Organic acids and derivatives
Filtered Search Results
Copper(II) gluconate
CAS: 527-09-3 Molecular Formula: C12H22CuO14 Molecular Weight (g/mol): 453.84 MDL Number: MFCD00075297 InChI Key: OCUCCJIRFHNWBP-IYEMJOQQSA-L Synonym: copper gluconate PubChem CID: 131854750 ChEBI: CHEBI:31431 IUPAC Name: copper;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Cu+2]
| PubChem CID | 131854750 |
|---|---|
| CAS | 527-09-3 |
| Molecular Weight (g/mol) | 453.84 |
| ChEBI | CHEBI:31431 |
| MDL Number | MFCD00075297 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Cu+2] |
| Synonym | copper gluconate |
| IUPAC Name | copper;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | OCUCCJIRFHNWBP-IYEMJOQQSA-L |
| Molecular Formula | C12H22CuO14 |
Sodium formate, ACS, 99.0% min
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.007 MDL Number: MFCD00013101 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.007 |
| ChEBI | CHEBI:62965 |
| MDL Number | MFCD00013101 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
Methacrylic Acid (stabilized with MEHQ) 99.0+%, TCI America™
CAS: 79-41-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00002651 InChI Key: CERQOIWHTDAKMF-UHFFFAOYSA-N Synonym: methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl PubChem CID: 4093 ChEBI: CHEBI:25219 IUPAC Name: 2-methylprop-2-enoic acid SMILES: CC(=C)C(=O)O
| PubChem CID | 4093 |
|---|---|
| CAS | 79-41-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:25219 |
| MDL Number | MFCD00002651 |
| SMILES | CC(=C)C(=O)O |
| Synonym | methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl |
| IUPAC Name | 2-methylprop-2-enoic acid |
| InChI Key | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
2-Hydroxyethyl methacrylate, 97%, stab. with 4-methoxyphenol
CAS: 868-77-9 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.143 MDL Number: MFCD00002863 InChI Key: WOBHKFSMXKNTIM-UHFFFAOYSA-N Synonym: 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 PubChem CID: 13360 ChEBI: CHEBI:34288 IUPAC Name: 2-hydroxyethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCO
| PubChem CID | 13360 |
|---|---|
| CAS | 868-77-9 |
| Molecular Weight (g/mol) | 130.143 |
| ChEBI | CHEBI:34288 |
| MDL Number | MFCD00002863 |
| SMILES | CC(=C)C(=O)OCCO |
| Synonym | 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate |
| InChI Key | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
1-[3-(Dimethylamino)propyl]-3-ethylurea, 97%
CAS: 32897-26-0 Molecular Formula: C8H19N3O Molecular Weight (g/mol): 173.26 MDL Number: MFCD00027752 InChI Key: NGJUYARYEXGDNN-UHFFFAOYSA-N Synonym: 1-3-dimethylamino propyl-3-ethylurea,1-ethyl-3 3-dimethylamino urea,1-ethyl-3-3-dimethylaminopropyl urea,urea, n-3-dimethylamino propyl-n'-ethyl,3-3-dimethylamino propyl-1-ethylurea,1-3-dimethylamino propyl-3-ethyl isourea,1-3-dimethylaminopropyl-3-ethylurea,3-ethyl amino hydroxy methylene amino-n,n-dimethylpropan-1-amine PubChem CID: 4196313 IUPAC Name: 1-[3-(dimethylamino)propyl]-3-ethylurea SMILES: CCNC(=O)NCCCN(C)C
| PubChem CID | 4196313 |
|---|---|
| CAS | 32897-26-0 |
| Molecular Weight (g/mol) | 173.26 |
| MDL Number | MFCD00027752 |
| SMILES | CCNC(=O)NCCCN(C)C |
| Synonym | 1-3-dimethylamino propyl-3-ethylurea,1-ethyl-3 3-dimethylamino urea,1-ethyl-3-3-dimethylaminopropyl urea,urea, n-3-dimethylamino propyl-n'-ethyl,3-3-dimethylamino propyl-1-ethylurea,1-3-dimethylamino propyl-3-ethyl isourea,1-3-dimethylaminopropyl-3-ethylurea,3-ethyl amino hydroxy methylene amino-n,n-dimethylpropan-1-amine |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-ethylurea |
| InChI Key | NGJUYARYEXGDNN-UHFFFAOYSA-N |
| Molecular Formula | C8H19N3O |
Trifluoromethanesulfonic acid, 98+%
CAS: 1493-13-6 Molecular Formula: CHF3O3S Molecular Weight (g/mol): 150.07 MDL Number: MFCD00007514 InChI Key: ITMCEJHCFYSIIV-UHFFFAOYSA-N Synonym: triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate PubChem CID: 62406 ChEBI: CHEBI:48511 IUPAC Name: trifluoromethanesulfonic acid SMILES: OS(=O)(=O)C(F)(F)F
| PubChem CID | 62406 |
|---|---|
| CAS | 1493-13-6 |
| Molecular Weight (g/mol) | 150.07 |
| ChEBI | CHEBI:48511 |
| MDL Number | MFCD00007514 |
| SMILES | OS(=O)(=O)C(F)(F)F |
| Synonym | triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate |
| IUPAC Name | trifluoromethanesulfonic acid |
| InChI Key | ITMCEJHCFYSIIV-UHFFFAOYSA-N |
| Molecular Formula | CHF3O3S |
1,2,3,4-Butanetetracarboxylic acid, 98+%
CAS: 1703-58-8 Molecular Formula: C8H10O8 Molecular Weight (g/mol): 234.16 MDL Number: MFCD00002722 InChI Key: GGAUUQHSCNMCAU-UHFFFAOYSA-N Synonym: 1,2,3,4-butanetetracarboxylic acid,butanetetracarboxylic acid,dsstox_cid_4670,dsstox_rid_77494,dsstox_gsid_24670,1,2,3,4-butanetetracarboxylic,meso-1,2,3,4-butanetetracarboxylic acid,acmc-20abw3,ksc176c1b,ggauuqhscnmcau-uhfffaoysa PubChem CID: 15560 IUPAC Name: butane-1,2,3,4-tetracarboxylic acid SMILES: C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O
| PubChem CID | 15560 |
|---|---|
| CAS | 1703-58-8 |
| Molecular Weight (g/mol) | 234.16 |
| MDL Number | MFCD00002722 |
| SMILES | C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| Synonym | 1,2,3,4-butanetetracarboxylic acid,butanetetracarboxylic acid,dsstox_cid_4670,dsstox_rid_77494,dsstox_gsid_24670,1,2,3,4-butanetetracarboxylic,meso-1,2,3,4-butanetetracarboxylic acid,acmc-20abw3,ksc176c1b,ggauuqhscnmcau-uhfffaoysa |
| IUPAC Name | butane-1,2,3,4-tetracarboxylic acid |
| InChI Key | GGAUUQHSCNMCAU-UHFFFAOYSA-N |
| Molecular Formula | C8H10O8 |
Mercury(II) acetate, 98+%
CAS: 1600-27-7 Molecular Formula: C4H6HgO4 Molecular Weight (g/mol): 318.68 MDL Number: MFCD00012165 InChI Key: BRMYZIKAHFEUFJ-UHFFFAOYSA-L Synonym: mercury 2+ ion acetic acid PubChem CID: 15337 ChEBI: CHEBI:33211 IUPAC Name: mercury(2+);diacetate SMILES: CC(=O)[O-].CC(=O)[O-].[Hg+2]
| PubChem CID | 15337 |
|---|---|
| CAS | 1600-27-7 |
| Molecular Weight (g/mol) | 318.68 |
| ChEBI | CHEBI:33211 |
| MDL Number | MFCD00012165 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Hg+2] |
| Synonym | mercury 2+ ion acetic acid |
| IUPAC Name | mercury(2+);diacetate |
| InChI Key | BRMYZIKAHFEUFJ-UHFFFAOYSA-L |
| Molecular Formula | C4H6HgO4 |
MES Sodium Salt, MP Biomedicals™
CAS: 71119-23-8 Molecular Formula: C6H12NNaO4S Molecular Weight (g/mol): 217.215 MDL Number: MFCD00065473 InChI Key: IRHWMYKYLWNHTL-UHFFFAOYSA-M Synonym: mes sodium salt,sodium 2-morpholinoethanesulfonate,2-n-morpholino ethanesulfonic acid sodium salt,4-morpholineethanesulfonic acid, sodium salt,sodium 4-morpholin-1-ylethylsulphonate,sodium 2-4-morpholinyl ethanesulfonate,mes-na,4-morpholineethanesulfonic acid sodium salt,sodium 4-morpholineethanesulfonate,4-morpholineethanesulfonic acid, sodium salt 1:1 PubChem CID: 23673676 ChEBI: CHEBI:62955 IUPAC Name: sodium;2-morpholin-4-ylethanesulfonate SMILES: C1COCCN1CCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23673676 |
|---|---|
| CAS | 71119-23-8 |
| Molecular Weight (g/mol) | 217.215 |
| ChEBI | CHEBI:62955 |
| MDL Number | MFCD00065473 |
| SMILES | C1COCCN1CCS(=O)(=O)[O-].[Na+] |
| Synonym | mes sodium salt,sodium 2-morpholinoethanesulfonate,2-n-morpholino ethanesulfonic acid sodium salt,4-morpholineethanesulfonic acid, sodium salt,sodium 4-morpholin-1-ylethylsulphonate,sodium 2-4-morpholinyl ethanesulfonate,mes-na,4-morpholineethanesulfonic acid sodium salt,sodium 4-morpholineethanesulfonate,4-morpholineethanesulfonic acid, sodium salt 1:1 |
| IUPAC Name | sodium;2-morpholin-4-ylethanesulfonate |
| InChI Key | IRHWMYKYLWNHTL-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO4S |
N,N'-Dicyclohexylurea, 98%
CAS: 2387-23-7 Molecular Formula: C13H24N2O Molecular Weight (g/mol): 224.348 MDL Number: MFCD00003829 InChI Key: ADFXKUOMJKEIND-UHFFFAOYSA-N Synonym: n,n'-dicyclohexylurea,dicyclohexylurea,urea, n,n'-dicyclohexyl,unii-zv7823vvim,chembl1458,zv7823vvim,urea,3-dicyclohexyl,urea,n'-dicyclohexyl,n,n inverted exclamation marka-dicyclohexylurea,urea, 1,3-dicyclohexyl PubChem CID: 4277 IUPAC Name: 1,3-dicyclohexylurea SMILES: C1CCC(CC1)NC(=O)NC2CCCCC2
| PubChem CID | 4277 |
|---|---|
| CAS | 2387-23-7 |
| Molecular Weight (g/mol) | 224.348 |
| MDL Number | MFCD00003829 |
| SMILES | C1CCC(CC1)NC(=O)NC2CCCCC2 |
| Synonym | n,n'-dicyclohexylurea,dicyclohexylurea,urea, n,n'-dicyclohexyl,unii-zv7823vvim,chembl1458,zv7823vvim,urea,3-dicyclohexyl,urea,n'-dicyclohexyl,n,n inverted exclamation marka-dicyclohexylurea,urea, 1,3-dicyclohexyl |
| IUPAC Name | 1,3-dicyclohexylurea |
| InChI Key | ADFXKUOMJKEIND-UHFFFAOYSA-N |
| Molecular Formula | C13H24N2O |
Bis(4-nitrophenyl) carbonate, 98%
CAS: 5070-13-3 Molecular Formula: C13H8N2O7 Molecular Weight (g/mol): 304.214 MDL Number: MFCD00007322 InChI Key: ACBQROXDOHKANW-UHFFFAOYSA-N Synonym: bis 4-nitrophenyl carbonate,bis p-nitrophenyl carbonate,4,4'-dinitrodiphenyl carbonate,carbonic acid, bis 4-nitrophenyl ester,p,p'-dinitrodiphenylcarbonate,carbonic acid bis 4-nitrophenyl ester,carbonic acid, bis p-nitrophenyl ester,npc bis 4-nitrophenyl carbonate PubChem CID: 78756 IUPAC Name: bis(4-nitrophenyl) carbonate SMILES: C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-]
| PubChem CID | 78756 |
|---|---|
| CAS | 5070-13-3 |
| Molecular Weight (g/mol) | 304.214 |
| MDL Number | MFCD00007322 |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
| Synonym | bis 4-nitrophenyl carbonate,bis p-nitrophenyl carbonate,4,4'-dinitrodiphenyl carbonate,carbonic acid, bis 4-nitrophenyl ester,p,p'-dinitrodiphenylcarbonate,carbonic acid bis 4-nitrophenyl ester,carbonic acid, bis p-nitrophenyl ester,npc bis 4-nitrophenyl carbonate |
| IUPAC Name | bis(4-nitrophenyl) carbonate |
| InChI Key | ACBQROXDOHKANW-UHFFFAOYSA-N |
| Molecular Formula | C13H8N2O7 |
Isopropyl myristate, 96%
CAS: 110-27-0 Molecular Formula: C17H34O2 Molecular Weight (g/mol): 270.45 MDL Number: MFCD00008982 InChI Key: AXISYYRBXTVTFY-UHFFFAOYSA-N Synonym: isopropyl myristate,isopropyl tetradecanoate,estergel,bisomel,isomyst,promyr,tetradecanoic acid, 1-methylethyl ester,deltyl extra,kesscomir,tegester PubChem CID: 8042 IUPAC Name: propan-2-yl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OC(C)C
| PubChem CID | 8042 |
|---|---|
| CAS | 110-27-0 |
| Molecular Weight (g/mol) | 270.45 |
| MDL Number | MFCD00008982 |
| SMILES | CCCCCCCCCCCCCC(=O)OC(C)C |
| Synonym | isopropyl myristate,isopropyl tetradecanoate,estergel,bisomel,isomyst,promyr,tetradecanoic acid, 1-methylethyl ester,deltyl extra,kesscomir,tegester |
| IUPAC Name | propan-2-yl tetradecanoate |
| InChI Key | AXISYYRBXTVTFY-UHFFFAOYSA-N |
| Molecular Formula | C17H34O2 |
Tris(2-carboxyethyl)phosphine hydrochloride, 98%
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
Ethyl acrylate, 99%, stab. with ca 20ppm 4-methoxyphenol
CAS: 140-88-5 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009188 InChI Key: JIGUQPWFLRLWPJ-UHFFFAOYSA-N Synonym: ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat PubChem CID: 8821 ChEBI: CHEBI:82327 IUPAC Name: ethyl prop-2-enoate SMILES: CCOC(=O)C=C
| PubChem CID | 8821 |
|---|---|
| CAS | 140-88-5 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:82327 |
| MDL Number | MFCD00009188 |
| SMILES | CCOC(=O)C=C |
| Synonym | ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat |
| IUPAC Name | ethyl prop-2-enoate |
| InChI Key | JIGUQPWFLRLWPJ-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Phloroglucinol, 99+%, anhydrous
CAS: 108-73-6 Molecular Formula: C6H6O3 Molecular Weight (g/mol): 126.1 InChI Key: QCDYQQDYXPDABM-UHFFFAOYSA-N Synonym: phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy PubChem CID: 359 ChEBI: CHEBI:16204 IUPAC Name: benzene-1,3,5-triol SMILES: C1=C(C=C(C=C1O)O)O
| PubChem CID | 359 |
|---|---|
| CAS | 108-73-6 |
| Molecular Weight (g/mol) | 126.1 |
| ChEBI | CHEBI:16204 |
| SMILES | C1=C(C=C(C=C1O)O)O |
| Synonym | phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy |
| IUPAC Name | benzene-1,3,5-triol |
| InChI Key | QCDYQQDYXPDABM-UHFFFAOYSA-N |
| Molecular Formula | C6H6O3 |