Organic acids and derivatives
Filtered Search Results
Triflumuron, 98+%, Thermo Scientific Chemicals
CAS: 64628-44-0 Molecular Formula: C15H10ClF3N2O3 Molecular Weight (g/mol): 358.701 MDL Number: MFCD00072496 InChI Key: XAIPTRIXGHTTNT-UHFFFAOYSA-N Synonym: triflumuron,alsystin,trifluron,mascot,alsystine,triflumuron iso,caswell no. 217c,bay-sir 8514,unii-3ft64dyg8k,bay-vi 7533 PubChem CID: 47445 ChEBI: CHEBI:39388 IUPAC Name: 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide SMILES: C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)Cl
| PubChem CID | 47445 |
|---|---|
| CAS | 64628-44-0 |
| Molecular Weight (g/mol) | 358.701 |
| ChEBI | CHEBI:39388 |
| MDL Number | MFCD00072496 |
| SMILES | C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)Cl |
| Synonym | triflumuron,alsystin,trifluron,mascot,alsystine,triflumuron iso,caswell no. 217c,bay-sir 8514,unii-3ft64dyg8k,bay-vi 7533 |
| IUPAC Name | 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide |
| InChI Key | XAIPTRIXGHTTNT-UHFFFAOYSA-N |
| Molecular Formula | C15H10ClF3N2O3 |
Propylene Carbonate, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 108-32-7
| CAS | 108-32-7 |
|---|
Methylurea, 97%
CAS: 598-50-5 Molecular Formula: C2H6N2O Molecular Weight (g/mol): 74.08 MDL Number: MFCD00007950 InChI Key: XGEGHDBEHXKFPX-UHFFFAOYSA-N Synonym: 1-methylurea,n-methylurea,monomethylurea,urea, methyl,methyl urea,urea, n-methyl,methylmocovina,methylmocovina czech,methylharnstoff german,n-methyl urea PubChem CID: 11719 ChEBI: CHEBI:44383 IUPAC Name: methylurea SMILES: CNC(=O)N
| PubChem CID | 11719 |
|---|---|
| CAS | 598-50-5 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:44383 |
| MDL Number | MFCD00007950 |
| SMILES | CNC(=O)N |
| Synonym | 1-methylurea,n-methylurea,monomethylurea,urea, methyl,methyl urea,urea, n-methyl,methylmocovina,methylmocovina czech,methylharnstoff german,n-methyl urea |
| IUPAC Name | methylurea |
| InChI Key | XGEGHDBEHXKFPX-UHFFFAOYSA-N |
| Molecular Formula | C2H6N2O |
Aminoguanidine bicarbonate, 98.5%
CAS: 2582-30-1 Molecular Formula: CH6N4·H2CO3 Molecular Weight (g/mol): 136.11 InChI Key: OTXHZHQQWQTQMW-UHFFFAOYSA-N Synonym: aminoguanidine bicarbonate,aminoguanidine hydrogen carbonate,aminoguanidinium bicarbonate,aminoguanidine hydrocarbonate,aminoguanidine carbonate 1:1,aminoguanidium hydrogen carbonate,n1-aminoguanidine carbonate 1:1,aminoguanidine hydrogencarbonate,aminoguanidinebicarbonate,hydrazinecarboximidamide carbonate PubChem CID: 164944 IUPAC Name: 2-aminoguanidine;carbonic acid SMILES: C(=NN)(N)N.C(=O)(O)O
| PubChem CID | 164944 |
|---|---|
| CAS | 2582-30-1 |
| Molecular Weight (g/mol) | 136.11 |
| SMILES | C(=NN)(N)N.C(=O)(O)O |
| Synonym | aminoguanidine bicarbonate,aminoguanidine hydrogen carbonate,aminoguanidinium bicarbonate,aminoguanidine hydrocarbonate,aminoguanidine carbonate 1:1,aminoguanidium hydrogen carbonate,n1-aminoguanidine carbonate 1:1,aminoguanidine hydrogencarbonate,aminoguanidinebicarbonate,hydrazinecarboximidamide carbonate |
| IUPAC Name | 2-aminoguanidine;carbonic acid |
| InChI Key | OTXHZHQQWQTQMW-UHFFFAOYSA-N |
| Molecular Formula | CH6N4·H2CO3 |
Phloroglucinol, Anhydrous, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 108-73-6
| CAS | 108-73-6 |
|---|
Phloroglucinol, Dihydrate, BAKER™, J.T. Baker™
CAS: 6099-90-7 Molecular Formula: C6H10O5 Molecular Weight (g/mol): 162.141 InChI Key: MPYXTIHPALVENR-UHFFFAOYSA-N Synonym: phloroglucinol dihydrate,benzene-1,3,5-triol dihydrate,1,3,5-trihydroxybenzene dihydrate,1,3,5-benzenetriol, dihydrate,phloroglucinol, dihydrate,sym-trihydroxybenze,unii-0x7b22brg1,ccris 6521,1,3,5-benzoltrioldihydrat,phloroglucinoldihydrate PubChem CID: 80196 IUPAC Name: benzene-1,3,5-triol;dihydrate SMILES: C1=C(C=C(C=C1O)O)O.O.O
| PubChem CID | 80196 |
|---|---|
| CAS | 6099-90-7 |
| Molecular Weight (g/mol) | 162.141 |
| SMILES | C1=C(C=C(C=C1O)O)O.O.O |
| Synonym | phloroglucinol dihydrate,benzene-1,3,5-triol dihydrate,1,3,5-trihydroxybenzene dihydrate,1,3,5-benzenetriol, dihydrate,phloroglucinol, dihydrate,sym-trihydroxybenze,unii-0x7b22brg1,ccris 6521,1,3,5-benzoltrioldihydrat,phloroglucinoldihydrate |
| IUPAC Name | benzene-1,3,5-triol;dihydrate |
| InChI Key | MPYXTIHPALVENR-UHFFFAOYSA-N |
| Molecular Formula | C6H10O5 |
Methyl isobutyrate, 99%
CAS: 547-63-7 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00008914 InChI Key: BHIWKHZACMWKOJ-UHFFFAOYSA-N Synonym: methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne PubChem CID: 11039 ChEBI: CHEBI:73689 IUPAC Name: methyl 2-methylpropanoate SMILES: CC(C)C(=O)OC
| PubChem CID | 11039 |
|---|---|
| CAS | 547-63-7 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:73689 |
| MDL Number | MFCD00008914 |
| SMILES | CC(C)C(=O)OC |
| Synonym | methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne |
| IUPAC Name | methyl 2-methylpropanoate |
| InChI Key | BHIWKHZACMWKOJ-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Methyl 4-[3-(dimethylamino)propoxy]benzoate, 97%, Thermo Scientific™
CAS: 190660-97-0 Molecular Formula: C13H19NO3 Molecular Weight (g/mol): 237.30 MDL Number: MFCD06203847 InChI Key: SRXQDDFKGDLAJM-UHFFFAOYSA-N Synonym: methyl 4-3-dimethylamino propoxy benzoate,4-3-dimethylamino-propoxy-benzoic acid methyl ester,methyl 4-3-n,n-dimethylamino-1-propyloxy benzoate,methyl-4-3-n,n-dimethylamino-1-propyloxy benzoate PubChem CID: 18508114 IUPAC Name: methyl 4-[3-(dimethylamino)propoxy]benzoate SMILES: COC(=O)C1=CC=C(OCCCN(C)C)C=C1
| PubChem CID | 18508114 |
|---|---|
| CAS | 190660-97-0 |
| Molecular Weight (g/mol) | 237.30 |
| MDL Number | MFCD06203847 |
| SMILES | COC(=O)C1=CC=C(OCCCN(C)C)C=C1 |
| Synonym | methyl 4-3-dimethylamino propoxy benzoate,4-3-dimethylamino-propoxy-benzoic acid methyl ester,methyl 4-3-n,n-dimethylamino-1-propyloxy benzoate,methyl-4-3-n,n-dimethylamino-1-propyloxy benzoate |
| IUPAC Name | methyl 4-[3-(dimethylamino)propoxy]benzoate |
| InChI Key | SRXQDDFKGDLAJM-UHFFFAOYSA-N |
| Molecular Formula | C13H19NO3 |
Methyl 3-cyclohexenecarboxylate, 97%, Thermo Scientific™
CAS: 6493-77-2 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.18 MDL Number: MFCD00053266 InChI Key: IPUNVLFESXFVFH-UHFFFAOYNA-N Synonym: methyl cyclohex-3-enecarboxylate,3-cyclohexene-1-carboxylic acid methyl ester,methyl 3-cyclohexenecarboxylate,3-cyclohexene-1-carboxylic acid, methyl ester,methyl 3-cyclohexene-1-carboxylate,1-carbomethoxy-3-cyclohexene,methyl 4-cyclohexenecarboxylate,methyl 1,2,3,6-tetrahydrobenzoate,1,3-butadiene-methyl acrylate adduct,acmc-1bity PubChem CID: 96926 IUPAC Name: methyl cyclohex-3-ene-1-carboxylate SMILES: COC(=O)C1CCC=CC1
| PubChem CID | 96926 |
|---|---|
| CAS | 6493-77-2 |
| Molecular Weight (g/mol) | 140.18 |
| MDL Number | MFCD00053266 |
| SMILES | COC(=O)C1CCC=CC1 |
| Synonym | methyl cyclohex-3-enecarboxylate,3-cyclohexene-1-carboxylic acid methyl ester,methyl 3-cyclohexenecarboxylate,3-cyclohexene-1-carboxylic acid, methyl ester,methyl 3-cyclohexene-1-carboxylate,1-carbomethoxy-3-cyclohexene,methyl 4-cyclohexenecarboxylate,methyl 1,2,3,6-tetrahydrobenzoate,1,3-butadiene-methyl acrylate adduct,acmc-1bity |
| IUPAC Name | methyl cyclohex-3-ene-1-carboxylate |
| InChI Key | IPUNVLFESXFVFH-UHFFFAOYNA-N |
| Molecular Formula | C8H12O2 |
Isopropenyl acetate, 99%
CAS: 108-22-5 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00008709 InChI Key: HETCEOQFVDFGSY-UHFFFAOYSA-N Synonym: isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate PubChem CID: 7916 IUPAC Name: prop-1-en-2-yl acetate SMILES: CC(=C)OC(C)=O
| PubChem CID | 7916 |
|---|---|
| CAS | 108-22-5 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00008709 |
| SMILES | CC(=C)OC(C)=O |
| Synonym | isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate |
| IUPAC Name | prop-1-en-2-yl acetate |
| InChI Key | HETCEOQFVDFGSY-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
1,1-Cyclopropanedicarboxylic acid monomethyl ester, 97%
CAS: 113020-21-6 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.126 MDL Number: MFCD06800496 InChI Key: IZYOHLOUZVEIOS-UHFFFAOYSA-N Synonym: 1-methoxycarbonyl cyclopropanecarboxylic acid,1,1-cyclopropanedicarboxylic acid monomethyl ester,1-methoxycarbonyl cyclopropane-1-carboxylic acid,cyclopropane-1,1-dicarboxylic acid, methyl ester,1-methoxycarbonylcyclopropanecarboxylic acid,1,1-cyclopropanedicarboxylic acid-1-methyl ester,1-methoxycarbonyl cyclopropanecarboxylicacid,acmc-1c7y7,methyl cyclopropane-1,1-dicarboxylate,1-methoxycarbonylcyclopropane carboxylic acid PubChem CID: 13861823 IUPAC Name: 1-methoxycarbonylcyclopropane-1-carboxylic acid SMILES: COC(=O)C1(CC1)C(=O)O
| PubChem CID | 13861823 |
|---|---|
| CAS | 113020-21-6 |
| Molecular Weight (g/mol) | 144.126 |
| MDL Number | MFCD06800496 |
| SMILES | COC(=O)C1(CC1)C(=O)O |
| Synonym | 1-methoxycarbonyl cyclopropanecarboxylic acid,1,1-cyclopropanedicarboxylic acid monomethyl ester,1-methoxycarbonyl cyclopropane-1-carboxylic acid,cyclopropane-1,1-dicarboxylic acid, methyl ester,1-methoxycarbonylcyclopropanecarboxylic acid,1,1-cyclopropanedicarboxylic acid-1-methyl ester,1-methoxycarbonyl cyclopropanecarboxylicacid,acmc-1c7y7,methyl cyclopropane-1,1-dicarboxylate,1-methoxycarbonylcyclopropane carboxylic acid |
| IUPAC Name | 1-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChI Key | IZYOHLOUZVEIOS-UHFFFAOYSA-N |
| Molecular Formula | C6H8O4 |
Glycidyl methacrylate, 97%, stabilized
CAS: 106-91-2 InChI Key: VOZRXNHHFUQHIL-UHFFFAOYSA-N Synonym: glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane PubChem CID: 7837 IUPAC Name: oxiran-2-ylmethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC1CO1
| PubChem CID | 7837 |
|---|---|
| CAS | 106-91-2 |
| SMILES | CC(=C)C(=O)OCC1CO1 |
| Synonym | glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate |
| InChI Key | VOZRXNHHFUQHIL-UHFFFAOYSA-N |
2,2,3,4,4,4-Hexafluorobutyl methacrylate, 96%, stab.
CAS: 36405-47-7 Molecular Formula: C8H8F6O2 Molecular Weight (g/mol): 250.14 MDL Number: MFCD00042311 InChI Key: DFVPUWGVOPDJTC-UHFFFAOYSA-N Synonym: 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer PubChem CID: 549772 IUPAC Name: 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F
| PubChem CID | 549772 |
|---|---|
| CAS | 36405-47-7 |
| Molecular Weight (g/mol) | 250.14 |
| MDL Number | MFCD00042311 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| Synonym | 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate |
| InChI Key | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| Molecular Formula | C8H8F6O2 |
Mono-methyl phthalate, 98%
CAS: 4376-18-5 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002466 InChI Key: FNJSWIPFHMKRAT-UHFFFAOYSA-N Synonym: 2-methoxycarbonyl benzoic acid,methyl hydrogen phthalate,monomethyl phthalate,mono-methyl phthalate,phthalic acid monomethyl ester,o-methoxycarbonyl benzoic acid,monomethyl 1,2-benzenedicarboxylate,phthalic acid, monomethyl ester,monomethylphthalate,unii-2stt6d18jr PubChem CID: 20392 IUPAC Name: 2-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=CC=C1C(O)=O
| PubChem CID | 20392 |
|---|---|
| CAS | 4376-18-5 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00002466 |
| SMILES | COC(=O)C1=CC=CC=C1C(O)=O |
| Synonym | 2-methoxycarbonyl benzoic acid,methyl hydrogen phthalate,monomethyl phthalate,mono-methyl phthalate,phthalic acid monomethyl ester,o-methoxycarbonyl benzoic acid,monomethyl 1,2-benzenedicarboxylate,phthalic acid, monomethyl ester,monomethylphthalate,unii-2stt6d18jr |
| IUPAC Name | 2-methoxycarbonylbenzoic acid |
| InChI Key | FNJSWIPFHMKRAT-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
Methyl 2-fluoroacrylate, 95%, stab. with 1% BHT
CAS: 2343-89-7 Molecular Formula: C4H5FO2 Molecular Weight (g/mol): 104.08 MDL Number: MFCD04039286 InChI Key: ZTZJVAOTIOAZGZ-UHFFFAOYSA-N Synonym: methyl 2-fluoroacrylate,methyl-2-fluoroacrylate,2-fluoroacrylic acid methyl ester,methyl fluoroacrylate,2-propenoic acid, 2-fluoro-, methyl ester,methyl a-fluoroacrylate,pubchem12658,methyl alpha-fluoroacrylate,acmc-209g3b,ksc493a9d PubChem CID: 2782524 IUPAC Name: methyl 2-fluoroprop-2-enoate SMILES: COC(=O)C(=C)F
| PubChem CID | 2782524 |
|---|---|
| CAS | 2343-89-7 |
| Molecular Weight (g/mol) | 104.08 |
| MDL Number | MFCD04039286 |
| SMILES | COC(=O)C(=C)F |
| Synonym | methyl 2-fluoroacrylate,methyl-2-fluoroacrylate,2-fluoroacrylic acid methyl ester,methyl fluoroacrylate,2-propenoic acid, 2-fluoro-, methyl ester,methyl a-fluoroacrylate,pubchem12658,methyl alpha-fluoroacrylate,acmc-209g3b,ksc493a9d |
| IUPAC Name | methyl 2-fluoroprop-2-enoate |
| InChI Key | ZTZJVAOTIOAZGZ-UHFFFAOYSA-N |
| Molecular Formula | C4H5FO2 |