Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
| Boiling Point | 100°C |
|---|---|
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Starch Solution |
| ChemAlert Storage Symbol | Gray |
| Density | 1.0g/cm³ |
| Vapor Pressure | 14mmHg |
| Sensitivity | Pass Test |
| Name Note | Stabilized |
| CAS | 7732-18-5 |
| MDL Number | MFCD00082026 |
| Packaging | Poly Bottle |
| Molecular Formula | (C6H10O5)n |
| Melting Point | 0°C |
Diisopropylamine, 99+%, Thermo Scientific Chemicals
CAS: 108-18-9 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.193 MDL Number: MFCD00008862 InChI Key: UAOMVDZJSHZZME-UHFFFAOYSA-N Synonym: diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine PubChem CID: 7912 IUPAC Name: N-propan-2-ylpropan-2-amine SMILES: CC(C)NC(C)C
| PubChem CID | 7912 |
|---|---|
| CAS | 108-18-9 |
| Molecular Weight (g/mol) | 101.193 |
| MDL Number | MFCD00008862 |
| SMILES | CC(C)NC(C)C |
| Synonym | diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine |
| IUPAC Name | N-propan-2-ylpropan-2-amine |
| InChI Key | UAOMVDZJSHZZME-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
alpha-Bromo-p-toluic acid, 97%
CAS: 6232-88-8 Molecular Formula: C8H7BrO2 Molecular Weight (g/mol): 215.05 MDL Number: MFCD00002567 InChI Key: CQQSQBRPAJSTFB-UHFFFAOYSA-N Synonym: 4-bromomethyl benzoic acid,alpha-bromo-p-toluic acid,benzoic acid, 4-bromomethyl,p-bromomethyl benzoic acid,4-carboxybenzyl bromide,4-bromomethyl-benzoic acid,a-bromo-p-toluic acid,p-carboxybenzyl bromide,p-bromomethylbenzoic acid PubChem CID: 22599 IUPAC Name: 4-(bromomethyl)benzoic acid SMILES: C1=CC(=CC=C1CBr)C(=O)O
| PubChem CID | 22599 |
|---|---|
| CAS | 6232-88-8 |
| Molecular Weight (g/mol) | 215.05 |
| MDL Number | MFCD00002567 |
| SMILES | C1=CC(=CC=C1CBr)C(=O)O |
| Synonym | 4-bromomethyl benzoic acid,alpha-bromo-p-toluic acid,benzoic acid, 4-bromomethyl,p-bromomethyl benzoic acid,4-carboxybenzyl bromide,4-bromomethyl-benzoic acid,a-bromo-p-toluic acid,p-carboxybenzyl bromide,p-bromomethylbenzoic acid |
| IUPAC Name | 4-(bromomethyl)benzoic acid |
| InChI Key | CQQSQBRPAJSTFB-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO2 |
LiChropur™ Sodium octyl sulfate , ≥99.0% (T), MilliporeSigma™ Supelco™
MDL Number: MFCD00007470 Synonym: Octyl sulfate sodium salt
| MDL Number | MFCD00007470 |
|---|---|
| Synonym | Octyl sulfate sodium salt |
7-Bromo-2,1,3-benzothiadiazole-4-carboxaldehyde 98.0+%, TCI America™
CAS: 1071224-34-4 Molecular Formula: C7H3BrN2OS Molecular Weight (g/mol): 243.078 MDL Number: MFCD23704428 InChI Key: VPDPNJVAWKCZEH-UHFFFAOYSA-N Synonym: 7-Bromo-4-formyl-2,1,3-benzothiadiazole PubChem CID: 58497962 IUPAC Name: 4-bromo-2,1,3-benzothiadiazole-7-carbaldehyde SMILES: C1=C(C2=NSN=C2C(=C1)Br)C=O
| PubChem CID | 58497962 |
|---|---|
| CAS | 1071224-34-4 |
| Molecular Weight (g/mol) | 243.078 |
| MDL Number | MFCD23704428 |
| SMILES | C1=C(C2=NSN=C2C(=C1)Br)C=O |
| Synonym | 7-Bromo-4-formyl-2,1,3-benzothiadiazole |
| IUPAC Name | 4-bromo-2,1,3-benzothiadiazole-7-carbaldehyde |
| InChI Key | VPDPNJVAWKCZEH-UHFFFAOYSA-N |
| Molecular Formula | C7H3BrN2OS |
7-Fluoroisatin 98.0+%, TCI America™
CAS: 317-20-4 Molecular Formula: C8H4FNO2 Molecular Weight (g/mol): 165.123 InChI Key: HGBGVEOXPHGSOS-UHFFFAOYSA-N Synonym: 7-fluoroisatin,7-fluoroindoline-2,3-dione,7-fluoro-2,3-indolinedione,1h-indole-2,3-dione, 7-fluoro,7-fluoroindole-1h-2,3-dione,7-fluoroindole-2,3-dione,7-fluoro-2,3-dihydro-1h-indole-2,3-dione,7-fluoroisatine,7-fluoro-1h-benzo d azoline-2,3-dione,7-fluor-1h-indol-2,3-dion PubChem CID: 586418 IUPAC Name: 7-fluoro-1H-indole-2,3-dione SMILES: C1=CC2=C(C(=C1)F)NC(=O)C2=O
| PubChem CID | 586418 |
|---|---|
| CAS | 317-20-4 |
| Molecular Weight (g/mol) | 165.123 |
| SMILES | C1=CC2=C(C(=C1)F)NC(=O)C2=O |
| Synonym | 7-fluoroisatin,7-fluoroindoline-2,3-dione,7-fluoro-2,3-indolinedione,1h-indole-2,3-dione, 7-fluoro,7-fluoroindole-1h-2,3-dione,7-fluoroindole-2,3-dione,7-fluoro-2,3-dihydro-1h-indole-2,3-dione,7-fluoroisatine,7-fluoro-1h-benzo d azoline-2,3-dione,7-fluor-1h-indol-2,3-dion |
| IUPAC Name | 7-fluoro-1H-indole-2,3-dione |
| InChI Key | HGBGVEOXPHGSOS-UHFFFAOYSA-N |
| Molecular Formula | C8H4FNO2 |
Dextran 40, Powder, USP, Spectrum™ Chemical
CAS: 9004-54-0 Molecular Formula: (C6H9O5)n(C6H10O5)m Molecular Weight (g/mol): 504.44 MDL Number: MFCD00130935 InChI Key: FZWBNHMXJMCXLU-UHFFFAOYNA-N IUPAC Name: Dextran SMILES: O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O
| CAS | 9004-54-0 |
|---|---|
| Molecular Weight (g/mol) | 504.44 |
| MDL Number | MFCD00130935 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O |
| IUPAC Name | Dextran |
| InChI Key | FZWBNHMXJMCXLU-UHFFFAOYNA-N |
| Molecular Formula | (C6H9O5)n(C6H10O5)m |
N-Lauryldiethanolamine 95.0+%, TCI America™
CAS: 1541-67-9 Molecular Formula: C16H34NO2 Molecular Weight (g/mol): 272.45 MDL Number: MFCD00059002 InChI Key: ASGZLXKBMOBPBV-UHFFFAOYSA-N PubChem CID: 352309 IUPAC Name: dodecylidenebis(2-hydroxyethyl)azanium SMILES: CCCCCCCCCCCC=[N+](CCO)CCO
| PubChem CID | 352309 |
|---|---|
| CAS | 1541-67-9 |
| Molecular Weight (g/mol) | 272.45 |
| MDL Number | MFCD00059002 |
| SMILES | CCCCCCCCCCCC=[N+](CCO)CCO |
| IUPAC Name | dodecylidenebis(2-hydroxyethyl)azanium |
| InChI Key | ASGZLXKBMOBPBV-UHFFFAOYSA-N |
| Molecular Formula | C16H34NO2 |
7-Fluoroisatin, 97%
CAS: 317-20-4 Molecular Formula: C8H4FNO2 Molecular Weight (g/mol): 165.123 MDL Number: MFCD01569508 InChI Key: HGBGVEOXPHGSOS-UHFFFAOYSA-N Synonym: 7-fluoroisatin,7-fluoroindoline-2,3-dione,7-fluoro-2,3-indolinedione,1h-indole-2,3-dione, 7-fluoro,7-fluoroindole-1h-2,3-dione,7-fluoroindole-2,3-dione,7-fluoro-2,3-dihydro-1h-indole-2,3-dione,7-fluoroisatine,7-fluoro-1h-benzo d azoline-2,3-dione,7-fluor-1h-indol-2,3-dion PubChem CID: 586418 IUPAC Name: 7-fluoro-1H-indole-2,3-dione SMILES: C1=CC2=C(C(=C1)F)NC(=O)C2=O
| PubChem CID | 586418 |
|---|---|
| CAS | 317-20-4 |
| Molecular Weight (g/mol) | 165.123 |
| MDL Number | MFCD01569508 |
| SMILES | C1=CC2=C(C(=C1)F)NC(=O)C2=O |
| Synonym | 7-fluoroisatin,7-fluoroindoline-2,3-dione,7-fluoro-2,3-indolinedione,1h-indole-2,3-dione, 7-fluoro,7-fluoroindole-1h-2,3-dione,7-fluoroindole-2,3-dione,7-fluoro-2,3-dihydro-1h-indole-2,3-dione,7-fluoroisatine,7-fluoro-1h-benzo d azoline-2,3-dione,7-fluor-1h-indol-2,3-dion |
| IUPAC Name | 7-fluoro-1H-indole-2,3-dione |
| InChI Key | HGBGVEOXPHGSOS-UHFFFAOYSA-N |
| Molecular Formula | C8H4FNO2 |
7-Bromoisatin, 97%
CAS: 20780-74-9 Molecular Formula: C8H4BrNO2 Molecular Weight (g/mol): 226.029 MDL Number: MFCD00774354 InChI Key: OCVKSIWBTJCXPV-UHFFFAOYSA-N Synonym: 7-bromoisatin,7-bromoindoline-2,3-dione,7-bromo-2,3-dioxoindoline,1h-indole-2,3-dione, 7-bromo,7-bromoindole-2,3-dione,7-bromo-2,3-dihydro-1h-indole-2,3-dione,7-bromoindole-1h-2,3-dione,7-bromo-2,3-indolinedione,7-bromo isatin,7-bromo-isatin PubChem CID: 2302353 IUPAC Name: 7-bromo-1H-indole-2,3-dione SMILES: C1=CC2=C(C(=C1)Br)NC(=O)C2=O
| PubChem CID | 2302353 |
|---|---|
| CAS | 20780-74-9 |
| Molecular Weight (g/mol) | 226.029 |
| MDL Number | MFCD00774354 |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=O)C2=O |
| Synonym | 7-bromoisatin,7-bromoindoline-2,3-dione,7-bromo-2,3-dioxoindoline,1h-indole-2,3-dione, 7-bromo,7-bromoindole-2,3-dione,7-bromo-2,3-dihydro-1h-indole-2,3-dione,7-bromoindole-1h-2,3-dione,7-bromo-2,3-indolinedione,7-bromo isatin,7-bromo-isatin |
| IUPAC Name | 7-bromo-1H-indole-2,3-dione |
| InChI Key | OCVKSIWBTJCXPV-UHFFFAOYSA-N |
| Molecular Formula | C8H4BrNO2 |
o-Toluenesulfonamide 98.0+%, TCI America™
CAS: 88-19-7 Molecular Formula: C7H9NO2S Molecular Weight (g/mol): 171.214 MDL Number: MFCD00007934 InChI Key: YCMLQMDWSXFTIF-UHFFFAOYSA-N Synonym: o-toluenesulfonamide,2-methylbenzene-1-sulfonamide,benzenesulfonamide, 2-methyl,2-toluenesulfonamide,o-methylbenzenesulfonamide,toluene-2-sulfonamide,ketjenflex 9,toluene-2-sulphonamide,ortho-toluenesulfonamide,2-tolylsulfonamide PubChem CID: 6924 IUPAC Name: 2-methylbenzenesulfonamide SMILES: CC1=CC=CC=C1S(=O)(=O)N
| PubChem CID | 6924 |
|---|---|
| CAS | 88-19-7 |
| Molecular Weight (g/mol) | 171.214 |
| MDL Number | MFCD00007934 |
| SMILES | CC1=CC=CC=C1S(=O)(=O)N |
| Synonym | o-toluenesulfonamide,2-methylbenzene-1-sulfonamide,benzenesulfonamide, 2-methyl,2-toluenesulfonamide,o-methylbenzenesulfonamide,toluene-2-sulfonamide,ketjenflex 9,toluene-2-sulphonamide,ortho-toluenesulfonamide,2-tolylsulfonamide |
| IUPAC Name | 2-methylbenzenesulfonamide |
| InChI Key | YCMLQMDWSXFTIF-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO2S |
2,8-Dibromodibenzofuran 98.0+%, TCI America™
CAS: 10016-52-1 Molecular Formula: C12H6Br2O Molecular Weight (g/mol): 325.99 MDL Number: MFCD00093683 InChI Key: UFCZRCPQBWIXTR-UHFFFAOYSA-N PubChem CID: 82290 IUPAC Name: 4,12-dibromo-8-oxatricyclo[7.4.0.0²,⁷]trideca-1(9),2(7),3,5,10,12-hexaene SMILES: BrC1=CC2=C(OC3=C2C=C(Br)C=C3)C=C1
| PubChem CID | 82290 |
|---|---|
