Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Sodium deuteroxide, for NMR, 30 wt% solution in D2O, 99+ atom % D
CAS: 14014-06-3 Molecular Formula: HNaO Molecular Weight (g/mol): 41.003 MDL Number: MFCD00037669 InChI Key: HEMHJVSKTPXQMS-DYCDLGHISA-M Synonym: sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci PubChem CID: 23676750 SMILES: [OH-].[Na+]
| PubChem CID | 23676750 |
|---|---|
| CAS | 14014-06-3 |
| Molecular Weight (g/mol) | 41.003 |
| MDL Number | MFCD00037669 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci |
| InChI Key | HEMHJVSKTPXQMS-DYCDLGHISA-M |
| Molecular Formula | HNaO |
n-Propyl Alcohol AR, Macron Fine Chemicals™
CAS: 71-23-8 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.10 MDL Number: MFCD00002941 InChI Key: BDERNNFJNOPAEC-UHFFFAOYSA-N Synonym: 1-propanol,propanol,propyl alcohol,n-propanol,n-propyl alcohol,ethylcarbinol,1-hydroxypropane,optal,osmosol extra,propylic alcohol PubChem CID: 1031 ChEBI: CHEBI:28831 IUPAC Name: propan-1-ol SMILES: CCCO
| PubChem CID | 1031 |
|---|---|
| CAS | 71-23-8 |
| Molecular Weight (g/mol) | 60.10 |
| ChEBI | CHEBI:28831 |
| MDL Number | MFCD00002941 |
| SMILES | CCCO |
| Synonym | 1-propanol,propanol,propyl alcohol,n-propanol,n-propyl alcohol,ethylcarbinol,1-hydroxypropane,optal,osmosol extra,propylic alcohol |
| IUPAC Name | propan-1-ol |
| InChI Key | BDERNNFJNOPAEC-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
Chlorobenzene-d{5}, 99% (Isotopic), Thermo Scientific Chemicals
CAS: 3114-55-4 Molecular Formula: C6H5Cl Molecular Weight (g/mol): 117.587 MDL Number: MFCD00000531 InChI Key: MVPPADPHJFYWMZ-RALIUCGRSA-N Synonym: chlorobenzene-d5,chloro 2h5 benzene,1-chloro 2 h? benzene,chlorobenzene d5,benzene-d5, chloro,2h5 phenyl chloride,1-chloro 2h5 benzene,benzene-d5-, chloro,chlorobenzene, perdeutero,chlorobenzene-d5, 99 atom % d PubChem CID: 575975 IUPAC Name: 1-chloro-2,3,4,5,6-pentadeuteriobenzene SMILES: C1=CC=C(C=C1)Cl
| PubChem CID | 575975 |
|---|---|
| CAS | 3114-55-4 |
| Molecular Weight (g/mol) | 117.587 |
| MDL Number | MFCD00000531 |
| SMILES | C1=CC=C(C=C1)Cl |
| Synonym | chlorobenzene-d5,chloro 2h5 benzene,1-chloro 2 h? benzene,chlorobenzene d5,benzene-d5, chloro,2h5 phenyl chloride,1-chloro 2h5 benzene,benzene-d5-, chloro,chlorobenzene, perdeutero,chlorobenzene-d5, 99 atom % d |
| IUPAC Name | 1-chloro-2,3,4,5,6-pentadeuteriobenzene |
| InChI Key | MVPPADPHJFYWMZ-RALIUCGRSA-N |
| Molecular Formula | C6H5Cl |
Chloroform-d, for NMR, 99.8% atom D, packaged in 1mL ampoules, Thermo Scientific Chemicals
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Petroleum ether, for analysis, boiling range 60-95°C
CAS: 64742-49-0 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.178 MDL Number: MFCD00081849 InChI Key: AFABGHUZZDYHJO-UHFFFAOYSA-N Synonym: isohexane,pentane, 2-methyl,2-methylpentan,2-methyl pentane,dimethylpropylmethane,1,1-dimethylbutane,iso-hexane,methyl pentane,unii-49ib0u6mld,2-methyl-pentane PubChem CID: 7892 SMILES: CCCC(C)C
| PubChem CID | 7892 |
|---|---|
| CAS | 64742-49-0 |
| Molecular Weight (g/mol) | 86.178 |
| MDL Number | MFCD00081849 |
| SMILES | CCCC(C)C |
| Synonym | isohexane,pentane, 2-methyl,2-methylpentan,2-methyl pentane,dimethylpropylmethane,1,1-dimethylbutane,iso-hexane,methyl pentane,unii-49ib0u6mld,2-methyl-pentane |
| InChI Key | AFABGHUZZDYHJO-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
Tetrachlorobis(tetrahydrofuran)zirconium(IV), Thermo Scientific Chemicals
CAS: 21959-01-3 Molecular Formula: C8H16Cl4O2Zr Molecular Weight (g/mol): 377.238 MDL Number: MFCD00145367 InChI Key: VDJJKYYENYIHFF-UHFFFAOYSA-J Synonym: tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 PubChem CID: 2734040 IUPAC Name: oxolane;tetrachlorozirconium SMILES: C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl
| PubChem CID | 2734040 |
|---|---|
| CAS | 21959-01-3 |
| Molecular Weight (g/mol) | 377.238 |
| MDL Number | MFCD00145367 |
| SMILES | C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl |
| Synonym | tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 |
| IUPAC Name | oxolane;tetrachlorozirconium |
| InChI Key | VDJJKYYENYIHFF-UHFFFAOYSA-J |
| Molecular Formula | C8H16Cl4O2Zr |
Epredia™ Isopropyl Alcohol
Filtered and laboratory tested to ensure a consistent high quality formulation for processing and staining procedures
Diethylene glycol mono-n-butyl ether, 99%
CAS: 112-34-5 Molecular Formula: C8H18O3 MDL Number: MFCD00002881 InChI Key: OAYXUHPQHDHDDZ-UHFFFAOYSA-N Synonym: 2-2-butoxyethoxy ethanol,diethylene glycol monobutyl ether,butyldiglycol,butyl carbitol,diethylene glycol butyl ether,butyl diglycol,butyl digol,ethanol, 2-2-butoxyethoxy,butoxyethoxyethanol,butoxydiglycol PubChem CID: 8177 SMILES: CCCCOCCOCCO
| PubChem CID | 8177 |
|---|---|
| CAS | 112-34-5 |
| MDL Number | MFCD00002881 |
| SMILES | CCCCOCCOCCO |
| Synonym | 2-2-butoxyethoxy ethanol,diethylene glycol monobutyl ether,butyldiglycol,butyl carbitol,diethylene glycol butyl ether,butyl diglycol,butyl digol,ethanol, 2-2-butoxyethoxy,butoxyethoxyethanol,butoxydiglycol |
| InChI Key | OAYXUHPQHDHDDZ-UHFFFAOYSA-N |
| Molecular Formula | C8H18O3 |
Styrene-d8, for NMR, 98+ atom% D, stabilized
CAS: 19361-62-7 Molecular Formula: C8H8 Molecular Weight (g/mol): 112.201 MDL Number: MFCD00044231 InChI Key: PPBRXRYQALVLMV-GDALLCCDSA-N Synonym: styrene-d8,2h8 styrene,perdeuteriostyrene,benzene-d5, ethenyl-d3,1,2,3,4,5-pentadeuterio-6-1,2,2-trideuterioethenyl benzene,benzene-1,2,3,4,5-d5, 6-ethenyl-1,2,2-d3,styrene d8,phenethylene-d8,phenylethene-d8,vinylbenzene-d8 PubChem CID: 88025 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(1,2,2-trideuterioethenyl)benzene SMILES: C=CC1=CC=CC=C1
| PubChem CID | 88025 |
|---|---|
| CAS | 19361-62-7 |
| Molecular Weight (g/mol) | 112.201 |
| MDL Number | MFCD00044231 |
| SMILES | C=CC1=CC=CC=C1 |
| Synonym | styrene-d8,2h8 styrene,perdeuteriostyrene,benzene-d5, ethenyl-d3,1,2,3,4,5-pentadeuterio-6-1,2,2-trideuterioethenyl benzene,benzene-1,2,3,4,5-d5, 6-ethenyl-1,2,2-d3,styrene d8,phenethylene-d8,phenylethene-d8,vinylbenzene-d8 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(1,2,2-trideuterioethenyl)benzene |
| InChI Key | PPBRXRYQALVLMV-GDALLCCDSA-N |
| Molecular Formula | C8H8 |
Acetone-d6, for NMR, packaged in 0.75ml ampoules, 100.0 atom % D
CAS: 666-52-4 Molecular Formula: C3H6O Molecular Weight (g/mol): 64.117 MDL Number: MFCD00044635 InChI Key: CSCPPACGZOOCGX-WFGJKAKNSA-N Synonym: acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone PubChem CID: 522220 ChEBI: CHEBI:78217 IUPAC Name: 1,1,1,3,3,3-hexadeuteriopropan-2-one SMILES: CC(=O)C
| PubChem CID | 522220 |
|---|---|
| CAS | 666-52-4 |
| Molecular Weight (g/mol) | 64.117 |
| ChEBI | CHEBI:78217 |
| MDL Number | MFCD00044635 |
| SMILES | CC(=O)C |
| Synonym | acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone |
| IUPAC Name | 1,1,1,3,3,3-hexadeuteriopropan-2-one |
| InChI Key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Molecular Formula | C3H6O |
Toluene, 99.85%, for HPLC
Greener Choice
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
CAS: 108-88-3 Molecular Formula: C7H8 Molecular Weight (g/mol): 92.14 MDL Number: MFCD00008512 InChI Key: YXFVVABEGXRONW-UHFFFAOYSA-N Synonym: methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene PubChem CID: 1140 ChEBI: CHEBI:17578 IUPAC Name: toluene SMILES: CC1=CC=CC=C1
| PubChem CID | 1140 |
|---|---|
| CAS | 108-88-3 |
| Molecular Weight (g/mol) | 92.14 |
| ChEBI | CHEBI:17578 |
| MDL Number | MFCD00008512 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene |
| IUPAC Name | toluene |
| InChI Key | YXFVVABEGXRONW-UHFFFAOYSA-N |
| Molecular Formula | C7H8 |
Acetonitrile-d3, for NMR, packaged in 1.00 ml ampoules, 99.95 atom % D
CAS: 2206-26-0 Molecular Formula: C2H3N Molecular Weight (g/mol): 44.07 MDL Number: MFCD00001881 InChI Key: WEVYAHXRMPXWCK-FIBGUPNXSA-N Synonym: acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g PubChem CID: 123151 IUPAC Name: 2,2,2-trideuterioacetonitrile SMILES: [2H]C([2H])([2H])C#N
| PubChem CID | 123151 |
|---|---|
| CAS | 2206-26-0 |
| Molecular Weight (g/mol) | 44.07 |
| MDL Number | MFCD00001881 |
| SMILES | [2H]C([2H])([2H])C#N |
| Synonym | acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g |
| IUPAC Name | 2,2,2-trideuterioacetonitrile |
| InChI Key | WEVYAHXRMPXWCK-FIBGUPNXSA-N |
| Molecular Formula | C2H3N |
Acetone, for residue analysis
CAS: 67-64-1 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00008765 InChI Key: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC Name: propan-2-one SMILES: CC(C)=O
| PubChem CID | 180 |
|---|---|
| CAS | 67-64-1 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:15347 |
| MDL Number | MFCD00008765 |
| SMILES | CC(C)=O |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| IUPAC Name | propan-2-one |
| InChI Key | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
n-Hexane, for pesticide residue analysis, approx. 95% n-Hexane
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
Nitromethane-d3, for NMR, 99 atom % D
CAS: 13031-32-8 Molecular Formula: CH3NO2 Molecular Weight (g/mol): 64.06 MDL Number: MFCD00044214 InChI Key: LYGJENNIWJXYER-FIBGUPNXSA-N Synonym: nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms PubChem CID: 123293 IUPAC Name: trideuterio(nitro)methane SMILES: [2H]C([2H])([2H])[N+]([O-])=O
| PubChem CID | 123293 |
|---|---|
| CAS | 13031-32-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00044214 |
| SMILES | [2H]C([2H])([2H])[N+]([O-])=O |
| Synonym | nitromethane-d3,nitro 2h3 methane,nitro 2 h? methane,nitromethane-d3, 99 atom % d,methane-d3, nitro,cd3no2,trideuteronitromethane,methane-d3-, nitro,nitromethane-d3, ≥99 atom % d, contains 1 % v/v tms |
| IUPAC Name | trideuterio(nitro)methane |
| InChI Key | LYGJENNIWJXYER-FIBGUPNXSA-N |
| Molecular Formula | CH3NO2 |