,6-Dimethylphenol, 99%
CAS: 576-26-1 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.17 MDL Number: MFCD00002240 InChI Key: NXXYKOUNUYWIHA-UHFFFAOYSA-N Synonym: 2,6-xylenol,phenol, 2,6-dimethyl,2,6-dimethyl phenol,2-hydroxy-m-xylene,1-hydroxy-2,6-dimethylbenzene,vic-m-xylenol,2,6-dmp,2,6-dimethyl-phenol,xylenol 235,2-hydroxy-1,3-dimethylbenzene PubChem CID: 11335 IUPAC Name: 2,6-dimethylphenol SMILES: CC1=CC=CC(C)=C1O
| PubChem CID | 11335 |
|---|---|
| CAS | 576-26-1 |
| Molecular Weight (g/mol) | 122.17 |
| MDL Number | MFCD00002240 |
| SMILES | CC1=CC=CC(C)=C1O |
| Synonym | 2,6-xylenol,phenol, 2,6-dimethyl,2,6-dimethyl phenol,2-hydroxy-m-xylene,1-hydroxy-2,6-dimethylbenzene,vic-m-xylenol,2,6-dmp,2,6-dimethyl-phenol,xylenol 235,2-hydroxy-1,3-dimethylbenzene |
| IUPAC Name | 2,6-dimethylphenol |
| InChI Key | NXXYKOUNUYWIHA-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
Polyethyleneimine, approx. M.N. 60,000, 50 wt% aq. solution, branched
CAS: 9002-98-6 Molecular Formula: ((C2H5N)zC2H4N)y(C2H5N)x Molecular Weight (g/mol): 43.07 MDL Number: MFCD00084427 InChI Key: NOWKCMXCCJGMRR-UHFFFAOYSA-N Synonym: ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin PubChem CID: 9033 ChEBI: CHEBI:30969 IUPAC Name: aziridine SMILES: *-CCNCCN(-*)CCN-*
| PubChem CID | 9033 |
|---|---|
| CAS | 9002-98-6 |
| Molecular Weight (g/mol) | 43.07 |
| ChEBI | CHEBI:30969 |
| MDL Number | MFCD00084427 |
| SMILES | *-CCNCCN(-*)CCN-* |
| Synonym | ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin |
| IUPAC Name | aziridine |
| InChI Key | NOWKCMXCCJGMRR-UHFFFAOYSA-N |
| Molecular Formula | ((C2H5N)zC2H4N)y(C2H5N)x |
4,7-Diphenyl-1,10-phenanthroline, 99%
CAS: 1662-01-7 Molecular Formula: C24H16N2 Molecular Weight (g/mol): 332.39 MDL Number: MFCD00004976 InChI Key: DHDHJYNTEFLIHY-UHFFFAOYSA-N Synonym: bathophenanthroline,1,10-phenanthroline, 4,7-diphenyl,bphen,1,10-bathophenanthroline,bathophenanthrolin,bathophenanthrolin german,unii-4a2b091f0g,4,7-diphenyl-1,10-diazaphenanthrene,gnf-pf-4554,4,7-diphenylpyridino 3,2-h quinoline PubChem CID: 72812 ChEBI: CHEBI:77995 IUPAC Name: 4,7-diphenyl-1,10-phenanthroline SMILES: C1=CC=C(C=C1)C2=C3C=CC4=C(C=CN=C4C3=NC=C2)C5=CC=CC=C5
| PubChem CID | 72812 |
|---|---|
| CAS | 1662-01-7 |
| Molecular Weight (g/mol) | 332.39 |
| ChEBI | CHEBI:77995 |
| MDL Number | MFCD00004976 |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC4=C(C=CN=C4C3=NC=C2)C5=CC=CC=C5 |
| Synonym | bathophenanthroline,1,10-phenanthroline, 4,7-diphenyl,bphen,1,10-bathophenanthroline,bathophenanthrolin,bathophenanthrolin german,unii-4a2b091f0g,4,7-diphenyl-1,10-diazaphenanthrene,gnf-pf-4554,4,7-diphenylpyridino 3,2-h quinoline |
| IUPAC Name | 4,7-diphenyl-1,10-phenanthroline |
| InChI Key | DHDHJYNTEFLIHY-UHFFFAOYSA-N |
| Molecular Formula | C24H16N2 |
1,4-Diiodobenzene, 98%
