Organooxygen compounds
Medchemexpress LLC 3,6,9,12,15,18,21-Heptaoxatricosan-1-ol, 23-azido- | 352439-36-2 | 97.0% | C16H33N3O8 | 250 MG
Azide-PEG8-alcohol is a PEG-based PROTAC linker that functions as a click chemistry reagent with an Azide group. It participates in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne groups, and strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN groups. This molecule is used in the synthesis of PROTACs, which harness the ubiquitin-proteasome system for selective protein degradation.
- Peg-based PROTAC linker
- Utilized in PROTAC synthesis
- Click chemistry reagent
- Features an Azide group
- Enables CuAAc reactions with alkyne groups
- Enables SPAAC reactions with DBCO or BCN groups
(C)OCCI | 10g | 524997635](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000488798.jpg-250.jpg)
eMolecules 101166-65-8 | tert-Butyl(2-iodoethoxy)dimethylsilane | Ambeed | MFCD09909940 | 286.228 | C8H19IOSi | 97.000 | CC(C)(C)[Si](C)(C)OCCI | 10g | 524997635
tert-Butyl(2-iodoethoxy)dimethylsilane | Ambeed | 101166-65-8 | MFCD09909940 | 286.228 | C8H19IOSi | 97.000 | CC(C)(C)[Si](C)(C)OCCI | 10g | 524997635
![eMolecules 1339022-10-4 | tert-Butyl (2S)-2-(hydroxymethyl)-2-methylpyrrolidine-1-carboxylate | ChemScene | MFCD23106104 | 215.293 | C11H21NO3 | 98.000 | CC(C)(C)OC(=O)N1CCC[C@@]1(C)CO | 1g | 572261963](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502695661.jpg-250.jpg)
eMolecules 1339022-10-4 | tert-Butyl (2S)-2-(hydroxymethyl)-2-methylpyrrolidine-1-carboxylate | ChemScene | MFCD23106104 | 215.293 | C11H21NO3 | 98.000 | CC(C)(C)OC(=O)N1CCC[C@@]1(C)CO | 1g | 572261963
tert-Butyl (2S)-2-(hydroxymethyl)-2-methylpyrrolidine-1-carboxylate | ChemScene | 1339022-10-4 | MFCD23106104 | 215.293 | C11H21NO3 | 98.000 | CC(C)(C)OC(=O)N1CCC[C@@]1(C)CO | 1g | 572261963