Organooxygen compounds
Medchemexpress LLC Carboxyatractyloside tripotassium | 77228-71-8 | 885.09 | 5 MG
Carboxyatractyloside tripotassium is a diterpenoid that can be isolated from plants of the genus Xanthium. It functions as an ADP/ATP carrier inhibitor, specifically inhibiting mitochondrial ADP/ATP transport. This compound promotes ROS production, induces Ca2+ release, and leads to mitochondrial dysfunction, and has been observed to induce lethargy, weakness, and epileptic seizures in rats.
- Promotes cell death in primary mouse lung endothelial cells.
- Exacerbates mitochondrial dysfunction, including depolarization, increased ROS generation, and MPT pore opening.
- Induces Ca2+ release, mitochondrial swelling, and membrane potential collapse in aged rat liver mitochondria.
- Causes histopathological damage to the liver and kidneys, including vacuolar degeneration and necrosis of hepatocytes and renal tubular necrosis.
![eMolecules 7383-74-6 | 2-PROPYN-1-AMINIUM, N,N,N-TRIMETHYL-, IODIDE | AstaTech225.073 | C6H12IN | 95.000 | [I-].C[N+](C)(C)CC#C | 0.1g | 696740797](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502470667.JPG-250.jpg)
eMolecules 7383-74-6 | 2-PROPYN-1-AMINIUM, N,N,N-TRIMETHYL-, IODIDE | AstaTech225.073 | C6H12IN | 95.000 | [I-].C[N+](C)(C)CC#C | 0.1g | 696740797
2-PROPYN-1-AMINIUM, N,N,N-TRIMETHYL-, IODIDE | AstaTech | 7383-74-6225.073 | C6H12IN | 95.000 | [I-].C[N+](C)(C)CC#C | 0.1g | 696740797
eMolecules 1629263-61-1 | (3-Methyl-cyclohex-3-enyl)-carbamic acid tert-butyl ester | J&W PharmLab LLC211.305 | C12H21NO2 | 92.000 | CC1=CCCC(C1)NC(=O)OC(C)(C)C | 1g | 599147630
(3-Methyl-cyclohex-3-enyl)-carbamic acid tert-butyl ester | J&W PharmLab LLC | 1629263-61-1211.305 | C12H21NO2 | 92.000 | CC1=CCCC(C1)NC(=O)OC(C)(C)C | 1g | 599147630
Aobchem 1-Bromo-4-(1-propyn-1-yl)benzene | ≥95% | CAS 23773-30-0 | C9H7Br | 500mg
1-Bromo-4-(1-propyn-1-yl)benzene | ≥95% | CAS 23773-30-0 | C9H7Br | 500mg