Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Acetonitrile - D3, deuteration degree min. 99% for NMR spectroscopy MagniSolv™, MilliporeSigma™
CAS: 2206-26-0 Molecular Formula: C2H3N Molecular Weight (g/mol): 44.07 MDL Number: MFCD00001881 InChI Key: WEVYAHXRMPXWCK-FIBGUPNXSA-N Synonym: acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g PubChem CID: 123151 IUPAC Name: (²H₃)acetonitrile SMILES: [2H]C([2H])([2H])C#N
| PubChem CID | 123151 |
|---|---|
| CAS | 2206-26-0 |
| Molecular Weight (g/mol) | 44.07 |
| MDL Number | MFCD00001881 |
| SMILES | [2H]C([2H])([2H])C#N |
| Synonym | acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g |
| IUPAC Name | (²H₃)acetonitrile |
| InChI Key | WEVYAHXRMPXWCK-FIBGUPNXSA-N |
| Molecular Formula | C2H3N |
Methanol, ≥99.8%, for spectroscopy ACS
CAS: 67-56-1 Molecular Formula: CH4O Molecular Weight (g/mol): 32.04 MDL Number: MFCD00004595 InChI Key: OKKJLVBELUTLKV-UHFFFAOYSA-N Synonym: methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit PubChem CID: 887 ChEBI: CHEBI:17790 IUPAC Name: methanol SMILES: CO
| PubChem CID | 887 |
|---|---|
| CAS | 67-56-1 |
| Molecular Weight (g/mol) | 32.04 |
| ChEBI | CHEBI:17790 |
| MDL Number | MFCD00004595 |
| SMILES | CO |
| Synonym | methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit |
| IUPAC Name | methanol |
| InChI Key | OKKJLVBELUTLKV-UHFFFAOYSA-N |
| Molecular Formula | CH4O |
N,N-Dimethylformamide-d{7}, 99.5% (Isotopic)
CAS: 4472-41-7 Molecular Formula: C3H7NO Molecular Weight (g/mol): 80.138 MDL Number: MFCD00003286 InChI Key: ZMXDDKWLCZADIW-YYWVXINBSA-N Synonym: n,n-dimethylformamide-d7,dmf-d7,deuterated dmf,n,n-di 2h3 methyl 2h formamide,dimethyl formamide-d7,dimethylformamide d,heptadeutero-n,n-dimethylformamide,n,n-dimethylformamide-d7 dmf-d7,formamide-1-d, n,n-di methyl-d3,n,n-dimethylformamide-d7 99.5atom%d PubChem CID: 78225 IUPAC Name: 1-deuterio-N,N-bis(trideuteriomethyl)formamide SMILES: CN(C)C=O
| PubChem CID | 78225 |
|---|---|
| CAS | 4472-41-7 |
| Molecular Weight (g/mol) | 80.138 |
| MDL Number | MFCD00003286 |
| SMILES | CN(C)C=O |
| Synonym | n,n-dimethylformamide-d7,dmf-d7,deuterated dmf,n,n-di 2h3 methyl 2h formamide,dimethyl formamide-d7,dimethylformamide d,heptadeutero-n,n-dimethylformamide,n,n-dimethylformamide-d7 dmf-d7,formamide-1-d, n,n-di methyl-d3,n,n-dimethylformamide-d7 99.5atom%d |
| IUPAC Name | 1-deuterio-N,N-bis(trideuteriomethyl)formamide |
| InChI Key | ZMXDDKWLCZADIW-YYWVXINBSA-N |
| Molecular Formula | C3H7NO |
3,5-Dimethylbenzenesulfonyl chloride, 97%
CAS: 2905-27-3 Molecular Formula: C8H9ClO2S Molecular Weight (g/mol): 204.67 MDL Number: MFCD03094655 InChI Key: LSAGRAXLOLZVKO-UHFFFAOYSA-N Synonym: 3,5-dimethylbenzene-1-sulfonyl chloride,3,5-dimethylphenyl chlorosulfone,3,5-dimethylbenzenesulfonylchloride,3,5-dimethylbenzenesulphonyl chloride,3,5-dimethyl-benzenesulfonyl chloride,pubchem5129,acmc-1ccrc,5-chlorosulphonyl-m-xylene,3,5-dimethylphenylsulfonyl chloride,3,5-xylenesulfonyl chloride PubChem CID: 2736235 SMILES: CC1=CC(=CC(C)=C1)S(Cl)(=O)=O
| PubChem CID | 2736235 |
|---|---|
| CAS | 2905-27-3 |
| Molecular Weight (g/mol) | 204.67 |
| MDL Number | MFCD03094655 |
| SMILES | CC1=CC(=CC(C)=C1)S(Cl)(=O)=O |
| Synonym | 3,5-dimethylbenzene-1-sulfonyl chloride,3,5-dimethylphenyl chlorosulfone,3,5-dimethylbenzenesulfonylchloride,3,5-dimethylbenzenesulphonyl chloride,3,5-dimethyl-benzenesulfonyl chloride,pubchem5129,acmc-1ccrc,5-chlorosulphonyl-m-xylene,3,5-dimethylphenylsulfonyl chloride,3,5-xylenesulfonyl chloride |
| InChI Key | LSAGRAXLOLZVKO-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO2S |
3,4-Dimethylbenzenesulfonyl chloride, 98%
CAS: 2905-30-8 Molecular Formula: C8H9ClO2S Molecular Weight (g/mol): 204.668 MDL Number: MFCD00625742 InChI Key: DNMQPRPJIWTNAX-UHFFFAOYSA-N Synonym: 3,4-dimethylbenzene-1-sulfonyl chloride,3,4-dimethylbenzenesulfonylchloride,3,4-dimethyl-benzenesulfonyl chloride,benzenesulfonyl chloride, 3,4-dimethyl,3,4-dimethylphenyl chlorosulfone,ksc562m4t,3,4-dimethylphenylsulfonyl chloride,3,4-dimethylbenzenesulphonyl chloride,3,4-dimethyl benzenesulfonyl chloride PubChem CID: 3689743 IUPAC Name: 3,4-dimethylbenzenesulfonyl chloride SMILES: CC1=C(C=C(C=C1)S(=O)(=O)Cl)C
| PubChem CID | 3689743 |
|---|---|
| CAS | 2905-30-8 |
| Molecular Weight (g/mol) | 204.668 |
| MDL Number | MFCD00625742 |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)C |
| Synonym | 3,4-dimethylbenzene-1-sulfonyl chloride,3,4-dimethylbenzenesulfonylchloride,3,4-dimethyl-benzenesulfonyl chloride,benzenesulfonyl chloride, 3,4-dimethyl,3,4-dimethylphenyl chlorosulfone,ksc562m4t,3,4-dimethylphenylsulfonyl chloride,3,4-dimethylbenzenesulphonyl chloride,3,4-dimethyl benzenesulfonyl chloride |
| IUPAC Name | 3,4-dimethylbenzenesulfonyl chloride |
| InChI Key | DNMQPRPJIWTNAX-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO2S |
Deuterium oxide, for NMR, packaged in 0.75ml ampoules, 99.8 atom% D
CAS: 7789-20-0 Molecular Formula: H2O Molecular Weight (g/mol): 20.03 MDL Number: MFCD00044636 InChI Key: XLYOFNOQVPJJNP-ZSJDYOACSA-N Synonym: deuterium oxide,water-d2,heavy water,deuterated water,dideuterium oxide,heavy water-d2,heavy water d2o,water sup 2-h2,deuterium oxide usan,water, heavy d2-o PubChem CID: 24602 ChEBI: CHEBI:41981 IUPAC Name: [(²H)oxy](²H) SMILES: [2H]O[2H]
| PubChem CID | 24602 |
|---|---|
| CAS | 7789-20-0 |
| Molecular Weight (g/mol) | 20.03 |
| ChEBI | CHEBI:41981 |
| MDL Number | MFCD00044636 |
| SMILES | [2H]O[2H] |
| Synonym | deuterium oxide,water-d2,heavy water,deuterated water,dideuterium oxide,heavy water-d2,heavy water d2o,water sup 2-h2,deuterium oxide usan,water, heavy d2-o |
| IUPAC Name | [(²H)oxy](²H) |
| InChI Key | XLYOFNOQVPJJNP-ZSJDYOACSA-N |
| Molecular Formula | H2O |
Sodium deuteroxide, for NMR, 30 wt% solution in D2O, 99+ atom % D
CAS: 14014-06-3 Molecular Formula: HNaO Molecular Weight (g/mol): 41.003 MDL Number: MFCD00037669 InChI Key: HEMHJVSKTPXQMS-DYCDLGHISA-M Synonym: sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci PubChem CID: 23676750 SMILES: [OH-].[Na+]
| PubChem CID | 23676750 |
|---|---|
| CAS | 14014-06-3 |
| Molecular Weight (g/mol) | 41.003 |
| MDL Number | MFCD00037669 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci |
| InChI Key | HEMHJVSKTPXQMS-DYCDLGHISA-M |
| Molecular Formula | HNaO |
Dichloromethane, 99+%, extra pure, stabilized with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
1-Butanol, HPLC Grade 99.4%, Thermo Scientific Chemicals
CAS: 71-36-3 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00002964 InChI Key: LRHPLDYGYMQRHN-UHFFFAOYSA-N Synonym: 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane PubChem CID: 263 ChEBI: CHEBI:28885 IUPAC Name: butan-1-ol SMILES: CCCCO
| PubChem CID | 263 |
|---|---|
| CAS | 71-36-3 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:28885 |
| MDL Number | MFCD00002964 |
| SMILES | CCCCO |
| Synonym | 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane |
| IUPAC Name | butan-1-ol |
| InChI Key | LRHPLDYGYMQRHN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Deuterium oxide, for NMR, 100.0 atom % D
CAS: 7789-20-0 Molecular Formula: H2O Molecular Weight (g/mol): 20.03 MDL Number: MFCD00044636 InChI Key: XLYOFNOQVPJJNP-ZSJDYOACSA-N Synonym: heavy water d2o,water sup 2-h2,deuterium oxide usan,heavy water,water, heavy d2-o,heavy water-d2,water-d2,dideuterium oxide,deuterium oxide,deuterated water PubChem CID: 24602 ChEBI: CHEBI:41981 IUPAC Name: [(²H)oxy](²H) SMILES: [2H]O[2H]
| PubChem CID | 24602 |
|---|---|
| CAS | 7789-20-0 |
| Molecular Weight (g/mol) | 20.03 |
| ChEBI | CHEBI:41981 |
| MDL Number | MFCD00044636 |
| SMILES | [2H]O[2H] |
| Synonym | heavy water d2o,water sup 2-h2,deuterium oxide usan,heavy water,water, heavy d2-o,heavy water-d2,water-d2,dideuterium oxide,deuterium oxide,deuterated water |
| IUPAC Name | [(²H)oxy](²H) |
| InChI Key | XLYOFNOQVPJJNP-ZSJDYOACSA-N |
| Molecular Formula | H2O |
N,N-Dimethylformamide, 99.5%, for analysis
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Dichloromethane, 99.8+%, for analysis, stabilized with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
2,5-Dimethyltetrahydrofuran (stabilized with BHT) 98.0+%, TCI America™
CAS: 1003-38-9 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.16 MDL Number: MFCD00005369 InChI Key: OXMIDRBAFOEOQT-UHFFFAOYNA-N Synonym: 2,5-dimethyltetrahydrofuran,furan, tetrahydro-2,5-dimethyl,tetrahydro-2,5-dimethylfuran,2,5-dimethyltetrahydrofuran, mixture of cis and trans,cis-tetrahydro-2,5-dimethylfuran,acmc-1c5fn,2,5-dimethyl-tetrahydrofuran,2,5-dimethyl-tetrahydro-furan,2,5-dimethyltetrahydrofuran,c&t,2,5-dimethyltetrahydrofuran,mixtureofcisandtrans PubChem CID: 13855 IUPAC Name: 2,5-dimethyloxolane SMILES: CC1CCC(C)O1
| PubChem CID | 13855 |
|---|---|
| CAS | 1003-38-9 |
| Molecular Weight (g/mol) | 100.16 |
| MDL Number | MFCD00005369 |
| SMILES | CC1CCC(C)O1 |
| Synonym | 2,5-dimethyltetrahydrofuran,furan, tetrahydro-2,5-dimethyl,tetrahydro-2,5-dimethylfuran,2,5-dimethyltetrahydrofuran, mixture of cis and trans,cis-tetrahydro-2,5-dimethylfuran,acmc-1c5fn,2,5-dimethyl-tetrahydrofuran,2,5-dimethyl-tetrahydro-furan,2,5-dimethyltetrahydrofuran,c&t,2,5-dimethyltetrahydrofuran,mixtureofcisandtrans |
| IUPAC Name | 2,5-dimethyloxolane |
| InChI Key | OXMIDRBAFOEOQT-UHFFFAOYNA-N |
| Molecular Formula | C6H12O |
1,4-Dioxane, anhydrous, 99.8%, stab. with 1-3ppm BHT, packaged under Argon in resealable ChemSeal™ bottles
CAS: 123-91-1 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00006571 InChI Key: RYHBNJHYFVUHQT-UHFFFAOYSA-N Synonym: dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin PubChem CID: 31275 ChEBI: CHEBI:47032 IUPAC Name: 1,4-dioxane SMILES: C1COCCO1
| PubChem CID | 31275 |
|---|---|
| CAS | 123-91-1 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:47032 |
| MDL Number | MFCD00006571 |
| SMILES | C1COCCO1 |
| Synonym | dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin |
| IUPAC Name | 1,4-dioxane |
| InChI Key | RYHBNJHYFVUHQT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Nitrobenzene-d5, for NMR, 99 atom % D
CAS: 4165-60-0 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 128.14 MDL Number: MFCD00044415 InChI Key: LQNUZADURLCDLV-RALIUCGRSA-N Synonym: nitrobenzene-d5,benzene-d5, nitro,nitrobenzene d5,benzene-d5-, nitro,1-nitro 2 h? benzene,nitrobenzene-d5, 99.5 atom % d,nitro 2h5 benzene,1-nitro 2h5 benzene,2h5 benzene, nitro,nitrobenzene-d5, analytical standard PubChem CID: 123210 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-nitrobenzene SMILES: [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])[N+]([O-])=O
| PubChem CID | 123210 |
|---|---|
| CAS | 4165-60-0 |
| Molecular Weight (g/mol) | 128.14 |
| MDL Number | MFCD00044415 |
| SMILES | [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])[N+]([O-])=O |
| Synonym | nitrobenzene-d5,benzene-d5, nitro,nitrobenzene d5,benzene-d5-, nitro,1-nitro 2 h? benzene,nitrobenzene-d5, 99.5 atom % d,nitro 2h5 benzene,1-nitro 2h5 benzene,2h5 benzene, nitro,nitrobenzene-d5, analytical standard |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-nitrobenzene |
| InChI Key | LQNUZADURLCDLV-RALIUCGRSA-N |
| Molecular Formula | C6H5NO2 |