Organic acids and derivatives
Filtered Search Results
Ethyl myristate, 98+%
CAS: 124-06-1 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00008984 InChI Key: MMKRHZKQPFCLLS-UHFFFAOYSA-N Synonym: ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid PubChem CID: 31283 ChEBI: CHEBI:84849 IUPAC Name: ethyl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 31283 |
|---|---|
| CAS | 124-06-1 |
| Molecular Weight (g/mol) | 256.43 |
| ChEBI | CHEBI:84849 |
| MDL Number | MFCD00008984 |
| SMILES | CCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid |
| IUPAC Name | ethyl tetradecanoate |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |
2,2,2-Trifluoro-N-methylacetamide, 98%
CAS: 815-06-5 Molecular Formula: C3H4F3NO Molecular Weight (g/mol): 127.066 MDL Number: MFCD00009670 InChI Key: IQNHBUQSOSYAJU-UHFFFAOYSA-N Synonym: n-methyltrifluoroacetamide,n-methyl-2,2,2-trifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl,2,2,2-trifluoro-n-methyl-acetamide,n-metnyl-2,2,2-trifluoroacetamide,methyltrifluoroacetamide,acmc-209plm,n-methyl-trifluoroacetamide,n-methyltrifluoro-acetamide PubChem CID: 69948 IUPAC Name: 2,2,2-trifluoro-N-methylacetamide SMILES: CNC(=O)C(F)(F)F
| PubChem CID | 69948 |
|---|---|
| CAS | 815-06-5 |
| Molecular Weight (g/mol) | 127.066 |
| MDL Number | MFCD00009670 |
| SMILES | CNC(=O)C(F)(F)F |
| Synonym | n-methyltrifluoroacetamide,n-methyl-2,2,2-trifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl,2,2,2-trifluoro-n-methyl-acetamide,n-metnyl-2,2,2-trifluoroacetamide,methyltrifluoroacetamide,acmc-209plm,n-methyl-trifluoroacetamide,n-methyltrifluoro-acetamide |
| IUPAC Name | 2,2,2-trifluoro-N-methylacetamide |
| InChI Key | IQNHBUQSOSYAJU-UHFFFAOYSA-N |
| Molecular Formula | C3H4F3NO |
Ethyl palmitate, 97%
CAS: 628-97-7 Molecular Formula: C18H36O2 Molecular Weight (g/mol): 284.48 MDL Number: MFCD00008996 InChI Key: XIRNKXNNONJFQO-UHFFFAOYSA-N Synonym: ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm PubChem CID: 12366 ChEBI: CHEBI:84932 IUPAC Name: ethyl hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 12366 |
|---|---|
| CAS | 628-97-7 |
| Molecular Weight (g/mol) | 284.48 |
| ChEBI | CHEBI:84932 |
| MDL Number | MFCD00008996 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm |
| IUPAC Name | ethyl hexadecanoate |
| InChI Key | XIRNKXNNONJFQO-UHFFFAOYSA-N |
| Molecular Formula | C18H36O2 |
Methyl acetate, 99+%, Extra Dry, AcroSeal™
CAS: 79-20-9 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00008711 InChI Key: KXKVLQRXCPHEJC-UHFFFAOYSA-N Synonym: tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu PubChem CID: 6584 ChEBI: CHEBI:77700 IUPAC Name: methyl acetate SMILES: CC(=O)OC
| PubChem CID | 6584 |
|---|---|
| CAS | 79-20-9 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:77700 |
| MDL Number | MFCD00008711 |
| SMILES | CC(=O)OC |
| Synonym | tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu |
| IUPAC Name | methyl acetate |
| InChI Key | KXKVLQRXCPHEJC-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
2,2,3,4,4,4-Hexafluorobutyl methacrylate, 96%, stab.
CAS: 36405-47-7 Molecular Formula: C8H8F6O2 Molecular Weight (g/mol): 250.14 MDL Number: MFCD00042311 InChI Key: DFVPUWGVOPDJTC-UHFFFAOYSA-N Synonym: 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer PubChem CID: 549772 IUPAC Name: 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F
| PubChem CID | 549772 |
|---|---|
| CAS | 36405-47-7 |
| Molecular Weight (g/mol) | 250.14 |
| MDL Number | MFCD00042311 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| Synonym | 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate |
| InChI Key | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| Molecular Formula | C8H8F6O2 |
1-Butylphosphonic acid, 98%
CAS: 3321-64-0 Molecular Formula: C4H11O3P Molecular Weight (g/mol): 138.10 MDL Number: MFCD00012295 InChI Key: UOKRBSXOBUKDGE-UHFFFAOYSA-N Synonym: n-butylphosphonic acid,1-butanephosphonic acid,butylphosphonate,1-butylphosphonic acid,phosphonic acid, butyl,n-butyl phosphonic acid,acmc-1cr41 PubChem CID: 76839 ChEBI: CHEBI:41384 IUPAC Name: butylphosphonic acid SMILES: CCCCP(O)(O)=O
| PubChem CID | 76839 |
|---|---|
| CAS | 3321-64-0 |
| Molecular Weight (g/mol) | 138.10 |
| ChEBI | CHEBI:41384 |
| MDL Number | MFCD00012295 |
| SMILES | CCCCP(O)(O)=O |
| Synonym | n-butylphosphonic acid,1-butanephosphonic acid,butylphosphonate,1-butylphosphonic acid,phosphonic acid, butyl,n-butyl phosphonic acid,acmc-1cr41 |
| IUPAC Name | butylphosphonic acid |
| InChI Key | UOKRBSXOBUKDGE-UHFFFAOYSA-N |
| Molecular Formula | C4H11O3P |
Methanesulfonamide, 97+%
CAS: 3144-09-0 Molecular Formula: CH5NO2S Molecular Weight (g/mol): 95.12 MDL Number: MFCD00007940 InChI Key: HNQIVZYLYMDVSB-UHFFFAOYSA-N Synonym: methylsulfonamide,methane sulfonamide,methanesulphonamide,methansulfonamid,methyl sulfonamide,aminosulfane dioxide,methyl sulfonylamine,ch3so2nh2,mesylamine,methansulfonamide PubChem CID: 72879 IUPAC Name: methanesulfonamide SMILES: CS(N)(=O)=O
| PubChem CID | 72879 |
|---|---|
| CAS | 3144-09-0 |
| Molecular Weight (g/mol) | 95.12 |
| MDL Number | MFCD00007940 |
| SMILES | CS(N)(=O)=O |
| Synonym | methylsulfonamide,methane sulfonamide,methanesulphonamide,methansulfonamid,methyl sulfonamide,aminosulfane dioxide,methyl sulfonylamine,ch3so2nh2,mesylamine,methansulfonamide |
| IUPAC Name | methanesulfonamide |
| InChI Key | HNQIVZYLYMDVSB-UHFFFAOYSA-N |
| Molecular Formula | CH5NO2S |
Biphenyl-4-boronic acid, 97+%
CAS: 5122-94-1 Molecular Formula: C12H11BO2 Molecular Weight (g/mol): 198.03 MDL Number: MFCD00093311 InChI Key: XPEIJWZLPWNNOK-UHFFFAOYSA-N Synonym: 4-biphenylboronic acid,1,1'-biphenyl-4-ylboronic acid,biphenyl-4-boronic acid,4-biphenyl boronic acid,biphenylboronic acid,4-phenylphenyl boranediol,4-phenylphenyl boronic acid,biphenyl-4-ylboronic acid,1,1'-biphenyl-4-yl-boronic acid,4-phenylbenzeneboronic acid PubChem CID: 151253 IUPAC Name: (4-phenylphenyl)boronic acid SMILES: OB(O)C1=CC=C(C=C1)C1=CC=CC=C1
| PubChem CID | 151253 |
|---|---|
| CAS | 5122-94-1 |
| Molecular Weight (g/mol) | 198.03 |
| MDL Number | MFCD00093311 |
| SMILES | OB(O)C1=CC=C(C=C1)C1=CC=CC=C1 |
| Synonym | 4-biphenylboronic acid,1,1'-biphenyl-4-ylboronic acid,biphenyl-4-boronic acid,4-biphenyl boronic acid,biphenylboronic acid,4-phenylphenyl boranediol,4-phenylphenyl boronic acid,biphenyl-4-ylboronic acid,1,1'-biphenyl-4-yl-boronic acid,4-phenylbenzeneboronic acid |
| IUPAC Name | (4-phenylphenyl)boronic acid |
| InChI Key | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| Molecular Formula | C12H11BO2 |
2,2,3,3,3-Pentafluoropropyl methacrylate, 97%, stab.
CAS: 45115-53-5 Molecular Formula: C7H7F5O2 Molecular Weight (g/mol): 218.123 MDL Number: MFCD00039256 InChI Key: CLISWDZSTWQFNX-UHFFFAOYSA-N Synonym: 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 123516 IUPAC Name: 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(F)(F)F)(F)F
| PubChem CID | 123516 |
|---|---|
| CAS | 45115-53-5 |
| Molecular Weight (g/mol) | 218.123 |
| MDL Number | MFCD00039256 |
| SMILES | CC(=C)C(=O)OCC(C(F)(F)F)(F)F |
| Synonym | 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate |
| InChI Key | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| Molecular Formula | C7H7F5O2 |
1-Ethyl-3-methylimidazolium diethyl phosphate, 98%
CAS: 848641-69-0 Molecular Formula: C10H21N2O4P Molecular Weight (g/mol): 264.26 MDL Number: MFCD09953486 InChI Key: HQWOEDCLDNFWEV-UHFFFAOYSA-M Synonym: 1-ethyl-3-methylimidazolium diethyl phosphate,1-ethyl-3-methylimidazolium diethylphosphate,dsstox_cid_27865,dsstox_rid_82618,dsstox_gsid_47889,emim dep,basionics™ lq 11,1-ethyl-3-methylimidazolium-diethyl phosphate,1-ethyl-3-methylimidazolium diethyl phosphate hplc PubChem CID: 53316406 IUPAC Name: diethyl phosphate;1-ethyl-3-methylimidazol-3-ium SMILES: CCN1C=C[N+](C)=C1.CCOP([O-])(=O)OCC
| PubChem CID | 53316406 |
|---|---|
| CAS | 848641-69-0 |
| Molecular Weight (g/mol) | 264.26 |
| MDL Number | MFCD09953486 |
| SMILES | CCN1C=C[N+](C)=C1.CCOP([O-])(=O)OCC |
| Synonym | 1-ethyl-3-methylimidazolium diethyl phosphate,1-ethyl-3-methylimidazolium diethylphosphate,dsstox_cid_27865,dsstox_rid_82618,dsstox_gsid_47889,emim dep,basionics™ lq 11,1-ethyl-3-methylimidazolium-diethyl phosphate,1-ethyl-3-methylimidazolium diethyl phosphate hplc |
| IUPAC Name | diethyl phosphate;1-ethyl-3-methylimidazol-3-ium |
| InChI Key | HQWOEDCLDNFWEV-UHFFFAOYSA-M |
| Molecular Formula | C10H21N2O4P |
4-Methylnaphthalene-1-boronic acid, 96%
CAS: 103986-53-4 Molecular Formula: C11H11BO2 Molecular Weight (g/mol): 186.02 MDL Number: MFCD01632204 InChI Key: JHVQEUGNYSVSDH-UHFFFAOYSA-N Synonym: 4-methyl-1-naphthaleneboronic acid,4-methyl-1-naphthalene boronic acid,4-methylnaphthalene-1-boronic acid,1-methylnaphthalene-4-boronic acid,4-methylnaphthalen-1-yl boronic acid,1-borono-4-methylnaphthalene,4-methyl-1-naphthyl boronic acid,4-methyl-1-naphthylboronic acid,4-methylnaphthalen-1-yl boranediol,boronic acid, 4-methyl-1-naphthalenyl PubChem CID: 2773511 IUPAC Name: (4-methylnaphthalen-1-yl)boronic acid SMILES: CC1=CC=C(B(O)O)C2=CC=CC=C12
| PubChem CID | 2773511 |
|---|---|
| CAS | 103986-53-4 |
| Molecular Weight (g/mol) | 186.02 |
| MDL Number | MFCD01632204 |
| SMILES | CC1=CC=C(B(O)O)C2=CC=CC=C12 |
| Synonym | 4-methyl-1-naphthaleneboronic acid,4-methyl-1-naphthalene boronic acid,4-methylnaphthalene-1-boronic acid,1-methylnaphthalene-4-boronic acid,4-methylnaphthalen-1-yl boronic acid,1-borono-4-methylnaphthalene,4-methyl-1-naphthyl boronic acid,4-methyl-1-naphthylboronic acid,4-methylnaphthalen-1-yl boranediol,boronic acid, 4-methyl-1-naphthalenyl |
| IUPAC Name | (4-methylnaphthalen-1-yl)boronic acid |
| InChI Key | JHVQEUGNYSVSDH-UHFFFAOYSA-N |
| Molecular Formula | C11H11BO2 |
2,3-Dimercapto-1-propanesulfonic acid sodium salt monohydrate, 95%
CAS: 207233-91-8 Molecular Formula: C3H7O3S3 Molecular Weight (g/mol): 187.27 MDL Number: MFCD00149543 InChI Key: JLVSRWOIZZXQAD-GSVOUGTGSA-M Synonym: sodium 2,3-dimercaptopropanesulfonate monohydrate,unithiol,dl-2,3-dimercapto-1-propanesulfonic acid sodium salt monohydrate,sodium 2,3-dimercaptopropane-1-sulfonate hydrate,2,3-dimercapto-1-propanesulfonic acid sodium salt monohydrate,sodium 2,3-dimercaptopropanesulfonate hydrate,dmps,sodium 2,3-disulfanylpropane-1-sulfonate hydrate,unitiol monohydrate PubChem CID: 23676755 SMILES: [O-]S(=O)(=O)C[C@H](S)CS
| PubChem CID | 23676755 |
|---|---|
| CAS | 207233-91-8 |
| Molecular Weight (g/mol) | 187.27 |
| MDL Number | MFCD00149543 |
| SMILES | [O-]S(=O)(=O)C[C@H](S)CS |
| Synonym | sodium 2,3-dimercaptopropanesulfonate monohydrate,unithiol,dl-2,3-dimercapto-1-propanesulfonic acid sodium salt monohydrate,sodium 2,3-dimercaptopropane-1-sulfonate hydrate,2,3-dimercapto-1-propanesulfonic acid sodium salt monohydrate,sodium 2,3-dimercaptopropanesulfonate hydrate,dmps,sodium 2,3-disulfanylpropane-1-sulfonate hydrate,unitiol monohydrate |
| InChI Key | JLVSRWOIZZXQAD-GSVOUGTGSA-M |
| Molecular Formula | C3H7O3S3 |
1-(tert-Butyl)-3-methyl-1H-pyrazole-5-carboxylic acid, ≥95%, Thermo Scientific™
CAS: 175277-09-5 Molecular Formula: C9H14N2O2 Molecular Weight (g/mol): 182.223 MDL Number: MFCD00084917 InChI Key: JZPMLZWJUMATOQ-UHFFFAOYSA-N Synonym: 1-tert-butyl-3-methyl-1h-pyrazole-5-carboxylic acid,2-tert-butyl-5-methyl-pyrazole-3-carboxylic acid,1-tert-butyl-3-methylpyrazole-5-carboxylic acid,maybridge1_008627,buttpark 9218-70,2-tert-butyl-5-methyl-3-pyrazolecarboxylic acid,1-tert-butyl-5-carboxy-3-methyl-1h-pyrazole,1-tert-butyl-3-methyl-1h-pyrazole-5-carboxylic acid PubChem CID: 2744573 IUPAC Name: 2-tert-butyl-5-methylpyrazole-3-carboxylic acid SMILES: CC1=NN(C(=C1)C(=O)O)C(C)(C)C
| PubChem CID | 2744573 |
|---|---|
| CAS | 175277-09-5 |
| Molecular Weight (g/mol) | 182.223 |
| MDL Number | MFCD00084917 |
| SMILES | CC1=NN(C(=C1)C(=O)O)C(C)(C)C |
| Synonym | 1-tert-butyl-3-methyl-1h-pyrazole-5-carboxylic acid,2-tert-butyl-5-methyl-pyrazole-3-carboxylic acid,1-tert-butyl-3-methylpyrazole-5-carboxylic acid,maybridge1_008627,buttpark 9218-70,2-tert-butyl-5-methyl-3-pyrazolecarboxylic acid,1-tert-butyl-5-carboxy-3-methyl-1h-pyrazole,1-tert-butyl-3-methyl-1h-pyrazole-5-carboxylic acid |
| IUPAC Name | 2-tert-butyl-5-methylpyrazole-3-carboxylic acid |
| InChI Key | JZPMLZWJUMATOQ-UHFFFAOYSA-N |
| Molecular Formula | C9H14N2O2 |
Bismuth subgallate hydrate
CAS: 342406-26-2 Molecular Formula: C7H5BiO6 Molecular Weight (g/mol): 394.09 MDL Number: MFCD00044980 InChI Key: JAONZGLTYYUPCT-UHFFFAOYSA-K Synonym: bismuth subgallate,wismutgallathydroxid,dermatol,bismuth gallate,dermatol puder,bismuth subgallas,bismutum subgallicum,basic bismuth gallate,gallic acid bismuth basic salt,wismutgallat, basisches PubChem CID: 16682999 IUPAC Name: 4-hydroxy-1,3,2$l^{2}-benzodioxabismole-6-carboxylic acid;hydrate SMILES: O[Bi]1OC2=C(O1)C(O)=CC(=C2)C(O)=O
| PubChem CID | 16682999 |
|---|---|
| CAS | 342406-26-2 |
| Molecular Weight (g/mol) | 394.09 |
| MDL Number | MFCD00044980 |
| SMILES | O[Bi]1OC2=C(O1)C(O)=CC(=C2)C(O)=O |
| Synonym | bismuth subgallate,wismutgallathydroxid,dermatol,bismuth gallate,dermatol puder,bismuth subgallas,bismutum subgallicum,basic bismuth gallate,gallic acid bismuth basic salt,wismutgallat, basisches |
| IUPAC Name | 4-hydroxy-1,3,2$l^{2}-benzodioxabismole-6-carboxylic acid;hydrate |
| InChI Key | JAONZGLTYYUPCT-UHFFFAOYSA-K |
| Molecular Formula | C7H5BiO6 |