Organic acids and derivatives
Filtered Search Results
Lithium trifluoromethanesulfonate, 98%
CAS: 33454-82-9 Molecular Formula: CF3LiO3S Molecular Weight (g/mol): 156.01 MDL Number: MFCD00013227 InChI Key: MCVFFRWZNYZUIJ-UHFFFAOYSA-M Synonym: lithium trifluoromethanesulfonate,lithium triflate,li triflate,lithium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, lithium salt,unii-1c966kv50i,trifluoromethanesulfonic acid lithium salt,lithium 1+ ion trifluoromethanesulfonate,methanesulfonic acid, 1,1,1-trifluoro-, lithium salt 1:1,trifluoromethanesulfonic acid, lithium salt PubChem CID: 3664839 IUPAC Name: lithium;trifluoromethanesulfonate SMILES: [Li+].C(F)(F)(F)S(=O)(=O)[O-]
| PubChem CID | 3664839 |
|---|---|
| CAS | 33454-82-9 |
| Molecular Weight (g/mol) | 156.01 |
| MDL Number | MFCD00013227 |
| SMILES | [Li+].C(F)(F)(F)S(=O)(=O)[O-] |
| Synonym | lithium trifluoromethanesulfonate,lithium triflate,li triflate,lithium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, lithium salt,unii-1c966kv50i,trifluoromethanesulfonic acid lithium salt,lithium 1+ ion trifluoromethanesulfonate,methanesulfonic acid, 1,1,1-trifluoro-, lithium salt 1:1,trifluoromethanesulfonic acid, lithium salt |
| IUPAC Name | lithium;trifluoromethanesulfonate |
| InChI Key | MCVFFRWZNYZUIJ-UHFFFAOYSA-M |
| Molecular Formula | CF3LiO3S |
Indium(III) trifluoromethanesulfonate, 98%
CAS: 128008-30-0 Molecular Formula: C3F9InO9S3 Molecular Weight (g/mol): 562.03 MDL Number: MFCD00144478 InChI Key: UCYRAEIHXSVXPV-UHFFFAOYSA-K Synonym: indium iii trifluoromethanesulfonate,indium triflate,indium trifluoromethanesulphonate,indium 3+ tritriflate,indium 3+ ; trifluoromethanesulfonate,indium iii triflate,indium iii trifluoromethanesulphonate,acmc-209bda,in tfa 3,ksc491q8t PubChem CID: 2734680 IUPAC Name: indium(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[In+3]
| PubChem CID | 2734680 |
|---|---|
| CAS | 128008-30-0 |
| Molecular Weight (g/mol) | 562.03 |
| MDL Number | MFCD00144478 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[In+3] |
| Synonym | indium iii trifluoromethanesulfonate,indium triflate,indium trifluoromethanesulphonate,indium 3+ tritriflate,indium 3+ ; trifluoromethanesulfonate,indium iii triflate,indium iii trifluoromethanesulphonate,acmc-209bda,in tfa 3,ksc491q8t |
| IUPAC Name | indium(3+);trifluoromethanesulfonate |
| InChI Key | UCYRAEIHXSVXPV-UHFFFAOYSA-K |
| Molecular Formula | C3F9InO9S3 |
1-Methyl-2-benzimidazolinone, 98%
CAS: 1849-01-0 Molecular Formula: C8H8N2O Molecular Weight (g/mol): 148.17 MDL Number: MFCD00142654 InChI Key: PYEHNKXDXBNHQQ-UHFFFAOYSA-N Synonym: 1-methyl-2-benzimidazolinone,1-methyl-1h-benzo d imidazol-2 3h-one,1-methyl-1,3-dihydro-2h-benzimidazol-2-one,1,3-dihydro-1-methyl-2h-benzimidazol-2-one,2h-benzimidazol-2-one, 1,3-dihydro-1-methyl,1-methyl-2,3-dihydro-1h-1,3-benzodiazol-2-one,1-methyl-3h-1,3-benzodiazol-2-one,n-methylbenzimidazolone,1-methylbenzimidazolone,n-methylbenzimidazolinone PubChem CID: 590540 IUPAC Name: 3-methyl-1H-benzimidazol-2-one SMILES: CN1C(=O)NC2=CC=CC=C12
| PubChem CID | 590540 |
|---|---|
| CAS | 1849-01-0 |
| Molecular Weight (g/mol) | 148.17 |
| MDL Number | MFCD00142654 |
| SMILES | CN1C(=O)NC2=CC=CC=C12 |
| Synonym | 1-methyl-2-benzimidazolinone,1-methyl-1h-benzo d imidazol-2 3h-one,1-methyl-1,3-dihydro-2h-benzimidazol-2-one,1,3-dihydro-1-methyl-2h-benzimidazol-2-one,2h-benzimidazol-2-one, 1,3-dihydro-1-methyl,1-methyl-2,3-dihydro-1h-1,3-benzodiazol-2-one,1-methyl-3h-1,3-benzodiazol-2-one,n-methylbenzimidazolone,1-methylbenzimidazolone,n-methylbenzimidazolinone |
| IUPAC Name | 3-methyl-1H-benzimidazol-2-one |
| InChI Key | PYEHNKXDXBNHQQ-UHFFFAOYSA-N |
| Molecular Formula | C8H8N2O |
Ethyl 2-amino-4-methylthiophene-3-carboxylate, 98+%
CAS: 43088-42-2 Molecular Formula: C8H11NO2S Molecular Weight (g/mol): 185.241 MDL Number: MFCD00051669 InChI Key: ILYCZKOBLRJJSW-UHFFFAOYSA-N Synonym: 2-amino-4-methylthiophene-3-carboxylic acid ethyl ester,2-amino-4-methyl-thiophene-3-carboxylic acid ethyl ester,3-thiophenecarboxylic acid, 2-amino-4-methyl-, ethyl ester,ethyl2-amino-4-methylthiophene-3-carboxylate,ethyl 2-amino-4-methyl-3-thiophenecarboxylate,acmc-20a9ux,maybridge1_003755,2-amino-4-methyl-3-ethoxycarbonyl-thiophene,ethyl 2-amino4-methylthiophene-3-carboxylate,2-amino-3-ethoxycarbonyl-4-methylthiophene PubChem CID: 521132 IUPAC Name: ethyl 2-amino-4-methylthiophene-3-carboxylate SMILES: CCOC(=O)C1=C(SC=C1C)N
| PubChem CID | 521132 |
|---|---|
| CAS | 43088-42-2 |
| Molecular Weight (g/mol) | 185.241 |
| MDL Number | MFCD00051669 |
| SMILES | CCOC(=O)C1=C(SC=C1C)N |
| Synonym | 2-amino-4-methylthiophene-3-carboxylic acid ethyl ester,2-amino-4-methyl-thiophene-3-carboxylic acid ethyl ester,3-thiophenecarboxylic acid, 2-amino-4-methyl-, ethyl ester,ethyl2-amino-4-methylthiophene-3-carboxylate,ethyl 2-amino-4-methyl-3-thiophenecarboxylate,acmc-20a9ux,maybridge1_003755,2-amino-4-methyl-3-ethoxycarbonyl-thiophene,ethyl 2-amino4-methylthiophene-3-carboxylate,2-amino-3-ethoxycarbonyl-4-methylthiophene |
| IUPAC Name | ethyl 2-amino-4-methylthiophene-3-carboxylate |
| InChI Key | ILYCZKOBLRJJSW-UHFFFAOYSA-N |
| Molecular Formula | C8H11NO2S |
Ethyl dodecanoate, 98%
CAS: 106-33-2 Molecular Formula: C14H28O2 Molecular Weight (g/mol): 228.38 MDL Number: MFCD00015065 InChI Key: MMXKVMNBHPAILY-UHFFFAOYSA-N Synonym: ethyl laurate,dodecanoic acid, ethyl ester,ethyl laurinate,ethyl dodecylate,lauric acid ethyl ester,lauric acid, ethyl ester,ethyl laurate natural,dodecanoic acid ethyl ester,ethyl n-dodecanote,unii-f389d4md5k PubChem CID: 7800 ChEBI: CHEBI:87427 IUPAC Name: ethyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCC
| PubChem CID | 7800 |
|---|---|
| CAS | 106-33-2 |
| Molecular Weight (g/mol) | 228.38 |
| ChEBI | CHEBI:87427 |
| MDL Number | MFCD00015065 |
| SMILES | CCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl laurate,dodecanoic acid, ethyl ester,ethyl laurinate,ethyl dodecylate,lauric acid ethyl ester,lauric acid, ethyl ester,ethyl laurate natural,dodecanoic acid ethyl ester,ethyl n-dodecanote,unii-f389d4md5k |
| IUPAC Name | ethyl dodecanoate |
| InChI Key | MMXKVMNBHPAILY-UHFFFAOYSA-N |
| Molecular Formula | C14H28O2 |
Ethyl 4-bromocrotonate, tech. 80%
CAS: 37746-78-4 Molecular Formula: C6H9BrO2 Molecular Weight (g/mol): 193.04 MDL Number: MFCD00000247 InChI Key: FHGRPBSDPBRTLS-ONEGZZNKSA-N Synonym: ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate PubChem CID: 5373944 IUPAC Name: ethyl (E)-4-bromobut-2-enoate SMILES: CCOC(=O)C=CCBr
| PubChem CID | 5373944 |
|---|---|
| CAS | 37746-78-4 |
| Molecular Weight (g/mol) | 193.04 |
| MDL Number | MFCD00000247 |
| SMILES | CCOC(=O)C=CCBr |
| Synonym | ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate |
| IUPAC Name | ethyl (E)-4-bromobut-2-enoate |
| InChI Key | FHGRPBSDPBRTLS-ONEGZZNKSA-N |
| Molecular Formula | C6H9BrO2 |
1,3-Dimethylurea, 98%
CAS: 96-31-1 Molecular Formula: C3H8N2O Molecular Weight (g/mol): 88.11 MDL Number: MFCD00008286 InChI Key: MGJKQDOBUOMPEZ-UHFFFAOYSA-N Synonym: n,n'-dimethylurea,sym-dimethylurea,urea, n,n'-dimethyl,dimethylurea,symmetric dimethylurea,urea, 1,3-dimethyl,n,n'-dimethylharnstoff,1,3-dimethyl urea,n,n'-dimethylharnstoff german,unii-wam6dr9i4x PubChem CID: 7293 ChEBI: CHEBI:80472 IUPAC Name: 1,3-dimethylurea SMILES: CNC(=O)NC
| PubChem CID | 7293 |
|---|---|
| CAS | 96-31-1 |
| Molecular Weight (g/mol) | 88.11 |
| ChEBI | CHEBI:80472 |
| MDL Number | MFCD00008286 |
| SMILES | CNC(=O)NC |
| Synonym | n,n'-dimethylurea,sym-dimethylurea,urea, n,n'-dimethyl,dimethylurea,symmetric dimethylurea,urea, 1,3-dimethyl,n,n'-dimethylharnstoff,1,3-dimethyl urea,n,n'-dimethylharnstoff german,unii-wam6dr9i4x |
| IUPAC Name | 1,3-dimethylurea |
| InChI Key | MGJKQDOBUOMPEZ-UHFFFAOYSA-N |
| Molecular Formula | C3H8N2O |
Ibuprofen Impurity B, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
Isopropyl Acetate, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for applications in quality control. Provides pharma laboratories and manufacturers with a convenient, cost-effective alternative to the preparation of in-house working standards.
| Boiling Point | 85°C to 91°C (literature) |
|---|---|
| Linear Formula | CH3COOCH(CH3)2 |
| Grade | Certified Reference Material |
| Vapor Pressure | 47 mmHg (20°C) |
| Vapor Density | 3.5 (vs air) |
| CAS | 108-21-4 |
| MDL Number | MFCD00008877 |
| Flash Point | 4°C (Not applicable) |
| Health Hazard 1 | H225 - H319 - H336 |
| Refractive Index | n20/D 1.377 (literature) |
| Synonym | Isopropyl Acetate; Acetic Acid Isopropyl Ester |
| Molecular Formula | C5H10O2 |
| Formula Weight | 102.13 |
| Melting Point | -73°C (literature) |
Isatoic anhydride, 98%
CAS: 118-48-9 Molecular Formula: C8H5NO3 Molecular Weight (g/mol): 163.13 MDL Number: MFCD00006700 InChI Key: TXJUTRJFNRYTHH-UHFFFAOYSA-N Synonym: isatoic anhydride,2h-3,1-benzoxazine-2,4 1h-dione,1h-benzo d 1,3 oxazine-2,4-dione,isatoic acid anhydride,4h-3,1-benzoxazine-2,4 1h-dione,isato acid anhydride,n-carboxyanthranilic anhydride,unii-r8tfa74y4u,3,1-benzoxazine-2,4 1h-dione,anthranilic acid, n-carboxy-, cyclic anhydride PubChem CID: 8359 SMILES: O=C1NC2=CC=CC=C2C(=O)O1
| PubChem CID | 8359 |
|---|---|
| CAS | 118-48-9 |
| Molecular Weight (g/mol) | 163.13 |
| MDL Number | MFCD00006700 |
| SMILES | O=C1NC2=CC=CC=C2C(=O)O1 |
| Synonym | isatoic anhydride,2h-3,1-benzoxazine-2,4 1h-dione,1h-benzo d 1,3 oxazine-2,4-dione,isatoic acid anhydride,4h-3,1-benzoxazine-2,4 1h-dione,isato acid anhydride,n-carboxyanthranilic anhydride,unii-r8tfa74y4u,3,1-benzoxazine-2,4 1h-dione,anthranilic acid, n-carboxy-, cyclic anhydride |
| InChI Key | TXJUTRJFNRYTHH-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO3 |
3H-Tetrafluoropropionic acid, 97%
CAS: 756-09-2 Molecular Formula: C3H2F4O2 Molecular Weight (g/mol): 146.041 MDL Number: MFCD00054686 InChI Key: PXRROZVNOOEPPZ-UHFFFAOYSA-N Synonym: flupropanate,3h-tetrafluoropropionic acid,2,2,3,3-tetrafluoropropionic acid,unii-376ks3j2q6,propanoic acid, 2,2,3,3-tetrafluoro,flupropanate iso,tetrafluoropropionic acid,pxrrozvnooeppz-uhfffaoysa PubChem CID: 69789 ChEBI: CHEBI:82013 IUPAC Name: 2,2,3,3-tetrafluoropropanoic acid SMILES: C(C(C(=O)O)(F)F)(F)F
| PubChem CID | 69789 |
|---|---|
| CAS | 756-09-2 |
| Molecular Weight (g/mol) | 146.041 |
| ChEBI | CHEBI:82013 |
| MDL Number | MFCD00054686 |
| SMILES | C(C(C(=O)O)(F)F)(F)F |
| Synonym | flupropanate,3h-tetrafluoropropionic acid,2,2,3,3-tetrafluoropropionic acid,unii-376ks3j2q6,propanoic acid, 2,2,3,3-tetrafluoro,flupropanate iso,tetrafluoropropionic acid,pxrrozvnooeppz-uhfffaoysa |
| IUPAC Name | 2,2,3,3-tetrafluoropropanoic acid |
| InChI Key | PXRROZVNOOEPPZ-UHFFFAOYSA-N |
| Molecular Formula | C3H2F4O2 |
5,6-Dimethyl-2-benzimidazolinone, 98%
CAS: 2033-30-9 Molecular Formula: C9H10N2O Molecular Weight (g/mol): 162.192 MDL Number: MFCD00051725 InChI Key: ORWJLFLEIZBRBR-UHFFFAOYSA-N Synonym: 5,6-dimethyl-1h-benzo d imidazol-2 3h-one,5,6-dimethyl-2-benzimidazolinone,1,3-dihydro-5,6-dimethyl-2h-benzimidazol-2-one,5,6-dimethylbenzimidazolin-2-one,2h-benzimidazol-2-one, 1,3-dihydro-5,6-dimethyl,2h-benzimidazol-2-one,1,3-dihydro-5,6-dimethyl,5,6-dimethyl-3-hydrobenzimidazol-2-one,5,6-dimethyl-1,3-dihydro-1,3-benzodiazol-2-one,5,6-dimethyl-1,3-dihydro-benzoimidazol-2-one,acmc-1cmtt PubChem CID: 74853 IUPAC Name: 5,6-dimethyl-1,3-dihydrobenzimidazol-2-one SMILES: CC1=CC2=C(C=C1C)NC(=O)N2
| PubChem CID | 74853 |
|---|---|
| CAS | 2033-30-9 |
| Molecular Weight (g/mol) | 162.192 |
| MDL Number | MFCD00051725 |
| SMILES | CC1=CC2=C(C=C1C)NC(=O)N2 |
| Synonym | 5,6-dimethyl-1h-benzo d imidazol-2 3h-one,5,6-dimethyl-2-benzimidazolinone,1,3-dihydro-5,6-dimethyl-2h-benzimidazol-2-one,5,6-dimethylbenzimidazolin-2-one,2h-benzimidazol-2-one, 1,3-dihydro-5,6-dimethyl,2h-benzimidazol-2-one,1,3-dihydro-5,6-dimethyl,5,6-dimethyl-3-hydrobenzimidazol-2-one,5,6-dimethyl-1,3-dihydro-1,3-benzodiazol-2-one,5,6-dimethyl-1,3-dihydro-benzoimidazol-2-one,acmc-1cmtt |
| IUPAC Name | 5,6-dimethyl-1,3-dihydrobenzimidazol-2-one |
| InChI Key | ORWJLFLEIZBRBR-UHFFFAOYSA-N |
| Molecular Formula | C9H10N2O |
N-Methylphthalimide, 98%
CAS: 550-44-7 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 InChI Key: ZXLYYQUMYFHCLQ-UHFFFAOYSA-N Synonym: n-methylphthalimide,2-methylisoindoline-1,3-dione,phthalimide, n-methyl,1h-isoindole-1,3 2h-dione, 2-methyl,unii-647up45j2u,2-methyl-1h-isoindole-1,3 2h-dione,n-methyl phthalimide,dsstox_cid_7198,acmc-1b11u PubChem CID: 11074 IUPAC Name: 2-methylisoindole-1,3-dione SMILES: CN1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 11074 |
|---|---|
| CAS | 550-44-7 |
| Molecular Weight (g/mol) | 161.16 |
| SMILES | CN1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-methylphthalimide,2-methylisoindoline-1,3-dione,phthalimide, n-methyl,1h-isoindole-1,3 2h-dione, 2-methyl,unii-647up45j2u,2-methyl-1h-isoindole-1,3 2h-dione,n-methyl phthalimide,dsstox_cid_7198,acmc-1b11u |
| IUPAC Name | 2-methylisoindole-1,3-dione |
| InChI Key | ZXLYYQUMYFHCLQ-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
Triethyl 2-phosphonobutyrate, 98%, Thermo Scientific Chemicals
CAS: 17145-91-4 Molecular Formula: C10H21O5P Molecular Weight (g/mol): 252.25 MDL Number: MFCD00041347 InChI Key: GYUCVQSNZFRDRL-UHFFFAOYSA-N Synonym: triethyl 2-phosphonobutyrate,ethyl 2-diethoxyphosphoryl butanoate,ethyl 2-diethylphosphono butyrate,butanoic acid, 2-diethoxyphosphinyl-, ethyl ester,triethyl 2-phosphonobutanoate,.alpha.-diethylphosphono butanoic acid, ethyl ester,butyric acid, 2-phosphono-, triethyl ester,butyric acid, triethyl ester,triethyl 2-phosphonobu-tyrate,triethyl-2-phosphono butyrate PubChem CID: 229053 IUPAC Name: ethyl 2-diethoxyphosphorylbutanoate SMILES: CCC(C(=O)OCC)P(=O)(OCC)OCC
| PubChem CID | 229053 |
|---|---|
| CAS | 17145-91-4 |
| Molecular Weight (g/mol) | 252.25 |
| MDL Number | MFCD00041347 |
| SMILES | CCC(C(=O)OCC)P(=O)(OCC)OCC |
| Synonym | triethyl 2-phosphonobutyrate,ethyl 2-diethoxyphosphoryl butanoate,ethyl 2-diethylphosphono butyrate,butanoic acid, 2-diethoxyphosphinyl-, ethyl ester,triethyl 2-phosphonobutanoate,.alpha.-diethylphosphono butanoic acid, ethyl ester,butyric acid, 2-phosphono-, triethyl ester,butyric acid, triethyl ester,triethyl 2-phosphonobu-tyrate,triethyl-2-phosphono butyrate |
| IUPAC Name | ethyl 2-diethoxyphosphorylbutanoate |
| InChI Key | GYUCVQSNZFRDRL-UHFFFAOYSA-N |
| Molecular Formula | C10H21O5P |
Methanephosphonic acid, 98%, Thermo Scientific Chemicals
CAS: 993-13-5 Molecular Formula: CH5O3P Molecular Weight (g/mol): 96.02 MDL Number: MFCD00002137 InChI Key: YACKEPLHDIMKIO-UHFFFAOYSA-N Synonym: methanephosphonic acid,phosphonic acid, methyl,methyl phosphonic acid,unii-329w4ym10z,phosphonomethyl group,ester group,phosphonomethyl,acmc-20ake9,d02fxw,methylphosphonic acid PubChem CID: 13818 ChEBI: CHEBI:45129 IUPAC Name: methylphosphonic acid SMILES: CP(O)(O)=O
| PubChem CID | 13818 |
|---|---|
| CAS | 993-13-5 |
| Molecular Weight (g/mol) | 96.02 |
| ChEBI | CHEBI:45129 |
| MDL Number | MFCD00002137 |
| SMILES | CP(O)(O)=O |
| Synonym | methanephosphonic acid,phosphonic acid, methyl,methyl phosphonic acid,unii-329w4ym10z,phosphonomethyl group,ester group,phosphonomethyl,acmc-20ake9,d02fxw,methylphosphonic acid |
| IUPAC Name | methylphosphonic acid |
| InChI Key | YACKEPLHDIMKIO-UHFFFAOYSA-N |
| Molecular Formula | CH5O3P |