Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
| Boiling Point | 84.0°C to 86.0°C |
|---|---|
| Water | 0.005% max. |
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Dry over Molecular Sieve |
| Density | 0.8670g/mL |
| Percent Purity | 99.5% |
| CAS | 110-71-4 |
| Health Hazard 3 | GHS P Statement Obtain special instructions before use. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. Wear protective gloves/protective clothing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN: Wash with plenty of soap and water. |
| Health Hazard 2 | GHS H Statement Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. Causes skin irritation. May form explosive peroxides. |
| Solubility Information | Solubility in water: miscible. Other solubilities: solulbe in hydrocarbon solvents, soluble in ethanol, ethyl ether, acetone, carbon, tetrachloride, benzene, dichloroethane |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Formula Weight | 90.12 |
| Specific Gravity | 0.867 |
| Melting Point | -69.0°C |
n-Heptane, 99+%, for spectroscopy
CAS: 142-82-5 Molecular Formula: C7H16 Molecular Weight (g/mol): 100.21 MDL Number: MFCD00009544 InChI Key: IMNFDUFMRHMDMM-UHFFFAOYSA-N Synonym: n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish PubChem CID: 8900 ChEBI: CHEBI:43098 IUPAC Name: heptane SMILES: CCCCCCC
| PubChem CID | 8900 |
|---|---|
| CAS | 142-82-5 |
| Molecular Weight (g/mol) | 100.21 |
| ChEBI | CHEBI:43098 |
| MDL Number | MFCD00009544 |
| SMILES | CCCCCCC |
| Synonym | n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish |
| IUPAC Name | heptane |
| InChI Key | IMNFDUFMRHMDMM-UHFFFAOYSA-N |
| Molecular Formula | C7H16 |
1-Methyl-2-pyrrolidinone, 99.5%, for analysis
CAS: 872-50-4 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 InChI Key: SECXISVLQFMRJM-UHFFFAOYSA-N IUPAC Name: 1-methylpyrrolidin-2-one SMILES: CN1CCCC1=O
| CAS | 872-50-4 |
|---|---|
| Molecular Weight (g/mol) | 99.13 |
| SMILES | CN1CCCC1=O |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI Key | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Xylenes, 99.99%, For ACS analysis, MP Biomedicals™
CAS: 1330-20-7 Molecular Formula: C8H10 Molecular Weight (g/mol): 106.17 Synonym: Xylol
| CAS | 1330-20-7 |
|---|---|
| Molecular Weight (g/mol) | 106.17 |
| Synonym | Xylol |
| Molecular Formula | C8H10 |
1,1,2,2-Tetrachloroethane-d2, for NMR, packaged in 0.75 ml ampoules, 99.5 atom % D
CAS: 33685-54-0 Molecular Formula: C2H2Cl4 Molecular Weight (g/mol): 169.85 InChI Key: QPFMBZIOSGYJDE-QDNHWIQGSA-N IUPAC Name: tetrachloro(²H₂)ethane SMILES: [2H]C(Cl)(Cl)C([2H])(Cl)Cl
| CAS | 33685-54-0 |
|---|---|
| Molecular Weight (g/mol) | 169.85 |
| SMILES | [2H]C(Cl)(Cl)C([2H])(Cl)Cl |
| IUPAC Name | tetrachloro(²H₂)ethane |
| InChI Key | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| Molecular Formula | C2H2Cl4 |
Dimethyl sulfoxide-d{6}, 100% (Isotopic), contains 0.03% v/v TMS
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Pyridine-d{5}, 100%(Isotopic)
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
Tetrachlorobis(tetrahydrofuran)zirconium(IV), Thermo Scientific Chemicals
CAS: 21959-01-3 Molecular Formula: C8H16Cl4O2Zr Molecular Weight (g/mol): 377.238 MDL Number: MFCD00145367 InChI Key: VDJJKYYENYIHFF-UHFFFAOYSA-J Synonym: tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 PubChem CID: 2734040 IUPAC Name: oxolane;tetrachlorozirconium SMILES: C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl
| PubChem CID | 2734040 |
|---|---|
| CAS | 21959-01-3 |
| Molecular Weight (g/mol) | 377.238 |
| MDL Number | MFCD00145367 |
| SMILES | C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl |
| Synonym | tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 |
| IUPAC Name | oxolane;tetrachlorozirconium |
| InChI Key | VDJJKYYENYIHFF-UHFFFAOYSA-J |
| Molecular Formula | C8H16Cl4O2Zr |
Methanol-d{4}, 100%(Isotopic)
CAS: 811-98-3 Molecular Formula: CH4O Molecular Weight (g/mol): 36.066 MDL Number: MFCD00044637 InChI Key: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d PubChem CID: 71568 IUPAC Name: trideuterio(deuteriooxy)methane SMILES: CO
| PubChem CID | 71568 |
|---|---|
| CAS | 811-98-3 |
| Molecular Weight (g/mol) | 36.066 |
| MDL Number | MFCD00044637 |
| SMILES | CO |
| Synonym | methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d |
| IUPAC Name | trideuterio(deuteriooxy)methane |
| InChI Key | OKKJLVBELUTLKV-MZCSYVLQSA-N |
| Molecular Formula | CH4O |
3-Chlorobenzeneboronic acid, 97%
CAS: 63503-60-6 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00161354 InChI Key: SDEAGACSNFSZCU-UHFFFAOYSA-N Synonym: 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 PubChem CID: 2734323 IUPAC Name: (3-chlorophenyl)boronic acid SMILES: OB(O)C1=CC(Cl)=CC=C1
| PubChem CID | 2734323 |
|---|---|
| CAS | 63503-60-6 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00161354 |
| SMILES | OB(O)C1=CC(Cl)=CC=C1 |
| Synonym | 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 |
| IUPAC Name | (3-chlorophenyl)boronic acid |
| InChI Key | SDEAGACSNFSZCU-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
3-Chloro-o-xylene, 97%
CAS: 608-23-1 Molecular Formula: C8H9Cl Molecular Weight (g/mol): 140.61 MDL Number: MFCD00060689 InChI Key: NVLHGZIXTRYOKT-UHFFFAOYSA-N Synonym: 3-chloro-o-xylene,2,3-dimethylchlorobenzene,benzene, chlorodimethyl,3-chloro-1,2-dimethylbenzene,3-chloro-ortho-xylene,benzene, 1-chloro-2,3-dimethyl,xylyl chloride,chloro o-xylene,mono-chlorxylol,chloro-ortho-xylene PubChem CID: 32884 IUPAC Name: 1-chloro-2,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)Cl)C
| PubChem CID | 32884 |
|---|---|
| CAS | 608-23-1 |
| Molecular Weight (g/mol) | 140.61 |
| MDL Number | MFCD00060689 |
| SMILES | CC1=C(C(=CC=C1)Cl)C |
| Synonym | 3-chloro-o-xylene,2,3-dimethylchlorobenzene,benzene, chlorodimethyl,3-chloro-1,2-dimethylbenzene,3-chloro-ortho-xylene,benzene, 1-chloro-2,3-dimethyl,xylyl chloride,chloro o-xylene,mono-chlorxylol,chloro-ortho-xylene |
| IUPAC Name | 1-chloro-2,3-dimethylbenzene |
| InChI Key | NVLHGZIXTRYOKT-UHFFFAOYSA-N |
| Molecular Formula | C8H9Cl |
1-Propanol, 99+%
CAS: 71-23-8 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.10 MDL Number: MFCD00002941 InChI Key: BDERNNFJNOPAEC-UHFFFAOYSA-N Synonym: 1-propanol,propanol,propyl alcohol,n-propanol,n-propyl alcohol,ethylcarbinol,1-hydroxypropane,optal,osmosol extra,propylic alcohol PubChem CID: 1031 ChEBI: CHEBI:28831 IUPAC Name: propan-1-ol SMILES: CCCO
| PubChem CID | 1031 |
|---|---|
| CAS | 71-23-8 |
| Molecular Weight (g/mol) | 60.10 |
| ChEBI | CHEBI:28831 |
| MDL Number | MFCD00002941 |
| SMILES | CCCO |
| Synonym | 1-propanol,propanol,propyl alcohol,n-propanol,n-propyl alcohol,ethylcarbinol,1-hydroxypropane,optal,osmosol extra,propylic alcohol |
| IUPAC Name | propan-1-ol |
| InChI Key | BDERNNFJNOPAEC-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
2-Propanol For spectroscopy Uvasol™, MilliporeSigma™
CAS: 67-63-0 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.096 InChI Key: KFZMGEQAYNKOFK-UHFFFAOYSA-N Synonym: isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol PubChem CID: 3776 ChEBI: CHEBI:17824 IUPAC Name: propan-2-ol SMILES: CC(C)O
| PubChem CID | 3776 |
|---|---|
| CAS | 67-63-0 |
| Molecular Weight (g/mol) | 60.096 |
| ChEBI | CHEBI:17824 |
| SMILES | CC(C)O |
| Synonym | isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol |
| IUPAC Name | propan-2-ol |
| InChI Key | KFZMGEQAYNKOFK-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
n-Hexane For spectroscopy Uvasol™, MilliporeSigma™
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
3-Chloro-4-methylbenzeneboronic acid, 97%
CAS: 175883-63-3 Molecular Formula: C7H8BClO2 Molecular Weight (g/mol): 170.40 MDL Number: MFCD04039010 InChI Key: YTJUYWRCAZWVSX-UHFFFAOYSA-N Synonym: 3-chloro-4-methylphenyl boronic acid,3-chloro-4-methylbenzeneboronic acid,3-chloro-4-methylphenylboronicacid,3-chloro-p-tolylboronic acid,boronic acid, 3-chloro-4-methylphenyl,pubchem5132,3-chloro-4-methyl-phenyl boronic acid,acmc-209eaq,ksc489k9f,3-chloro-4-methylphenyl-boronic acid PubChem CID: 3854610 IUPAC Name: (3-chloro-4-methylphenyl)boronic acid SMILES: CC1=CC=C(C=C1Cl)B(O)O
| PubChem CID | 3854610 |
|---|---|
| CAS | 175883-63-3 |
| Molecular Weight (g/mol) | 170.40 |
| MDL Number | MFCD04039010 |
| SMILES | CC1=CC=C(C=C1Cl)B(O)O |
| Synonym | 3-chloro-4-methylphenyl boronic acid,3-chloro-4-methylbenzeneboronic acid,3-chloro-4-methylphenylboronicacid,3-chloro-p-tolylboronic acid,boronic acid, 3-chloro-4-methylphenyl,pubchem5132,3-chloro-4-methyl-phenyl boronic acid,acmc-209eaq,ksc489k9f,3-chloro-4-methylphenyl-boronic acid |
| IUPAC Name | (3-chloro-4-methylphenyl)boronic acid |
| InChI Key | YTJUYWRCAZWVSX-UHFFFAOYSA-N |
| Molecular Formula | C7H8BClO2 |