Phenanthrolines
Apexbio Technology LLC o-Phenanthroline monohydrate 5144-89-8 100mg
o-Phenanthroline monohydrate (CAS 5144-89-8) is a small-molecule inhibitor targeting matrix metalloproteinases (MMPs) It is designed to chelate metal ions thereby inhibiting the catalytic activity of MMPs and modulating related biological pathways o-Phenanthroline monohydrate exerts its biological activity primarily through metal ion chelation particularly by complexing with ferrous ions to form a chromophoric complex It demonstrates inhibitory activity in research involving MMPs and interference with chemically induced chromosomal aberrations Based on these pharmacological properties o-Phenanthroline monohydrate holds research potential in studies of cell migration tumor invasion signaling pathways and chromosome aberration modulation
eMolecules 22426-14-8 | 2-Bromo-1,10-phenanthroline | Ambeed | MFCD13152102 | 259.106 | C12H7BrN2 | 97.000 | Brc1ccc2ccc3cccnc3c2n1 | 1g | 525105645
2-Bromo-1,10-phenanthroline | Ambeed | 22426-14-8 | MFCD13152102 | 259.106 | C12H7BrN2 | 97.000 | Brc1ccc2ccc3cccnc3c2n1 | 1g | 525105645
eMolecules 31301-30-1 | 1,10-Phenanthroline-4-carbaldehyde | ChemScene | MFCD20528013 | 208.220 | C13H8N2O | 97.000 | O=Cc1ccnc2c1ccc1cccnc21 | 100mg | 346752051
1,10-Phenanthroline-4-carbaldehyde | ChemScene | 31301-30-1 | MFCD20528013 | 208.220 | C13H8N2O | 97.000 | O=Cc1ccnc2c1ccc1cccnc21 | 100mg | 346752051
eMolecules 22426-99-9 | N-(BENZYLOXY)-N-(2-PHENYLACETYL)ACETAMIDE | AstaTech | MFCD06658284 | 283.327 | C17H17NO3 | 95.000 | CC(=O)N(OCc1ccccc1)C(=O)Cc1ccccc1 | 0.25g | 696740649
N-(BENZYLOXY)-N-(2-PHENYLACETYL)ACETAMIDE | AstaTech | 22426-99-9 | MFCD06658284 | 283.327 | C17H17NO3 | 95.000 | CC(=O)N(OCc1ccccc1)C(=O)Cc1ccccc1 | 0.25g | 696740649
Chem-Impex International, Inc. 1,10-Phenanthroline monohydrate | 5144-89-8 | MFCD00149973 | 25G
1,10-Phenanthroline monohydrate, 5144-89-8, MFCD00149973, 25G
Sigma Aldrich Fine Chemicals Biosciences 1,10-Phenanthroline monohydrate ACS reagent, 99% | 5144-89-8 | MFCD00149973 | 100G
1,10-Phenanthroline monohydrate ACS reagent, 99% | Purity: 99% | Mol Wt: 198.22 | 5144-89-8 | MFCD00149973 | 100G
