Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
N,N-Dimethylacetamide, >99%, MP Biomedicals™
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Lidocaine, 99.9%, MP Biomedicals™
CAS: 137-58-6 Molecular Formula: C14H22N2O Molecular Weight (g/mol): 234.343 InChI Key: NNJVILVZKWQKPM-UHFFFAOYSA-N Synonym: lidocaine,lignocaine,xylocaine,lidoderm,2-diethylamino-n-2,6-dimethylphenyl acetamide,anestacon,esracaine,duncaine,cappicaine,gravocain PubChem CID: 3676 ChEBI: CHEBI:6456 IUPAC Name: 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide SMILES: CCN(CC)CC(=O)NC1=C(C=CC=C1C)C
| PubChem CID | 3676 |
|---|---|
| CAS | 137-58-6 |
| Molecular Weight (g/mol) | 234.343 |
| ChEBI | CHEBI:6456 |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C |
| Synonym | lidocaine,lignocaine,xylocaine,lidoderm,2-diethylamino-n-2,6-dimethylphenyl acetamide,anestacon,esracaine,duncaine,cappicaine,gravocain |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide |
| InChI Key | NNJVILVZKWQKPM-UHFFFAOYSA-N |
| Molecular Formula | C14H22N2O |
Chlorobis(3,5-dimethylphenyl)phosphine, tech. 90%
CAS: 74289-57-9 Molecular Formula: C16H18ClP Molecular Weight (g/mol): 276.744 MDL Number: MFCD01630841 InChI Key: FCEBDAANWYNQMO-UHFFFAOYSA-N Synonym: bis 3,5-dimethylphenyl chlorophosphine,chlorobis 3,5-dimethylphenyl phosphine,chlorobis 3,5-dimethylphenyl phosphane,chloro-bis 3,5-dimethylphenyl phosphane,bis 3,5-dimethylphenyl phosphinous chloride,phosphinous chloride, bis 3,5-dimethylphenyl,bis 3,5-dimethylphenyl chlorophosphine, tech,phosphinous chloride,p,p-bis 3,5-dimethylphenyl PubChem CID: 4187520 IUPAC Name: chloro-bis(3,5-dimethylphenyl)phosphane SMILES: CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)Cl)C
| PubChem CID | 4187520 |
|---|---|
| CAS | 74289-57-9 |
| Molecular Weight (g/mol) | 276.744 |
| MDL Number | MFCD01630841 |
| SMILES | CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)Cl)C |
| Synonym | bis 3,5-dimethylphenyl chlorophosphine,chlorobis 3,5-dimethylphenyl phosphine,chlorobis 3,5-dimethylphenyl phosphane,chloro-bis 3,5-dimethylphenyl phosphane,bis 3,5-dimethylphenyl phosphinous chloride,phosphinous chloride, bis 3,5-dimethylphenyl,bis 3,5-dimethylphenyl chlorophosphine, tech,phosphinous chloride,p,p-bis 3,5-dimethylphenyl |
| IUPAC Name | chloro-bis(3,5-dimethylphenyl)phosphane |
| InChI Key | FCEBDAANWYNQMO-UHFFFAOYSA-N |
| Molecular Formula | C16H18ClP |
2,4-Dimethylbenzeneboronic acid, 97%
CAS: 55499-44-0 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.984 MDL Number: MFCD02683101 InChI Key: TYONHSPZXLFWKI-UHFFFAOYSA-N Synonym: 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d PubChem CID: 4198739 IUPAC Name: (2,4-dimethylphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1)C)C)(O)O
| PubChem CID | 4198739 |
|---|---|
| CAS | 55499-44-0 |
| Molecular Weight (g/mol) | 149.984 |
| MDL Number | MFCD02683101 |
| SMILES | B(C1=C(C=C(C=C1)C)C)(O)O |
| Synonym | 2,4-dimethylphenyl boronic acid,2,4-dimethylbenzeneboronic acid,2,4-dimethyl phenyl boronic acid,2,4-dimethylphenylboronicacid,4-dimethylphenylboronic acid,boronic acid, 2,4-dimethylphenyl,4-borono-m-xylene,pubchem9565,m-xylene-4-boronic acid,acmc-1ay9d |
| IUPAC Name | (2,4-dimethylphenyl)boronic acid |
| InChI Key | TYONHSPZXLFWKI-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
Acetone, 99+%, extra pure
CAS: 67-64-1 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00008765 InChI Key: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC Name: propan-2-one SMILES: CC(C)=O
| PubChem CID | 180 |
|---|---|
| CAS | 67-64-1 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:15347 |
| MDL Number | MFCD00008765 |
| SMILES | CC(C)=O |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| IUPAC Name | propan-2-one |
| InChI Key | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
Petroleum Ether, B.R. 100°C to 140°C, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 8032-32-4
| CAS | 8032-32-4 |
|---|
2-Bromo-4,6-dimethylaniline, 98%
CAS: 41825-73-4 Molecular Formula: C8H10BrN Molecular Weight (g/mol): 200.08 MDL Number: MFCD00047826 InChI Key: YOSJCQJJIHEUKA-UHFFFAOYSA-N Synonym: 2-bromo-4,6-dimethyl-aniline,6-bromo-2,4-xylidine,benzenamine, 2-bromo-4,6-dimethyl,2-bromo-4,6-dimethylphenylamine,4-amino-5-bromo-m-xylene,2-bromo-4,6-dimethylbenzenamine,2-bromo-4,6-dimethyl-phenylamine,2-amino-3,5-dimethyl-1-bromobenzene,pubchem3761 PubChem CID: 170579 IUPAC Name: 2-bromo-4,6-dimethylaniline SMILES: CC1=CC(C)=C(N)C(Br)=C1
| PubChem CID | 170579 |
|---|---|
| CAS | 41825-73-4 |
| Molecular Weight (g/mol) | 200.08 |
| MDL Number | MFCD00047826 |
| SMILES | CC1=CC(C)=C(N)C(Br)=C1 |
| Synonym | 2-bromo-4,6-dimethyl-aniline,6-bromo-2,4-xylidine,benzenamine, 2-bromo-4,6-dimethyl,2-bromo-4,6-dimethylphenylamine,4-amino-5-bromo-m-xylene,2-bromo-4,6-dimethylbenzenamine,2-bromo-4,6-dimethyl-phenylamine,2-amino-3,5-dimethyl-1-bromobenzene,pubchem3761 |
| IUPAC Name | 2-bromo-4,6-dimethylaniline |
| InChI Key | YOSJCQJJIHEUKA-UHFFFAOYSA-N |
| Molecular Formula | C8H10BrN |
2-Bromo-1,3,5-trichlorobenzene, 97%
CAS: 19393-96-5 Molecular Formula: C6H2BrCl3 Molecular Weight (g/mol): 260.34 MDL Number: MFCD00060653 InChI Key: BAPPAFMEUDJAQI-UHFFFAOYSA-N PubChem CID: 140526 IUPAC Name: 2-bromo-1,3,5-trichlorobenzene SMILES: ClC1=CC(Cl)=C(Br)C(Cl)=C1
| PubChem CID | 140526 |
|---|---|
| CAS | 19393-96-5 |
| Molecular Weight (g/mol) | 260.34 |
| MDL Number | MFCD00060653 |
| SMILES | ClC1=CC(Cl)=C(Br)C(Cl)=C1 |
| IUPAC Name | 2-bromo-1,3,5-trichlorobenzene |
| InChI Key | BAPPAFMEUDJAQI-UHFFFAOYSA-N |
| Molecular Formula | C6H2BrCl3 |
4-Bromo-1-chloro-2-ethylbenzene, 98+%
CAS: 289039-22-1 Molecular Formula: C8H8BrCl Molecular Weight (g/mol): 219.506 MDL Number: MFCD00672954 InChI Key: ILQNJGBEXZUYOI-UHFFFAOYSA-N Synonym: 5-bromo-2-chloroethylbenzene,acmc-1cnam,4-bromo-1-chloro-2-ethyl benzene,4-bromo-1-chloro-2-ethyl-benzene PubChem CID: 44119401 IUPAC Name: 4-bromo-1-chloro-2-ethylbenzene SMILES: CCC1=C(C=CC(=C1)Br)Cl
| PubChem CID | 44119401 |
|---|---|
| CAS | 289039-22-1 |
| Molecular Weight (g/mol) | 219.506 |
| MDL Number | MFCD00672954 |
| SMILES | CCC1=C(C=CC(=C1)Br)Cl |
| Synonym | 5-bromo-2-chloroethylbenzene,acmc-1cnam,4-bromo-1-chloro-2-ethyl benzene,4-bromo-1-chloro-2-ethyl-benzene |
| IUPAC Name | 4-bromo-1-chloro-2-ethylbenzene |
| InChI Key | ILQNJGBEXZUYOI-UHFFFAOYSA-N |
| Molecular Formula | C8H8BrCl |
4-Fluoro-2,6-dimethylaniline, 97%
CAS: 392-70-1 Molecular Formula: C8H10FN Molecular Weight (g/mol): 139.173 MDL Number: MFCD03792669 InChI Key: MPNDLCBMLBACDD-UHFFFAOYSA-N Synonym: 4-fluoro-2,6-dimethylphenylamine,2,6-dimethyl-4-fluoroaniline,acmc-20amil,pubchem4426,4-fluoro-2,6-dimethyl-aniline,4-fluoranyl-2,6-dimethyl-aniline,benzenamine,4-fluoro-2,6-dimethyl PubChem CID: 1403908 IUPAC Name: 4-fluoro-2,6-dimethylaniline SMILES: CC1=CC(=CC(=C1N)C)F
| PubChem CID | 1403908 |
|---|---|
| CAS | 392-70-1 |
| Molecular Weight (g/mol) | 139.173 |
| MDL Number | MFCD03792669 |
| SMILES | CC1=CC(=CC(=C1N)C)F |
| Synonym | 4-fluoro-2,6-dimethylphenylamine,2,6-dimethyl-4-fluoroaniline,acmc-20amil,pubchem4426,4-fluoro-2,6-dimethyl-aniline,4-fluoranyl-2,6-dimethyl-aniline,benzenamine,4-fluoro-2,6-dimethyl |
| IUPAC Name | 4-fluoro-2,6-dimethylaniline |
| InChI Key | MPNDLCBMLBACDD-UHFFFAOYSA-N |
| Molecular Formula | C8H10FN |
3-Chloro-2-methylbenzeneboronic acid, 97%
CAS: 313545-20-9 Molecular Formula: C7H8BClO2 Molecular Weight (g/mol): 170.399 MDL Number: MFCD04115641 InChI Key: BJPNVVXTUYMJPN-UHFFFAOYSA-N Synonym: 3-chloro-2-methylphenyl boronic acid,2-borono-6-chlorotoluene,3-chloro-2-methylbenzeneboronic acid,3-chloro-2-methylphenyboronic acid,boronic acid, 3-chloro-2-methylphenyl,boronic acid,b-3-chloro-2-methylphenyl,3-chloro-2-methyl-phenyl boronic acid,acmc-209hls,3-chloro-2-methylphenboronic acid,3-chloro-2-methyl-phenylboronic acid PubChem CID: 3744103 IUPAC Name: (3-chloro-2-methylphenyl)boronic acid SMILES: B(C1=C(C(=CC=C1)Cl)C)(O)O
| PubChem CID | 3744103 |
|---|---|
| CAS | 313545-20-9 |
| Molecular Weight (g/mol) | 170.399 |
| MDL Number | MFCD04115641 |
| SMILES | B(C1=C(C(=CC=C1)Cl)C)(O)O |
| Synonym | 3-chloro-2-methylphenyl boronic acid,2-borono-6-chlorotoluene,3-chloro-2-methylbenzeneboronic acid,3-chloro-2-methylphenyboronic acid,boronic acid, 3-chloro-2-methylphenyl,boronic acid,b-3-chloro-2-methylphenyl,3-chloro-2-methyl-phenyl boronic acid,acmc-209hls,3-chloro-2-methylphenboronic acid,3-chloro-2-methyl-phenylboronic acid |
| IUPAC Name | (3-chloro-2-methylphenyl)boronic acid |
| InChI Key | BJPNVVXTUYMJPN-UHFFFAOYSA-N |
| Molecular Formula | C7H8BClO2 |
2-(3-Chlorophenyl)ethylboronic acid pinacol ester, 97%
CAS: 1315277-53-2 Molecular Formula: C14H20BClO2 Molecular Weight (g/mol): 266.572 MDL Number: MFCD12546188 InChI Key: WZAJMSPJXKZSTL-UHFFFAOYSA-N Synonym: 2-2-3-chlorophenyl ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenyl ethylboronic acid pinacol ester PubChem CID: 73995113 IUPAC Name: 2-[2-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)CCC2=CC(=CC=C2)Cl
| PubChem CID | 73995113 |
|---|---|
| CAS | 1315277-53-2 |
| Molecular Weight (g/mol) | 266.572 |
| MDL Number | MFCD12546188 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2=CC(=CC=C2)Cl |
| Synonym | 2-2-3-chlorophenyl ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenyl ethylboronic acid pinacol ester |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | WZAJMSPJXKZSTL-UHFFFAOYSA-N |
| Molecular Formula | C14H20BClO2 |
Chloroform, MilliporeSigma™
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 IUPAC Name: trichloromethane SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | trichloromethane |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Cyclohexane, MilliporeSigma™
CAS: 110-82-7 Molecular Formula: C6H12 Molecular Weight (g/mol): 84.16 MDL Number: MFCD00003814 InChI Key: XDTMQSROBMDMFD-UHFFFAOYSA-N Synonym: hexamethylene,hexahydrobenzene,hexanaphthene,cyclohexan,cykloheksan,cicloesano,cyclohexaan,benzene, hexahydro,benzenehexahydride,polycyclohexane PubChem CID: 8078 ChEBI: CHEBI:29005 IUPAC Name: cyclohexane SMILES: C1CCCCC1
| PubChem CID | 8078 |
|---|---|
| CAS | 110-82-7 |
| Molecular Weight (g/mol) | 84.16 |
| ChEBI | CHEBI:29005 |
| MDL Number | MFCD00003814 |
| SMILES | C1CCCCC1 |
| Synonym | hexamethylene,hexahydrobenzene,hexanaphthene,cyclohexan,cykloheksan,cicloesano,cyclohexaan,benzene, hexahydro,benzenehexahydride,polycyclohexane |
| IUPAC Name | cyclohexane |
| InChI Key | XDTMQSROBMDMFD-UHFFFAOYSA-N |
| Molecular Formula | C6H12 |
2-Fluoro-m-xylene, 98%
CAS: 443-88-9 Molecular Formula: C8H9F Molecular Weight (g/mol): 124.158 MDL Number: MFCD00039215 InChI Key: JTAUTNBVFDTYTI-UHFFFAOYSA-N Synonym: 2,6-dimethylfluorobenzene,2-fluoro-m-xylene,1-fluoro-2,6-dimethylbenzene,1,3-dimethyl-2-fluorobenzene,benzene, 2-fluoro-1,3-dimethyl,2,6-dimethyl fluorobenzene,2-fluoro-1,3-dimethyl-benzene,fr b1 f1,pubchem4407,2-fluoro-3-methyltoluene PubChem CID: 123065 IUPAC Name: 2-fluoro-1,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)C)F
| PubChem CID | 123065 |
|---|---|
| CAS | 443-88-9 |
| Molecular Weight (g/mol) | 124.158 |
| MDL Number | MFCD00039215 |
| SMILES | CC1=C(C(=CC=C1)C)F |
| Synonym | 2,6-dimethylfluorobenzene,2-fluoro-m-xylene,1-fluoro-2,6-dimethylbenzene,1,3-dimethyl-2-fluorobenzene,benzene, 2-fluoro-1,3-dimethyl,2,6-dimethyl fluorobenzene,2-fluoro-1,3-dimethyl-benzene,fr b1 f1,pubchem4407,2-fluoro-3-methyltoluene |
| IUPAC Name | 2-fluoro-1,3-dimethylbenzene |
| InChI Key | JTAUTNBVFDTYTI-UHFFFAOYSA-N |
| Molecular Formula | C8H9F |