Organic acids and derivatives
Apexbio Technology LLC 2-Aminobenzenesulfonic-acid
2-Aminobenzenesulfonic acid (CAS No 88-21-1) is frequently utilized in biomedical research for its role as a sulfonic acid derivative Originating from aromatic amines it functions within pathways related to sulfonation processes and is known to interact with various enzymes affecting metabolic pathways In vitro its activity is observed within the micromolar range influencing enzyme regulation and cellular responses The compound is employed in various applications including cell-based assays and animal model studies to evaluate its biochemical effects and therapeutic potential It is often involved in drug screening processes due to its modulation of specific biochemical pathways Experimental concentrations typically depend on the specific research design making it adaptable to a wide range of experimental conditions in both cellular and in vivo environments
![eMolecules 62086-04-8 | Tin(II) trifluoromethanesulfonate | Ambeed416.840 | C2F6O6S2Sn | 98.000 | [Sn++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F | 1g | 531648138](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502423609.JPG-250.jpg)
eMolecules 62086-04-8 | Tin(II) trifluoromethanesulfonate | Ambeed416.840 | C2F6O6S2Sn | 98.000 | [Sn++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F | 1g | 531648138
Tin(II) trifluoromethanesulfonate | Ambeed | 62086-04-8416.840 | C2F6O6S2Sn | 98.000 | [Sn++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F | 1g | 531648138
![eMolecules 76-61-9 | Ambeed | 33-Bis(4-hydroxy-5-isopropyl-2-methylphenyl)-3H-benzo[c][12]oxathiole 11-dioxide | 5g | 552755080 | A750751 | MFCD00005869 | 466.59 | C27H30O5S](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502421250.JPG-250.jpg)
eMolecules 76-61-9 | Ambeed | 33-Bis(4-hydroxy-5-isopropyl-2-methylphenyl)-3H-benzo[c][12]oxathiole 11-dioxide | 5g | 552755080 | A750751 | MFCD00005869 | 466.59 | C27H30O5S
Ambeed | 33-Bis(4-hydroxy-5-isopropyl-2-methylphenyl)-3H-benzo[c][12]oxathiole 11-dioxide | 5g | 552755080 | A750751 | 76-61-9 | MFCD00005869 | 466.590 | C27H30O5S
![eMolecules 207300-90-1 | 1-Heptanesulfonic acid sodium salt monohydrate | Chem-Impex | MFCD00149550 | 220.260 | C7H17NaO4S | 99.000 | O.[Na+].CCCCCCCS([O-])(=O)=O | 250g | 112757719](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000483027.jpg-250.jpg)
eMolecules 207300-90-1 | 1-Heptanesulfonic acid sodium salt monohydrate | Chem-Impex | MFCD00149550 | 220.260 | C7H17NaO4S | 99.000 | O.[Na+].CCCCCCCS([O-])(=O)=O | 250g | 112757719
1-Heptanesulfonic acid sodium salt monohydrate | Chem-Impex | 207300-90-1 | MFCD00149550 | 220.260 | C7H17NaO4S | 99.000 | O.[Na+].CCCCCCCS([O-])(=O)=O | 250g | 112757719
eMolecules 129112-26-1 | 2-Iodophenyl trifluoromethanesulfonate | Ambeed | MFCD07784326 | 352.070 | C7H4F3IO3S | 98.000 | FC(F)(F)S(=O)(=O)Oc1ccccc1I | 250mg | 632173304
2-Iodophenyl trifluoromethanesulfonate | Ambeed | 129112-26-1 | MFCD07784326 | 352.070 | C7H4F3IO3S | 98.000 | FC(F)(F)S(=O)(=O)Oc1ccccc1I | 250mg | 632173304
Medchemexpress LLC 1,1'-(Butane-1,4-diyl)bis(3-(2-(2-(2-aminoethoxy)ethoxy)ethyl)urea) dihydrochloride | 1571103-88-2 | 99.2% | 509.47 | 100 MG
1,1'-(Butane-1,4-diyl)bis(3-(2-(2-(2-aminoethoxy)ethoxy)ethyl)urea) dihydrochloride is a drug intermediate for synthesis of various active compounds. For research use only. We do not sell to patients.
- For research use only
- Not sold to patients
- Drug intermediate
Medchemexpress LLC Aminobenzenesulfonic auristatin E (TFA) | 1800462-99-0 | MFCD34676939 | 99.4% | 867.03 | C39H65F3N6O10S | 25 MG
Aminobenzenesulfonic auristatin E (TFA) is an agent-linker conjugate used in antibody-drug conjugate (ADC) research with potent antitumor activity. It is supplied as the trifluoroacetic acid (TFA) salt in a white to off-white solid and is intended for research applications in oncology and ADC development.
- Agent-linker conjugate for ADC research.
- Potent antitumor activity derived from auristatin E.
- TFA salt; white to off-white solid appearance.
- High purity (99.4%).
- Molecular weight 867.03 and formula C39H65F3N6O10S.
![eMolecules 332360-05-1 | Glyoxal sodium bisulfite addition compound hydrate | Oakwood Chemicals | MFCD00149541 | 284.160 | C2H6Na2O9S2 | 0.000 | O.[Na+].[Na+].OC(C(O)S([O-])(=O)=O)S([O-])(=O)=O | 25g | 480146963](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502148576.JPG-250.jpg)
eMolecules 332360-05-1 | Glyoxal sodium bisulfite addition compound hydrate | Oakwood Chemicals | MFCD00149541 | 284.160 | C2H6Na2O9S2 | 0.000 | O.[Na+].[Na+].OC(C(O)S([O-])(=O)=O)S([O-])(=O)=O | 25g | 480146963
Glyoxal sodium bisulfite addition compound hydrate | Oakwood Chemicals | 332360-05-1 | MFCD00149541 | 284.160 | C2H6Na2O9S2 | 0.000 | O.[Na+].[Na+].OC(C(O)S([O-])(=O)=O)S([O-])(=O)=O | 25g | 480146963