Benzenoids
Filtered Search Results
(R)-(-)-alpha-Methoxyphenylacetic acid, 99%
CAS: 3966-32-3 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00004250 InChI Key: DIWVBIXQCNRCFE-MRVPVSSYSA-N Synonym: r---alpha-methoxyphenylacetic acid,r-2-methoxy-2-phenylacetic acid,2r-2-methoxy-2-phenylacetic acid,r-methoxyphenylacetic acid,r-methoxy phenyl acetic acid,methoxy phenyl acetic acid #,r---.alpha.-methoxyphenylacetic acid,benzeneacetic acid, .alpha.-methoxy-, r,o-methyl-d-mandelic acid,ksc496q9j PubChem CID: 2724294 IUPAC Name: (2R)-2-methoxy-2-phenylacetic acid SMILES: COC(C1=CC=CC=C1)C(=O)O
| PubChem CID | 2724294 |
|---|---|
| CAS | 3966-32-3 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00004250 |
| SMILES | COC(C1=CC=CC=C1)C(=O)O |
| Synonym | r---alpha-methoxyphenylacetic acid,r-2-methoxy-2-phenylacetic acid,2r-2-methoxy-2-phenylacetic acid,r-methoxyphenylacetic acid,r-methoxy phenyl acetic acid,methoxy phenyl acetic acid #,r---.alpha.-methoxyphenylacetic acid,benzeneacetic acid, .alpha.-methoxy-, r,o-methyl-d-mandelic acid,ksc496q9j |
| IUPAC Name | (2R)-2-methoxy-2-phenylacetic acid |
| InChI Key | DIWVBIXQCNRCFE-MRVPVSSYSA-N |
| Molecular Formula | C9H10O3 |
Salicylamide, 99%
CAS: 65-45-2 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.14 MDL Number: MFCD00007978 InChI Key: SKZKKFZAGNVIMN-UHFFFAOYSA-N Synonym: salicylamide,o-hydroxybenzamide,benzamide, 2-hydroxy,salicylic acid amide,2-carbamoylphenol,flarpirina,morsarinas,algamon,algiamida,allevin PubChem CID: 5147 ChEBI: CHEBI:32114 IUPAC Name: 2-hydroxybenzamide SMILES: NC(=O)C1=CC=CC=C1O
| PubChem CID | 5147 |
|---|---|
| CAS | 65-45-2 |
| Molecular Weight (g/mol) | 137.14 |
| ChEBI | CHEBI:32114 |
| MDL Number | MFCD00007978 |
| SMILES | NC(=O)C1=CC=CC=C1O |
| Synonym | salicylamide,o-hydroxybenzamide,benzamide, 2-hydroxy,salicylic acid amide,2-carbamoylphenol,flarpirina,morsarinas,algamon,algiamida,allevin |
| IUPAC Name | 2-hydroxybenzamide |
| InChI Key | SKZKKFZAGNVIMN-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
2-Fluoro-6-(trifluoromethyl)benzaldehyde, 98%, Thermo Scientific™
CAS: 60611-24-7 Molecular Formula: C8H4F4O Molecular Weight (g/mol): 192.11 MDL Number: MFCD00061273 InChI Key: FAKUGVHRTLCKHB-UHFFFAOYSA-N Synonym: 2-fluoro-6-trifluoromethyl benzaldehyde,benzaldehyde, 2-fluoro-6-trifluoromethyl,alpha,alpha,alpha,6-tetrafluoro-o-tolualdehyde,pubchem4236,2-fluoro-6-trifluoromethyl-benzaldehyde,acmc-1b5by,otf-bad-6f,3-fluoro-2-formylbenzotrifluoride,attercop-chm at111495 PubChem CID: 521933 IUPAC Name: 2-fluoro-6-(trifluoromethyl)benzaldehyde SMILES: FC1=CC=CC(=C1C=O)C(F)(F)F
| PubChem CID | 521933 |
|---|---|
| CAS | 60611-24-7 |
| Molecular Weight (g/mol) | 192.11 |
| MDL Number | MFCD00061273 |
| SMILES | FC1=CC=CC(=C1C=O)C(F)(F)F |
| Synonym | 2-fluoro-6-trifluoromethyl benzaldehyde,benzaldehyde, 2-fluoro-6-trifluoromethyl,alpha,alpha,alpha,6-tetrafluoro-o-tolualdehyde,pubchem4236,2-fluoro-6-trifluoromethyl-benzaldehyde,acmc-1b5by,otf-bad-6f,3-fluoro-2-formylbenzotrifluoride,attercop-chm at111495 |
| IUPAC Name | 2-fluoro-6-(trifluoromethyl)benzaldehyde |
| InChI Key | FAKUGVHRTLCKHB-UHFFFAOYSA-N |
| Molecular Formula | C8H4F4O |
3,5-Bis(trifluoromethyl)bromobenzene, 99%
CAS: 328-70-1 Molecular Formula: C8H3BrF6 Molecular Weight (g/mol): 293.01 InChI Key: CSVCVIHEBDJTCJ-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl bromobenzene,1-bromo-3,5-bis trifluoromethyl benzene,1,3-bis trifluoromethyl-5-bromobenzene,mbt-br,3,5-di trifluoromethyl bromobenzene,3,5-bis trifluoromethyl-1-bromobenzene,3,5-bis-trifluoromethylbromobenzene,benzene, 1-bromo-3,5-bis trifluoromethyl,3,5-bis trifluoromethyl phenyl bromide,1-bromo-3,5-bis-trifluoromethyl-benzene PubChem CID: 67602 IUPAC Name: 1-bromo-3,5-bis(trifluoromethyl)benzene SMILES: C1=C(C=C(C=C1C(F)(F)F)Br)C(F)(F)F
| PubChem CID | 67602 |
|---|---|
| CAS | 328-70-1 |
| Molecular Weight (g/mol) | 293.01 |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Br)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl bromobenzene,1-bromo-3,5-bis trifluoromethyl benzene,1,3-bis trifluoromethyl-5-bromobenzene,mbt-br,3,5-di trifluoromethyl bromobenzene,3,5-bis trifluoromethyl-1-bromobenzene,3,5-bis-trifluoromethylbromobenzene,benzene, 1-bromo-3,5-bis trifluoromethyl,3,5-bis trifluoromethyl phenyl bromide,1-bromo-3,5-bis-trifluoromethyl-benzene |
| IUPAC Name | 1-bromo-3,5-bis(trifluoromethyl)benzene |
| InChI Key | CSVCVIHEBDJTCJ-UHFFFAOYSA-N |
| Molecular Formula | C8H3BrF6 |
2-Bromo-4-(trifluoromethyl)phenol, 98%
CAS: 81107-97-3 Molecular Formula: C7H4BrF3O Molecular Weight (g/mol): 241.007 MDL Number: MFCD06657954 InChI Key: DTEDKIRYMYDIGO-UHFFFAOYSA-N PubChem CID: 2761168 IUPAC Name: 2-bromo-4-(trifluoromethyl)phenol SMILES: C1=CC(=C(C=C1C(F)(F)F)Br)O
| PubChem CID | 2761168 |
|---|---|
| CAS | 81107-97-3 |
| Molecular Weight (g/mol) | 241.007 |
| MDL Number | MFCD06657954 |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)O |
| IUPAC Name | 2-bromo-4-(trifluoromethyl)phenol |
| InChI Key | DTEDKIRYMYDIGO-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrF3O |
4-Chloro-2-(trifluoromethyl)phenyl isocyanate, 97%
CAS: 16588-69-5 Molecular Formula: C8H3ClF3NO Molecular Weight (g/mol): 221.56 MDL Number: MFCD00013873 InChI Key: SBDPJLJFODHSFF-UHFFFAOYSA-N Synonym: 4-chloro-2-trifluoromethyl phenyl isocyanate,4-chloro-1-isocyanato-2-trifluoromethyl benzene,4-chloro-2-trifluoromethyl phenylisocyanate,5-chloro-2-isocyanatobenzotrifluoride,timtec-bb sbb006655,4-chloro-2-trifluoromethyl benzenisocyanate,pubchem4450,acmc-1c7bp,4-chloro-2-trifluoromethylphenyl isocyanate,4-chloro-2-trifluoromethyl-isocyanatobenzene PubChem CID: 2733264 IUPAC Name: 4-chloro-1-isocyanato-2-(trifluoromethyl)benzene SMILES: FC(F)(F)C1=C(C=CC(Cl)=C1)N=C=O
| PubChem CID | 2733264 |
|---|---|
| CAS | 16588-69-5 |
| Molecular Weight (g/mol) | 221.56 |
| MDL Number | MFCD00013873 |
| SMILES | FC(F)(F)C1=C(C=CC(Cl)=C1)N=C=O |
| Synonym | 4-chloro-2-trifluoromethyl phenyl isocyanate,4-chloro-1-isocyanato-2-trifluoromethyl benzene,4-chloro-2-trifluoromethyl phenylisocyanate,5-chloro-2-isocyanatobenzotrifluoride,timtec-bb sbb006655,4-chloro-2-trifluoromethyl benzenisocyanate,pubchem4450,acmc-1c7bp,4-chloro-2-trifluoromethylphenyl isocyanate,4-chloro-2-trifluoromethyl-isocyanatobenzene |
| IUPAC Name | 4-chloro-1-isocyanato-2-(trifluoromethyl)benzene |
| InChI Key | SBDPJLJFODHSFF-UHFFFAOYSA-N |
| Molecular Formula | C8H3ClF3NO |
Chlorobis[4-(trifluoromethyl)phenyl]phosphine, 97%
CAS: 13685-24-0 Molecular Formula: C14H8ClF6P Molecular Weight (g/mol): 356.632 MDL Number: MFCD04972304 InChI Key: PBLUOOURLNAOAJ-UHFFFAOYSA-N Synonym: bis 4-trifluoromethylphenyl chlorophosphine,chlorobis 4-trifluoromethyl phenyl phosphine,bis 4-trifluoromethyl phenyl chlorophosphine,chlorobis 4-trifluoromethyl phenyl phosphane,acmc-20alnb,chloro-bis 4-trifluoromethyl phenyl phosphane PubChem CID: 4379933 IUPAC Name: chloro-bis[4-(trifluoromethyl)phenyl]phosphane SMILES: C1=CC(=CC=C1C(F)(F)F)P(C2=CC=C(C=C2)C(F)(F)F)Cl
| PubChem CID | 4379933 |
|---|---|
| CAS | 13685-24-0 |
| Molecular Weight (g/mol) | 356.632 |
| MDL Number | MFCD04972304 |
| SMILES | C1=CC(=CC=C1C(F)(F)F)P(C2=CC=C(C=C2)C(F)(F)F)Cl |
| Synonym | bis 4-trifluoromethylphenyl chlorophosphine,chlorobis 4-trifluoromethyl phenyl phosphine,bis 4-trifluoromethyl phenyl chlorophosphine,chlorobis 4-trifluoromethyl phenyl phosphane,acmc-20alnb,chloro-bis 4-trifluoromethyl phenyl phosphane |
| IUPAC Name | chloro-bis[4-(trifluoromethyl)phenyl]phosphane |
| InChI Key | PBLUOOURLNAOAJ-UHFFFAOYSA-N |
| Molecular Formula | C14H8ClF6P |
2,4-Bis(trifluoromethyl)benzoic acid, 98%, Thermo Scientific™
CAS: 32890-87-2 Molecular Formula: C9H4F6O2 Molecular Weight (g/mol): 258.12 MDL Number: MFCD00042496 InChI Key: JTOIZLCQNWWDCN-UHFFFAOYSA-N Synonym: 2,4-bis trifluoromethyl benzoic acid,2,4-bis-trifluoromethylbenzoic acid,2,4-di trifluoromethyl benzoic acid,benzoic acid, 2,4-bis trifluoromethyl,2,4-bis-trifluoromethyl-benzoic acid,maybridge4_003283,acmc-20aoeb,pubchem8491,rarechem al bo 0512 PubChem CID: 141752 IUPAC Name: 2,4-bis(trifluoromethyl)benzoic acid SMILES: C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O
| PubChem CID | 141752 |
|---|---|
| CAS | 32890-87-2 |
| Molecular Weight (g/mol) | 258.12 |
| MDL Number | MFCD00042496 |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O |
| Synonym | 2,4-bis trifluoromethyl benzoic acid,2,4-bis-trifluoromethylbenzoic acid,2,4-di trifluoromethyl benzoic acid,benzoic acid, 2,4-bis trifluoromethyl,2,4-bis-trifluoromethyl-benzoic acid,maybridge4_003283,acmc-20aoeb,pubchem8491,rarechem al bo 0512 |
| IUPAC Name | 2,4-bis(trifluoromethyl)benzoic acid |
| InChI Key | JTOIZLCQNWWDCN-UHFFFAOYSA-N |
| Molecular Formula | C9H4F6O2 |
3,5-Bis(trifluoromethyl)benzeneboronic acid, 97+%
CAS: 73852-19-4 Molecular Formula: C8H5BF6O2 Molecular Weight (g/mol): 257.93 MDL Number: MFCD00051850 InChI Key: BPTABBGLHGBJQR-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenylboronic acid,3,5-bis trifluoromethyl benzeneboronic acid,3,5-bis trifluoromethyl phenyl boronic acid,3,5-bis-trifluoromethylphenylboronic acid,3,5-bis trifluoromethylphenyl boronic acid,3,5-bis trifluoromethyl phenylboroic acid,btfpba,3,5-bis trifluoromethyl phenyl boranediol PubChem CID: 156265 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]boronic acid SMILES: OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 156265 |
|---|---|
| CAS | 73852-19-4 |
| Molecular Weight (g/mol) | 257.93 |
| MDL Number | MFCD00051850 |
| SMILES | OB(O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl phenylboronic acid,3,5-bis trifluoromethyl benzeneboronic acid,3,5-bis trifluoromethyl phenyl boronic acid,3,5-bis-trifluoromethylphenylboronic acid,3,5-bis trifluoromethylphenyl boronic acid,3,5-bis trifluoromethyl phenylboroic acid,btfpba,3,5-bis trifluoromethyl phenyl boranediol |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]boronic acid |
| InChI Key | BPTABBGLHGBJQR-UHFFFAOYSA-N |
| Molecular Formula | C8H5BF6O2 |
Methyl 2-amino-5-(trifluoromethyl)benzoate, 98%
CAS: 117324-58-0 Molecular Formula: C9H8F3NO2 Molecular Weight (g/mol): 219.163 MDL Number: MFCD08234902 InChI Key: QGFUDNJZHZNPCS-UHFFFAOYSA-N PubChem CID: 14233808 IUPAC Name: methyl 2-amino-5-(trifluoromethyl)benzoate SMILES: COC(=O)C1=C(C=CC(=C1)C(F)(F)F)N
| PubChem CID | 14233808 |
|---|---|
| CAS | 117324-58-0 |
| Molecular Weight (g/mol) | 219.163 |
| MDL Number | MFCD08234902 |
| SMILES | COC(=O)C1=C(C=CC(=C1)C(F)(F)F)N |
| IUPAC Name | methyl 2-amino-5-(trifluoromethyl)benzoate |
| InChI Key | QGFUDNJZHZNPCS-UHFFFAOYSA-N |
| Molecular Formula | C9H8F3NO2 |
Sulfanilic Acid, Anhydrous, ACS, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 121-57-3 Molecular Formula: C6H7NO3S Molecular Weight (g/mol): 173.19 InChI Key: HVBSAKJJOYLTQU-UHFFFAOYSA-N IUPAC Name: 4-aminobenzene-1-sulfonic acid SMILES: NC1=CC=C(C=C1)S(O)(=O)=O
| CAS | 121-57-3 |
|---|---|
| Molecular Weight (g/mol) | 173.19 |
| SMILES | NC1=CC=C(C=C1)S(O)(=O)=O |
| IUPAC Name | 4-aminobenzene-1-sulfonic acid |
| InChI Key | HVBSAKJJOYLTQU-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO3S |
3-(Methylthio)benzoic acid, 97%
CAS: 825-99-0 Molecular Formula: C8H8O2S Molecular Weight (g/mol): 168.21 MDL Number: MFCD00156993 InChI Key: PZGADOOBMVLBJE-UHFFFAOYSA-N Synonym: 3-methylthio benzoic acid,3-methylsulfanyl benzoic acid,benzoic acid, 3-methylthio,benzoic acid, m-methylthio,3-mercaptobenzoic acid s-methyl ether,3-methylsulfanyl-benzoic acid,3-carboxythioanisole,pubchem10679 PubChem CID: 220329 IUPAC Name: 3-methylsulfanylbenzoic acid SMILES: CSC1=CC=CC(=C1)C(=O)O
| PubChem CID | 220329 |
|---|---|
| CAS | 825-99-0 |
| Molecular Weight (g/mol) | 168.21 |
| MDL Number | MFCD00156993 |
| SMILES | CSC1=CC=CC(=C1)C(=O)O |
