Oxacyclic compounds
Chem-Impex International, Inc. Oxazole-4-carboxylic acid ethyl ester | 23012-14-8 | MFCD04114940 | 5G
Oxazole-4-carboxylic acid ethyl ester, 23012-14-8, MFCD04114940, 5G
Chem-Impex International, Inc. N,N-Bis(2-oxo-3-oxazolidinyl)phosphinic chloride | 68641-49-6 | MFCD00010077 | 25G
N,N-Bis(2-oxo-3-oxazolidinyl)phosphinic chloride, 68641-49-6, MFCD00010077, 25G
eMolecules 170681-91-1 | 5-Bromo-7-methylbenzofuran | MFCD11877829 | 1g
ChemScene | 45-Bis(4-aminophenyl)-[1121-terphenyl]-44-diamine | 250mg | 586498729 | CS-0146289 | 2458125-05-6 | 442.566 | C30H26N4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 16110-98-8 | 2-PHENYLMALEIC ACID | AstaTech | MFCD01075740 | 192.170 | C10H8O4 | 97.000 | OC(=O)\C=C(/C(O)=O)c1ccccc1 | 0.25g | 490831107
2-PHENYLMALEIC ACID | AstaTech | 16110-98-8 | MFCD01075740 | 192.170 | C10H8O4 | 97.000 | OC(=O)\C=C(/C(O)=O)c1ccccc1 | 0.25g | 490831107
Accela Chembio Inc 4-(5-methyl-1 | 2 | 4-oxadiazol-3-yl)benzoic Acid | 1g | 95124-68-8 | MFCD06797475 | 97+% | Shelf Life: 1980 Days | Regular
4-(5-methyl-1 | 2 | 4-oxadiazol-3-yl)benzoic Acid | 1g | 95124-68-8 | MFCD06797475 | 97+% | Shelf Life: 1980 Days | Regular
eMolecules 82788-37-2 | ChemScene | Methyl 6-methylbenzofuran-2-carboxylate | 1g | 582642755 | CS-0043039 | MFCD11975072 | 190.198 | C11H10O3
ChemScene | Methyl 6-methylbenzofuran-2-carboxylate | 1g | 582642755 | CS-0043039 | 82788-37-2 | MFCD11975072 | 190.198 | C11H10O3
Medchemexpress LLC Alpha-naphthoflavone | 604-59-1 | MFCD00004985 | ≥98.0% | 272.30 g/mol | C19H12O2 | 20MG
Alpha-naphthoflavone is an orally active flavonoid used in research as a potent, competitive inhibitor of aromatase and certain cytochrome P450 enzymes. It is intended for laboratory research use; consult the safety data sheet for handling, storage, and hazard information.
![eMolecules 1006464-09-0 | 3-(5-Methyl-2-furyl)-1h-pyrazole-4-carbaldehyde | Combi-Blocks | MFCD08444448 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc(o1)-c1n[nH]cc1C=O | 1g | 482935466](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502187196.JPG-250.jpg)
eMolecules 1006464-09-0 | 3-(5-Methyl-2-furyl)-1h-pyrazole-4-carbaldehyde | Combi-Blocks | MFCD08444448 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc(o1)-c1n[nH]cc1C=O | 1g | 482935466
3-(5-Methyl-2-furyl)-1h-pyrazole-4-carbaldehyde | Combi-Blocks | 1006464-09-0 | MFCD08444448 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc(o1)-c1n[nH]cc1C=O | 1g | 482935466
eMolecules 286837-05-6 | 7-Bromo-3-methylbenzofuran | Apollo Scientific | MFCD28405090 | 211.058 | C9H7BrO | 95.000 | Cc1coc2c(Br)cccc12 | 1g | 562429411
7-Bromo-3-methylbenzofuran | Apollo Scientific | 286837-05-6 | MFCD28405090 | 211.058 | C9H7BrO | 95.000 | Cc1coc2c(Br)cccc12 | 1g | 562429411
eMolecules 21911-69-3 | P-TOLYLAMINO-ACETIC ACID | AstaTech | MFCD00995183 | 165.192 | C9H11NO2 | 95.000 | Cc1ccc(NCC(O)=O)cc1 | 0.25g | 449757952
P-TOLYLAMINO-ACETIC ACID | AstaTech | 21911-69-3 | MFCD00995183 | 165.192 | C9H11NO2 | 95.000 | Cc1ccc(NCC(O)=O)cc1 | 0.25g | 449757952
![eMolecules 22876-17-1 | 6-Amino-2-benzoxazolinone | Chem-Impex | MFCD00463899 | 150.137 | C7H6N2O2 | 98.000 | Nc1ccc2[nH]c(=O)oc2c1 | 1g | 112761765](https://assets.fishersci.com/TFS-Assets/CCG/product-images/501716068.jpg-250.jpg)
eMolecules 22876-17-1 | 6-Amino-2-benzoxazolinone | Chem-Impex | MFCD00463899 | 150.137 | C7H6N2O2 | 98.000 | Nc1ccc2[nH]c(=O)oc2c1 | 1g | 112761765
6-Amino-2-benzoxazolinone | Chem-Impex | 22876-17-1 | MFCD00463899 | 150.137 | C7H6N2O2 | 98.000 | Nc1ccc2[nH]c(=O)oc2c1 | 1g | 112761765
![eMolecules 19932-84-4 | 6-Chloro-1,3-benzoxazol-2(3h)-one | Combi-Blocks | MFCD00463914 | 169.560 | C7H4ClNO2 | 98.000 | Clc1ccc2[nH]c(=O)oc2c1 | 1g | 232306722](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-232306722.PNG-250.jpg)
eMolecules 19932-84-4 | 6-Chloro-1,3-benzoxazol-2(3h)-one | Combi-Blocks | MFCD00463914 | 169.560 | C7H4ClNO2 | 98.000 | Clc1ccc2[nH]c(=O)oc2c1 | 1g | 232306722
6-Chloro-1,3-benzoxazol-2(3h)-one | Combi-Blocks | 19932-84-4 | MFCD00463914 | 169.560 | C7H4ClNO2 | 98.000 | Clc1ccc2[nH]c(=O)oc2c1 | 1g | 232306722