| CAS | 10016-52-1 |
| Molecular Weight (g/mol) | 325.99 |
| MDL Number | MFCD00093683 |
| SMILES | BrC1=CC2=C(OC3=C2C=C(Br)C=C3)C=C1 |
| IUPAC Name | 4,12-dibromo-8-oxatricyclo[7.4.0.0²,⁷]trideca-1(9),2(7),3,5,10,12-hexaene |
| InChI Key | UFCZRCPQBWIXTR-UHFFFAOYSA-N |
| Molecular Formula | C12H6Br2O |
4-Propoxybenzoic Acid 98.0+%, TCI America™
CAS: 5438-19-7 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.20 MDL Number: MFCD00013989 InChI Key: GDFUWFOCYZZGQU-UHFFFAOYSA-N Synonym: p-propoxybenzoic acid,4-n-propoxybenzoic acid,benzoic acid, 4-propoxy,4-n-propyloxybenzoic acid,4-propoxy-benzoic acid,benzoic acid, p-propoxy,p-propyloxybenzoic acid,pubchem2681,4-propoxy benzoic acid,p-carboxyphenoxy propane PubChem CID: 138500 IUPAC Name: 4-propoxybenzoic acid SMILES: CCCOC1=CC=C(C=C1)C(O)=O
| PubChem CID | 138500 |
|---|---|
| CAS | 5438-19-7 |
| Molecular Weight (g/mol) | 180.20 |
| MDL Number | MFCD00013989 |
| SMILES | CCCOC1=CC=C(C=C1)C(O)=O |
| Synonym | p-propoxybenzoic acid,4-n-propoxybenzoic acid,benzoic acid, 4-propoxy,4-n-propyloxybenzoic acid,4-propoxy-benzoic acid,benzoic acid, p-propoxy,p-propyloxybenzoic acid,pubchem2681,4-propoxy benzoic acid,p-carboxyphenoxy propane |
| IUPAC Name | 4-propoxybenzoic acid |
| InChI Key | GDFUWFOCYZZGQU-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
3-tert-Butylaniline 98.0+%, TCI America™
CAS: 5369-19-7 Molecular Formula: C10H15N Molecular Weight (g/mol): 149.24 MDL Number: MFCD00125078 InChI Key: DPKTVUKEPNBABS-UHFFFAOYSA-N Synonym: 3-tert-butyl aniline,3-tert-butylbenzenamine,benzenamine, 3-1,1-dimethylethyl,3-t-butyl aniline,3-tert-butyl-phenylamine,3-tert-butyl phenylamine,3-tert-butylphenyl amine,m-t-butylaniline,3-t-butylaniline,m-tert-butylaniline PubChem CID: 79334 IUPAC Name: 3-tert-butylaniline SMILES: CC(C)(C)C1=CC=CC(N)=C1
| PubChem CID | 79334 |
|---|---|
| CAS | 5369-19-7 |
| Molecular Weight (g/mol) | 149.24 |
| MDL Number | MFCD00125078 |
| SMILES | CC(C)(C)C1=CC=CC(N)=C1 |
| Synonym | 3-tert-butyl aniline,3-tert-butylbenzenamine,benzenamine, 3-1,1-dimethylethyl,3-t-butyl aniline,3-tert-butyl-phenylamine,3-tert-butyl phenylamine,3-tert-butylphenyl amine,m-t-butylaniline,3-t-butylaniline,m-tert-butylaniline |
| IUPAC Name | 3-tert-butylaniline |
| InChI Key | DPKTVUKEPNBABS-UHFFFAOYSA-N |
| Molecular Formula | C10H15N |
2-Bromo-2-methylpropane 98.0+%, TCI America™
CAS: 507-19-7 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000125 InChI Key: RKSOPLXZQNSWAS-UHFFFAOYSA-N Synonym: tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane PubChem CID: 10485 IUPAC Name: 2-bromo-2-methylpropane SMILES: CC(C)(C)Br
| PubChem CID | 10485 |
|---|---|
| CAS | 507-19-7 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000125 |
| SMILES | CC(C)(C)Br |
| Synonym | tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane |
| IUPAC Name | 2-bromo-2-methylpropane |
| InChI Key | RKSOPLXZQNSWAS-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |