Pyrazines
eMolecules 1240842-74-3 | Benzyl quinoxaline-2-carboxylate | Combi-Blocks264.284 | C16H12N2O2 | 98.000 | O=C(OCc1ccccc1)c1cnc2ccccc2n1 | 1g | 495746298
Benzyl quinoxaline-2-carboxylate | Combi-Blocks | 1240842-74-3264.284 | C16H12N2O2 | 98.000 | O=C(OCc1ccccc1)c1cnc2ccccc2n1 | 1g | 495746298
eMolecules 110637-40-6 | Alloc-gly-oh dcha | Combi-Blocks, Inc. | MFCD08272340 | 340.464 | C18H32N2O4 | 98.000 | OC(=O)CNC(=O)OCC=C.C1CCC(CC1)NC1CCCCC1 | 5g | 761034750
Alloc-gly-oh dcha | Combi-Blocks, Inc. | 110637-40-6 | MFCD08272340 | 340.464 | C18H32N2O4 | 98.000 | OC(=O)CNC(=O)OCC=C.C1CCC(CC1)NC1CCCCC1 | 5g | 761034750
eMolecules 54632-11-0 | 3-Amino-5-chloropyrazine-2-carbonitrile | Key Organics/BIONET - Building Blocks | MFCD10697779 | 154.560 | C5H3ClN4 | 95.000 | Nc1nc(Cl)cnc1C#N | 1mg | 326425504
3-Amino-5-chloropyrazine-2-carbonitrile | Key Organics/BIONET - Building Blocks | 54632-11-0 | MFCD10697779 | 154.560 | C5H3ClN4 | 95.000 | Nc1nc(Cl)cnc1C#N | 1mg | 326425504
Medchemexpress LLC 2,4-diamino-6-hydroxypyrimidine | 56-06-4 | MFCD00006098 | 99.9% | 126.12 g/mol | C4H6N4O | 1 ML
2,4-diamino-6-hydroxypyrimidine is a small-molecule research reagent that acts as a specific inhibitor of GTP cyclohydrolase I, used to modulate tetrahydrobiopterin (BH4) synthesis and nitric oxide production in biochemical and cellular assays. The compound is supplied as a solid and as a pre-made 10 mM solution in DMSO, and batch documentation is available.
Cell Signaling Technology Phospho-eIF2-alpha Ser51 Mat
Phospho-eIF2-alpha (Ser51) Matched Antibody Pair 1 Kit
