Organic acids and derivatives
Filtered Search Results
Mercury(II) trifluoroacetate, 98+%
CAS: 13257-51-7 Molecular Formula: C4F6HgO4 Molecular Weight (g/mol): 426.622 MDL Number: MFCD00013201 InChI Key: WMHOESUUCMEQMS-UHFFFAOYSA-L Synonym: mercury ii trifluoroacetate,mercury bis trifluoroacetate,mercury 2+ ditrifluoroacetate,mercury 2+ ; 2,2,2-trifluoroacetate,bis trifluoroacetato mercury,hg ococf3 2,hg o2ccf3 2,mercury bis-trifluoroacetate,mercury ii bis trifluoroacetate PubChem CID: 2723924 IUPAC Name: mercury(2+);2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Hg+2]
| PubChem CID | 2723924 |
|---|---|
| CAS | 13257-51-7 |
| Molecular Weight (g/mol) | 426.622 |
| MDL Number | MFCD00013201 |
| SMILES | C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Hg+2] |
| Synonym | mercury ii trifluoroacetate,mercury bis trifluoroacetate,mercury 2+ ditrifluoroacetate,mercury 2+ ; 2,2,2-trifluoroacetate,bis trifluoroacetato mercury,hg ococf3 2,hg o2ccf3 2,mercury bis-trifluoroacetate,mercury ii bis trifluoroacetate |
| IUPAC Name | mercury(2+);2,2,2-trifluoroacetate |
| InChI Key | WMHOESUUCMEQMS-UHFFFAOYSA-L |
| Molecular Formula | C4F6HgO4 |
Methyl 3-methylphenylacetate, 98%
CAS: 53088-69-0 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00968468 InChI Key: AWTKFTNNPQGGLX-UHFFFAOYSA-N Synonym: methyl 2-m-tolyl acetate,methyl 3-methylphenylacetate,methyl 2-3-methylphenyl acetate,3-methylphenylacetic acid methyl ester,benzeneacetic acid, 3-methyl-, methyl ester,methyl 2-m-tolylacetate,m-tolylacetic acid methyl ester,m-toly-acetic acid methyl ester,m-tolyl-acetic acid methyl ester,methyl 2-3-methylphenyl ethanoate PubChem CID: 5135288 IUPAC Name: methyl 2-(3-methylphenyl)acetate SMILES: COC(=O)CC1=CC=CC(C)=C1
| PubChem CID | 5135288 |
|---|---|
| CAS | 53088-69-0 |
| Molecular Weight (g/mol) | 164.20 |
| MDL Number | MFCD00968468 |
| SMILES | COC(=O)CC1=CC=CC(C)=C1 |
| Synonym | methyl 2-m-tolyl acetate,methyl 3-methylphenylacetate,methyl 2-3-methylphenyl acetate,3-methylphenylacetic acid methyl ester,benzeneacetic acid, 3-methyl-, methyl ester,methyl 2-m-tolylacetate,m-tolylacetic acid methyl ester,m-toly-acetic acid methyl ester,m-tolyl-acetic acid methyl ester,methyl 2-3-methylphenyl ethanoate |
| IUPAC Name | methyl 2-(3-methylphenyl)acetate |
| InChI Key | AWTKFTNNPQGGLX-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
Sodium 1-tetradecyl sulfate, 95%, cont. up to ca 5% sodium methyl sulfate
CAS: 1191-50-0 Molecular Formula: C14H29NaO4S Molecular Weight (g/mol): 316.43 MDL Number: MFCD00007468 InChI Key: UPUIQOIQVMNQAP-UHFFFAOYSA-M Synonym: sodium tetradecyl sulfate,sodium myristyl sulfate,niaproof 4,sodium tetradecyl sulphate,tesapon k 14,texapon k 14,trombavar,natri tetradecylsulfas,sotradecol sodium,tetradecyl sodium sulfate PubChem CID: 23665770 IUPAC Name: sodium;tetradecyl sulfate SMILES: [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 23665770 |
|---|---|
| CAS | 1191-50-0 |
| Molecular Weight (g/mol) | 316.43 |
| MDL Number | MFCD00007468 |
| SMILES | [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium tetradecyl sulfate,sodium myristyl sulfate,niaproof 4,sodium tetradecyl sulphate,tesapon k 14,texapon k 14,trombavar,natri tetradecylsulfas,sotradecol sodium,tetradecyl sodium sulfate |
| IUPAC Name | sodium;tetradecyl sulfate |
| InChI Key | UPUIQOIQVMNQAP-UHFFFAOYSA-M |
| Molecular Formula | C14H29NaO4S |
4-Hydroxybutyl acrylate, 95%, stab. with ca 500ppm 4-methoxyphenol
CAS: 2478-10-6 MDL Number: MFCD00010261
| CAS | 2478-10-6 |
|---|---|
| MDL Number | MFCD00010261 |
N-(n-Butyl)phthalimide, 99%
CAS: 1515-72-6 Molecular Formula: C12H13NO2 Molecular Weight (g/mol): 203.241 MDL Number: MFCD00039695 InChI Key: DLKDEVCJRCPTLN-UHFFFAOYSA-N Synonym: n-butylphthalimide,2-butylisoindoline-1,3-dione,n-n-butyl phthalimide,1-phthalimidobutane,phthalimide, n-butyl,1h-isoindole-1,3 2h-dione, 2-butyl,unii-5th1dkt35e,2-butyl-1h-isoindole-1,3 2h-dione,5th1dkt35e,2-butylbenzo c azoline-1,3-dione PubChem CID: 73812 IUPAC Name: 2-butylisoindole-1,3-dione SMILES: CCCCN1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 73812 |
|---|---|
| CAS | 1515-72-6 |
| Molecular Weight (g/mol) | 203.241 |
| MDL Number | MFCD00039695 |
| SMILES | CCCCN1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-butylphthalimide,2-butylisoindoline-1,3-dione,n-n-butyl phthalimide,1-phthalimidobutane,phthalimide, n-butyl,1h-isoindole-1,3 2h-dione, 2-butyl,unii-5th1dkt35e,2-butyl-1h-isoindole-1,3 2h-dione,5th1dkt35e,2-butylbenzo c azoline-1,3-dione |
| IUPAC Name | 2-butylisoindole-1,3-dione |
| InChI Key | DLKDEVCJRCPTLN-UHFFFAOYSA-N |
| Molecular Formula | C12H13NO2 |
Cyclohexylacetic acid, 98+%
CAS: 5292-21-7 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.20 MDL Number: MFCD00001518 InChI Key: LJOODBDWMQKMFB-UHFFFAOYSA-N Synonym: cyclohexylacetic acid,cyclohexaneacetic acid,cyclohexylethanoic acid,hexahydrophenylacetic acid,cyclohexyl acetic acid,unii-v43k3to0hn,fema no. 2347,cyclohexane-acetic acid,v43k3to0hn,cyclo-hexylacetic acid PubChem CID: 21363 ChEBI: CHEBI:37277 IUPAC Name: 2-cyclohexylacetic acid SMILES: OC(=O)CC1CCCCC1
| PubChem CID | 21363 |
|---|---|
| CAS | 5292-21-7 |
| Molecular Weight (g/mol) | 142.20 |
| ChEBI | CHEBI:37277 |
| MDL Number | MFCD00001518 |
| SMILES | OC(=O)CC1CCCCC1 |
| Synonym | cyclohexylacetic acid,cyclohexaneacetic acid,cyclohexylethanoic acid,hexahydrophenylacetic acid,cyclohexyl acetic acid,unii-v43k3to0hn,fema no. 2347,cyclohexane-acetic acid,v43k3to0hn,cyclo-hexylacetic acid |
| IUPAC Name | 2-cyclohexylacetic acid |
| InChI Key | LJOODBDWMQKMFB-UHFFFAOYSA-N |
| Molecular Formula | C8H14O2 |
S-Methylisothiouronium sulfate, 98+%
CAS: 867-44-7 Molecular Formula: C4H14N4O4S3 Molecular Weight (g/mol): 278.36 MDL Number: MFCD00013055 InChI Key: BZZXQZOBAUXLHZ-UHFFFAOYSA-N Synonym: s-methylisothiourea hemisulfate,2-methyl-2-thiopseudourea hemisulfate,carbamimidothioic acid, methyl ester, sulfate 2:1,s-methylisothiourea sulfate 2:1,s-methylthiouronium sulfate 2:1,bis 2-methylisothiouronium sulphate,methyl carbamimidothioate sulfate 2:1,methylcarbamimidothioate sulfate 2:1,s-methylisothiourea, sulfate,2-methyl-2-thiopseudourea sulfate 2:1 PubChem CID: 13347 IUPAC Name: methyl carbamimidothioate;sulfuric acid SMILES: CSC(=N)N.CSC(=N)N.OS(=O)(=O)O
| PubChem CID | 13347 |
|---|---|
| CAS | 867-44-7 |
| Molecular Weight (g/mol) | 278.36 |
| MDL Number | MFCD00013055 |
| SMILES | CSC(=N)N.CSC(=N)N.OS(=O)(=O)O |
| Synonym | s-methylisothiourea hemisulfate,2-methyl-2-thiopseudourea hemisulfate,carbamimidothioic acid, methyl ester, sulfate 2:1,s-methylisothiourea sulfate 2:1,s-methylthiouronium sulfate 2:1,bis 2-methylisothiouronium sulphate,methyl carbamimidothioate sulfate 2:1,methylcarbamimidothioate sulfate 2:1,s-methylisothiourea, sulfate,2-methyl-2-thiopseudourea sulfate 2:1 |
| IUPAC Name | methyl carbamimidothioate;sulfuric acid |
| InChI Key | BZZXQZOBAUXLHZ-UHFFFAOYSA-N |
| Molecular Formula | C4H14N4O4S3 |
2-Chloro-2-ethoxyacetic acid ethyl ester, 90%, remainder mainly ethyl diethoxyacetat, Thermo Scientific Chemicals
CAS: 34006-60-5 Molecular Formula: C6H11ClO3 Molecular Weight (g/mol): 166.60 MDL Number: MFCD00043953 InChI Key: WDCHMODANTVRTF-UHFFFAOYNA-N Synonym: 2-chloro-2-ethoxyacetic acid ethyl ester,ethyl 2-chloro-2-ethoxy-acetate,ethyl2-chloro-2-ethoxyacetate,ethyl chloro ethoxy acetate,chloro ethoxy acetic acid ethyl ester,ethyl alpha-chloro-alpha-ethoxyacetate,ethyl alpha-chloro-alpha-ethoxy-acetate,2-chloro-2-ethoxy-acetic acid ethyl ester,acetic acid,2-chloro-2-ethoxy-, ethyl ester PubChem CID: 2724873 IUPAC Name: ethyl 2-(1-chloroethoxy)acetate SMILES: CCOC(=O)COC(C)Cl
| PubChem CID | 2724873 |
|---|---|
| CAS | 34006-60-5 |
| Molecular Weight (g/mol) | 166.60 |
| MDL Number | MFCD00043953 |
| SMILES | CCOC(=O)COC(C)Cl |
| Synonym | 2-chloro-2-ethoxyacetic acid ethyl ester,ethyl 2-chloro-2-ethoxy-acetate,ethyl2-chloro-2-ethoxyacetate,ethyl chloro ethoxy acetate,chloro ethoxy acetic acid ethyl ester,ethyl alpha-chloro-alpha-ethoxyacetate,ethyl alpha-chloro-alpha-ethoxy-acetate,2-chloro-2-ethoxy-acetic acid ethyl ester,acetic acid,2-chloro-2-ethoxy-, ethyl ester |
| IUPAC Name | ethyl 2-(1-chloroethoxy)acetate |
| InChI Key | WDCHMODANTVRTF-UHFFFAOYNA-N |
| Molecular Formula | C6H11ClO3 |
2-Methoxyethyl acrylate, 98%, stab. with ca 50-100ppm 4-methoxyphenol
CAS: 3121-61-7 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD00048149,MFCD00803685 InChI Key: HFCUBKYHMMPGBY-UHFFFAOYSA-N Synonym: 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca PubChem CID: 18392 IUPAC Name: 2-methoxyethyl prop-2-enoate SMILES: COCCOC(=O)C=C
| PubChem CID | 18392 |
|---|---|
| CAS | 3121-61-7 |
| Molecular Weight (g/mol) | 130.14 |
| MDL Number | MFCD00048149,MFCD00803685 |
| SMILES | COCCOC(=O)C=C |
| Synonym | 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca |
| IUPAC Name | 2-methoxyethyl prop-2-enoate |
| InChI Key | HFCUBKYHMMPGBY-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
3-Aminobenzeneboronic acid hemisulfate, 98+%
CAS: 66472-86-4 Molecular Formula: C12H18B2N2O8S Molecular Weight (g/mol): 371.96 MDL Number: MFCD00013111 InChI Key: UKTAURVTSWDIQR-UHFFFAOYSA-N Synonym: 3-aminophenyl boronic acid sulfate 2:1,3-aminobenzeneboronic acid hemisulfate salt,3-aminophenylboronic acid hemisulfate,3-aminobenzeneboronic acid hemisulfate,3-aminophenylboronic acid hemisulphate,4-aminophenylboronic acid hemisulfate,m-aminophenyl boronic acid, hemisulphate,boronic acid, 3-aminophenyl-, sulfate 2:1,3-aminophenyl boronic acid; sulfuric acid,bis m-aminophenylboronic acid ; sulfuric acid PubChem CID: 16211139 IUPAC Name: (3-aminophenyl)boronic acid;sulfuric acid SMILES: OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O
| PubChem CID | 16211139 |
|---|---|
| CAS | 66472-86-4 |
| Molecular Weight (g/mol) | 371.96 |
| MDL Number | MFCD00013111 |
| SMILES | OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O |
| Synonym | 3-aminophenyl boronic acid sulfate 2:1,3-aminobenzeneboronic acid hemisulfate salt,3-aminophenylboronic acid hemisulfate,3-aminobenzeneboronic acid hemisulfate,3-aminophenylboronic acid hemisulphate,4-aminophenylboronic acid hemisulfate,m-aminophenyl boronic acid, hemisulphate,boronic acid, 3-aminophenyl-, sulfate 2:1,3-aminophenyl boronic acid; sulfuric acid,bis m-aminophenylboronic acid ; sulfuric acid |
| IUPAC Name | (3-aminophenyl)boronic acid;sulfuric acid |
| InChI Key | UKTAURVTSWDIQR-UHFFFAOYSA-N |
| Molecular Formula | C12H18B2N2O8S |
Acetic hydrazide, 96%
CAS: 1068-57-1 Molecular Formula: C2H6N2O Molecular Weight (g/mol): 74.083 MDL Number: MFCD00007610 InChI Key: OFLXLNCGODUUOT-UHFFFAOYSA-N Synonym: acethydrazide,acetylhydrazine,acetic hydrazide,acetic acid hydrazide,acetyl hydrazide,monoacetylhydrazine,n-acetylhydrazine,ethanehydrazonic acid,acetic acid, hydrazide,acetyl hydrazine PubChem CID: 14039 ChEBI: CHEBI:48978 IUPAC Name: acetohydrazide SMILES: CC(=O)NN
| PubChem CID | 14039 |
|---|---|
| CAS | 1068-57-1 |
| Molecular Weight (g/mol) | 74.083 |
| ChEBI | CHEBI:48978 |
| MDL Number | MFCD00007610 |
| SMILES | CC(=O)NN |
| Synonym | acethydrazide,acetylhydrazine,acetic hydrazide,acetic acid hydrazide,acetyl hydrazide,monoacetylhydrazine,n-acetylhydrazine,ethanehydrazonic acid,acetic acid, hydrazide,acetyl hydrazine |
| IUPAC Name | acetohydrazide |
