Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Molybdenum, plasma standard solution, Specpure™ Mo 10,000μg/mL
CAS: 7439-98-7 Molecular Formula: Mo Molecular Weight (g/mol): 95.95 MDL Number: MFCD00003465 InChI Key: ZOKXTWBITQBERF-UHFFFAOYSA-N Synonym: molybdenum, elemental,6+ ion,mchvl,vi ion,molybdenum, metallic,metco 63,atom,molybdenum, ion 6+,tsm1,amperit 106.2 PubChem CID: 23932 ChEBI: CHEBI:28685 IUPAC Name: molybdenum SMILES: [Mo]
| PubChem CID | 23932 |
|---|---|
| CAS | 7439-98-7 |
| Molecular Weight (g/mol) | 95.95 |
| ChEBI | CHEBI:28685 |
| MDL Number | MFCD00003465 |
| SMILES | [Mo] |
| Synonym | molybdenum, elemental,6+ ion,mchvl,vi ion,molybdenum, metallic,metco 63,atom,molybdenum, ion 6+,tsm1,amperit 106.2 |
| IUPAC Name | molybdenum |
| InChI Key | ZOKXTWBITQBERF-UHFFFAOYSA-N |
| Molecular Formula | Mo |
Gold wire, 2.0mm (0.08in) dia, Premion™, 99.9985% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Thermo Scientific Chemicals Ammonium chloride, for molecular biology
CAS: 12125-02-9 Molecular Formula: ClH4N Molecular Weight (g/mol): 53.49 MDL Number: MFCD00011420 InChI Key: NLXLAEXVIDQMFP-UHFFFAOYSA-N IUPAC Name: ammonium chloride SMILES: N.Cl
| CAS | 12125-02-9 |
|---|---|
| Molecular Weight (g/mol) | 53.49 |
| MDL Number | MFCD00011420 |
| SMILES | N.Cl |
| IUPAC Name | ammonium chloride |
| InChI Key | NLXLAEXVIDQMFP-UHFFFAOYSA-N |
| Molecular Formula | ClH4N |
| Linear Formula | ZnCl2 |
|---|---|
| Molecular Weight (g/mol) | 136.29 |
| ChEBI | CHEBI:49976 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Zinc chloride |
| SMILES | Cl[Zn]Cl |
| Merck Index | 15, 10331 |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Density | 1.0700g/mL |
| PubChem CID | 5727 |
| Name Note | 2M solution in 2-Methyltetrahydrofuran |
| Concentration or Composition (by Analyte or Components) | 23 to 27% |
| CAS | 96-47-9 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00011295 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May cause respiratory irritation. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. May form explos |
| Flash Point | −11°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| Molecular Formula | Cl2Zn |
| EINECS Number | 231-592- |
| Formula Weight | 136.29 |
| Specific Gravity | 1.07 |
Sodium nitrate, 99.999%, (trace metal basis)
CAS: 7631-99-4 Molecular Formula: NNaO3 Molecular Weight (g/mol): 84.99 MDL Number: MFCD00011119 InChI Key: VWDWKYIASSYTQR-UHFFFAOYSA-N Synonym: sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 PubChem CID: 24268 ChEBI: CHEBI:63005 SMILES: [Na+].[O-][N+]([O-])=O
| PubChem CID | 24268 |
|---|---|
| CAS | 7631-99-4 |
| Molecular Weight (g/mol) | 84.99 |
| ChEBI | CHEBI:63005 |
| MDL Number | MFCD00011119 |
| SMILES | [Na+].[O-][N+]([O-])=O |
| Synonym | sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 |
| InChI Key | VWDWKYIASSYTQR-UHFFFAOYSA-N |
| Molecular Formula | NNaO3 |
Ammonium hydrogen sulfate, extra pure
CAS: 7803-63-6 Molecular Formula: H5NO4S Molecular Weight (g/mol): 115.10 InChI Key: BIGPRXCJEDHCLP-UHFFFAOYSA-N Synonym: ammonium bisulfate,ammonium hydrogensulphate,sulfuric acid, monoammonium salt,unii-6218r7mbzb,sulfuric acid, ammonium salt 1:1,azanium hydrogen sulfate,ammonia sulfate,acmc-1bcew,ammonium hydrogen sulphate,nh4hso4 PubChem CID: 24655 SMILES: [NH4+].OS([O-])(=O)=O
| PubChem CID | 24655 |
|---|---|
| CAS | 7803-63-6 |
| Molecular Weight (g/mol) | 115.10 |
| SMILES | [NH4+].OS([O-])(=O)=O |
| Synonym | ammonium bisulfate,ammonium hydrogensulphate,sulfuric acid, monoammonium salt,unii-6218r7mbzb,sulfuric acid, ammonium salt 1:1,azanium hydrogen sulfate,ammonia sulfate,acmc-1bcew,ammonium hydrogen sulphate,nh4hso4 |
| InChI Key | BIGPRXCJEDHCLP-UHFFFAOYSA-N |
| Molecular Formula | H5NO4S |
(3-Methylaminopropyl)trimethoxysilane, 95%
CAS: 3069-25-8 Molecular Formula: C7H19NO3Si Molecular Weight (g/mol): 193.32 MDL Number: MFCD00048021 InChI Key: DVYVMJLSUSGYMH-UHFFFAOYSA-N Synonym: n-methylaminopropyltrimethoxysilane,n-methyl-3-trimethoxysilyl propan-1-amine,trimethoxy 3-methylamino propyl silane,1-propanamine, n-methyl-3-trimethoxysilyl,n-methyl-3-trimethoxysilyl propylamine,n-methyl-3-aminopropyltrimethoxysilane,3-methylaminopropyl-trimethoxysilane,methyl 3-trimethoxysilyl propyl amine,n-methyl-3-aminopropyl-trimethoxysilane,acmc-20ak27 PubChem CID: 76480 IUPAC Name: N-methyl-3-trimethoxysilylpropan-1-amine SMILES: CNCCC[Si](OC)(OC)OC
| PubChem CID | 76480 |
|---|---|
| CAS | 3069-25-8 |
| Molecular Weight (g/mol) | 193.32 |
| MDL Number | MFCD00048021 |
| SMILES | CNCCC[Si](OC)(OC)OC |
| Synonym | n-methylaminopropyltrimethoxysilane,n-methyl-3-trimethoxysilyl propan-1-amine,trimethoxy 3-methylamino propyl silane,1-propanamine, n-methyl-3-trimethoxysilyl,n-methyl-3-trimethoxysilyl propylamine,n-methyl-3-aminopropyltrimethoxysilane,3-methylaminopropyl-trimethoxysilane,methyl 3-trimethoxysilyl propyl amine,n-methyl-3-aminopropyl-trimethoxysilane,acmc-20ak27 |
| IUPAC Name | N-methyl-3-trimethoxysilylpropan-1-amine |
| InChI Key | DVYVMJLSUSGYMH-UHFFFAOYSA-N |
| Molecular Formula | C7H19NO3Si |
Strontium nitrate, 98%, extra pure
CAS: 10042-76-9 Molecular Formula: N2O6Sr Molecular Weight (g/mol): 211.63 MDL Number: MFCD00011248 InChI Key: DHEQXMRUPNDRPG-UHFFFAOYSA-N Synonym: strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 PubChem CID: 24848 IUPAC Name: strontium(2+) dinitrate SMILES: [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24848 |
|---|---|
| CAS | 10042-76-9 |
| Molecular Weight (g/mol) | 211.63 |
| MDL Number | MFCD00011248 |
| SMILES | [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 |
| IUPAC Name | strontium(2+) dinitrate |
| InChI Key | DHEQXMRUPNDRPG-UHFFFAOYSA-N |
| Molecular Formula | N2O6Sr |
| Linear Formula | SbCl5 |
|---|---|
| Molecular Weight (g/mol) | 299.02 |
| Color | Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Antimony(V)-chloride |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl |
| Merck Index | 15,686 |
| InChI Key | VMPVEPPRYRXYNP-UHFFFAOYSA-I |
| Density | 1.4420g/mL |
| PubChem CID | 24294 |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00011213 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. May cause drowsiness or dizziness. Toxic to aquatic life with long lasting effects. |
| Packaging | AcroSeal™ Glass Bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german |
| IUPAC Name | pentachloro-$l^{5}-stibane |
| Molecular Formula | Cl5Sb |
| EINECS Number | 231-601-8 |
| Formula Weight | 299.01 |
| Specific Gravity | 1.442 |
Bismuth(III) chloride, 97+% (dry wt.), may cont. up to 3% water
CAS: 7787-60-2 Molecular Formula: BiCl3 Molecular Weight (g/mol): 315.33 MDL Number: MFCD00003461 InChI Key: JHXKRIRFYBPWGE-UHFFFAOYSA-K Synonym: bismuth trichloride,bismuth chloride,trichlorobismuthine,trichlorobismuth,bismuth iii chloride,bismuthine, trichloro,trichlorobismute,bismuth lll chloride PubChem CID: 24591 IUPAC Name: trichlorobismuthane SMILES: Cl[Bi](Cl)Cl
| PubChem CID | 24591 |
|---|---|
| CAS | 7787-60-2 |
| Molecular Weight (g/mol) | 315.33 |
| MDL Number | MFCD00003461 |
| SMILES | Cl[Bi](Cl)Cl |
| Synonym | bismuth trichloride,bismuth chloride,trichlorobismuthine,trichlorobismuth,bismuth iii chloride,bismuthine, trichloro,trichlorobismute,bismuth lll chloride |
| IUPAC Name | trichlorobismuthane |
| InChI Key | JHXKRIRFYBPWGE-UHFFFAOYSA-K |
| Molecular Formula | BiCl3 |
Sodium thiocyanate, 98+%, for analysis
CAS: 540-72-7 Molecular Formula: CNNaS Molecular Weight (g/mol): 81.07 MDL Number: MFCD00011123 InChI Key: VGTPCRGMBIAPIM-UHFFFAOYSA-M Synonym: sodium thiocyanate,sodium rhodanate,sodium sulfocyanate,sodium rhodanide,thiocyanic acid, sodium salt,thiocyanate sodium,scyan,sodium isothiocyanate,nascn,haimased PubChem CID: 516871 ChEBI: CHEBI:30952 IUPAC Name: sodium;thiocyanate SMILES: [Na+].[S-]C#N
| PubChem CID | 516871 |
|---|---|
| CAS | 540-72-7 |
| Molecular Weight (g/mol) | 81.07 |
| ChEBI | CHEBI:30952 |
| MDL Number | MFCD00011123 |
| SMILES | [Na+].[S-]C#N |
| Synonym | sodium thiocyanate,sodium rhodanate,sodium sulfocyanate,sodium rhodanide,thiocyanic acid, sodium salt,thiocyanate sodium,scyan,sodium isothiocyanate,nascn,haimased |
| IUPAC Name | sodium;thiocyanate |
| InChI Key | VGTPCRGMBIAPIM-UHFFFAOYSA-M |
| Molecular Formula | CNNaS |
Titanium gauze, 80 mesh woven from 0.13mm (0.005in) dia wire
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Ammonium Fluoborate, MP Biomedicals
CAS: 13826-83-0 Molecular Formula: BF4H4N Molecular Weight (g/mol): 104.84 MDL Number: MFCD06245785 InChI Key: PDTKOBRZPAIMRD-UHFFFAOYSA-O Synonym: ammonium tetrafluoroborate,ammonium fluoroborate,ammonium fluoborate,ammonium borofluoride,unii-c945z80o8x,ammonium tetrafluroborate,azanium tetrafluoroborate,arnmonium tetrafluoroborate,nh4bf4,ksc492c2p PubChem CID: 9964072 IUPAC Name: ammonium tetrafluoroboranuide SMILES: [NH4+].F[B-](F)(F)F
| PubChem CID | 9964072 |
|---|---|
| CAS | 13826-83-0 |
| Molecular Weight (g/mol) | 104.84 |
| MDL Number | MFCD06245785 |
| SMILES | [NH4+].F[B-](F)(F)F |
| Synonym | ammonium tetrafluoroborate,ammonium fluoroborate,ammonium fluoborate,ammonium borofluoride,unii-c945z80o8x,ammonium tetrafluroborate,azanium tetrafluoroborate,arnmonium tetrafluoroborate,nh4bf4,ksc492c2p |
| IUPAC Name | ammonium tetrafluoroboranuide |
| InChI Key | PDTKOBRZPAIMRD-UHFFFAOYSA-O |
| Molecular Formula | BF4H4N |
Cobalt rod, 5mm (0.2in) dia, Puratronic™, 99.995% (metals basis)
CAS: 7440-48-4 Molecular Formula: Co Molecular Weight (g/mol): 58.93 MDL Number: MFCD00010935 InChI Key: GUTLYIVDDKVIGB-UHFFFAOYSA-N Synonym: kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride PubChem CID: 104730 ChEBI: CHEBI:27638 IUPAC Name: cobalt SMILES: [Co]
| PubChem CID | 104730 |
|---|---|
| CAS | 7440-48-4 |
| Molecular Weight (g/mol) | 58.93 |
| ChEBI | CHEBI:27638 |
| MDL Number | MFCD00010935 |
| SMILES | [Co] |
| Synonym | kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride |
| IUPAC Name | cobalt |
| InChI Key | GUTLYIVDDKVIGB-UHFFFAOYSA-N |
| Molecular Formula | Co |
Nickel foil, 0.1mm (0.004in) thick, Puratronic™, 99.994% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |