Organic acids and derivatives
Filtered Search Results
Tripropylene Glycol Diacrylate (stabilized with MEHQ) 90.0+%, TCI America™
CAS: 42978-66-5 Molecular Formula: C15H24O6 MDL Number: MFCD00064598
| CAS | 42978-66-5 |
|---|---|
| MDL Number | MFCD00064598 |
| Molecular Formula | C15H24O6 |
Allyl Methacrylate (stabilized with MEHQ) 99.0+%, TCI America™
CAS: 96-05-9 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00008592 InChI Key: FBCQUCJYYPMKRO-UHFFFAOYSA-N Synonym: allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech PubChem CID: 7274 IUPAC Name: prop-2-en-1-yl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC=C
| PubChem CID | 7274 |
|---|---|
| CAS | 96-05-9 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00008592 |
| SMILES | CC(=C)C(=O)OCC=C |
| Synonym | allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech |
| IUPAC Name | prop-2-en-1-yl 2-methylprop-2-enoate |
| InChI Key | FBCQUCJYYPMKRO-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
Propyl Methanesulfonate 98.0+%, TCI America™
CAS: 1912-31-8 Molecular Formula: C4H10O3S Molecular Weight (g/mol): 138.181 MDL Number: MFCD00007561 InChI Key: DKORSYDQYFVQNS-UHFFFAOYSA-N Synonym: Methanesulfonic Acid Propyl Ester PubChem CID: 74705 IUPAC Name: propyl methanesulfonate SMILES: CCCOS(=O)(=O)C
| PubChem CID | 74705 |
|---|---|
| CAS | 1912-31-8 |
| Molecular Weight (g/mol) | 138.181 |
| MDL Number | MFCD00007561 |
| SMILES | CCCOS(=O)(=O)C |
| Synonym | Methanesulfonic Acid Propyl Ester |
| IUPAC Name | propyl methanesulfonate |
| InChI Key | DKORSYDQYFVQNS-UHFFFAOYSA-N |
| Molecular Formula | C4H10O3S |
Cesium Acetate 98.0+%, TCI America™
CAS: 3396-11-0 Molecular Formula: C2H3CsO2 Molecular Weight (g/mol): 191.949 MDL Number: MFCD00013056 InChI Key: ZOAIGCHJWKDIPJ-UHFFFAOYSA-M Synonym: cesium acetate,acetic acid, cesium salt,caesium acetate,acetic acid, cesium salt 1:1,acetic acid, cesiumsalt,acetic acid cesium salt,caesium 1+ ion acetate,cesiumacetate,acetic acid cesium,caesium 1+ acetate ion PubChem CID: 5152919 IUPAC Name: cesium;acetate SMILES: CC(=O)[O-].[Cs+]
| PubChem CID | 5152919 |
|---|---|
| CAS | 3396-11-0 |
| Molecular Weight (g/mol) | 191.949 |
| MDL Number | MFCD00013056 |
| SMILES | CC(=O)[O-].[Cs+] |
| Synonym | cesium acetate,acetic acid, cesium salt,caesium acetate,acetic acid, cesium salt 1:1,acetic acid, cesiumsalt,acetic acid cesium salt,caesium 1+ ion acetate,cesiumacetate,acetic acid cesium,caesium 1+ acetate ion |
| IUPAC Name | cesium;acetate |
| InChI Key | ZOAIGCHJWKDIPJ-UHFFFAOYSA-M |
| Molecular Formula | C2H3CsO2 |
Nitrilotris(methylenephosphonic Acid) (ca. 50% in Water, ca. 2.2mol/L), TCI America™
CAS: 6419-19-8 Molecular Formula: C3H12NO9P3 Molecular Weight (g/mol): 299.048 MDL Number: MFCD00002138 InChI Key: YDONNITUKPKTIG-UHFFFAOYSA-N Synonym: nitrilotris methylene triphosphonic acid,tris phosphonomethyl amine,ferrofos 509,aminotrimethylene phosphonic acid,dowell l 37,dequest 2000,nitrilotrimethylphosphonic acid,nitrilotris methylenephosphonic acid,aminotris methylphosphonic acid,aminotri methylenephosphonic acid PubChem CID: 16698 IUPAC Name: [bis(phosphonomethyl)amino]methylphosphonic acid SMILES: C(N(CP(=O)(O)O)CP(=O)(O)O)P(=O)(O)O
| PubChem CID | 16698 |
|---|---|
| CAS | 6419-19-8 |
| Molecular Weight (g/mol) | 299.048 |
| MDL Number | MFCD00002138 |
| SMILES | C(N(CP(=O)(O)O)CP(=O)(O)O)P(=O)(O)O |
| Synonym | nitrilotris methylene triphosphonic acid,tris phosphonomethyl amine,ferrofos 509,aminotrimethylene phosphonic acid,dowell l 37,dequest 2000,nitrilotrimethylphosphonic acid,nitrilotris methylenephosphonic acid,aminotris methylphosphonic acid,aminotri methylenephosphonic acid |
| IUPAC Name | [bis(phosphonomethyl)amino]methylphosphonic acid |
| InChI Key | YDONNITUKPKTIG-UHFFFAOYSA-N |
| Molecular Formula | C3H12NO9P3 |
trans-1,2-Cyclohexanediaminetetraacetic Acid Monohydrate 99.0+%, TCI America™
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 IUPAC Name: 2-{[(1R,2R)-2-[bis(carboxylatomethyl)azaniumyl]cyclohexyl](carboxylatomethyl)azaniumyl}acetate SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| IUPAC Name | 2-{[(1R,2R)-2-[bis(carboxylatomethyl)azaniumyl]cyclohexyl](carboxylatomethyl)azaniumyl}acetate |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
Isoamyl Acrylate (stabilized with HQ) 98.0+%, TCI America™
CAS: 4245-35-6 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.198 MDL Number: MFCD00053725 InChI Key: ZVYGIPWYVVJFRW-UHFFFAOYSA-N Synonym: Acrylic Acid Isoamyl Ester, Isopentyl Acrylate, Acrylic Acid Isopentyl Ester PubChem CID: 77920 IUPAC Name: 3-methylbutyl prop-2-enoate SMILES: CC(C)CCOC(=O)C=C
| PubChem CID | 77920 |
|---|---|
| CAS | 4245-35-6 |
| Molecular Weight (g/mol) | 142.198 |
| MDL Number | MFCD00053725 |
| SMILES | CC(C)CCOC(=O)C=C |
| Synonym | Acrylic Acid Isoamyl Ester, Isopentyl Acrylate, Acrylic Acid Isopentyl Ester |
| IUPAC Name | 3-methylbutyl prop-2-enoate |
| InChI Key | ZVYGIPWYVVJFRW-UHFFFAOYSA-N |
| Molecular Formula | C8H14O2 |
Copper(II) Trifluoromethanesulfonate 98.0+%, TCI America™
CAS: 34946-82-2 Molecular Formula: CHCuF3O3S Molecular Weight (g/mol): 213.617 MDL Number: MFCD00077492 InChI Key: GZWXEFRPSWBAGC-UHFFFAOYSA-N Synonym: copper; trifluoromethanesulfonic acid PubChem CID: 45051791 IUPAC Name: copper;trifluoromethanesulfonic acid SMILES: C(F)(F)(F)S(=O)(=O)O.[Cu]
| PubChem CID | 45051791 |
|---|---|
| CAS | 34946-82-2 |
| Molecular Weight (g/mol) | 213.617 |
| MDL Number | MFCD00077492 |
| SMILES | C(F)(F)(F)S(=O)(=O)O.[Cu] |
| Synonym | copper; trifluoromethanesulfonic acid |
| IUPAC Name | copper;trifluoromethanesulfonic acid |
| InChI Key | GZWXEFRPSWBAGC-UHFFFAOYSA-N |
| Molecular Formula | CHCuF3O3S |
4,4'-(Hexafluoroisopropylidene)diphthalic Anhydride 98.0+%, TCI America™
CAS: 1107-00-2 Molecular Formula: C19H6F6O6 Molecular Weight (g/mol): 444.241 MDL Number: MFCD00039143 InChI Key: QHHKLPCQTTWFSS-UHFFFAOYSA-N Synonym: 4,4'-hexafluoroisopropylidene diphthalic anhydride,4,4'-hexafluoroisopropylidene diphthalicanhydride,5,5'-perfluoropropane-2,2-diyl bis isobenzofuran-1,3-dione,2,2-bis 3,4-anhydrodicarboxyphenyl hexafluoropropane,4,4'-hexafluoroisopropylidene bis phthalic anhydride,6fda,1,3-isobenzofurandione, 5,5'-2,2,2-trifluoro-1-trifluoromethyl ethylidene bis,2,2-bis 3,4-dicarboxyphenyl-1,1,1,3,3,3-hexafluoropropane dianhydride,5-2-1,3-dioxo-2-benzofuran-5-yl-1,1,1,3,3,3-hexafluoropropan-2-yl-2-benzofuran-1,3-dione,2,2'-bis-3,4-dicarboxyphenyl hexafluoropropane dianhydride PubChem CID: 70677 IUPAC Name: 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione SMILES: C1=CC2=C(C=C1C(C3=CC4=C(C=C3)C(=O)OC4=O)(C(F)(F)F)C(F)(F)F)C(=O)OC2=O
| PubChem CID | 70677 |
|---|---|
| CAS | 1107-00-2 |
| Molecular Weight (g/mol) | 444.241 |
| MDL Number | MFCD00039143 |
| SMILES | C1=CC2=C(C=C1C(C3=CC4=C(C=C3)C(=O)OC4=O)(C(F)(F)F)C(F)(F)F)C(=O)OC2=O |
| Synonym | 4,4'-hexafluoroisopropylidene diphthalic anhydride,4,4'-hexafluoroisopropylidene diphthalicanhydride,5,5'-perfluoropropane-2,2-diyl bis isobenzofuran-1,3-dione,2,2-bis 3,4-anhydrodicarboxyphenyl hexafluoropropane,4,4'-hexafluoroisopropylidene bis phthalic anhydride,6fda,1,3-isobenzofurandione, 5,5'-2,2,2-trifluoro-1-trifluoromethyl ethylidene bis,2,2-bis 3,4-dicarboxyphenyl-1,1,1,3,3,3-hexafluoropropane dianhydride,5-2-1,3-dioxo-2-benzofuran-5-yl-1,1,1,3,3,3-hexafluoropropan-2-yl-2-benzofuran-1,3-dione,2,2'-bis-3,4-dicarboxyphenyl hexafluoropropane dianhydride |
| IUPAC Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione |
| InChI Key | QHHKLPCQTTWFSS-UHFFFAOYSA-N |
| Molecular Formula | C19H6F6O6 |
1,3-Bis(hydroxymethyl)urea 97.0+%, TCI America™
CAS: 140-95-4 Molecular Formula: C3H8N2O3 Molecular Weight (g/mol): 120.11 MDL Number: MFCD00014414 InChI Key: QUBQYFYWUJJAAK-UHFFFAOYSA-N Synonym: 1,3-bis hydroxymethyl urea,dimethylolurea,oxymethurea,n,n'-dimethylolurea,methural,carbamol,caurite,metural,urofix,protesine dmu PubChem CID: 8827 IUPAC Name: 1,3-bis(hydroxymethyl)urea SMILES: OCNC(=O)NCO
| PubChem CID | 8827 |
|---|---|
| CAS | 140-95-4 |
| Molecular Weight (g/mol) | 120.11 |
| MDL Number | MFCD00014414 |
| SMILES | OCNC(=O)NCO |
| Synonym | 1,3-bis hydroxymethyl urea,dimethylolurea,oxymethurea,n,n'-dimethylolurea,methural,carbamol,caurite,metural,urofix,protesine dmu |
| IUPAC Name | 1,3-bis(hydroxymethyl)urea |
| InChI Key | QUBQYFYWUJJAAK-UHFFFAOYSA-N |
| Molecular Formula | C3H8N2O3 |
Sodium 1-Heptanesulfonate 98.0+%, TCI America™
CAS: 22767-50-6 Molecular Formula: C7H15NaO3S Molecular Weight (g/mol): 202.244 MDL Number: MFCD00007543 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M Synonym: sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate PubChem CID: 23672332 IUPAC Name: sodium;heptane-1-sulfonate SMILES: CCCCCCCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| Molecular Weight (g/mol) | 202.244 |
| MDL Number | MFCD00007543 |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Synonym | sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate |
| IUPAC Name | sodium;heptane-1-sulfonate |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Molecular Formula | C7H15NaO3S |
Sodium DL-3-Hydroxybutyrate 99.0+%, TCI America™
CAS: 150-83-4 Molecular Formula: C4H7NaO3 Molecular Weight (g/mol): 126.087 MDL Number: MFCD00016716 InChI Key: NBPUSGBJDWCHKC-UHFFFAOYSA-M Synonym: sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt PubChem CID: 23676771 IUPAC Name: sodium;3-hydroxybutanoate SMILES: CC(CC(=O)[O-])O.[Na+]
| PubChem CID | 23676771 |
|---|---|
| CAS | 150-83-4 |
| Molecular Weight (g/mol) | 126.087 |
| MDL Number | MFCD00016716 |
| SMILES | CC(CC(=O)[O-])O.[Na+] |
| Synonym | sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt |
| IUPAC Name | sodium;3-hydroxybutanoate |
| InChI Key | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| Molecular Formula | C4H7NaO3 |
Methyl Propiolate 98.0+%, TCI America™
CAS: 922-67-8 Molecular Formula: C4H4O2 Molecular Weight (g/mol): 84.074 MDL Number: MFCD00008572 InChI Key: IMAKHNTVDGLIRY-UHFFFAOYSA-N Synonym: methyl propiolate,methyl propynoate,2-propynoic acid, methyl ester,propiolic acid, methyl ester,methyl acetylenecarboxylate,methyl ethynecarboxylate,propynoic acid, methyl ester,propynoic acid methyl ester,methyl propargylate,acetylenecarboxylic acid methyl ester PubChem CID: 13536 IUPAC Name: methyl prop-2-ynoate SMILES: COC(=O)C#C
| PubChem CID | 13536 |
|---|---|
| CAS | 922-67-8 |
| Molecular Weight (g/mol) | 84.074 |
| MDL Number | MFCD00008572 |
| SMILES | COC(=O)C#C |
| Synonym | methyl propiolate,methyl propynoate,2-propynoic acid, methyl ester,propiolic acid, methyl ester,methyl acetylenecarboxylate,methyl ethynecarboxylate,propynoic acid, methyl ester,propynoic acid methyl ester,methyl propargylate,acetylenecarboxylic acid methyl ester |
| IUPAC Name | methyl prop-2-ynoate |
| InChI Key | IMAKHNTVDGLIRY-UHFFFAOYSA-N |
| Molecular Formula | C4H4O2 |
Sodium Glucoheptonate Dihydrate 98.0+%, TCI America™
CAS: 31138-65-5 Molecular Formula: C7H13NaO8 Molecular Weight (g/mol): 248.163 MDL Number: MFCD00013425 InChI Key: FMYOMWCQJXWGEN-AXUKCSBQSA-M Synonym: sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt PubChem CID: 49853507 IUPAC Name: sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate SMILES: C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+]
| PubChem CID | 49853507 |
|---|---|
| CAS | 31138-65-5 |
| Molecular Weight (g/mol) | 248.163 |
| MDL Number | MFCD00013425 |
| SMILES | C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+] |
| Synonym | sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt |
| IUPAC Name | sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| InChI Key | FMYOMWCQJXWGEN-AXUKCSBQSA-M |
| Molecular Formula | C7H13NaO8 |