Organic acids and derivatives
Filtered Search Results
Edetate Disodium, Multi-Compendial, U.S.P., J.T. Baker™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Edetate Disodium, U.S.P., J.T. Baker™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
EDTA, Powder, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Methyl trimethylacetate, 99%
CAS: 598-98-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008843 InChI Key: CNMFHDIDIMZHKY-UHFFFAOYSA-N Synonym: methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 PubChem CID: 69027 IUPAC Name: methyl 2,2-dimethylpropanoate SMILES: CC(C)(C)C(=O)OC
| PubChem CID | 69027 |
|---|---|
| CAS | 598-98-1 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008843 |
| SMILES | CC(C)(C)C(=O)OC |
| Synonym | methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 |
| IUPAC Name | methyl 2,2-dimethylpropanoate |
| InChI Key | CNMFHDIDIMZHKY-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
EDTA Disodium Salt, Dihydrate, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Methyl 4,4,4-trifluorocrotonate, 97%
CAS: 85694-31-1 Molecular Formula: C5H5F3O2 Molecular Weight (g/mol): 154.09 MDL Number: MFCD00077567 InChI Key: DMMZYYLXAGRBDO-NSCUHMNNSA-N Synonym: methyl 4,4,4-trifluorocrotonate,methyl 2e-4,4,4-trifluorobut-2-enoate,methyl4,4,4-trifluorocrotonate,methyl e-3-trifluoromethyl propenoate,e-methyl 4,4,4-trifluorobut-2-enoate,methyl 4,4,4-trifluorobut-2-enoate,heddpndiaicichibemultbb`,methyl 4,4,4-trifluorocrotonat,methyl e-4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid methyl ester PubChem CID: 5371282 IUPAC Name: methyl (E)-4,4,4-trifluorobut-2-enoate SMILES: COC(=O)\C=C\C(F)(F)F
| PubChem CID | 5371282 |
|---|---|
| CAS | 85694-31-1 |
| Molecular Weight (g/mol) | 154.09 |
| MDL Number | MFCD00077567 |
| SMILES | COC(=O)\C=C\C(F)(F)F |
| Synonym | methyl 4,4,4-trifluorocrotonate,methyl 2e-4,4,4-trifluorobut-2-enoate,methyl4,4,4-trifluorocrotonate,methyl e-3-trifluoromethyl propenoate,e-methyl 4,4,4-trifluorobut-2-enoate,methyl 4,4,4-trifluorobut-2-enoate,heddpndiaicichibemultbb`,methyl 4,4,4-trifluorocrotonat,methyl e-4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid methyl ester |
| IUPAC Name | methyl (E)-4,4,4-trifluorobut-2-enoate |
| InChI Key | DMMZYYLXAGRBDO-NSCUHMNNSA-N |
| Molecular Formula | C5H5F3O2 |
Urea, BiotechGrade, 99-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N IUPAC Name: urea SMILES: NC(N)=O
| CAS | 57-13-6 |
|---|---|
| Molecular Weight (g/mol) | 60.06 |
| SMILES | NC(N)=O |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
2,3-Dichlorophenylboronic acid, 97%
CAS: 151169-74-3 Molecular Formula: C6H5BCl2O2 Molecular Weight (g/mol): 190.81 MDL Number: MFCD01075703 InChI Key: TYIKXPOMOYDGCS-UHFFFAOYSA-N Synonym: 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid PubChem CID: 2734661 IUPAC Name: (2,3-dichlorophenyl)boronic acid SMILES: OB(O)C1=C(Cl)C(Cl)=CC=C1
| PubChem CID | 2734661 |
|---|---|
| CAS | 151169-74-3 |
| Molecular Weight (g/mol) | 190.81 |
| MDL Number | MFCD01075703 |
| SMILES | OB(O)C1=C(Cl)C(Cl)=CC=C1 |
| Synonym | 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid |
| IUPAC Name | (2,3-dichlorophenyl)boronic acid |
| InChI Key | TYIKXPOMOYDGCS-UHFFFAOYSA-N |
| Molecular Formula | C6H5BCl2O2 |
Nickel(II) citrate hydrate, 98%