| InChI Key | OFLXLNCGODUUOT-UHFFFAOYSA-N |
| Molecular Formula | C2H6N2O |
Edetate Disodium, Dihydrate, BiotechGrade, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Sodium Ascorbate, Powder, USP, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| CAS | 134-03-2 |
|---|---|
| Molecular Weight (g/mol) | 198.11 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
Dihydrofluorescein diacetate, 97%
CAS: 35340-49-9 Molecular Formula: C24H18O7 Molecular Weight (g/mol): 418.401 MDL Number: MFCD00005056 InChI Key: YKSJJXGQHSESKB-UHFFFAOYSA-N Synonym: dihydrofluorescein diacetate,2-3,6-diacetoxy-9h-xanthen-9-yl benzoic acid,diacetyldihydrofluorescein,2-3,6-diacetoxy-9h-xanth-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid,dihydrofluorescein diacetate h2fda,2-3,6-diacetyloxy-9h-xanthen-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid # PubChem CID: 629056 IUPAC Name: 2-(3,6-diacetyloxy-9H-xanthen-9-yl)benzoic acid SMILES: CC(=O)OC1=CC2=C(C=C1)C(C3=C(O2)C=C(C=C3)OC(=O)C)C4=CC=CC=C4C(=O)O
| PubChem CID | 629056 |
|---|---|
| CAS | 35340-49-9 |
| Molecular Weight (g/mol) | 418.401 |
| MDL Number | MFCD00005056 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C(C3=C(O2)C=C(C=C3)OC(=O)C)C4=CC=CC=C4C(=O)O |
| Synonym | dihydrofluorescein diacetate,2-3,6-diacetoxy-9h-xanthen-9-yl benzoic acid,diacetyldihydrofluorescein,2-3,6-diacetoxy-9h-xanth-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid,dihydrofluorescein diacetate h2fda,2-3,6-diacetyloxy-9h-xanthen-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid # |
| IUPAC Name | 2-(3,6-diacetyloxy-9H-xanthen-9-yl)benzoic acid |
| InChI Key | YKSJJXGQHSESKB-UHFFFAOYSA-N |
| Molecular Formula | C24H18O7 |
Ethyl 4-pyridineacetate, 98%
CAS: 54401-85-3 Molecular Formula: C9H11NO2 Molecular Weight (g/mol): 165.192 MDL Number: MFCD00051830 InChI Key: QVLJLWHOILVHJJ-UHFFFAOYSA-N Synonym: ethyl 4-pyridylacetate,ethyl 2-pyridin-4-yl acetate,ethyl pyridine-4-acetate,ethyl pyridin-4-ylacetate,4-pyridineacetic acid ethyl ester,4-pyridineacetic acid, ethyl ester,ethyl 2-4-pyridyl acetate,4-pyridylacetic acid ethyl ester,ethyl 4-pyridineacetate,ethyl-4-pyridylacetate PubChem CID: 736321 IUPAC Name: ethyl 2-pyridin-4-ylacetate SMILES: CCOC(=O)CC1=CC=NC=C1
| PubChem CID | 736321 |
|---|---|
| CAS | 54401-85-3 |
| Molecular Weight (g/mol) | 165.192 |
| MDL Number | MFCD00051830 |
| SMILES | CCOC(=O)CC1=CC=NC=C1 |
| Synonym | ethyl 4-pyridylacetate,ethyl 2-pyridin-4-yl acetate,ethyl pyridine-4-acetate,ethyl pyridin-4-ylacetate,4-pyridineacetic acid ethyl ester,4-pyridineacetic acid, ethyl ester,ethyl 2-4-pyridyl acetate,4-pyridylacetic acid ethyl ester,ethyl 4-pyridineacetate,ethyl-4-pyridylacetate |
| IUPAC Name | ethyl 2-pyridin-4-ylacetate |
| InChI Key | QVLJLWHOILVHJJ-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO2 |