Organosulfur Compounds
Medchemexpress LLC Ethylenethiourea | 96-45-7 | MFCD00005276 | 98.0% | 102.16 | 1 ML
Ethylenethiourea is a degradation product of the ethylenebisthiocarbamate group of fungicides. It is tumorigenic and teratogenic, and orally active.
- Tumorigenic and teratogenic properties
- Orally active
- Stable at elevated temperatures over a wide pH range
![eMolecules 18741-24-7 | 2-Mercapto-3-phenylquinazolin-4-one | Oakwood Chemical | MFCD00023895 | 254.310 | C14H10N2OS | 95.000 | O=c1n(-c2ccccc2)c(=S)[nH]c2ccccc12 | 100mg | 537713488](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502149935.JPG-250.jpg)
eMolecules 18741-24-7 | 2-Mercapto-3-phenylquinazolin-4-one | Oakwood Chemical | MFCD00023895 | 254.310 | C14H10N2OS | 95.000 | O=c1n(-c2ccccc2)c(=S)[nH]c2ccccc12 | 100mg | 537713488
2-Mercapto-3-phenylquinazolin-4-one | Oakwood Chemical | 18741-24-7 | MFCD00023895 | 254.310 | C14H10N2OS | 95.000 | O=c1n(-c2ccccc2)c(=S)[nH]c2ccccc12 | 100mg | 537713488
![eMolecules 27231-36-3 | 2-Mercapto-5-methylbenzimidazole | Combi-Blocks | MFCD00010617 | 164.230 | C8H8N2S | 95.000 | Cc1ccc2[nH]c(S)nc2c1 | 1g | 290687361](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502184018.JPG-250.jpg)
eMolecules 27231-36-3 | 2-Mercapto-5-methylbenzimidazole | Combi-Blocks | MFCD00010617 | 164.230 | C8H8N2S | 95.000 | Cc1ccc2[nH]c(S)nc2c1 | 1g | 290687361
2-Mercapto-5-methylbenzimidazole | Combi-Blocks | 27231-36-3 | MFCD00010617 | 164.230 | C8H8N2S | 95.000 | Cc1ccc2[nH]c(S)nc2c1 | 1g | 290687361
eMolecules 6325-91-3 | 2-Mercapto-5-nitrobenzimidazole | MFCD00804727 | 25g
Combi-Blocks | 2-Mercapto-5-nitrobenzimidazole | 25g | 335354889 | QF-9095 | 95.000 | 6325-91-3 | MFCD00804727 | 195.200 | C7H5N3O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
AdipoGen Thiocolchicoside
Chemical. CAS 602-41-5. Formula C27H33NO10S. MW 563.6. Synthetic. Potent competitive gamma-aminobutyric acid type A GABAA receptor antagonist and glycine receptor agonist. Described to be a muscle relaxant. Anti-inflammatory agent with analgesic properties. Shown to be an anticancer compound through inhibition of NF-kappaB and NF-kappaB-regulated gene products. Therapeutic option for the management of bone metastatic disease.
AdipoGen Z-Leu-Leu-Leu-BOH2 MG-262
Chemical. CAS 179324-22-2. Formula C25H42BN3O6. MW 491.4. Highly potent and selective cell permeable inhibitor of the proteasome. Inhibits the chymotrypsin-like and caspase-like peptidase activity of the proteasome. Calpain and cathepsin inhibitor. Autophagy activator. Similar structure as MG-132 AG-CP3-0011 but much higher potency.
eMolecules 887913-52-2 | N-BOC-N'-METHYL THIOUREA | AstaTech | MFCD16036320 | 190.260 | C7H14N2O2S | 95.000 | CNC(=S)NC(=O)OC(C)(C)C | 0.25g | 296384358
N-BOC-N'-METHYL THIOUREA | AstaTech | 887913-52-2 | MFCD16036320 | 190.260 | C7H14N2O2S | 95.000 | CNC(=S)NC(=O)OC(C)(C)C | 0.25g | 296384358
eMolecules 621-40-9 | N-(3-Methylphenyl)thiourea | Chem-Impex | MFCD00060451 | 166.240 | C8H10N2S | 98.000 | Cc1cccc(NC(N)=S)c1 | 1g | 386899236
N-(3-Methylphenyl)thiourea | Chem-Impex | 621-40-9 | MFCD00060451 | 166.240 | C8H10N2S | 98.000 | Cc1cccc(NC(N)=S)c1 | 1g | 386899236
eMolecules 6972-05-0 | 1,1-DIMETHYL-THIOUREA | AstaTech | MFCD00060474 | 104.170 | C3H8N2S | 95.000 | CN(C)C(N)=S | 0.25g | 402181171
1,1-DIMETHYL-THIOUREA | AstaTech | 6972-05-0 | MFCD00060474 | 104.170 | C3H8N2S | 95.000 | CN(C)C(N)=S | 0.25g | 402181171
Aobchem N N-dibenzyl-4-(methylthio)aniline | 95% | C21H21NS | 1g
N N-dibenzyl-4-(methylthio)aniline | 95% | C21H21NS | 1g
Aobchem 5 5 -Bis(methylthio)-2 2 -bithiophene | 95% | CAS 99119-58-1 | C10H10S4 | 1g
5 5 -Bis(methylthio)-2 2 -bithiophene | 95% | CAS 99119-58-1 | C10H10S4 | 1g
Aobchem 1-(3-((Methylthio)methyl)phenyl)propan-1-one | 95% | CAS 1854585-24-2 | C11H14OS | 500mg
1-(3-((Methylthio)methyl)phenyl)propan-1-one | 95% | CAS 1854585-24-2 | C11H14OS | 500mg
Aobchem 1-(3-((Methylthio)methyl)phenyl)propan-1-one | 95% | CAS 1854585-24-2 | C11H14OS | 1g
1-(3-((Methylthio)methyl)phenyl)propan-1-one | 95% | CAS 1854585-24-2 | C11H14OS | 1g
Alkali Scientific Guanidine Thiocyanate 6M Solution, 10 L
Guanidine Thiocyanate 6M Solution is a powerful chaotropic reagent used for nucleic acid isolation, particularly for extracting RNA and DNA from a variety of biological samples. This 10L bulk solution is ideal for high-volume applications where large quantities of biological samples need to be processed. The reagent works by disrupting the molecular structure of proteins and cellular components, facilitating the efficient release of nucleic acids while preventing enzymatic degradation. Its high chaotropic strength ensures that both RNA and DNA are preserved intact, making this solution essential for genomics, proteomics, and molecular biology laboratories engaged in nucleic acid research and clinical diagnostics.
Medchemexpress LLC Sodium thiocyanate | 540-72-7 | 99.1% | 81.07 | 250 G
Sodium thiocyanate is a laboratory chemical primarily used for the manufacture of various substances. It functions by reducing plasma levels of the pro-inflammatory cytokine IL-6 and increasing the anti-inflammatory cytokine IL-10 levels. Additionally, it significantly reduces the formation of Reactive Oxygen Species (ROS).
- Reduces pro-inflammatory cytokine IL-6 levels.
- Increases anti-inflammatory cytokine IL-10 levels.
- Significantly reduces ROS formation.
- Used in the manufacture of substances.