CAS: 6018-92-4 Molecular Formula: C12H10Ni3O14 Molecular Weight (g/mol): 554.28 MDL Number: MFCD00054366 InChI Key: UPPLJLAHMKABPR-UHFFFAOYSA-H Synonym: nickel ii citrate hydrate PubChem CID: 131881812 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;nickel SMILES: [Ni++].[Ni++].[Ni++].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O.OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| PubChem CID | 131881812 |
|---|---|
| CAS | 6018-92-4 |
| Molecular Weight (g/mol) | 554.28 |
| MDL Number | MFCD00054366 |
| SMILES | [Ni++].[Ni++].[Ni++].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O.OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | nickel ii citrate hydrate |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;nickel |
| InChI Key | UPPLJLAHMKABPR-UHFFFAOYSA-H |
| Molecular Formula | C12H10Ni3O14 |
Tetramethyl methylenediphosphonate, 98+%
CAS: 16001-93-7 Molecular Formula: C5H14O6P2 Molecular Weight (g/mol): 232.109 MDL Number: MFCD00014884 InChI Key: XAVFZUKFLWOSOS-UHFFFAOYSA-N Synonym: tetramethyl methylenediphosphonate,bis dimethoxyphosphoryl methane,tetramethyl methylenebis phosphonate,phosphonic acid, methylenebis-, tetramethyl ester,acmc-20ajjd,tetramethyl methanebisphosphonate,tetramethyl-methylenediphosphonate,tetramethyl methylenebisphosphonate,methylenebis phosphonic acid dimethyl ester,methylenediphosphonic acid tetramethyl ester PubChem CID: 519206 IUPAC Name: bis(dimethoxyphosphoryl)methane SMILES: COP(=O)(CP(=O)(OC)OC)OC
| PubChem CID | 519206 |
|---|---|
| CAS | 16001-93-7 |
| Molecular Weight (g/mol) | 232.109 |
| MDL Number | MFCD00014884 |
| SMILES | COP(=O)(CP(=O)(OC)OC)OC |
| Synonym | tetramethyl methylenediphosphonate,bis dimethoxyphosphoryl methane,tetramethyl methylenebis phosphonate,phosphonic acid, methylenebis-, tetramethyl ester,acmc-20ajjd,tetramethyl methanebisphosphonate,tetramethyl-methylenediphosphonate,tetramethyl methylenebisphosphonate,methylenebis phosphonic acid dimethyl ester,methylenediphosphonic acid tetramethyl ester |
| IUPAC Name | bis(dimethoxyphosphoryl)methane |
| InChI Key | XAVFZUKFLWOSOS-UHFFFAOYSA-N |
| Molecular Formula | C5H14O6P2 |
Dimethyl (2-oxopropyl)phosphonate, 95%
CAS: 4202-14-6 Molecular Formula: C5H11O4P Molecular Weight (g/mol): 166.11 MDL Number: MFCD00008769 InChI Key: UOWIYNWMROWVDG-UHFFFAOYSA-N Synonym: dimethyl 2-oxopropyl phosphonate,dimethyl acetylmethylphosphonate,dimethyl 2-oxopropylphosphonate,dimethyl acetonylphosphonate,2-oxopropyl phosphonic acid dimethyl ester,1-dimethoxycarbonyl acetone,acmc-209jmw,dimethoxyphosphoryl acetone PubChem CID: 77872 IUPAC Name: 1-dimethoxyphosphorylpropan-2-one SMILES: CC(=O)CP(=O)(OC)OC
| PubChem CID | 77872 |
|---|---|
| CAS | 4202-14-6 |
| Molecular Weight (g/mol) | 166.11 |
| MDL Number | MFCD00008769 |
| SMILES | CC(=O)CP(=O)(OC)OC |
| Synonym | dimethyl 2-oxopropyl phosphonate,dimethyl acetylmethylphosphonate,dimethyl 2-oxopropylphosphonate,dimethyl acetonylphosphonate,2-oxopropyl phosphonic acid dimethyl ester,1-dimethoxycarbonyl acetone,acmc-209jmw,dimethoxyphosphoryl acetone |
| IUPAC Name | 1-dimethoxyphosphorylpropan-2-one |
| InChI Key | UOWIYNWMROWVDG-UHFFFAOYSA-N |
| Molecular Formula | C5H11O4P |
1,4-Butanesultone, 99%
CAS: 1633-83-6 Molecular Formula: C4H8O3S Molecular Weight (g/mol): 136.17 MDL Number: MFCD00006584 InChI Key: MHYFEEDKONKGEB-UHFFFAOYSA-N Synonym: 1,4-butane sultone,1,4-butanesultone,butane sultone,butanesultone,1,2-oxathiane, 2,2-dioxide,butanesulfone,1,2-oxathiane 2,2-dioxide,1,4-butylene sulfone,delta-valerosultone,1,4-butanesulfone PubChem CID: 15411 IUPAC Name: oxathiane 2,2-dioxide SMILES: O=S1(=O)CCCCO1
| PubChem CID | 15411 |
|---|---|
| CAS | 1633-83-6 |
| Molecular Weight (g/mol) | 136.17 |
| MDL Number | MFCD00006584 |
| SMILES | O=S1(=O)CCCCO1 |
| Synonym | 1,4-butane sultone,1,4-butanesultone,butane sultone,butanesultone,1,2-oxathiane, 2,2-dioxide,butanesulfone,1,2-oxathiane 2,2-dioxide,1,4-butylene sulfone,delta-valerosultone,1,4-butanesulfone |
| IUPAC Name | oxathiane 2,2-dioxide |
| InChI Key | MHYFEEDKONKGEB-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3S |
Edetate Disodium, USP, EP, JP, bioCERTIFIED™, 1 kg, Spectrum Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
5-Amino-1-methyl-2-oxoindoline, 97%, Thermo Scientific™
CAS: 20870-91-1 Molecular Formula: C9H10N2O Molecular Weight (g/mol): 162.19 MDL Number: MFCD09702413 InChI Key: ZGLUKQQSWABKDH-UHFFFAOYSA-N Synonym: 5-amino-1-methyl-2-oxoindoline,5-amino-1-methylindolin-2-one,5-amino-1-methyl-1,3-dihydro-2h-indol-2-one,5-amino-1-methyl-2,3-dihydro-1h-indol-2-one,2h-indol-2-one, 5-amino-1,3-dihydro-1-methyl,5-azanyl-1-methyl-3h-indol-2-one,5-amino-1-methyl-1,3-dihydro-indol-2-on,5-amino-1-methyl-1,3-dihydro-indol-2-one,2h-indol-2-one,5-amino-1,3-dihydro-1-methyl,5-amino-1-methyl-1,3-dihydroindol-2-one PubChem CID: 22692470 IUPAC Name: 5-amino-1-methyl-3H-indol-2-one SMILES: CN1C(=O)CC2=C1C=CC(N)=C2
| PubChem CID | 22692470 |
|---|---|
| CAS | 20870-91-1 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD09702413 |
| SMILES | CN1C(=O)CC2=C1C=CC(N)=C2 |
| Synonym | 5-amino-1-methyl-2-oxoindoline,5-amino-1-methylindolin-2-one,5-amino-1-methyl-1,3-dihydro-2h-indol-2-one,5-amino-1-methyl-2,3-dihydro-1h-indol-2-one,2h-indol-2-one, 5-amino-1,3-dihydro-1-methyl,5-azanyl-1-methyl-3h-indol-2-one,5-amino-1-methyl-1,3-dihydro-indol-2-on,5-amino-1-methyl-1,3-dihydro-indol-2-one,2h-indol-2-one,5-amino-1,3-dihydro-1-methyl,5-amino-1-methyl-1,3-dihydroindol-2-one |
| IUPAC Name | 5-amino-1-methyl-3H-indol-2-one |
| InChI Key | ZGLUKQQSWABKDH-UHFFFAOYSA-N |
| Molecular Formula | C9H10N2O |
2,2,2-Trifluoroethyl trichloromethanesulfonate, 94%
CAS: 23199-56-6 Molecular Formula: C3H2Cl3F3O3S Molecular Weight (g/mol): 281.45 MDL Number: MFCD00042400 InChI Key: GOIWZZQXWJVDOG-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl trichloromethanesulphonate,2,2,2-trifluoroethyl trichloromethane-sulfonate,trichloromethanesulfonic acid 2,2,2-trifluoroethyl ester,methanesulfonic acid, trichloro-, 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl trichloromethyl sulfonate,acmc-20aoku,trifluoroethyl trichloromethylsulfonate,trifluoroethyl trichloromethanesulphonate,2,2,2-trifluoroethyltrichloromethanesulfonate,1,1,1-trifluoroethyl trichloromethanesulfonate PubChem CID: 90027 IUPAC Name: 2,2,2-trifluoroethyl trichloromethanesulfonate SMILES: FC(F)(F)COS(=O)(=O)C(Cl)(Cl)Cl
| PubChem CID | 90027 |
|---|---|
| CAS | 23199-56-6 |
| Molecular Weight (g/mol) | 281.45 |
| MDL Number | MFCD00042400 |
| SMILES | FC(F)(F)COS(=O)(=O)C(Cl)(Cl)Cl |
| Synonym | 2,2,2-trifluoroethyl trichloromethanesulphonate,2,2,2-trifluoroethyl trichloromethane-sulfonate,trichloromethanesulfonic acid 2,2,2-trifluoroethyl ester,methanesulfonic acid, trichloro-, 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl trichloromethyl sulfonate,acmc-20aoku,trifluoroethyl trichloromethylsulfonate,trifluoroethyl trichloromethanesulphonate,2,2,2-trifluoroethyltrichloromethanesulfonate,1,1,1-trifluoroethyl trichloromethanesulfonate |
| IUPAC Name | 2,2,2-trifluoroethyl trichloromethanesulfonate |
| InChI Key | GOIWZZQXWJVDOG-UHFFFAOYSA-N |
| Molecular Formula | C3H2Cl3F3O3S |