CAS: 624-38-4 Molecular Formula: C6H4I2 Molecular Weight (g/mol): 329.907 MDL Number: MFCD00001054 InChI Key: LFMWZTSOMGDDJU-UHFFFAOYSA-N Synonym: p-diiodobenzene,benzene, 1,4-diiodo,p-benzene diiodide,benzene, p-diiodo,unii-i9xcf83vav,i9xcf83vav,1,4-diiodbenzene,1,4-diidobenzene,1,4 diiodobenzene,1,4-diiodiobenzene PubChem CID: 12208 IUPAC Name: 1,4-diiodobenzene SMILES: C1=CC(=CC=C1I)I
| PubChem CID | 12208 |
|---|---|
| CAS | 624-38-4 |
| Molecular Weight (g/mol) | 329.907 |
| MDL Number | MFCD00001054 |
| SMILES | C1=CC(=CC=C1I)I |
| Synonym | p-diiodobenzene,benzene, 1,4-diiodo,p-benzene diiodide,benzene, p-diiodo,unii-i9xcf83vav,i9xcf83vav,1,4-diiodbenzene,1,4-diidobenzene,1,4 diiodobenzene,1,4-diiodiobenzene |
| IUPAC Name | 1,4-diiodobenzene |
| InChI Key | LFMWZTSOMGDDJU-UHFFFAOYSA-N |
| Molecular Formula | C6H4I2 |
Poly(acrylic acid), 63 wt% solution in water; approx. M.W. 2,000
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
Poly(acrylic acid), 25 wt% solution in water; approx. M.W. 240,000
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
2,2,2-Trichloroethyl chloroformate, 97%
CAS: 17341-93-4 MDL Number: MFCD00000810 InChI Key: LJCZNYWLQZZIOS-UHFFFAOYSA-N Synonym: 2,2,2-trichloroethyl chloroformate,trichloroethyl chloroformate,2,2,2-trichloroethylchloroformate,carbonochloridic acid, 2,2,2-trichloroethyl ester,2,2,2-trichloroethoxycarbonyl chloride,chloroformic acid 2,2,2-trichloroethyl ester,formic acid, chloro-, 2,2,2-trichloroethyl ester,chloro 2,2,2-trichloroethoxy methanone,beta, beta, beta-trichloroethoxycarbonyl chloride,troc PubChem CID: 87063 IUPAC Name: 2,2,2-trichloroethyl carbonochloridate SMILES: C(C(Cl)(Cl)Cl)OC(=O)Cl
| PubChem CID | 87063 |
|---|---|
| CAS | 17341-93-4 |
| MDL Number | MFCD00000810 |
| SMILES | C(C(Cl)(Cl)Cl)OC(=O)Cl |
| Synonym | 2,2,2-trichloroethyl chloroformate,trichloroethyl chloroformate,2,2,2-trichloroethylchloroformate,carbonochloridic acid, 2,2,2-trichloroethyl ester,2,2,2-trichloroethoxycarbonyl chloride,chloroformic acid 2,2,2-trichloroethyl ester,formic acid, chloro-, 2,2,2-trichloroethyl ester,chloro 2,2,2-trichloroethoxy methanone,beta, beta, beta-trichloroethoxycarbonyl chloride,troc |
| IUPAC Name | 2,2,2-trichloroethyl carbonochloridate |
| InChI Key | LJCZNYWLQZZIOS-UHFFFAOYSA-N |
Abamectin
CAS: 71751-41-2 Molecular Formula: C48H72O14 MDL Number: MFCD01769550 Synonym: Avermectin B1
| CAS | 71751-41-2 |
|---|---|
| MDL Number | MFCD01769550 |
| Synonym | Avermectin B1 |
| Molecular Formula | C48H72O14 |
Methylcyclohexane, 99%, extra pure
CAS: 108-87-2 Molecular Formula: C7H14 Molecular Weight (g/mol): 98.19 MDL Number: MFCD00001497 InChI Key: UAEPNZWRGJTJPN-UHFFFAOYSA-N Synonym: cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan PubChem CID: 7962 IUPAC Name: methylcyclohexane SMILES: CC1CCCCC1
| PubChem CID | 7962 |
|---|---|
| CAS | 108-87-2 |
| Molecular Weight (g/mol) | 98.19 |
| MDL Number | MFCD00001497 |
| SMILES | CC1CCCCC1 |
| Synonym | cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan |
| IUPAC Name | methylcyclohexane |
| InChI Key | UAEPNZWRGJTJPN-UHFFFAOYSA-N |
| Molecular Formula | C7H14 |