Organic Acids
![eMolecules 2248271-56-7 | 4-{[(tert-butoxy)carbonyl]amino}-2-chloro-6-fluorobenzoic acid | Synthonix289.690 | C12H13ClFNO4 | 98.000 | CC(C)(C)OC(=O)Nc1cc(F)c(C(O)=O)c(Cl)c1 | 10mg | 794075932](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477998.JPG-250.jpg)
eMolecules 2248271-56-7 | 4-{[(tert-butoxy)carbonyl]amino}-2-chloro-6-fluorobenzoic acid | Synthonix289.690 | C12H13ClFNO4 | 98.000 | CC(C)(C)OC(=O)Nc1cc(F)c(C(O)=O)c(Cl)c1 | 10mg | 794075932
4-{[(tert-butoxy)carbonyl]amino}-2-chloro-6-fluorobenzoic acid | Synthonix | 2248271-56-7289.690 | C12H13ClFNO4 | 98.000 | CC(C)(C)OC(=O)Nc1cc(F)c(C(O)=O)c(Cl)c1 | 10mg | 794075932
Apexbio Technology LLC SCH772984 TFA 942183-80-4 (free base) 5mg
SCH772984 TFA is a small-molecule inhibitor targeting extracellular signal-regulated kinase 1/2 (ERK1/2) It is designed to inhibit ERK catalytic activity thereby blocking phosphorylation of downstream substrates and regulating the RAS-RAF-MEK-ERK signaling pathway SCH772984 TFA exerts its biological activity primarily through direct interaction with ERK1/2 acting as an ATP-competitive inhibitor Based on these pharmacological properties SCH772984 TFA holds research potential in studies examining ERK signaling s role in oncogenic pathway activation tumor cell growth survival mechanisms and resistance phenomena in various cancer models
C(O)=O | 25mg | 714102585](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502474869.JPG-250.jpg)
eMolecules 1647201-26-0 | (R)-2-Butyloctanoic acid | ChemScene200.322 | C12H24O2 | 98.000 | CCCCCC[C@@H](CCCC)C(O)=O | 25mg | 714102585
(R)-2-Butyloctanoic acid | ChemScene | 1647201-26-0200.322 | C12H24O2 | 98.000 | CCCCCC[C@@H](CCCC)C(O)=O | 25mg | 714102585
![eMolecules N-(Acid-PEG8)-N-bis(PEG8-Azide) | Broadpharm |1284.500 | C55H109N7O26 | 95.000 | OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] | 100mg | 795361833](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477867.JPG-250.jpg)
eMolecules N-(Acid-PEG8)-N-bis(PEG8-Azide) | Broadpharm |1284.500 | C55H109N7O26 | 95.000 | OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] | 100mg | 795361833
N-(Acid-PEG8)-N-bis(PEG8-Azide) | Broadpharm |1284.500 | C55H109N7O26 | 95.000 | OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] | 100mg | 795361833
![eMolecules 93012-48-7 | 3-[2-(benzyloxy)phenyl]-2-oxopropanoic acid | Synthonix270.284 | C16H14O4 | 90.000 | OC(=O)C(=O)Cc1ccccc1OCc1ccccc1 | 250mg | 794076327](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477930.JPG-250.jpg)
eMolecules 93012-48-7 | 3-[2-(benzyloxy)phenyl]-2-oxopropanoic acid | Synthonix270.284 | C16H14O4 | 90.000 | OC(=O)C(=O)Cc1ccccc1OCc1ccccc1 | 250mg | 794076327
3-[2-(benzyloxy)phenyl]-2-oxopropanoic acid | Synthonix | 93012-48-7270.284 | C16H14O4 | 90.000 | OC(=O)C(=O)Cc1ccccc1OCc1ccccc1 | 250mg | 794076327
amino}pyridine-3-carboxylic acid | Synthonix320.268 | C13H15F3N2O4 | 95.000 | CC(C)(C)OC(=O)N(CC(F)(F)F)c1ccc(cn1)C(O)=O | 250mg | 784552967](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478315.JPG-250.jpg)
eMolecules 2639411-93-9 | 6-{[(tert-butoxy)carbonyl](2,2,2-trifluoroethyl)amino}pyridine-3-carboxylic acid | Synthonix320.268 | C13H15F3N2O4 | 95.000 | CC(C)(C)OC(=O)N(CC(F)(F)F)c1ccc(cn1)C(O)=O | 250mg | 784552967
6-{[(tert-butoxy)carbonyl](2,2,2-trifluoroethyl)amino}pyridine-3-carboxylic acid | Synthonix | 2639411-93-9320.268 | C13H15F3N2O4 | 95.000 | CC(C)(C)OC(=O)N(CC(F)(F)F)c1ccc(cn1)C(O)=O | 250mg | 784552967
CCOCCOCCOCCOCCNC(=O)OC1CCC\C=C\CC1)C(=O)N[C@@H](CCCNC(N)=O)C(O)=O | 10mg | 798870868](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477831.JPG-250.jpg)
eMolecules TCO-PEG4-Val-Cit | Broadpharm |673.805 | C31H55N5O11 | 95.000 | CC(C)[C@H](NC(=O)CCOCCOCCOCCOCCNC(=O)OC1CCC\C=C\CC1)C(=O)N[C@@H](CCCNC(N)=O)C(O)=O | 10mg | 798870868
TCO-PEG4-Val-Cit | Broadpharm |673.805 | C31H55N5O11 | 95.000 | CC(C)[C@H](NC(=O)CCOCCOCCOCCOCCNC(=O)OC1CCC\C=C\CC1)C(=O)N[C@@H](CCCNC(N)=O)C(O)=O | 10mg | 798870868
eMolecules 1287670-30-7 | 2-(2-((tert-butoxycarbonyl)(2,2,2-trifluoroethyl)amino)pyridin-4-yl)oxazole-4-carboxylic acid | Synthonix387.315 | C16H16F3N3O5 | 98.000 | CC(C)(C)OC(=O)N(CC(F)(F)F)c1cc(ccn1)-c1nc(co1)C(O)=O | 250mg | 794075712
2-(2-((tert-butoxycarbonyl)(2,2,2-trifluoroethyl)amino)pyridin-4-yl)oxazole-4-carboxylic acid | Synthonix | 1287670-30-7387.315 | C16H16F3N3O5 | 98.000 | CC(C)(C)OC(=O)N(CC(F)(F)F)c1cc(ccn1)-c1nc(co1)C(O)=O | 250mg | 794075712
![eMolecules 699-49-0 | rel-(1R,2S)-1,2-Dimethyl-1,2-cyclopropanedicarboxylic acid | Synthonix | MFCD03413472 | 158.153 | C7H10O4 | 90.000 | C[C@@]1(C[C@@]1(C)C(O)=O)C(O)=O | 250mg | 779537460](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478584.JPG-250.jpg)
eMolecules 699-49-0 | rel-(1R,2S)-1,2-Dimethyl-1,2-cyclopropanedicarboxylic acid | Synthonix | MFCD03413472 | 158.153 | C7H10O4 | 90.000 | C[C@@]1(C[C@@]1(C)C(O)=O)C(O)=O | 250mg | 779537460
rel-(1R,2S)-1,2-Dimethyl-1,2-cyclopropanedicarboxylic acid | Synthonix | 699-49-0 | MFCD03413472 | 158.153 | C7H10O4 | 90.000 | C[C@@]1(C[C@@]1(C)C(O)=O)C(O)=O | 250mg | 779537460
![eMolecules 19038-19-8 | (R)-4-((5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxohexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid | Synthonix374.565 | C24H38O3 | 98.000 | C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C | 250mg | 779536969](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478619.JPG-250.jpg)
eMolecules 19038-19-8 | (R)-4-((5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxohexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid | Synthonix374.565 | C24H38O3 | 98.000 | C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C | 250mg | 779536969
(R)-4-((5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxohexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid | Synthonix | 19038-19-8374.565 | C24H38O3 | 98.000 | C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C | 250mg | 779536969
eMolecules 1416473-21-6 | 2-methyl-5-(1-methylcyclopropyl)pyrazole-3-carboxylic acid | Synthonix | MFCD24503272 | 180.207 | C9H12N2O2 | 98.000 | Cn1nc(cc1C(O)=O)C1(C)CC1 | 25mg | 786491462
2-methyl-5-(1-methylcyclopropyl)pyrazole-3-carboxylic acid | Synthonix | 1416473-21-6 | MFCD24503272 | 180.207 | C9H12N2O2 | 98.000 | Cn1nc(cc1C(O)=O)C1(C)CC1 | 25mg | 786491462
eMolecules 4942-47-6 | 1-Adamantaneacetic acid | Ambeed194.274 | C12H18O2 | 98.000 | OC(=O)CC12CC3CC(CC(C3)C1)C2 | 1g | 490509199
1-Adamantaneacetic acid | Ambeed | 4942-47-6194.274 | C12H18O2 | 98.000 | OC(=O)CC12CC3CC(CC(C3)C1)C2 | 1g | 490509199
eMolecules 1384966-55-5 | Ambeed | Di(adamantan-1-yl)(2-((triisopropylsilyl)oxy)phenyl)phosphine | 100mg | 672837994 | A1168687 | 550.883 | C35H55OPSi
Ambeed | 4-(2H-123-Triazol-2-yl)benzaldehyde | 250mg | 525039419 | A133650 | 179056-04-3 | MFCD08669904 | 173.175 | C9H7N3O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Selleck Chemical LLC Salicylic acid S4539-100mg
Salicylic acid (2-Hydroxybenzoic acid) is a beta hydroxy acid that occurs as a natural compound in plants which is an inhibitor of ethylene biosynthesis and cyclooxygenase activity Salicylic acid can be used to induce animal models of Gastric and Intestinal Ulcers
eMolecules 19146-55-5 | Ambeed | Ac-D-Glu-OH | 100g | 491675237 | A607464 | MFCD00063196 | 189.167 | C7H11NO5
Ambeed | 22-(99-Dioctyl-9H-fluorene-27-diyl)bis(132-dioxaborinane) | 250mg | 598443842 | A474547 | 317802-08-7 | MFCD03701607 | 558.420 | C35H52B2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool