Organic acids and derivatives
Filtered Search Results
Bis(2-ethylhexyl) hydrogen phosphate, 95%
CAS: 298-07-7 Molecular Formula: C16H35O4P Molecular Weight (g/mol): 322.43 MDL Number: MFCD00009492 InChI Key: SEGLCEQVOFDUPX-UHFFFAOYNA-N Synonym: bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid PubChem CID: 9275 IUPAC Name: bis(2-ethylhexyl) hydrogen phosphate SMILES: CCCCC(CC)COP(O)(=O)OCC(CC)CCCC
| PubChem CID | 9275 |
|---|---|
| CAS | 298-07-7 |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Molecular Formula | C16H35O4P |
Ammonium bismuth citrate, Bi 48-52%, water ca 2%
CAS: 25530-63-6 Molecular Formula: C6H11BiNO7 Molecular Weight (g/mol): 418.134 MDL Number: MFCD00036420 InChI Key: JDINTLWFPXWXCT-UHFFFAOYSA-N Synonym: ammonium bismuth citrate PubChem CID: 87101692 IUPAC Name: azane;bismuth;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Bi]
| PubChem CID | 87101692 |
|---|---|
| CAS | 25530-63-6 |
| Molecular Weight (g/mol) | 418.134 |
| MDL Number | MFCD00036420 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Bi] |
| Synonym | ammonium bismuth citrate |
| IUPAC Name | azane;bismuth;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | JDINTLWFPXWXCT-UHFFFAOYSA-N |
| Molecular Formula | C6H11BiNO7 |
Methyl 2,2-dimethyl-3-hydroxypropionate, 98+%
CAS: 14002-80-3 Molecular Formula: C6H12O3 Molecular Weight (g/mol): 132.16 MDL Number: MFCD00009707 InChI Key: KJRFTNVYOAGTHK-UHFFFAOYSA-N Synonym: hydroxypivalic acid methyl ester,methyl 3-hydroxypivalate,methyl hydroxypivalate,methyl 2,2-dimethyl-3-hydroxypropionate,hydroxypivalicacidmethylester,propanoic acid, 3-hydroxy-2,2-dimethyl-, methyl ester,2,2-dimethyl-3-hydroxypropionic acid methyl ester,3-hydroxy-2,2-dimethyl-propionic acid methyl ester,methyl 2,2-dimethyl-3-hydroxypropanoate,methyl hydroxylpivalate PubChem CID: 84152 IUPAC Name: methyl 3-hydroxy-2,2-dimethylpropanoate SMILES: COC(=O)C(C)(C)CO
| PubChem CID | 84152 |
|---|---|
| CAS | 14002-80-3 |
| Molecular Weight (g/mol) | 132.16 |
| MDL Number | MFCD00009707 |
| SMILES | COC(=O)C(C)(C)CO |
| Synonym | hydroxypivalic acid methyl ester,methyl 3-hydroxypivalate,methyl hydroxypivalate,methyl 2,2-dimethyl-3-hydroxypropionate,hydroxypivalicacidmethylester,propanoic acid, 3-hydroxy-2,2-dimethyl-, methyl ester,2,2-dimethyl-3-hydroxypropionic acid methyl ester,3-hydroxy-2,2-dimethyl-propionic acid methyl ester,methyl 2,2-dimethyl-3-hydroxypropanoate,methyl hydroxylpivalate |
| IUPAC Name | methyl 3-hydroxy-2,2-dimethylpropanoate |
| InChI Key | KJRFTNVYOAGTHK-UHFFFAOYSA-N |
| Molecular Formula | C6H12O3 |
Nickel(II) acetate tetrahydrate, 98+%
CAS: 6018-89-9 Molecular Formula: C4H14NiO8 Molecular Weight (g/mol): 248.84 MDL Number: MFCD00066973 InChI Key: OINIXPNQKAZCRL-UHFFFAOYSA-L Synonym: nickel ii acetate tetrahydrate,nickel acetate tetrahydrate,nickel diacetate tetrahydrate,diacetatonickel tetrahydrate,nickelous acetate tetrahydrate,unii-6soa8l0560,acetic acid, nickel +2 salt, tetrahydrate,nickel 2+ diacetate tetrahydrate,nickel acetate tetrahydrate nickel and nickel compounds,acetic acid, nickel 2+ salt, tetrahydrate PubChem CID: 62601 IUPAC Name: nickel(2+);diacetate;tetrahydrate SMILES: O.O.O.O.[Ni++].CC([O-])=O.CC([O-])=O
| PubChem CID | 62601 |
|---|---|
| CAS | 6018-89-9 |
| Molecular Weight (g/mol) | 248.84 |
| MDL Number | MFCD00066973 |
| SMILES | O.O.O.O.[Ni++].CC([O-])=O.CC([O-])=O |
| Synonym | nickel ii acetate tetrahydrate,nickel acetate tetrahydrate,nickel diacetate tetrahydrate,diacetatonickel tetrahydrate,nickelous acetate tetrahydrate,unii-6soa8l0560,acetic acid, nickel +2 salt, tetrahydrate,nickel 2+ diacetate tetrahydrate,nickel acetate tetrahydrate nickel and nickel compounds,acetic acid, nickel 2+ salt, tetrahydrate |
| IUPAC Name | nickel(2+);diacetate;tetrahydrate |
| InChI Key | OINIXPNQKAZCRL-UHFFFAOYSA-L |
| Molecular Formula | C4H14NiO8 |
n-Propyl Gallate, MP Biomedicals™
CAS: 121-79-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.2 MDL Number: MFCD00002196 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N
| CAS | 121-79-9 |
|---|---|
| Molecular Weight (g/mol) | 212.2 |
| MDL Number | MFCD00002196 |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
Pyruvic acid, sodium salt, 99+%
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.04 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.04 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
TES, 99%
CAS: 7365-44-8 Molecular Formula: C6H15NO6S Molecular Weight (g/mol): 229.247 MDL Number: MFCD00007532 InChI Key: JOCBASBOOFNAJA-UHFFFAOYSA-N Synonym: tes,n-tris hydroxymethyl methyl-2-aminoethanesulfonic acid,tes buffer,tes free acid,ethanesulfonic acid, 2-2-hydroxy-1,1-bis hydroxymethyl ethyl amino,2-1,3-dihydroxy-2-hydroxymethyl propan-2-yl amino ethanesulfonic acid,2-2-hydroxy-1,1-dihydroxymethyl-ethylamino-ethanesulfonic acid,tris hydroxymethyl methyl-2-aminomethane sulfonic acid,2-tris hydroxymethyl methylamino ethane-1-sulphonic acid,n-tri hydroxymethyl methyltaurine PubChem CID: 81831 ChEBI: CHEBI:44356 IUPAC Name: 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonic acid SMILES: C(CS(=O)(=O)O)NC(CO)(CO)CO
| PubChem CID | 81831 |
|---|---|
| CAS | 7365-44-8 |
| Molecular Weight (g/mol) | 229.247 |
| ChEBI | CHEBI:44356 |
| MDL Number | MFCD00007532 |
| SMILES | C(CS(=O)(=O)O)NC(CO)(CO)CO |
| Synonym | tes,n-tris hydroxymethyl methyl-2-aminoethanesulfonic acid,tes buffer,tes free acid,ethanesulfonic acid, 2-2-hydroxy-1,1-bis hydroxymethyl ethyl amino,2-1,3-dihydroxy-2-hydroxymethyl propan-2-yl amino ethanesulfonic acid,2-2-hydroxy-1,1-dihydroxymethyl-ethylamino-ethanesulfonic acid,tris hydroxymethyl methyl-2-aminomethane sulfonic acid,2-tris hydroxymethyl methylamino ethane-1-sulphonic acid,n-tri hydroxymethyl methyltaurine |
| IUPAC Name | 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonic acid |
| InChI Key | JOCBASBOOFNAJA-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO6S |
2-Bromoethanesulfonic acid, sodium salt, 98%
CAS: 4263-52-9 Molecular Formula: C2H4BrNaO3S Molecular Weight (g/mol): 211.01 MDL Number: MFCD00007530 InChI Key: HNFOAHXBHLWKNF-UHFFFAOYSA-M Synonym: sodium 2-bromoethanesulfonate,2-bromoethanesulfonic acid sodium salt,sodium 2-bromoethanesulphonate,2-bromoethanesulfonic acid, sodium salt,sodium bromoethylsulfonate,ethanesulfonic acid, 2-bromo-, sodium salt,ethanesulfonic acid, 2-bromo-, sodium salt 1:1,sodium 2-bromoethane sulfonate,2-bromoethanesulfonic acid sodium,natrium-2-bromethansulfonat PubChem CID: 23666797 IUPAC Name: sodium;2-bromoethanesulfonate SMILES: C(CBr)S(=O)(=O)[O-].[Na+]
| PubChem CID | 23666797 |
|---|---|
| CAS | 4263-52-9 |
| Molecular Weight (g/mol) | 211.01 |
| MDL Number | MFCD00007530 |
| SMILES | C(CBr)S(=O)(=O)[O-].[Na+] |
| Synonym | sodium 2-bromoethanesulfonate,2-bromoethanesulfonic acid sodium salt,sodium 2-bromoethanesulphonate,2-bromoethanesulfonic acid, sodium salt,sodium bromoethylsulfonate,ethanesulfonic acid, 2-bromo-, sodium salt,ethanesulfonic acid, 2-bromo-, sodium salt 1:1,sodium 2-bromoethane sulfonate,2-bromoethanesulfonic acid sodium,natrium-2-bromethansulfonat |
| IUPAC Name | sodium;2-bromoethanesulfonate |
| InChI Key | HNFOAHXBHLWKNF-UHFFFAOYSA-M |
| Molecular Formula | C2H4BrNaO3S |
Ethylene carbonate, 99%
CAS: 96-49-1 Molecular Formula: C3H4O3 Molecular Weight (g/mol): 88.062 MDL Number: MFCD00005382 InChI Key: KMTRUDSVKNLOMY-UHFFFAOYSA-N Synonym: ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec PubChem CID: 7303 IUPAC Name: 1,3-dioxolan-2-one SMILES: C1COC(=O)O1
| PubChem CID | 7303 |
|---|---|
| CAS | 96-49-1 |
| Molecular Weight (g/mol) | 88.062 |
| MDL Number | MFCD00005382 |
| SMILES | C1COC(=O)O1 |
| Synonym | ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec |
| IUPAC Name | 1,3-dioxolan-2-one |
| InChI Key | KMTRUDSVKNLOMY-UHFFFAOYSA-N |
| Molecular Formula | C3H4O3 |
Bis(2-ethylhexyl) phosphate, 95%
CAS: 298-07-7 Molecular Formula: C16H35O4P Molecular Weight (g/mol): 322.43 MDL Number: MFCD00009492 InChI Key: SEGLCEQVOFDUPX-UHFFFAOYNA-N Synonym: bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid PubChem CID: 9275 IUPAC Name: bis(2-ethylhexyl) hydrogen phosphate SMILES: CCCCC(CC)COP(O)(=O)OCC(CC)CCCC
| PubChem CID | 9275 |
|---|---|
| CAS | 298-07-7 |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Molecular Formula | C16H35O4P |
Ethylenebis(oxyethylenenitrilo)tetraacetic acid, 98%
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.34 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.34 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
Ethylenediaminetetraacetic Acid Disodium Salt Dihydrate, ≥99%, Molecular Biology Reagent Grade, MP Biomedicals™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Diethyl maleate, 97%
CAS: 141-05-9 Molecular Formula: C8H12O4 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00009191 InChI Key: IEPRKVQEAMIZSS-WAYWQWQTSA-N Synonym: diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 PubChem CID: 5271566 ChEBI: CHEBI:68508 IUPAC Name: diethyl (Z)-but-2-enedioate SMILES: CCOC(=O)C=CC(=O)OCC
| PubChem CID | 5271566 |
|---|---|
| CAS | 141-05-9 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:68508 |
| MDL Number | MFCD00009191 |
| SMILES | CCOC(=O)C=CC(=O)OCC |
| Synonym | diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 |
| IUPAC Name | diethyl (Z)-but-2-enedioate |
| InChI Key | IEPRKVQEAMIZSS-WAYWQWQTSA-N |
| Molecular Formula | C8H12O4 |
1,1,3,3-Tetramethylurea, 99%
CAS: 632-22-4 Molecular Formula: C5H12N2O Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008319 InChI Key: AVQQQNCBBIEMEU-UHFFFAOYSA-N Synonym: tetramethylurea,temur,urea, tetramethyl,n,n,n',n'-tetramethylurea,tetramethyluree,tmu,urea, 1,1,3,3-tetramethyl,urea, n,n,n',n'-tetramethyl,tetramethyluree french,tetramethyl-urea PubChem CID: 12437 ChEBI: CHEBI:84278 IUPAC Name: 1,1,3,3-tetramethylurea SMILES: CN(C)C(=O)N(C)C
| PubChem CID | 12437 |
|---|---|
| CAS | 632-22-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:84278 |
| MDL Number | MFCD00008319 |
| SMILES | CN(C)C(=O)N(C)C |
| Synonym | tetramethylurea,temur,urea, tetramethyl,n,n,n',n'-tetramethylurea,tetramethyluree,tmu,urea, 1,1,3,3-tetramethyl,urea, n,n,n',n'-tetramethyl,tetramethyluree french,tetramethyl-urea |
| IUPAC Name | 1,1,3,3-tetramethylurea |
| InChI Key | AVQQQNCBBIEMEU-UHFFFAOYSA-N |
| Molecular Formula | C5H12N2O |
4-Methylvaleric acid, 99%
CAS: 646-07-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00002803 InChI Key: FGKJLKRYENPLQH-UHFFFAOYSA-N Synonym: 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid PubChem CID: 12587 ChEBI: CHEBI:74903 IUPAC Name: 4-methylpentanoic acid SMILES: CC(C)CCC(=O)O
| PubChem CID | 12587 |
|---|---|
| CAS | 646-07-1 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:74903 |
| MDL Number | MFCD00002803 |
| SMILES | CC(C)CCC(=O)O |
| Synonym | 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid |
| IUPAC Name | 4-methylpentanoic acid |
| InChI Key | FGKJLKRYENPLQH-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |