Organic acids and derivatives
Filtered Search Results
alpha-Ketoglutaric acid disodium salt dihydrate, 99%
CAS: 305-72-6 Molecular Formula: C5H4Na2O5 Molecular Weight (g/mol): 190.062 MDL Number: MFCD00150702 InChI Key: YBGBJYVHJTVUSL-UHFFFAOYSA-L Synonym: disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate PubChem CID: 31040 IUPAC Name: disodium;2-oxopentanedioate SMILES: C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 31040 |
|---|---|
| CAS | 305-72-6 |
| Molecular Weight (g/mol) | 190.062 |
| MDL Number | MFCD00150702 |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate |
| IUPAC Name | disodium;2-oxopentanedioate |
| InChI Key | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| Molecular Formula | C5H4Na2O5 |
Sodium L-(+)-tartrate dihydrate, 99%
CAS: 6106-24-7 Molecular Formula: C4H8Na2O8 Molecular Weight (g/mol): 230.08 MDL Number: MFCD00150035 InChI Key: FGJLAJMGHXGFDE-UDMGOBQRNA-L Synonym: unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi PubChem CID: 131855972 IUPAC Name: (2R,3R)-2,3-dihydroxybutanedioic acid;sodium;dihydrate SMILES: O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O
| PubChem CID | 131855972 |
|---|---|
| CAS | 6106-24-7 |
| Molecular Weight (g/mol) | 230.08 |
| MDL Number | MFCD00150035 |
| SMILES | O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| Synonym | unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;sodium;dihydrate |
| InChI Key | FGJLAJMGHXGFDE-UDMGOBQRNA-L |
| Molecular Formula | C4H8Na2O8 |
Sodium oxalate, 99%
CAS: 62-76-0 Molecular Formula: C2Na2O4 Molecular Weight (g/mol): 134.00 MDL Number: MFCD00012465 InChI Key: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC Name: disodium;oxalate SMILES: [Na+].[Na+].[O-]C(=O)C([O-])=O
| PubChem CID | 6125 |
|---|---|
| CAS | 62-76-0 |
| Molecular Weight (g/mol) | 134.00 |
| MDL Number | MFCD00012465 |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| IUPAC Name | disodium;oxalate |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molecular Formula | C2Na2O4 |
2-Ethylhexanoic acid, 99%
CAS: 149-57-5 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.214 MDL Number: MFCD00002675 InChI Key: OBETXYAYXDNJHR-UHFFFAOYSA-N Synonym: 2-ethylcaproic acid,hexanoic acid, 2-ethyl,ethylhexanoic acid,ethylhexoic acid,2-ethylhexoic acid,butylethylacetic acid,2-butylbutanoic acid,3-heptanecarboxylic acid,ethyl hexanoic acid,2-ethyl-hexoic acid PubChem CID: 8697 IUPAC Name: 2-ethylhexanoic acid SMILES: CCCCC(CC)C(=O)O
| PubChem CID | 8697 |
|---|---|
| CAS | 149-57-5 |
| Molecular Weight (g/mol) | 144.214 |
| MDL Number | MFCD00002675 |
| SMILES | CCCCC(CC)C(=O)O |
| Synonym | 2-ethylcaproic acid,hexanoic acid, 2-ethyl,ethylhexanoic acid,ethylhexoic acid,2-ethylhexoic acid,butylethylacetic acid,2-butylbutanoic acid,3-heptanecarboxylic acid,ethyl hexanoic acid,2-ethyl-hexoic acid |
| IUPAC Name | 2-ethylhexanoic acid |
| InChI Key | OBETXYAYXDNJHR-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
Ethyl tiglate, 98%
CAS: 5837-78-5 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00015183 InChI Key: OAPHLAAOJMTMLY-GQCTYLIASA-N Synonym: ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate PubChem CID: 5281163 ChEBI: CHEBI:4892 IUPAC Name: ethyl (E)-2-methylbut-2-enoate SMILES: CCOC(=O)C(=CC)C
| PubChem CID | 5281163 |
|---|---|
| CAS | 5837-78-5 |
| Molecular Weight (g/mol) | 128.171 |
| ChEBI | CHEBI:4892 |
| MDL Number | MFCD00015183 |
| SMILES | CCOC(=O)C(=CC)C |
| Synonym | ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate |
| IUPAC Name | ethyl (E)-2-methylbut-2-enoate |
| InChI Key | OAPHLAAOJMTMLY-GQCTYLIASA-N |
| Molecular Formula | C7H12O2 |
Tris(2-carboxyethyl)phosphine hydrochloride, 95%, 0.5M soln. in water
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
2,2,3,3,3-Pentafluoropropyl methacrylate, 97%, stab.
CAS: 45115-53-5 Molecular Formula: C7H7F5O2 Molecular Weight (g/mol): 218.123 MDL Number: MFCD00039256 InChI Key: CLISWDZSTWQFNX-UHFFFAOYSA-N Synonym: 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 123516 IUPAC Name: 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(F)(F)F)(F)F
| PubChem CID | 123516 |
|---|---|
| CAS | 45115-53-5 |
| Molecular Weight (g/mol) | 218.123 |
| MDL Number | MFCD00039256 |
| SMILES | CC(=C)C(=O)OCC(C(F)(F)F)(F)F |
| Synonym | 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate |
| InChI Key | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| Molecular Formula | C7H7F5O2 |
Isopentyl butyrate, 98%
CAS: 106-27-4 Molecular Formula: C9H18O2 Molecular Weight (g/mol): 158.24 MDL Number: MFCD00044888 InChI Key: PQLMXFQTAMDXIZ-UHFFFAOYSA-N Synonym: isoamyl butyrate,isopentyl butyrate,isopentyl butanoate,isoamyl butanoate,butanoic acid, 3-methylbutyl ester,3-methylbutyl butyrate,butyric acid, isopentyl ester,isoamyl-n-butyrate,isopentyl alcohol, butyrate,isoamyl butylate PubChem CID: 7795 ChEBI: CHEBI:87422 IUPAC Name: 3-methylbutyl butanoate SMILES: CCCC(=O)OCCC(C)C
| PubChem CID | 7795 |
|---|---|
| CAS | 106-27-4 |
| Molecular Weight (g/mol) | 158.24 |
| ChEBI | CHEBI:87422 |
| MDL Number | MFCD00044888 |
| SMILES | CCCC(=O)OCCC(C)C |
| Synonym | isoamyl butyrate,isopentyl butyrate,isopentyl butanoate,isoamyl butanoate,butanoic acid, 3-methylbutyl ester,3-methylbutyl butyrate,butyric acid, isopentyl ester,isoamyl-n-butyrate,isopentyl alcohol, butyrate,isoamyl butylate |
| IUPAC Name | 3-methylbutyl butanoate |
| InChI Key | PQLMXFQTAMDXIZ-UHFFFAOYSA-N |
| Molecular Formula | C9H18O2 |
Ethyl 2-butynoate, 98%
CAS: 4341-76-8 Molecular Formula: C6H8O2 Molecular Weight (g/mol): 112.128 MDL Number: MFCD00015182 InChI Key: FCJJZKCJURDYNF-UHFFFAOYSA-N Synonym: ethyl 2-butynoate,ethyl tetrolate,2-butynoic acid ethyl ester,but-2-ynoic acid ethyl ester,2-butynoic acid, ethyl ester,tetrolic acid ethyl ester,ethyl-2-butynoate,ethyl 3-methylpropiolate,acmc-1aeo2,ethyl 1-propynecarboxylate PubChem CID: 78043 IUPAC Name: ethyl but-2-ynoate SMILES: CCOC(=O)C#CC
| PubChem CID | 78043 |
|---|---|
| CAS | 4341-76-8 |
| Molecular Weight (g/mol) | 112.128 |
| MDL Number | MFCD00015182 |
| SMILES | CCOC(=O)C#CC |
| Synonym | ethyl 2-butynoate,ethyl tetrolate,2-butynoic acid ethyl ester,but-2-ynoic acid ethyl ester,2-butynoic acid, ethyl ester,tetrolic acid ethyl ester,ethyl-2-butynoate,ethyl 3-methylpropiolate,acmc-1aeo2,ethyl 1-propynecarboxylate |
| IUPAC Name | ethyl but-2-ynoate |
| InChI Key | FCJJZKCJURDYNF-UHFFFAOYSA-N |
| Molecular Formula | C6H8O2 |
Trimethyl phosphate, 98+%
CAS: 512-56-1 Molecular Formula: C3H9O4P Molecular Weight (g/mol): 140.08 MDL Number: MFCD00008348 InChI Key: WVLBCYQITXONBZ-UHFFFAOYSA-N Synonym: trimethylphosphate,phosphoric acid, trimethyl ester,trimethyl orthophosphate,tmpo,trimethoxyphosphine oxide,phosphoric acid trimethyl ester,o,o,o-trimethyl phosphate,trimethylfosfat,phosphate, trimethyl,trimethylfosfat czech PubChem CID: 10541 ChEBI: CHEBI:46324 IUPAC Name: trimethyl phosphate SMILES: COP(=O)(OC)OC
| PubChem CID | 10541 |
|---|---|
| CAS | 512-56-1 |
| Molecular Weight (g/mol) | 140.08 |
| ChEBI | CHEBI:46324 |
| MDL Number | MFCD00008348 |
| SMILES | COP(=O)(OC)OC |
| Synonym | trimethylphosphate,phosphoric acid, trimethyl ester,trimethyl orthophosphate,tmpo,trimethoxyphosphine oxide,phosphoric acid trimethyl ester,o,o,o-trimethyl phosphate,trimethylfosfat,phosphate, trimethyl,trimethylfosfat czech |
| IUPAC Name | trimethyl phosphate |
| InChI Key | WVLBCYQITXONBZ-UHFFFAOYSA-N |
| Molecular Formula | C3H9O4P |
Sodium formate, ACS, 99.0% min
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.007 MDL Number: MFCD00013101 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.007 |
| ChEBI | CHEBI:62965 |
| MDL Number | MFCD00013101 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
Acetazolamide, 99%
CAS: 59-66-5 Molecular Formula: C4H6N4O3S2 Molecular Weight (g/mol): 222.24 MDL Number: MFCD00003105 InChI Key: BZKPWHYZMXOIDC-UHFFFAOYSA-N Synonym: acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran PubChem CID: 1986 ChEBI: CHEBI:27690 IUPAC Name: N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide SMILES: CC(=O)NC1=NN=C(S1)S(N)(=O)=O
| PubChem CID | 1986 |
|---|---|
| CAS | 59-66-5 |
| Molecular Weight (g/mol) | 222.24 |
| ChEBI | CHEBI:27690 |
| MDL Number | MFCD00003105 |
| SMILES | CC(=O)NC1=NN=C(S1)S(N)(=O)=O |
| Synonym | acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran |
| IUPAC Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| InChI Key | BZKPWHYZMXOIDC-UHFFFAOYSA-N |
| Molecular Formula | C4H6N4O3S2 |
Dimethyl oxalate, 99%
CAS: 553-90-2 Molecular Formula: C4H6O4 Molecular Weight (g/mol): 118.09 MDL Number: MFCD00008442 InChI Key: LOMVENUNSWAXEN-UHFFFAOYSA-N Synonym: methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid PubChem CID: 11120 ChEBI: CHEBI:6859 IUPAC Name: dimethyl oxalate SMILES: COC(=O)C(=O)OC
| PubChem CID | 11120 |
|---|---|
| CAS | 553-90-2 |
| Molecular Weight (g/mol) | 118.09 |
| ChEBI | CHEBI:6859 |
| MDL Number | MFCD00008442 |
| SMILES | COC(=O)C(=O)OC |
| Synonym | methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid |
| IUPAC Name | dimethyl oxalate |
| InChI Key | LOMVENUNSWAXEN-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4 |
2,2,4-Trimethyl-1,3-pentanediol 1-monoisobutyrate
CAS: 25265-77-4 Molecular Formula: C12H24O3 Molecular Weight (g/mol): 216.321 MDL Number: MFCD00148967 InChI Key: DAFHKNAQFPVRKR-UHFFFAOYSA-N Synonym: texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate PubChem CID: 6490 IUPAC Name: (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate SMILES: CC(C)C(C(C)(C)COC(=O)C(C)C)O
| PubChem CID | 6490 |
|---|---|
| CAS | 25265-77-4 |
| Molecular Weight (g/mol) | 216.321 |
| MDL Number | MFCD00148967 |
| SMILES | CC(C)C(C(C)(C)COC(=O)C(C)C)O |
| Synonym | texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate |
| IUPAC Name | (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate |
| InChI Key | DAFHKNAQFPVRKR-UHFFFAOYSA-N |
| Molecular Formula | C12H24O3 |
3-Mercaptopropionic acid, 99%
CAS: 107-96-0 Molecular Formula: C3H6O2S Molecular Weight (g/mol): 106.139 MDL Number: MFCD00004897 InChI Key: DKIDEFUBRARXTE-UHFFFAOYSA-N Synonym: 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid PubChem CID: 6514 ChEBI: CHEBI:44111 IUPAC Name: 3-sulfanylpropanoic acid SMILES: C(CS)C(=O)O
| PubChem CID | 6514 |
|---|---|
| CAS | 107-96-0 |
| Molecular Weight (g/mol) | 106.139 |
| ChEBI | CHEBI:44111 |
| MDL Number | MFCD00004897 |
| SMILES | C(CS)C(=O)O |
| Synonym | 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid |
| IUPAC Name | 3-sulfanylpropanoic acid |
| InChI Key | DKIDEFUBRARXTE-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2S |