Organooxygen compounds
Aobchem 1-(4-Ethylphenyl)-1-pentyn-3-ol | 95% | CAS 2511364-46-6 | C13H16O | 250mg
1-(4-Ethylphenyl)-1-pentyn-3-ol | 95% | CAS 2511364-46-6 | C13H16O | 250mg
Aobchem 1-(2-Methylthiophen-3-yl)ethanone | ≥95% | CAS 43039-99-2 | C7H8OS | 1g
1-(2-Methylthiophen-3-yl)ethanone | ≥95% | CAS 43039-99-2 | C7H8OS | 1g
Aobchem 2-Propyn-1-one 1-phenyl-3-(4-propylphenyl)- | 95% | CAS 1613380-88-3 | C18H16O | 500mg
2-Propyn-1-one 1-phenyl-3-(4-propylphenyl)- | 95% | CAS 1613380-88-3 | C18H16O | 500mg
Medchemexpress LLC Deramciclane | 120444-71-5 | MFCD00865305 | 98.1% | 301.47 g/mol | C20H31NO | 100 MG
Deramciclane is a research-grade small molecule that acts at serotonin 5-HT2A and 5-HT2C receptors, reported to function as an antagonist and inverse agonist. It is used in pharmacology and preclinical studies to investigate anxiolytic mechanisms, receptor binding, and signaling pathways. Key chemical identifiers include CAS 120444-71-5, chemical formula C20H31NO, and a molecular weight of about 301.47 g/mol.
- High purity suitable for research applications.
- Characterized by standard analytical methods.
- Suitable for in vitro receptor binding and functional assays.
- Supplied as a weighed solid for accurate dosing.
- Stable when stored under recommended laboratory conditions.
Aobchem -(3 3-Diethoxy-1-propyn-1-yl)benzenemethanol | 97% | CAS 53366-79-3 | C14H18O3 | 250mg
-(3 3-Diethoxy-1-propyn-1-yl)benzenemethanol | 97% | CAS 53366-79-3 | C14H18O3 | 250mg
Aobchem -(3 3-Diethoxy-1-propyn-1-yl)benzenemethanol | 97% | CAS 53366-79-3 | C14H18O3 | 1g
-(3 3-Diethoxy-1-propyn-1-yl)benzenemethanol | 97% | CAS 53366-79-3 | C14H18O3 | 1g
Apexbio Technology LLC 1-Hexadecanol 36653-82-4 50mg
1-Hexadecanol (CAS 36653-82-4) is a long-chain aliphatic fatty alcohol frequently employed as an intermediate in the synthesis of various surfactants and emollients While it does not directly target specific biological pathways its amphipathic properties enable it to modulate membrane fluidity and influence lipid organization in cellular models In biomedical research 1-hexadecanol is utilized to study membrane biophysics lipid metabolism and as a precursor in the formulation of delivery vehicles for pharmaceuticals Its role in altering membrane properties also makes it valuable for investigating cellular permeability and drug transport mechanisms
eMolecules 59101-28-9 | 16-BROMO-1-HEXADECANOL | AstaTech | MFCD01076224 | 321.343 | C16H33BrO | 95.000 | OCCCCCCCCCCCCCCCCBr | 0.25g | 721428323
16-BROMO-1-HEXADECANOL | AstaTech | 59101-28-9 | MFCD01076224 | 321.343 | C16H33BrO | 95.000 | OCCCCCCCCCCCCCCCCBr | 0.25g | 721428323
eMolecules 125607-09-2 | Hexaethylene glycol phosphoramidite | Broadpharm | MFCD16876143 | 784.928 | C42H61N2O10P | 0.000 | COc1ccc(cc1)C(OCCOCCOCCOCCOCCOCCOP(OCCC#N)N(C(C)C)C(C)C)(c1ccccc1)c1ccc(OC)cc1 | 250mg | 795361983
Hexaethylene glycol phosphoramidite | Broadpharm | 125607-09-2 | MFCD16876143 | 784.928 | C42H61N2O10P | 0.000 | COc1ccc(cc1)C(OCCOCCOCCOCCOCCOCCOP(OCCC#N)N(C(C)C)C(C)C)(c1ccccc1)c1ccc(OC)cc1 | 250mg | 795361983
Sigma Aldrich Fine Chemicals Biosciences 3-Phenyl-1-propanol >=98%, FCC | 122-97-4 | MFCD00002950 | 1KG
3-Phenyl-1-propanol >=98%, FCC | Purity: >=98% | Mol Wt: 136.19 | 122-97-4 | MFCD00002950 | 1KG
U.S. Pharmacopeia OLEYL ALCOHOL | 143-28-2 | 268.5 g/mol | 5 X 50 MG
OLEYL ALCOHOL | 143-28-2 | 268.5 g/mol | 5 X 50 MG
eMolecules 3513-81-3 | 2-Methylene-1,3-propanediol | Combi-Blocks | MFCD00075162 | 88.106 | C4H8O2 | 98.000 | OCC(=C)CO | 25g | 267168870
2-Methylene-1,3-propanediol | Combi-Blocks | 3513-81-3 | MFCD00075162 | 88.106 | C4H8O2 | 98.000 | OCC(=C)CO | 25g | 267168870
Aobchem 1-Bromo-4-(1-propyn-1-yl)benzene | ≥95% | CAS 23773-30-0 | C9H7Br | 250mg
1-Bromo-4-(1-propyn-1-yl)benzene | ≥95% | CAS 23773-30-0 | C9H7Br | 250mg