Other Solvents
Filtered Search Results
Deuterium chloride, for NMR, 20 wt. % solution in D2O, 99+ atom % D
CAS: 7698-05-7 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00044642 InChI Key: VEXZGXHMUGYJMC-FTGQXOHASA-N Synonym: deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide PubChem CID: 522634 SMILES: Cl
| PubChem CID | 522634 |
|---|---|
| CAS | 7698-05-7 |
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00044642 |
| SMILES | Cl |
| Synonym | deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide |
| InChI Key | VEXZGXHMUGYJMC-FTGQXOHASA-N |
| Molecular Formula | ClH |
2,2,4-Trimethylpentane, 99+%, for spectroscopy ACS
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
1,1,2,2-Tetrachloroethane-d2, for NMR, 99 atom % D
CAS: 33685-54-0 Molecular Formula: C2H2Cl4 Molecular Weight (g/mol): 169.85 MDL Number: MFCD00037672 InChI Key: QPFMBZIOSGYJDE-QDNHWIQGSA-N Synonym: 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d PubChem CID: 118531 IUPAC Name: 1,1,2,2-tetrachloro-1,2-dideuterioethane SMILES: C(C(Cl)Cl)(Cl)Cl
| PubChem CID | 118531 |
|---|---|
| CAS | 33685-54-0 |
| Molecular Weight (g/mol) | 169.85 |
| MDL Number | MFCD00037672 |
| SMILES | C(C(Cl)Cl)(Cl)Cl |
| Synonym | 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d |
| IUPAC Name | 1,1,2,2-tetrachloro-1,2-dideuterioethane |
| InChI Key | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| Molecular Formula | C2H2Cl4 |
N,N-Dimethylformamide, 99.8%, for peptide synthesis
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
| Boiling Point | 84.0°C to 86.0°C |
|---|---|
| Water | 0.005% max. |
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Dry over Molecular Sieve |
| Density | 0.8670g/mL |
| Percent Purity | 99.5% |
| CAS | 110-71-4 |
| Health Hazard 3 | GHS P Statement Obtain special instructions before use. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. Wear protective gloves/protective clothing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN: Wash with plenty of soap and water. |
| Health Hazard 2 | GHS H Statement Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. Causes skin irritation. May form explosive peroxides. |
| Solubility Information | Solubility in water: miscible. Other solubilities: solulbe in hydrocarbon solvents, soluble in ethanol, ethyl ether, acetone, carbon, tetrachloride, benzene, dichloroethane |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Formula Weight | 90.12 |
| Specific Gravity | 0.867 |
| Melting Point | -69.0°C |
Diethyl ether, 99.5%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
1,2-Dichloroethane, Spectrophotometric Grade, 99+%
CAS: 107-06-2 Molecular Formula: C2H4Cl2 Molecular Weight (g/mol): 98.95 MDL Number: MFCD00000963 InChI Key: WSLDOOZREJYCGB-UHFFFAOYSA-N Synonym: ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion PubChem CID: 11 ChEBI: CHEBI:27789 IUPAC Name: 1,2-dichloroethane SMILES: ClCCCl
| PubChem CID | 11 |
|---|---|
| CAS | 107-06-2 |
| Molecular Weight (g/mol) | 98.95 |
| ChEBI | CHEBI:27789 |
| MDL Number | MFCD00000963 |
| SMILES | ClCCCl |
| Synonym | ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion |
| IUPAC Name | 1,2-dichloroethane |
| InChI Key | WSLDOOZREJYCGB-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl2 |
1-Butanol, 99.5%, for analysis
CAS: 71-36-3 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00002964 InChI Key: LRHPLDYGYMQRHN-UHFFFAOYSA-N Synonym: 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane PubChem CID: 263 ChEBI: CHEBI:28885 IUPAC Name: butan-1-ol SMILES: CCCCO
| PubChem CID | 263 |
|---|---|
| CAS | 71-36-3 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:28885 |
| MDL Number | MFCD00002964 |
| SMILES | CCCCO |
| Synonym | 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane |
| IUPAC Name | butan-1-ol |
| InChI Key | LRHPLDYGYMQRHN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Dimethyl sulfoxide - D6, w/TMS(0.03vol.%), deuteratn. deg. min. 99.8% for NMR MagniSolv™, MilliporeSigma™
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | (²H₃)methanesulfinyl(²H₃)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
1,2-Dichloroethane, 99.8%, Extra Dry, AcroSeal™
CAS: 107-06-2 Molecular Formula: C2H4Cl2 Molecular Weight (g/mol): 98.95 MDL Number: MFCD00000963 InChI Key: WSLDOOZREJYCGB-UHFFFAOYSA-N Synonym: ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion PubChem CID: 11 ChEBI: CHEBI:27789 IUPAC Name: 1,2-dichloroethane SMILES: ClCCCl
| PubChem CID | 11 |
|---|---|
| CAS | 107-06-2 |
| Molecular Weight (g/mol) | 98.95 |
| ChEBI | CHEBI:27789 |
| MDL Number | MFCD00000963 |
| SMILES | ClCCCl |
| Synonym | ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion |
| IUPAC Name | 1,2-dichloroethane |
| InChI Key | WSLDOOZREJYCGB-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl2 |
Xylenes, 99%, for biochemistry and histology, mixed isomers with ethylbenzene, AcroSeal™
CAS: 1330-20-7 Molecular Formula: C8H10 Molecular Weight (g/mol): 106.17 InChI Key: IVSZLXZYQVIEFR-UHFFFAOYSA-N IUPAC Name: 1,3-xylene SMILES: CC1=CC(C)=CC=C1
| CAS | 1330-20-7 |
|---|---|
| Molecular Weight (g/mol) | 106.17 |
| SMILES | CC1=CC(C)=CC=C1 |
| IUPAC Name | 1,3-xylene |
| InChI Key | IVSZLXZYQVIEFR-UHFFFAOYSA-N |
| Molecular Formula | C8H10 |
N,N-Dimethylformamide, 99.8%, Extra Dry, AcroSeal™, package of 4x25ML bottles
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
CytoScint ES, MP Biomedicals™
Liquid Scintillation Cocktails; CytoScint ES; MP Biomedical; 4 x 1 gal.; Biodegradable
| Chemical Name or Material | Liquid Scintillation Cocktails |
|---|
tert-Butyl methyl ether, for HPLC
CAS: 1634-04-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00008812 InChI Key: BZLVMXJERCGZMT-UHFFFAOYSA-N Synonym: tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane PubChem CID: 15413 ChEBI: CHEBI:27642 IUPAC Name: 2-methoxy-2-methylpropane SMILES: CC(C)(C)OC
| PubChem CID | 15413 |
|---|---|
| CAS | 1634-04-4 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:27642 |
| MDL Number | MFCD00008812 |
| SMILES | CC(C)(C)OC |
| Synonym | tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane |
| IUPAC Name | 2-methoxy-2-methylpropane |
| InChI Key | BZLVMXJERCGZMT-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Pyridine-d5, for NMR, 99 atom % D
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |