Organic acids and derivatives
Filtered Search Results
Ethylenediamine Tetraacetic Acid Disodium Salt ACS MP Biomedicals
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
5-Hydroxyquinoline, 99%
CAS: 578-67-6 Molecular Formula: C9H7NO Molecular Weight (g/mol): 145.161 MDL Number: MFCD00006792 InChI Key: GVNQVWJYDXOLST-UHFFFAOYSA-N Synonym: 5-hydroxyquinoline,quinolin-5-ol,5-quinolinol,5-chinolinol,ccris 4330,gyesayhwismzok-uhfffaoysa-n,5-hydroxyquinoline 5-quinolinol,quinolin-5-one,5-hyroxyquinoline,5-hydroxy quinoline PubChem CID: 11360 IUPAC Name: 1H-quinolin-5-one SMILES: C1=CC(=O)C2=CC=CNC2=C1
| PubChem CID | 11360 |
|---|---|
| CAS | 578-67-6 |
| Molecular Weight (g/mol) | 145.161 |
| MDL Number | MFCD00006792 |
| SMILES | C1=CC(=O)C2=CC=CNC2=C1 |
| Synonym | 5-hydroxyquinoline,quinolin-5-ol,5-quinolinol,5-chinolinol,ccris 4330,gyesayhwismzok-uhfffaoysa-n,5-hydroxyquinoline 5-quinolinol,quinolin-5-one,5-hyroxyquinoline,5-hydroxy quinoline |
| IUPAC Name | 1H-quinolin-5-one |
| InChI Key | GVNQVWJYDXOLST-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO |
Cyclohexylboronic acid pinacol ester, 97%
CAS: 87100-15-0 Molecular Formula: C12H23BO2 Molecular Weight (g/mol): 210.124 MDL Number: MFCD04038749 InChI Key: OUEVCDGYTKLNMJ-UHFFFAOYSA-N Synonym: cyclohexylboronic acid pinacol ester,1,3,2-dioxaborolane, 2-cyclohexyl-4,4,5,5-tetramethyl,cyclohexylboronic acid, pinacol ester,4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane,pubchem7924,cyclohexylboronic acid, pinacol eser,1-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane PubChem CID: 3668596 IUPAC Name: 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C2CCCCC2
| PubChem CID | 3668596 |
|---|---|
| CAS | 87100-15-0 |
| Molecular Weight (g/mol) | 210.124 |
| MDL Number | MFCD04038749 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCCC2 |
| Synonym | cyclohexylboronic acid pinacol ester,1,3,2-dioxaborolane, 2-cyclohexyl-4,4,5,5-tetramethyl,cyclohexylboronic acid, pinacol ester,4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane,pubchem7924,cyclohexylboronic acid, pinacol eser,1-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclohexane |
| IUPAC Name | 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | OUEVCDGYTKLNMJ-UHFFFAOYSA-N |
| Molecular Formula | C12H23BO2 |
p-Xylene-2-sulfonic Acid, Hydrate, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 609-54-1
| CAS | 609-54-1 |
|---|
Ethyl fluoroacetate, 97%, Thermo Scientific Chemicals
CAS: 459-72-3 Molecular Formula: C4H7FO2 Molecular Weight (g/mol): 106.1 MDL Number: MFCD00000450 InChI Key: VCYZVXRKYPKDQB-UHFFFAOYSA-N Synonym: ethyl fluoroacetate,ethyl monofluoroacetate,acetic acid, fluoro-, ethyl ester,fluoroacetic acid ethyl ester,unii-aus1l6um7b,ethylester kyseliny fluoroctove,monofluoroacetic acid ethyl ester,aus1l6um7b,ethylester kyseliny fluoroctove czech,acetic acid, 2-fluoro-, ethyl ester PubChem CID: 9988 IUPAC Name: ethyl 2-fluoroacetate SMILES: CCOC(=O)CF
| PubChem CID | 9988 |
|---|---|
| CAS | 459-72-3 |
| Molecular Weight (g/mol) | 106.1 |
| MDL Number | MFCD00000450 |
| SMILES | CCOC(=O)CF |
| Synonym | ethyl fluoroacetate,ethyl monofluoroacetate,acetic acid, fluoro-, ethyl ester,fluoroacetic acid ethyl ester,unii-aus1l6um7b,ethylester kyseliny fluoroctove,monofluoroacetic acid ethyl ester,aus1l6um7b,ethylester kyseliny fluoroctove czech,acetic acid, 2-fluoro-, ethyl ester |
| IUPAC Name | ethyl 2-fluoroacetate |
| InChI Key | VCYZVXRKYPKDQB-UHFFFAOYSA-N |
| Molecular Formula | C4H7FO2 |
Methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate, 95%, Thermo Scientific™
CAS: 69687-80-5 Molecular Formula: C8H11NO2 Molecular Weight (g/mol): 153.181 MDL Number: MFCD00203859 InChI Key: OQWZEJIISPYZPW-UHFFFAOYSA-N Synonym: methyl 2,5-dimethylpyrrole-3-carboxylate,1h-pyrrole-3-carboxylic acid, 2,5-dimethyl-, methyl ester,2,5-dimethyl-1h-pyrrole-3-carboxylic acid methyl ester,maybridge1_008495,acmc-1b2uc,2,5-dimethyl,4-carbomethoxy pyrrole,2,5-dimethylpyrrole-3-carboxylic acid methyl ester,1h-pyrrole-3-carboxylicacid,2,5-dimethyl-,methyl ester,1h-pyrrole-3-carboxylicacid, 2,5-dimethyl-, methyl ester PubChem CID: 592729 IUPAC Name: methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate SMILES: CC1=CC(=C(N1)C)C(=O)OC
| PubChem CID | 592729 |
|---|---|
| CAS | 69687-80-5 |
| Molecular Weight (g/mol) | 153.181 |
| MDL Number | MFCD00203859 |
| SMILES | CC1=CC(=C(N1)C)C(=O)OC |
| Synonym | methyl 2,5-dimethylpyrrole-3-carboxylate,1h-pyrrole-3-carboxylic acid, 2,5-dimethyl-, methyl ester,2,5-dimethyl-1h-pyrrole-3-carboxylic acid methyl ester,maybridge1_008495,acmc-1b2uc,2,5-dimethyl,4-carbomethoxy pyrrole,2,5-dimethylpyrrole-3-carboxylic acid methyl ester,1h-pyrrole-3-carboxylicacid,2,5-dimethyl-,methyl ester,1h-pyrrole-3-carboxylicacid, 2,5-dimethyl-, methyl ester |
| IUPAC Name | methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| InChI Key | OQWZEJIISPYZPW-UHFFFAOYSA-N |
| Molecular Formula | C8H11NO2 |
Methyl 2,4,6-trihydroxybenzoate, 98%
CAS: 3147-39-5 Molecular Formula: C8H8O5 Molecular Weight (g/mol): 184.147 MDL Number: MFCD00013969 InChI Key: AQDIJIAUYXOCGX-UHFFFAOYSA-N PubChem CID: 76600 IUPAC Name: methyl 2,4,6-trihydroxybenzoate SMILES: COC(=O)C1=C(C=C(C=C1O)O)O
| PubChem CID | 76600 |
|---|---|
| CAS | 3147-39-5 |
| Molecular Weight (g/mol) | 184.147 |
| MDL Number | MFCD00013969 |
| SMILES | COC(=O)C1=C(C=C(C=C1O)O)O |
| IUPAC Name | methyl 2,4,6-trihydroxybenzoate |
| InChI Key | AQDIJIAUYXOCGX-UHFFFAOYSA-N |
| Molecular Formula | C8H8O5 |
2-Ethylhexyl acetate, 99%
CAS: 103-09-3 Molecular Formula: C10H20O2 Molecular Weight (g/mol): 172.27 MDL Number: MFCD00027249 InChI Key: WOYWLLHHWAMFCB-UHFFFAOYNA-N Synonym: acetic acid, 2-ethylhexyl ester,2-ethyl-1-hexanol acetate,2-ethylhexyl ethanoate,2-ethyl-1-hexyl acetate,2-ethylhexanyl acetate,2-ethylhexylacetate,beta-ethylhexyl acetate,acetic acid 2-ethylhexyl ester,fema number 2806,2-ethylhexylester kyseliny octove PubChem CID: 7635 ChEBI: CHEBI:87392 IUPAC Name: 2-ethylhexyl acetate SMILES: CCCCC(CC)COC(C)=O
| PubChem CID | 7635 |
|---|---|
| CAS | 103-09-3 |
| Molecular Weight (g/mol) | 172.27 |
| ChEBI | CHEBI:87392 |
| MDL Number | MFCD00027249 |
| SMILES | CCCCC(CC)COC(C)=O |
| Synonym | acetic acid, 2-ethylhexyl ester,2-ethyl-1-hexanol acetate,2-ethylhexyl ethanoate,2-ethyl-1-hexyl acetate,2-ethylhexanyl acetate,2-ethylhexylacetate,beta-ethylhexyl acetate,acetic acid 2-ethylhexyl ester,fema number 2806,2-ethylhexylester kyseliny octove |
| IUPAC Name | 2-ethylhexyl acetate |
| InChI Key | WOYWLLHHWAMFCB-UHFFFAOYNA-N |
| Molecular Formula | C10H20O2 |
3-Carboxy-2-methoxybenzeneboronic acid, 98%, Thermo Scientific Chemicals
CAS: 913836-10-9 Molecular Formula: C8H9BO5 Molecular Weight (g/mol): 195.965 MDL Number: MFCD09027237 InChI Key: QUWLFFYGKXZCER-UHFFFAOYSA-N Synonym: benzoicacid, 3-borono-2-methoxy,3-carboxy-2-methoxyphenylboronic acid,3-dihydroxyboranyl-2-methoxybenzoic acid,3-carboxy-2-methoxybenzeneboronic acid,acmc-209rau,2-methoxy-3-dihydroxyboryl benzoic acid PubChem CID: 44119386 IUPAC Name: 3-borono-2-methoxybenzoic acid SMILES: B(C1=C(C(=CC=C1)C(=O)O)OC)(O)O
| PubChem CID | 44119386 |
|---|---|
| CAS | 913836-10-9 |
| Molecular Weight (g/mol) | 195.965 |
| MDL Number | MFCD09027237 |
| SMILES | B(C1=C(C(=CC=C1)C(=O)O)OC)(O)O |
| Synonym | benzoicacid, 3-borono-2-methoxy,3-carboxy-2-methoxyphenylboronic acid,3-dihydroxyboranyl-2-methoxybenzoic acid,3-carboxy-2-methoxybenzeneboronic acid,acmc-209rau,2-methoxy-3-dihydroxyboryl benzoic acid |
| IUPAC Name | 3-borono-2-methoxybenzoic acid |
| InChI Key | QUWLFFYGKXZCER-UHFFFAOYSA-N |
| Molecular Formula | C8H9BO5 |
DL-2-Hydroxybutyric acid sodium salt, 97+%
CAS: 5094-24-6 Molecular Formula: C4H7NaO3 Molecular Weight (g/mol): 126.09 MDL Number: MFCD00004565 InChI Key: MOSCXNXKSOHVSQ-UHFFFAOYNA-M Synonym: sodium 2-hydroxybutanoate,sodium 2-hydroxybutyrate,sodium dl-2-hydroxybutyrate,2-hydroxybutyric acid sodium salt,dl-2-hydroxybutyric acid sodium salt,sodium hydroxybutyrate,acmc-1btqj,sodium,a-hydroxybutyrate,sodium 2-oxidanylbutanoate,sodiumdl-2-hydroxybutyrate PubChem CID: 23663641 IUPAC Name: sodium;2-hydroxybutanoate SMILES: [Na+].CCC(O)C([O-])=O
| PubChem CID | 23663641 |
|---|---|
| CAS | 5094-24-6 |
| Molecular Weight (g/mol) | 126.09 |
| MDL Number | MFCD00004565 |
| SMILES | [Na+].CCC(O)C([O-])=O |
| Synonym | sodium 2-hydroxybutanoate,sodium 2-hydroxybutyrate,sodium dl-2-hydroxybutyrate,2-hydroxybutyric acid sodium salt,dl-2-hydroxybutyric acid sodium salt,sodium hydroxybutyrate,acmc-1btqj,sodium,a-hydroxybutyrate,sodium 2-oxidanylbutanoate,sodiumdl-2-hydroxybutyrate |
| IUPAC Name | sodium;2-hydroxybutanoate |
| InChI Key | MOSCXNXKSOHVSQ-UHFFFAOYNA-M |
| Molecular Formula | C4H7NaO3 |
2-Fluoro-5-nitrobenzeneboronic acid, 97%
CAS: 819849-20-2 Molecular Formula: C6H5BFNO4 Molecular Weight (g/mol): 184.92 MDL Number: MFCD03092929 InChI Key: SYAFEPQKPQIRAL-UHFFFAOYSA-N Synonym: 2-fluoro-5-nitrophenyl boronic acid,2-fluoro-5-nitrophenylboronicacid,2-fluoro-5-nitrobenzeneboronic acid,5-nitro-2-fluorophenylboronic acid,boronic acid, 2-fluoro-5-nitrophenyl,2-fluoro-5-nitro-phenyl boronic acid,acmc-209pmq,ksc649e7n,2-fluoro-5-nitro phenyl boronic acid,b-2-fluoro-5-nitrophenyl-boronic acid PubChem CID: 2763280 IUPAC Name: (2-fluoro-5-nitrophenyl)boronic acid SMILES: OB(O)C1=CC(=CC=C1F)[N+]([O-])=O
| PubChem CID | 2763280 |
|---|---|
| CAS | 819849-20-2 |
| Molecular Weight (g/mol) | 184.92 |
| MDL Number | MFCD03092929 |
| SMILES | OB(O)C1=CC(=CC=C1F)[N+]([O-])=O |
| Synonym | 2-fluoro-5-nitrophenyl boronic acid,2-fluoro-5-nitrophenylboronicacid,2-fluoro-5-nitrobenzeneboronic acid,5-nitro-2-fluorophenylboronic acid,boronic acid, 2-fluoro-5-nitrophenyl,2-fluoro-5-nitro-phenyl boronic acid,acmc-209pmq,ksc649e7n,2-fluoro-5-nitro phenyl boronic acid,b-2-fluoro-5-nitrophenyl-boronic acid |
| IUPAC Name | (2-fluoro-5-nitrophenyl)boronic acid |
| InChI Key | SYAFEPQKPQIRAL-UHFFFAOYSA-N |
| Molecular Formula | C6H5BFNO4 |
Ethyl 3-(trifluoromethyl)crotonate, (E)+(Z), 96%
CAS: 24490-03-7 Molecular Formula: C7H9F3O2 Molecular Weight (g/mol): 182.14 MDL Number: MFCD00040846 InChI Key: OSZLARYVWBUKTG-SNAWJCMRSA-N Synonym: ethyl 4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate,ethyl 2e-4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate, cis + trans,ethyl e-4,4,4-trifluoro-3-methylbut-2-enoate,e-3-trifluoromethyl-2-butenoic acid ethyl ester PubChem CID: 5838607 IUPAC Name: ethyl (E)-4,4,4-trifluoro-3-methylbut-2-enoate SMILES: CCOC(=O)\C=C(/C)C(F)(F)F
| PubChem CID | 5838607 |
|---|---|
| CAS | 24490-03-7 |
| Molecular Weight (g/mol) | 182.14 |
| MDL Number | MFCD00040846 |
| SMILES | CCOC(=O)\C=C(/C)C(F)(F)F |
| Synonym | ethyl 4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate,ethyl 2e-4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate, cis + trans,ethyl e-4,4,4-trifluoro-3-methylbut-2-enoate,e-3-trifluoromethyl-2-butenoic acid ethyl ester |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-methylbut-2-enoate |
| InChI Key | OSZLARYVWBUKTG-SNAWJCMRSA-N |
| Molecular Formula | C7H9F3O2 |
2-Ethoxycarbonylphenylboronic acid, 97%
CAS: 380430-53-5 Molecular Formula: C9H11BO4 Molecular Weight (g/mol): 193.99 MDL Number: MFCD02179453 InChI Key: QZKVVOXAEBCLPZ-UHFFFAOYSA-N Synonym: 2-ethoxycarbonyl phenyl boronic acid,2-ethoxycarbonylbenzeneboronic acid,2-ethoxycarbonyl phenylboronic acid,2-ethoxycarbonylphenyl boronic acid,o-ethoxycarbonylphenylboronic acid,2-carbethoxyphenylboronic acid,ethyl 2-dihydroxyboranyl benzoate,ethyl 2-boronobenzoate,2-ethoxycarbonyl benzeneboronic acid PubChem CID: 2773405 IUPAC Name: (2-ethoxycarbonylphenyl)boronic acid SMILES: CCOC(=O)C1=CC=CC=C1B(O)O
| PubChem CID | 2773405 |
|---|---|
| CAS | 380430-53-5 |
| Molecular Weight (g/mol) | 193.99 |
| MDL Number | MFCD02179453 |
| SMILES | CCOC(=O)C1=CC=CC=C1B(O)O |
| Synonym | 2-ethoxycarbonyl phenyl boronic acid,2-ethoxycarbonylbenzeneboronic acid,2-ethoxycarbonyl phenylboronic acid,2-ethoxycarbonylphenyl boronic acid,o-ethoxycarbonylphenylboronic acid,2-carbethoxyphenylboronic acid,ethyl 2-dihydroxyboranyl benzoate,ethyl 2-boronobenzoate,2-ethoxycarbonyl benzeneboronic acid |
| IUPAC Name | (2-ethoxycarbonylphenyl)boronic acid |
| InChI Key | QZKVVOXAEBCLPZ-UHFFFAOYSA-N |
| Molecular Formula | C9H11BO4 |
Dibenzofuran-4-boronic acid, 98+%
CAS: 100124-06-9 Molecular Formula: C12H9BO3 Molecular Weight (g/mol): 212.011 MDL Number: MFCD00092336 InChI Key: ZXHUJRZYLRVVNP-UHFFFAOYSA-N Synonym: dibenzofuran-4-boronic acid,dibenzo b,d furan-4-ylboronic acid,4-dibenzofuranyl boronic acid,4-dibenzofuranboronic acid,4-dibenzofuranboronicacid,4-dibenzofuranylboronic acid,boronic acid, 4-dibenzofuranyl,dibenzo b,d furan-4-boronic acid,8-oxatricyclo 7.4.0.0 2 ,? trideca-1 9 ,2 7 ,3,5,10,12-hexaen-6-ylboronic acid PubChem CID: 2734328 IUPAC Name: dibenzofuran-4-ylboronic acid SMILES: B(C1=C2C(=CC=C1)C3=CC=CC=C3O2)(O)O
| PubChem CID | 2734328 |
|---|---|
| CAS | 100124-06-9 |
| Molecular Weight (g/mol) | 212.011 |
| MDL Number | MFCD00092336 |
| SMILES | B(C1=C2C(=CC=C1)C3=CC=CC=C3O2)(O)O |
| Synonym | dibenzofuran-4-boronic acid,dibenzo b,d furan-4-ylboronic acid,4-dibenzofuranyl boronic acid,4-dibenzofuranboronic acid,4-dibenzofuranboronicacid,4-dibenzofuranylboronic acid,boronic acid, 4-dibenzofuranyl,dibenzo b,d furan-4-boronic acid,8-oxatricyclo 7.4.0.0 2 ,? trideca-1 9 ,2 7 ,3,5,10,12-hexaen-6-ylboronic acid |
| IUPAC Name | dibenzofuran-4-ylboronic acid |
| InChI Key | ZXHUJRZYLRVVNP-UHFFFAOYSA-N |
| Molecular Formula | C12H9BO3 |
2,4,6-Trimethoxybenzeneboronic acid, 98%
CAS: 135159-25-0 Molecular Formula: C9H13BO5 Molecular Weight (g/mol): 212.01 MDL Number: MFCD01114642 InChI Key: PKLRXZVPEQJTTJ-UHFFFAOYSA-N Synonym: 2,4,6-trimethoxybenzeneboronic acid,2,4,6-trimethoxyphenyl boronic acid,boronic acid,b-2,4,6-trimethoxyphenyl,1,3,5-trimethoxybenzene-2-boronic ester,pubchem9566,1,3,5-trimethoxybenzene-2-bronic ester,acmc-1cirz,ablock ab-12-9177,2,4,6-trimethoxybenzeneboronicacid PubChem CID: 4197996 IUPAC Name: (2,4,6-trimethoxyphenyl)boronic acid SMILES: COC1=CC(OC)=C(B(O)O)C(OC)=C1
| PubChem CID | 4197996 |
|---|---|
| CAS | 135159-25-0 |
| Molecular Weight (g/mol) | 212.01 |
| MDL Number | MFCD01114642 |
| SMILES | COC1=CC(OC)=C(B(O)O)C(OC)=C1 |
| Synonym | 2,4,6-trimethoxybenzeneboronic acid,2,4,6-trimethoxyphenyl boronic acid,boronic acid,b-2,4,6-trimethoxyphenyl,1,3,5-trimethoxybenzene-2-boronic ester,pubchem9566,1,3,5-trimethoxybenzene-2-bronic ester,acmc-1cirz,ablock ab-12-9177,2,4,6-trimethoxybenzeneboronicacid |
| IUPAC Name | (2,4,6-trimethoxyphenyl)boronic acid |
| InChI Key | PKLRXZVPEQJTTJ-UHFFFAOYSA-N |
| Molecular Formula | C9H13BO5 |