| Synonym | 3-methylthio benzoic acid,3-methylsulfanyl benzoic acid,benzoic acid, 3-methylthio,benzoic acid, m-methylthio,3-mercaptobenzoic acid s-methyl ether,3-methylsulfanyl-benzoic acid,3-carboxythioanisole,pubchem10679 |
| IUPAC Name | 3-methylsulfanylbenzoic acid |
| InChI Key | PZGADOOBMVLBJE-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2S |
4-(Dimethylamino)benzaldehyde, MilliporeSigma™
CAS: 100-10-7 Molecular Formula: C9H11NO Molecular Weight (g/mol): 149.19 MDL Number: MFCD00003381 InChI Key: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
| PubChem CID | 7479 |
|---|---|
| CAS | 100-10-7 |
| Molecular Weight (g/mol) | 149.19 |
| MDL Number | MFCD00003381 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| IUPAC Name | 4-(dimethylamino)benzaldehyde |
| InChI Key | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO |
5-Bromo-2,4-dihydroxybenzoic acid, 97%
CAS: 7355-22-8 Molecular Formula: C7H5BrO4 Molecular Weight (g/mol): 233.02 MDL Number: MFCD00002452 InChI Key: ZRBCISXJLHZOMS-UHFFFAOYSA-N Synonym: benzoic acid, 5-bromo-2,4-dihydroxy,5-bromo-beta-resorcylic acid,2,4-dihydroxy-5-bromobenzoic acid,5-bromo-.beta.-resorcylic acid,.beta.-resorcylic acid, 5-bromo,5-bromo-2,4-dihydroxy-benzoic acid,beta-resorcylic acid, 5-bromo,5-bromo-2,4-dihydroxy-benzoicacid,5-bromo-2,4-dihydroxybenzoicacid,5-bromo-b-resorcylic acid PubChem CID: 81814 IUPAC Name: 5-bromo-2,4-dihydroxybenzoic acid SMILES: OC(=O)C1=CC(Br)=C(O)C=C1O
| PubChem CID | 81814 |
|---|---|
| CAS | 7355-22-8 |
| Molecular Weight (g/mol) | 233.02 |
| MDL Number | MFCD00002452 |
| SMILES | OC(=O)C1=CC(Br)=C(O)C=C1O |
| Synonym | benzoic acid, 5-bromo-2,4-dihydroxy,5-bromo-beta-resorcylic acid,2,4-dihydroxy-5-bromobenzoic acid,5-bromo-.beta.-resorcylic acid,.beta.-resorcylic acid, 5-bromo,5-bromo-2,4-dihydroxy-benzoic acid,beta-resorcylic acid, 5-bromo,5-bromo-2,4-dihydroxy-benzoicacid,5-bromo-2,4-dihydroxybenzoicacid,5-bromo-b-resorcylic acid |
| IUPAC Name | 5-bromo-2,4-dihydroxybenzoic acid |
| InChI Key | ZRBCISXJLHZOMS-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrO4 |
3,4-Dinitrobenzoic acid, 98+%
CAS: 528-45-0 Molecular Formula: C7H4N2O6 Molecular Weight (g/mol): 212.12 MDL Number: MFCD00007255 InChI Key: OMVRRHJJQILIJX-UHFFFAOYSA-N Synonym: 3,4-dinitrobenzoic acid,benzoic acid, 3,4-dinitro,unii-0l3n4t0gpd,ccris 3128,3,4-dinitrobenzioc acid,0l3n4t0gpd,3,4-dinitrobenzoate,3,4-di-nitro-benzoic acid,zlchem 522,pubchem4956 PubChem CID: 10709 IUPAC Name: 3,4-dinitrobenzoic acid SMILES: OC(=O)C1=CC=C(C(=C1)[N+]([O-])=O)[N+]([O-])=O
| PubChem CID | 10709 |
|---|---|
| CAS | 528-45-0 |
| Molecular Weight (g/mol) | 212.12 |
| MDL Number | MFCD00007255 |
| SMILES | OC(=O)C1=CC=C(C(=C1)[N+]([O-])=O)[N+]([O-])=O |
| Synonym | 3,4-dinitrobenzoic acid,benzoic acid, 3,4-dinitro,unii-0l3n4t0gpd,ccris 3128,3,4-dinitrobenzioc acid,0l3n4t0gpd,3,4-dinitrobenzoate,3,4-di-nitro-benzoic acid,zlchem 522,pubchem4956 |
| IUPAC Name | 3,4-dinitrobenzoic acid |
| InChI Key | OMVRRHJJQILIJX-UHFFFAOYSA-N |
| Molecular Formula | C7H4N2O6 |