Organic acids and derivatives
Filtered Search Results
Diethyl (3,3-diethoxypropyl)phosphonate, 95%, stabilized with max. 1% w/w Na2CO3
CAS: 15110-17-5 Molecular Formula: C11H25O5P Molecular Weight (g/mol): 268.29 MDL Number: MFCD00800259 InChI Key: WKPXMGJOGYEGNW-UHFFFAOYSA-N Synonym: diethyl 3,3-diethoxypropyl phosphonate,diethyl 3,3-diethoxypropylphosphonate,phosphonic acid, p-3,3-diethoxypropyl-, diethyl ester,3-diethoxyphosphoryl-1,1-diethoxy-propane,3-diethoxyphosphoryl propanaldehyde diethyl acetal,phosphonic acid,p-3,3-diethoxypropyl-, diethyl ester PubChem CID: 328856 IUPAC Name: 3-diethoxyphosphoryl-1,1-diethoxypropane SMILES: CCOC(CCP(=O)(OCC)OCC)OCC
| PubChem CID | 328856 |
|---|---|
| CAS | 15110-17-5 |
| Molecular Weight (g/mol) | 268.29 |
| MDL Number | MFCD00800259 |
| SMILES | CCOC(CCP(=O)(OCC)OCC)OCC |
| Synonym | diethyl 3,3-diethoxypropyl phosphonate,diethyl 3,3-diethoxypropylphosphonate,phosphonic acid, p-3,3-diethoxypropyl-, diethyl ester,3-diethoxyphosphoryl-1,1-diethoxy-propane,3-diethoxyphosphoryl propanaldehyde diethyl acetal,phosphonic acid,p-3,3-diethoxypropyl-, diethyl ester |
| IUPAC Name | 3-diethoxyphosphoryl-1,1-diethoxypropane |
| InChI Key | WKPXMGJOGYEGNW-UHFFFAOYSA-N |
| Molecular Formula | C11H25O5P |
Strontium oxalate, 95%, Thermo Scientific Chemicals
CAS: 814-95-9 Molecular Formula: C2O4Sr Molecular Weight (g/mol): 175.638 MDL Number: MFCD00050803 InChI Key: KQAGKTURZUKUCH-UHFFFAOYSA-L Synonym: strontium oxalate,unii-7iaw7e69ni,7iaw7e69ni,strontium oxalate, src2o4,ethanedioic acid, strontium salt 1:1,oxalic acid, monostrontium salt,strontium 2+ ion oxalate,oxalic acid, strontium salt 1:1 8ci PubChem CID: 69947 IUPAC Name: strontium;oxalate SMILES: C(=O)(C(=O)[O-])[O-].[Sr+2]
| PubChem CID | 69947 |
|---|---|
| CAS | 814-95-9 |
| Molecular Weight (g/mol) | 175.638 |
| MDL Number | MFCD00050803 |
| SMILES | C(=O)(C(=O)[O-])[O-].[Sr+2] |
| Synonym | strontium oxalate,unii-7iaw7e69ni,7iaw7e69ni,strontium oxalate, src2o4,ethanedioic acid, strontium salt 1:1,oxalic acid, monostrontium salt,strontium 2+ ion oxalate,oxalic acid, strontium salt 1:1 8ci |
| IUPAC Name | strontium;oxalate |
| InChI Key | KQAGKTURZUKUCH-UHFFFAOYSA-L |
| Molecular Formula | C2O4Sr |
Cyclohexyl methyl methylphosphonate, 99%, Thermo Scientific Chemicals
CAS: 7040-52-0 Molecular Formula: C8H17O3P Molecular Weight (g/mol): 192.195 MDL Number: MFCD08064211 InChI Key: UXITUBFQUAHYSL-UHFFFAOYSA-N Synonym: cyclohexyl methyl methylphosphonate,phosphonic acid, methyl-, cyclohexyl methyl ester,cyclohexyl methyl methyl-phosphonate,methoxy methyl phosphoryl oxycyclohexane,methylphosphonic acid methylcyclohexyl ester PubChem CID: 574009 IUPAC Name: [methoxy(methyl)phosphoryl]oxycyclohexane SMILES: COP(=O)(C)OC1CCCCC1
| PubChem CID | 574009 |
|---|---|
| CAS | 7040-52-0 |
| Molecular Weight (g/mol) | 192.195 |
| MDL Number | MFCD08064211 |
| SMILES | COP(=O)(C)OC1CCCCC1 |
| Synonym | cyclohexyl methyl methylphosphonate,phosphonic acid, methyl-, cyclohexyl methyl ester,cyclohexyl methyl methyl-phosphonate,methoxy methyl phosphoryl oxycyclohexane,methylphosphonic acid methylcyclohexyl ester |
| IUPAC Name | [methoxy(methyl)phosphoryl]oxycyclohexane |
| InChI Key | UXITUBFQUAHYSL-UHFFFAOYSA-N |
| Molecular Formula | C8H17O3P |
(+)-Diethyl L-tartrate, 98%
CAS: 87-91-2 Molecular Formula: C8H14O6 Molecular Weight (g/mol): 206.19 MDL Number: MFCD00009143 InChI Key: YSAVZVORKRDODB-UHFFFAOYNA-N Synonym: diethyl l-+-tartrate,2r,3r-diethyl 2,3-dihydroxysuccinate,l +-diethyl l-tartrate,+-diethyl l-tartrate,diethyl l-tartrate,diethyl-l-tartrate,unii-oq72cpy58z,l-+-tartaric acid diethyl ester,diethyl l-tartarate,tartaric acid, diethyl ester, r,r PubChem CID: 6993580 SMILES: CCOC(=O)C(O)C(O)C(=O)OCC
| PubChem CID | 6993580 |
|---|---|
| CAS | 87-91-2 |
| Molecular Weight (g/mol) | 206.19 |
| MDL Number | MFCD00009143 |
| SMILES | CCOC(=O)C(O)C(O)C(=O)OCC |
| Synonym | diethyl l-+-tartrate,2r,3r-diethyl 2,3-dihydroxysuccinate,l +-diethyl l-tartrate,+-diethyl l-tartrate,diethyl l-tartrate,diethyl-l-tartrate,unii-oq72cpy58z,l-+-tartaric acid diethyl ester,diethyl l-tartarate,tartaric acid, diethyl ester, r,r |
| InChI Key | YSAVZVORKRDODB-UHFFFAOYNA-N |
| Molecular Formula | C8H14O6 |
Sulfanilic acid, ACS, 98.0-102.0%
CAS: 121-57-3 Molecular Formula: C6H7NO3S Molecular Weight (g/mol): 173.186 MDL Number: MFCD00007886 InChI Key: HVBSAKJJOYLTQU-UHFFFAOYSA-N Synonym: sulfanilic acid,sulphanilic acid,p-aminobenzenesulfonic acid,sulfanilsaeure,aniline-4-sulfonic acid,benzenesulfonic acid, 4-amino,aniline-p-sulfonic acid,aniline-p-sulphonic acid,p-aminophenylsulfonic acid,sulfanilicacid PubChem CID: 8479 ChEBI: CHEBI:27500 IUPAC Name: 4-aminobenzenesulfonic acid SMILES: C1=CC(=CC=C1N)S(=O)(=O)O
| PubChem CID | 8479 |
|---|---|
| CAS | 121-57-3 |
| Molecular Weight (g/mol) | 173.186 |
| ChEBI | CHEBI:27500 |
| MDL Number | MFCD00007886 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)O |
| Synonym | sulfanilic acid,sulphanilic acid,p-aminobenzenesulfonic acid,sulfanilsaeure,aniline-4-sulfonic acid,benzenesulfonic acid, 4-amino,aniline-p-sulfonic acid,aniline-p-sulphonic acid,p-aminophenylsulfonic acid,sulfanilicacid |
| IUPAC Name | 4-aminobenzenesulfonic acid |
| InChI Key | HVBSAKJJOYLTQU-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO3S |
tert-Butyl diethylphosphonoacetate, 95%
CAS: 27784-76-5 Molecular Formula: C10H21O5P Molecular Weight (g/mol): 252.247 MDL Number: MFCD00075414 InChI Key: NFEGNISFSSLEGU-UHFFFAOYSA-N Synonym: tert-butyl diethylphosphonoacetate,tert-butyl 2-diethoxyphosphoryl acetate,diethyl boc-methyl phosphonate,diethoxy-phosphoryl-acetic acid tert-butyl ester,t-butyl diethylphosphonoacetate,diethyl phosphonoacetic acid tert-butyl ester,t-butyl diethyl phosphonoacetate,diethylphosphonoacetic acid tert-butyl ester,diethyl 2-tert-butoxycarbonylmethyl phosphonate,acetic acid, diethoxyphosphinyl-, 1,1-dimethylethyl ester PubChem CID: 2773685 IUPAC Name: tert-butyl 2-diethoxyphosphorylacetate SMILES: CCOP(=O)(CC(=O)OC(C)(C)C)OCC
| PubChem CID | 2773685 |
|---|---|
| CAS | 27784-76-5 |
| Molecular Weight (g/mol) | 252.247 |
| MDL Number | MFCD00075414 |
| SMILES | CCOP(=O)(CC(=O)OC(C)(C)C)OCC |
| Synonym | tert-butyl diethylphosphonoacetate,tert-butyl 2-diethoxyphosphoryl acetate,diethyl boc-methyl phosphonate,diethoxy-phosphoryl-acetic acid tert-butyl ester,t-butyl diethylphosphonoacetate,diethyl phosphonoacetic acid tert-butyl ester,t-butyl diethyl phosphonoacetate,diethylphosphonoacetic acid tert-butyl ester,diethyl 2-tert-butoxycarbonylmethyl phosphonate,acetic acid, diethoxyphosphinyl-, 1,1-dimethylethyl ester |
| IUPAC Name | tert-butyl 2-diethoxyphosphorylacetate |
| InChI Key | NFEGNISFSSLEGU-UHFFFAOYSA-N |
| Molecular Formula | C10H21O5P |
Diethyl trichloromethylphosphonate, 98%
CAS: 866-23-9 Molecular Formula: C5H10Cl3O3P Molecular Weight (g/mol): 255.46 MDL Number: MFCD00013666 InChI Key: RVAQSYWDOSHWGP-UHFFFAOYSA-N Synonym: diethyl trichloromethylphosphonate,diethyl trichloromethyl phosphonate,phosphonic acid, trichloromethyl-, diethyl ester,methanephosphonic acid, trichloro-, diethyl ester,diethyltrichloromethylphosphonate,wln: gxggpo&o2&o2,4-03-00-00262 beilstein handbook reference,trichloromethylphosphonic acid diethyl,diethoxyphosphino trichloromethyl-1-one PubChem CID: 70085 IUPAC Name: 1-[ethoxy(trichloromethyl)phosphoryl]oxyethane SMILES: CCOP(=O)(OCC)C(Cl)(Cl)Cl
| PubChem CID | 70085 |
|---|---|
| CAS | 866-23-9 |
| Molecular Weight (g/mol) | 255.46 |
| MDL Number | MFCD00013666 |
| SMILES | CCOP(=O)(OCC)C(Cl)(Cl)Cl |
| Synonym | diethyl trichloromethylphosphonate,diethyl trichloromethyl phosphonate,phosphonic acid, trichloromethyl-, diethyl ester,methanephosphonic acid, trichloro-, diethyl ester,diethyltrichloromethylphosphonate,wln: gxggpo&o2&o2,4-03-00-00262 beilstein handbook reference,trichloromethylphosphonic acid diethyl,diethoxyphosphino trichloromethyl-1-one |
| IUPAC Name | 1-[ethoxy(trichloromethyl)phosphoryl]oxyethane |
| InChI Key | RVAQSYWDOSHWGP-UHFFFAOYSA-N |
| Molecular Formula | C5H10Cl3O3P |
A-803467, 98%, Thermo Scientific Chemicals
CAS: 944261-79-4 Molecular Formula: C19H16ClNO4 Molecular Weight (g/mol): 357.79 MDL Number: MFCD10574689 InChI Key: VHKBTPQDHDSBSP-UHFFFAOYSA-N PubChem CID: 16038374 IUPAC Name: 5-(4-chlorophenyl)-N-(3,5-dimethoxyphenyl)furan-2-carboxamide SMILES: COC1=CC(OC)=CC(NC(=O)C2=CC=C(O2)C2=CC=C(Cl)C=C2)=C1
| PubChem CID | 16038374 |
|---|---|
| CAS | 944261-79-4 |
| Molecular Weight (g/mol) | 357.79 |
| MDL Number | MFCD10574689 |
| SMILES | COC1=CC(OC)=CC(NC(=O)C2=CC=C(O2)C2=CC=C(Cl)C=C2)=C1 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(3,5-dimethoxyphenyl)furan-2-carboxamide |
| InChI Key | VHKBTPQDHDSBSP-UHFFFAOYSA-N |
| Molecular Formula | C19H16ClNO4 |
Cromolyn sodium salt, 98%
CAS: 15826-37-6 Molecular Formula: C23H14Na2O11 Molecular Weight (g/mol): 512.33 MDL Number: MFCD00057744 InChI Key: VLARUOGDXDTHEH-UHFFFAOYSA-L Synonym: cromolyn sodium,sodium cromoglycate,disodium cromoglycate,sodium cromoglicate,sodium cromolyn,gastrocrom,nasalcrom,cromoglycate disodium,natrium cromoglicat,lomudal PubChem CID: 27503 ChEBI: CHEBI:128458 SMILES: [Na+].[Na+].OC(COC1=C2C(=O)C=C(OC2=CC=C1)C([O-])=O)COC1=C2C(=O)C=C(OC2=CC=C1)C([O-])=O
| PubChem CID | 27503 |
|---|---|
| CAS | 15826-37-6 |
| Molecular Weight (g/mol) | 512.33 |
| ChEBI | CHEBI:128458 |
| MDL Number | MFCD00057744 |
| SMILES | [Na+].[Na+].OC(COC1=C2C(=O)C=C(OC2=CC=C1)C([O-])=O)COC1=C2C(=O)C=C(OC2=CC=C1)C([O-])=O |
| Synonym | cromolyn sodium,sodium cromoglycate,disodium cromoglycate,sodium cromoglicate,sodium cromolyn,gastrocrom,nasalcrom,cromoglycate disodium,natrium cromoglicat,lomudal |
| InChI Key | VLARUOGDXDTHEH-UHFFFAOYSA-L |
| Molecular Formula | C23H14Na2O11 |
Ethyl dodecanoate, 98%
CAS: 106-33-2 Molecular Formula: C14H28O2 Molecular Weight (g/mol): 228.38 MDL Number: MFCD00015065 InChI Key: MMXKVMNBHPAILY-UHFFFAOYSA-N Synonym: ethyl laurate,dodecanoic acid, ethyl ester,ethyl laurinate,ethyl dodecylate,lauric acid ethyl ester,lauric acid, ethyl ester,ethyl laurate natural,dodecanoic acid ethyl ester,ethyl n-dodecanote,unii-f389d4md5k PubChem CID: 7800 ChEBI: CHEBI:87427 IUPAC Name: ethyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCC
| PubChem CID | 7800 |
|---|---|
| CAS | 106-33-2 |
| Molecular Weight (g/mol) | 228.38 |
| ChEBI | CHEBI:87427 |
| MDL Number | MFCD00015065 |
| SMILES | CCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl laurate,dodecanoic acid, ethyl ester,ethyl laurinate,ethyl dodecylate,lauric acid ethyl ester,lauric acid, ethyl ester,ethyl laurate natural,dodecanoic acid ethyl ester,ethyl n-dodecanote,unii-f389d4md5k |
| IUPAC Name | ethyl dodecanoate |
| InChI Key | MMXKVMNBHPAILY-UHFFFAOYSA-N |
| Molecular Formula | C14H28O2 |
S-Ethyl thioacetate, 98+%
CAS: 625-60-5 Molecular Formula: C4H8OS Molecular Weight (g/mol): 104.167 MDL Number: MFCD00015178 InChI Key: APTGPWJUOYMUCE-UHFFFAOYSA-N Synonym: s-ethyl thioacetate,ethanethioic acid, ethyl ester,ethanethioic acid, s-ethyl ester,ethyl thiolacetate,ethyl ethanethioate,ethanethioic acid s-ethyl ester,s-ethyl thiolacetate,acetic acid, thio-, ethyl ester,thioethyl compound,acetic acid, thio-, s-ethyl ester PubChem CID: 61171 IUPAC Name: S-ethyl ethanethioate SMILES: CCSC(=O)C
| PubChem CID | 61171 |
|---|---|
| CAS | 625-60-5 |
| Molecular Weight (g/mol) | 104.167 |
| MDL Number | MFCD00015178 |
| SMILES | CCSC(=O)C |
| Synonym | s-ethyl thioacetate,ethanethioic acid, ethyl ester,ethanethioic acid, s-ethyl ester,ethyl thiolacetate,ethyl ethanethioate,ethanethioic acid s-ethyl ester,s-ethyl thiolacetate,acetic acid, thio-, ethyl ester,thioethyl compound,acetic acid, thio-, s-ethyl ester |
| IUPAC Name | S-ethyl ethanethioate |
| InChI Key | APTGPWJUOYMUCE-UHFFFAOYSA-N |
| Molecular Formula | C4H8OS |
Tetraethyl ethylenediphosphonate, 98%
CAS: 995-32-4 Molecular Formula: C10H24O6P2 Molecular Weight (g/mol): 302.24 MDL Number: MFCD00015133 InChI Key: RSQYXXACEZCDFS-UHFFFAOYSA-N Synonym: tetraethyl ethylenediphosphonate,tetraethyl ethylenebisphosphonate,ethylenediphosphonic acid tetraethyl ester,tetraethyl ethane-1,2-diylbis phosphonate,1,2-bis diethoxyphosphoryl ethane,1,2-bis diethyl-phosphonato ethane,phosphonic acid, 1,2-ethanediylbis-, tetraethyl ester,diethyl 2-diethoxyphosphoryl ethylphosphonate,phosphonic acid, ethylenedi-, tetraethyl ester,acmc-209scy PubChem CID: 70446 IUPAC Name: 1,2-bis(diethoxyphosphoryl)ethane SMILES: CCOP(=O)(CCP(=O)(OCC)OCC)OCC
| PubChem CID | 70446 |
|---|---|
| CAS | 995-32-4 |
| Molecular Weight (g/mol) | 302.24 |
| MDL Number | MFCD00015133 |
| SMILES | CCOP(=O)(CCP(=O)(OCC)OCC)OCC |
| Synonym | tetraethyl ethylenediphosphonate,tetraethyl ethylenebisphosphonate,ethylenediphosphonic acid tetraethyl ester,tetraethyl ethane-1,2-diylbis phosphonate,1,2-bis diethoxyphosphoryl ethane,1,2-bis diethyl-phosphonato ethane,phosphonic acid, 1,2-ethanediylbis-, tetraethyl ester,diethyl 2-diethoxyphosphoryl ethylphosphonate,phosphonic acid, ethylenedi-, tetraethyl ester,acmc-209scy |
| IUPAC Name | 1,2-bis(diethoxyphosphoryl)ethane |
| InChI Key | RSQYXXACEZCDFS-UHFFFAOYSA-N |
| Molecular Formula | C10H24O6P2 |
(+)-Dibenzoyl-D-tartaric acid, 98+%
CAS: 17026-42-5 Molecular Formula: C18H14O8 Molecular Weight (g/mol): 358.30 MDL Number: MFCD00063222 InChI Key: YONLFQNRGZXBBF-ZCWZLOQUNA-N Synonym: dibenzoyl-d-tartaric acid,+-dibenzoyl-d-tartaric acid,2s,3s-2,3-bis benzoyloxy succinic acid,d-dibenzoyl tartaric acid,butanedioic acid, 2,3-bis benzoyloxy-, 2s,3s,+-o,o-dibenzoyltartaric acid,2s,3s-+-dibenzoyltartaric acid,+-dibenzoyltartaric acid,+-dibenzoyl tartaric acid PubChem CID: 1550213 SMILES: OC(=O)[C@@H](OC(=O)C1=CC=CC=C1)[C@H](OC(=O)C1=CC=CC=C1)C(O)=O
| PubChem CID | 1550213 |
|---|---|
| CAS | 17026-42-5 |
| Molecular Weight (g/mol) | 358.30 |
| MDL Number | MFCD00063222 |
| SMILES | OC(=O)[C@@H](OC(=O)C1=CC=CC=C1)[C@H](OC(=O)C1=CC=CC=C1)C(O)=O |
| Synonym | dibenzoyl-d-tartaric acid,+-dibenzoyl-d-tartaric acid,2s,3s-2,3-bis benzoyloxy succinic acid,d-dibenzoyl tartaric acid,butanedioic acid, 2,3-bis benzoyloxy-, 2s,3s,+-o,o-dibenzoyltartaric acid,2s,3s-+-dibenzoyltartaric acid,+-dibenzoyltartaric acid,+-dibenzoyl tartaric acid |
| InChI Key | YONLFQNRGZXBBF-ZCWZLOQUNA-N |
| Molecular Formula | C18H14O8 |
Ethyl 4-bromocrotonate, tech. 80%
CAS: 37746-78-4 Molecular Formula: C6H9BrO2 Molecular Weight (g/mol): 193.04 MDL Number: MFCD00000247 InChI Key: FHGRPBSDPBRTLS-ONEGZZNKSA-N Synonym: ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate PubChem CID: 5373944 IUPAC Name: ethyl (E)-4-bromobut-2-enoate SMILES: CCOC(=O)C=CCBr
| PubChem CID | 5373944 |
|---|---|
| CAS | 37746-78-4 |
| Molecular Weight (g/mol) | 193.04 |
| MDL Number | MFCD00000247 |
| SMILES | CCOC(=O)C=CCBr |
| Synonym | ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate |
| IUPAC Name | ethyl (E)-4-bromobut-2-enoate |
| InChI Key | FHGRPBSDPBRTLS-ONEGZZNKSA-N |
| Molecular Formula | C6H9BrO2 |
Ethyl methanesulfonate, 99%
CAS: 62-50-0 Molecular Formula: C3H8O3S Molecular Weight (g/mol): 124.15 MDL Number: MFCD00007559 InChI Key: PLUBXMRUUVWRLT-UHFFFAOYSA-N Synonym: ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid PubChem CID: 6113 ChEBI: CHEBI:23994 IUPAC Name: ethyl methanesulfonate SMILES: CCOS(=O)(=O)C
| PubChem CID | 6113 |
|---|---|
| CAS | 62-50-0 |
| Molecular Weight (g/mol) | 124.15 |
| ChEBI | CHEBI:23994 |
| MDL Number | MFCD00007559 |
| SMILES | CCOS(=O)(=O)C |
| Synonym | ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid |
| IUPAC Name | ethyl methanesulfonate |
| InChI Key | PLUBXMRUUVWRLT-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3S |