Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Platinum wire, 0.25mm (0.01in) dia, For ISA Type R or S Standard Grade Thermocouple
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Hydrogen Bromide, 33% Solution in Acetic Acid, 31 -35%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
| Percent Purity | 31 to 35% |
|---|---|
| CAS | 10035-10-6 |
| Grade | Reagent |
| Appearance | Light to Dark Yellow Liquid |
Platinum Iridium wire, 0.25mm (0.01in) dia, annealed
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Titanium Thinfoil, 0.006mm (0.0002in) thick, 99.6% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Platinum wire, 1.5mm (0.059in) dia, hard, 99.95% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Boron pieces, crystalline, 1-30mm (0.039-1.2in), 99.4% (metals basis)
CAS: 7440-42-8 Molecular Formula: B Molecular Weight (g/mol): 10.81 MDL Number: MFCD00134034 MFCD00151272 InChI Key: ZOXJGFHDIHLPTG-UHFFFAOYSA-N Synonym: boron, metallic,unii-n9e3x5056q,boron, amorphous,powder, crystalline,boro,boron-elemental,boron, elemental,and compounds,boracium,boranylidyne PubChem CID: 5462311 ChEBI: CHEBI:27560 IUPAC Name: boron SMILES: [B]
| PubChem CID | 5462311 |
|---|---|
| CAS | 7440-42-8 |
| Molecular Weight (g/mol) | 10.81 |
| ChEBI | CHEBI:27560 |
| MDL Number | MFCD00134034 MFCD00151272 |
| SMILES | [B] |
| Synonym | boron, metallic,unii-n9e3x5056q,boron, amorphous,powder, crystalline,boro,boron-elemental,boron, elemental,and compounds,boracium,boranylidyne |
| IUPAC Name | boron |
| InChI Key | ZOXJGFHDIHLPTG-UHFFFAOYSA-N |
| Molecular Formula | B |
Antimony(III) bromide, 99%
CAS: 7789-61-9 Molecular Formula: Br3Sb Molecular Weight (g/mol): 361.472 MDL Number: MFCD00016317 InChI Key: RPJGYLSSECYURW-UHFFFAOYSA-K Synonym: antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 PubChem CID: 24615 IUPAC Name: tribromostibane SMILES: Br[Sb](Br)Br
| PubChem CID | 24615 |
|---|---|
| CAS | 7789-61-9 |
| Molecular Weight (g/mol) | 361.472 |
| MDL Number | MFCD00016317 |
| SMILES | Br[Sb](Br)Br |
| Synonym | antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 |
| IUPAC Name | tribromostibane |
| InChI Key | RPJGYLSSECYURW-UHFFFAOYSA-K |
| Molecular Formula | Br3Sb |
Tetrakis(dimethylamino)silane, 99%
CAS: 1624-01-7 Molecular Formula: C8H24N4Si Molecular Weight (g/mol): 204.39 MDL Number: MFCD00014859 InChI Key: SSCVMVQLICADPI-UHFFFAOYSA-N Synonym: tetrakis dimethylamino silane,silanetetramine, octamethyl,octamethylsilanetetramine,octamethylsilatetramine,silane, tetrakis dimethylamino,silane 48-12 tetrakis,dimethylamine, n,n',n,n'-silanetetrayltetrakis,silanetetramine, n,n,n',n',n,n,n',n'-octamethyl,n,n,n',n',n,n,n',n'-octamethylsilanetetraamine,si nme2 4 PubChem CID: 74194 IUPAC Name: N-methyl-N-[tris(dimethylamino)silyl]methanamine SMILES: CN(C)[Si](N(C)C)(N(C)C)N(C)C
| PubChem CID | 74194 |
|---|---|
| CAS | 1624-01-7 |
| Molecular Weight (g/mol) | 204.39 |
| MDL Number | MFCD00014859 |
| SMILES | CN(C)[Si](N(C)C)(N(C)C)N(C)C |
| Synonym | tetrakis dimethylamino silane,silanetetramine, octamethyl,octamethylsilanetetramine,octamethylsilatetramine,silane, tetrakis dimethylamino,silane 48-12 tetrakis,dimethylamine, n,n',n,n'-silanetetrayltetrakis,silanetetramine, n,n,n',n',n,n,n',n'-octamethyl,n,n,n',n',n,n,n',n'-octamethylsilanetetraamine,si nme2 4 |
| IUPAC Name | N-methyl-N-[tris(dimethylamino)silyl]methanamine |
| InChI Key | SSCVMVQLICADPI-UHFFFAOYSA-N |
| Molecular Formula | C8H24N4Si |
Bismuth Lead Tin ingot (Rose's metal)
CAS: 56001-37-7 Molecular Formula: C10H14N5Na2O14P3 Molecular Weight (g/mol): 567.14 MDL Number: MFCD03410297 InChI Key: FIZIYLKEXVIRHJ-KHRSEZDTNA-L Synonym: guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate PubChem CID: 131676145 IUPAC Name: ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate SMILES: [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1
| PubChem CID | 131676145 |
|---|---|
| CAS | 56001-37-7 |
| Molecular Weight (g/mol) | 567.14 |
| MDL Number | MFCD03410297 |
| SMILES | [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |
| Synonym | guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate |
| IUPAC Name | ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate |
| InChI Key | FIZIYLKEXVIRHJ-KHRSEZDTNA-L |
| Molecular Formula | C10H14N5Na2O14P3 |
Magnesium foil, 0.125mm (0.005in) thick, hard, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 7439-95-4 Molecular Formula: Mg Molecular Weight (g/mol): 24.30 MDL Number: MFCD00085308 InChI Key: JLVVSXFLKOJNIY-UHFFFAOYSA-N Synonym: magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs PubChem CID: 5462224 ChEBI: CHEBI:25107 IUPAC Name: magnesium SMILES: [Mg]
| PubChem CID | 5462224 |
|---|---|
| CAS | 7439-95-4 |
| Molecular Weight (g/mol) | 24.30 |
| ChEBI | CHEBI:25107 |
| MDL Number | MFCD00085308 |
| SMILES | [Mg] |
| Synonym | magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs |
| IUPAC Name | magnesium |
| InChI Key | JLVVSXFLKOJNIY-UHFFFAOYSA-N |
| Molecular Formula | Mg |
Chromium powder, -100+325 mesh, 99.97% (metals basis)
CAS: 7440-47-3 Molecular Formula: Cr Molecular Weight (g/mol): 52.00 MDL Number: MFCD00010944 InChI Key: VYZAMTAEIAYCRO-UHFFFAOYSA-N Synonym: chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 PubChem CID: 23976 ChEBI: CHEBI:28073 IUPAC Name: chromium SMILES: [Cr]
| PubChem CID | 23976 |
|---|---|
| CAS | 7440-47-3 |
| Molecular Weight (g/mol) | 52.00 |
| ChEBI | CHEBI:28073 |
| MDL Number | MFCD00010944 |
| SMILES | [Cr] |
| Synonym | chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 |
| IUPAC Name | chromium |
| InChI Key | VYZAMTAEIAYCRO-UHFFFAOYSA-N |
| Molecular Formula | Cr |
Nickel Chromium wire, Thermo Scientific Chemicals
CAS: 11106-97-1 Molecular Formula: CrNi Molecular Weight (g/mol): 110.69 MDL Number: MFCD00673110 InChI Key: VNNRSPGTAMTISX-UHFFFAOYSA-N Synonym: nickel chromium,nickel-chromium,nicr,nickel chromium lump,chromium, compd. with nickel 1:1,chromium nickel,acmc-1byoe,nickel chromium powder,-140+325 mesh,nickel chromium wire, 1.0mm 0.04in dia,nickel chromium wire, 0.25mm 0.01in dia PubChem CID: 11320920 IUPAC Name: chromium;nickel SMILES: [Cr].[Ni]
| PubChem CID | 11320920 |
|---|---|
| CAS | 11106-97-1 |
| Molecular Weight (g/mol) | 110.69 |
| MDL Number | MFCD00673110 |
| SMILES | [Cr].[Ni] |
| Synonym | nickel chromium,nickel-chromium,nicr,nickel chromium lump,chromium, compd. with nickel 1:1,chromium nickel,acmc-1byoe,nickel chromium powder,-140+325 mesh,nickel chromium wire, 1.0mm 0.04in dia,nickel chromium wire, 0.25mm 0.01in dia |
| IUPAC Name | chromium;nickel |
| InChI Key | VNNRSPGTAMTISX-UHFFFAOYSA-N |
| Molecular Formula | CrNi |
Boron tribromide, 99.9%
CAS: 10294-33-4 Molecular Formula: BBr3 Molecular Weight (g/mol): 250.52 MDL Number: MFCD00011312 InChI Key: ILAHWRKJUDSMFH-UHFFFAOYSA-N Synonym: boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide PubChem CID: 25134 IUPAC Name: tribromoborane SMILES: BrB(Br)Br
| PubChem CID | 25134 |
|---|---|
| CAS | 10294-33-4 |
| Molecular Weight (g/mol) | 250.52 |
| MDL Number | MFCD00011312 |
| SMILES | BrB(Br)Br |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| IUPAC Name | tribromoborane |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molecular Formula | BBr3 |
Copper sputtering target, 76.2mm (3.0 in.) dia. x 6.35mm (0.250 in.) thick, 99.995% (metals basis), Thermo Scientific™
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Allylchlorodimethylsilane, 94%
CAS: 4028-23-3 Molecular Formula: C5H11ClSi Molecular Weight (g/mol): 134.678 MDL Number: MFCD00000506 InChI Key: KMVZWUQHMJAWSY-UHFFFAOYSA-N Synonym: allyldimethylchlorosilane,allylchlorodimethylsilane,silane, chlorodimethyl-2-propenyl,allyl chloro dimethylsilane,allyl-chloro-dimethyl silane,silane, chlorodimethyl-2-propen-1-yl,admcs,allyl chlorodimethylsilane,allylchlorodimethyl silane,acmc-1afr7 PubChem CID: 77646 IUPAC Name: chloro-dimethyl-prop-2-enylsilane SMILES: C[Si](C)(CC=C)Cl
| PubChem CID | 77646 |
|---|---|
| CAS | 4028-23-3 |
| Molecular Weight (g/mol) | 134.678 |
| MDL Number | MFCD00000506 |
| SMILES | C[Si](C)(CC=C)Cl |
| Synonym | allyldimethylchlorosilane,allylchlorodimethylsilane,silane, chlorodimethyl-2-propenyl,allyl chloro dimethylsilane,allyl-chloro-dimethyl silane,silane, chlorodimethyl-2-propen-1-yl,admcs,allyl chlorodimethylsilane,allylchlorodimethyl silane,acmc-1afr7 |
| IUPAC Name | chloro-dimethyl-prop-2-enylsilane |
| InChI Key | KMVZWUQHMJAWSY-UHFFFAOYSA-N |
| Molecular Formula | C5H11ClSi |