Benzene and substituted derivatives
Filtered Search Results
4-tert-Butylcatechol, 98%
CAS: 98-29-3 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00002201 InChI Key: XESZUVZBAMCAEJ-UHFFFAOYSA-N Synonym: 4-tert-butylcatechol,p-tert-butylcatechol,4-tert-butylpyrocatechol,p-tert-butyl catechol,4-tert-butyl benzene-1,2-diol,4-t-butylpyrocatechol,p-tert-butylpyrocatechol,4-t-butylcatechol,1,2-benzenediol, 4-1,1-dimethylethyl,4-tert-butylcatechin PubChem CID: 7381 IUPAC Name: 4-tert-butylbenzene-1,2-diol SMILES: CC(C)(C)C1=CC=C(O)C(O)=C1
| PubChem CID | 7381 |
|---|---|
| CAS | 98-29-3 |
| Molecular Weight (g/mol) | 166.22 |
| MDL Number | MFCD00002201 |
| SMILES | CC(C)(C)C1=CC=C(O)C(O)=C1 |
| Synonym | 4-tert-butylcatechol,p-tert-butylcatechol,4-tert-butylpyrocatechol,p-tert-butyl catechol,4-tert-butyl benzene-1,2-diol,4-t-butylpyrocatechol,p-tert-butylpyrocatechol,4-t-butylcatechol,1,2-benzenediol, 4-1,1-dimethylethyl,4-tert-butylcatechin |
| IUPAC Name | 4-tert-butylbenzene-1,2-diol |
| InChI Key | XESZUVZBAMCAEJ-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |
Terephthaldicarboxaldehyde, 98%
CAS: 623-27-8 Molecular Formula: C8H6O2 Molecular Weight (g/mol): 134.13 MDL Number: MFCD00006949 InChI Key: KUCOHFSKRZZVRO-UHFFFAOYSA-N Synonym: 1,4-benzenedicarboxaldehyde,p-phthalaldehyde,terephthaldehyde,terephthaldialdehyde,terephthaladehyde,terephthaldicarboxaldehyde,terephthalic aldehyde,1,4-phthalaldehyde,p-formylbenzaldehyde,terephtaldehyde PubChem CID: 12173 IUPAC Name: terephthalaldehyde SMILES: C1=CC(=CC=C1C=O)C=O
| PubChem CID | 12173 |
|---|---|
| CAS | 623-27-8 |
| Molecular Weight (g/mol) | 134.13 |
| MDL Number | MFCD00006949 |
| SMILES | C1=CC(=CC=C1C=O)C=O |
| Synonym | 1,4-benzenedicarboxaldehyde,p-phthalaldehyde,terephthaldehyde,terephthaldialdehyde,terephthaladehyde,terephthaldicarboxaldehyde,terephthalic aldehyde,1,4-phthalaldehyde,p-formylbenzaldehyde,terephtaldehyde |
| IUPAC Name | terephthalaldehyde |
| InChI Key | KUCOHFSKRZZVRO-UHFFFAOYSA-N |
| Molecular Formula | C8H6O2 |
2-Chlorobenzaldehyde, 99%
CAS: 89-98-5 Molecular Formula: C7H5ClO Molecular Weight (g/mol): 140.57 MDL Number: MFCD00003304 InChI Key: FPYUJUBAXZAQNL-UHFFFAOYSA-N Synonym: o-chlorobenzaldehyde,chlorobenzaldehyde,benzaldehyde, 2-chloro,benzaldehyde, o-chloro,2-chlorbenzaldehyd,2-clorobenzaldeide,o-chloorbenzaldehyde,usaf m-7,2-chloorbenzaldehyde,o-chlorobenzenecarboxaldehyde PubChem CID: 6996 IUPAC Name: 2-chlorobenzaldehyde SMILES: C1=CC=C(C(=C1)C=O)Cl
| PubChem CID | 6996 |
|---|---|
| CAS | 89-98-5 |
| Molecular Weight (g/mol) | 140.57 |
| MDL Number | MFCD00003304 |
| SMILES | C1=CC=C(C(=C1)C=O)Cl |
| Synonym | o-chlorobenzaldehyde,chlorobenzaldehyde,benzaldehyde, 2-chloro,benzaldehyde, o-chloro,2-chlorbenzaldehyd,2-clorobenzaldeide,o-chloorbenzaldehyde,usaf m-7,2-chloorbenzaldehyde,o-chlorobenzenecarboxaldehyde |
| IUPAC Name | 2-chlorobenzaldehyde |
| InChI Key | FPYUJUBAXZAQNL-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO |
2,3,4,5,6-Pentafluorostyrene, 98%, stab. with 250ppm 4-tert-butylcatechol
CAS: 653-34-9 Molecular Formula: C8H3F5 Molecular Weight (g/mol): 194.104 MDL Number: MFCD00000300 InChI Key: LVJZCPNIJXVIAT-UHFFFAOYSA-N Synonym: 2,3,4,5,6-pentafluorostyrene,pentafluorostyrene,benzene, ethenylpentafluoro,1,2,3,4,5-pentafluoro-6-vinyl-benzene,2',3',4',5',6'-pentafluorostyrene,2-2,3,4,5,6-pentafluorophenyl ethyl,vinylpentafluorobenzene,acmc-1avmt,styrene, 2,3,4,5,6-pentafluoro,1,2,3,4,5-pentafluoro-6-vinylbenzene PubChem CID: 69556 IUPAC Name: 1-ethenyl-2,3,4,5,6-pentafluorobenzene SMILES: C=CC1=C(C(=C(C(=C1F)F)F)F)F
| PubChem CID | 69556 |
|---|---|
| CAS | 653-34-9 |
| Molecular Weight (g/mol) | 194.104 |
| MDL Number | MFCD00000300 |
| SMILES | C=CC1=C(C(=C(C(=C1F)F)F)F)F |
| Synonym | 2,3,4,5,6-pentafluorostyrene,pentafluorostyrene,benzene, ethenylpentafluoro,1,2,3,4,5-pentafluoro-6-vinyl-benzene,2',3',4',5',6'-pentafluorostyrene,2-2,3,4,5,6-pentafluorophenyl ethyl,vinylpentafluorobenzene,acmc-1avmt,styrene, 2,3,4,5,6-pentafluoro,1,2,3,4,5-pentafluoro-6-vinylbenzene |
| IUPAC Name | 1-ethenyl-2,3,4,5,6-pentafluorobenzene |
| InChI Key | LVJZCPNIJXVIAT-UHFFFAOYSA-N |
| Molecular Formula | C8H3F5 |
Cumene, 99.9%, extra pure
CAS: 98-82-8 Molecular Formula: C9H12 Molecular Weight (g/mol): 120.19 MDL Number: MFCD00008881 InChI Key: RWGFKTVRMDUZSP-UHFFFAOYSA-N Synonym: isopropylbenzene,2-phenylpropane,cumol,benzene, 1-methylethyl,1-methylethyl benzene,isopropylbenzol,cumeen,isopropilbenzene,isopropylbenzeen,2-fenilpropano PubChem CID: 7406 ChEBI: CHEBI:34656 IUPAC Name: cumene SMILES: CC(C)C1=CC=CC=C1
| PubChem CID | 7406 |
|---|---|
| CAS | 98-82-8 |
| Molecular Weight (g/mol) | 120.19 |
| ChEBI | CHEBI:34656 |
| MDL Number | MFCD00008881 |
| SMILES | CC(C)C1=CC=CC=C1 |
| Synonym | isopropylbenzene,2-phenylpropane,cumol,benzene, 1-methylethyl,1-methylethyl benzene,isopropylbenzol,cumeen,isopropilbenzene,isopropylbenzeen,2-fenilpropano |
| IUPAC Name | cumene |
| InChI Key | RWGFKTVRMDUZSP-UHFFFAOYSA-N |
| Molecular Formula | C9H12 |
1,3-Dibromobenzene, 97%
CAS: 108-36-1 Molecular Formula: C6H4Br2 Molecular Weight (g/mol): 235.91 MDL Number: MFCD00000078 InChI Key: JSRLURSZEMLAFO-UHFFFAOYSA-N Synonym: m-dibromobenzene,benzene, 1,3-dibromo,benzene, m-dibromo,unii-74ef6kh8tc,1,3-dibromo-benzene,74ef6kh8tc,1,3-dibromo benzene,3,5-dibromobenzene,1,3-dibrormobenzene,1, 3-dibromobenzene PubChem CID: 7927 ChEBI: CHEBI:37151 IUPAC Name: 1,3-dibromobenzene SMILES: BrC1=CC(Br)=CC=C1
| PubChem CID | 7927 |
|---|---|
| CAS | 108-36-1 |
| Molecular Weight (g/mol) | 235.91 |
| ChEBI | CHEBI:37151 |
| MDL Number | MFCD00000078 |
| SMILES | BrC1=CC(Br)=CC=C1 |
| Synonym | m-dibromobenzene,benzene, 1,3-dibromo,benzene, m-dibromo,unii-74ef6kh8tc,1,3-dibromo-benzene,74ef6kh8tc,1,3-dibromo benzene,3,5-dibromobenzene,1,3-dibrormobenzene,1, 3-dibromobenzene |
| IUPAC Name | 1,3-dibromobenzene |
| InChI Key | JSRLURSZEMLAFO-UHFFFAOYSA-N |
| Molecular Formula | C6H4Br2 |
4-Fluorobenzylamine, 98+%
CAS: 140-75-0 Molecular Formula: C7H8FN Molecular Weight (g/mol): 125.146 MDL Number: MFCD00008120 InChI Key: IIFVWLUQBAIPMJ-UHFFFAOYSA-N Synonym: 4-fluorobenzylamine,4-fluorophenyl methanamine,benzenemethanamine, 4-fluoro,p-fluorobenzylamine,benzylamine, p-fluoro,p-fluorobenzyl amine,4-fluoro-benzylamine,1-4-fluorophenyl methanamine,4-fluorobenzyl amine,chembl12392 PubChem CID: 67326 IUPAC Name: (4-fluorophenyl)methanamine SMILES: C1=CC(=CC=C1CN)F
| PubChem CID | 67326 |
|---|---|
| CAS | 140-75-0 |
| Molecular Weight (g/mol) | 125.146 |
| MDL Number | MFCD00008120 |
| SMILES | C1=CC(=CC=C1CN)F |
| Synonym | 4-fluorobenzylamine,4-fluorophenyl methanamine,benzenemethanamine, 4-fluoro,p-fluorobenzylamine,benzylamine, p-fluoro,p-fluorobenzyl amine,4-fluoro-benzylamine,1-4-fluorophenyl methanamine,4-fluorobenzyl amine,chembl12392 |
| IUPAC Name | (4-fluorophenyl)methanamine |
| InChI Key | IIFVWLUQBAIPMJ-UHFFFAOYSA-N |
| Molecular Formula | C7H8FN |
3,4-Dimethoxybenzylamine, 97%
CAS: 5763-61-1 Molecular Formula: C9H13NO2 Molecular Weight (g/mol): 167.21 MDL Number: MFCD00008116 InChI Key: DIVNUTGTTIRPQA-UHFFFAOYSA-N Synonym: 3,4-dimethoxybenzylamine,veratrylamine,3,4-dimethoxyphenyl methanamine,benzenemethanamine, 3,4-dimethoxy,1-3,4-dimethoxyphenyl methanamine,benzylamine, 3,4-dimethoxy,3,4-dimethoxyphenyl methylamine,veratrylamin,pubchem7394,acmc-1altc PubChem CID: 79832 IUPAC Name: (3,4-dimethoxyphenyl)methanamine SMILES: COC1=CC=C(CN)C=C1OC
| PubChem CID | 79832 |
|---|---|
| CAS | 5763-61-1 |
| Molecular Weight (g/mol) | 167.21 |
| MDL Number | MFCD00008116 |
| SMILES | COC1=CC=C(CN)C=C1OC |
| Synonym | 3,4-dimethoxybenzylamine,veratrylamine,3,4-dimethoxyphenyl methanamine,benzenemethanamine, 3,4-dimethoxy,1-3,4-dimethoxyphenyl methanamine,benzylamine, 3,4-dimethoxy,3,4-dimethoxyphenyl methylamine,veratrylamin,pubchem7394,acmc-1altc |
| IUPAC Name | (3,4-dimethoxyphenyl)methanamine |
| InChI Key | DIVNUTGTTIRPQA-UHFFFAOYSA-N |
| Molecular Formula | C9H13NO2 |
5-Sulfosalicylic acid dihydrate, 98%
CAS: 5965-83-3 Molecular Formula: C9H14O6S Molecular Weight (g/mol): 250.27 MDL Number: MFCD00007508,MFCD00149540 InChI Key: NFYHZVWMQHQKRU-UHFFFAOYSA-N Synonym: 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd PubChem CID: 2723734 SMILES: C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O
| PubChem CID | 2723734 |
|---|---|
| CAS | 5965-83-3 |
| Molecular Weight (g/mol) | 250.27 |
| MDL Number | MFCD00007508,MFCD00149540 |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| Molecular Formula | C9H14O6S |
2-Chloro-4-(trifluoromethyl)aniline, 98%
CAS: 39885-50-2 Molecular Formula: C7H5ClF3N Molecular Weight (g/mol): 195.57 MDL Number: MFCD00042563 InChI Key: MBBUTABXEITVNY-UHFFFAOYSA-N Synonym: 2-chloro-4-trifluoromethyl aniline,4-amino-3-chlorobenzotrifluoride,4-amino-5-chloro-benzotrifluoride,benzenamine, 2-chloro-4-trifluoromethyl,3-chloro-4-aminobenzotrifluoride,2-chloro-4-trifluoromethyl-phenylamine,2-chloro-4-trifluoromethyl benzenamine,2-chloro-4-trifluoromethyl phenylamine,4-amino-3-chloro-benzotrifluoride,pubchem2474 PubChem CID: 162001 IUPAC Name: 2-chloro-4-(trifluoromethyl)aniline SMILES: NC1=CC=C(C=C1Cl)C(F)(F)F
| PubChem CID | 162001 |
|---|---|
| CAS | 39885-50-2 |
| Molecular Weight (g/mol) | 195.57 |
| MDL Number | MFCD00042563 |
| SMILES | NC1=CC=C(C=C1Cl)C(F)(F)F |
| Synonym | 2-chloro-4-trifluoromethyl aniline,4-amino-3-chlorobenzotrifluoride,4-amino-5-chloro-benzotrifluoride,benzenamine, 2-chloro-4-trifluoromethyl,3-chloro-4-aminobenzotrifluoride,2-chloro-4-trifluoromethyl-phenylamine,2-chloro-4-trifluoromethyl benzenamine,2-chloro-4-trifluoromethyl phenylamine,4-amino-3-chloro-benzotrifluoride,pubchem2474 |
| IUPAC Name | 2-chloro-4-(trifluoromethyl)aniline |
| InChI Key | MBBUTABXEITVNY-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClF3N |
3,5-Diaminobenzoic acid, 96%, may contain up to 3% moisture
CAS: 535-87-5 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.153 MDL Number: MFCD00007807 InChI Key: UENRXLSRMCSUSN-UHFFFAOYSA-N Synonym: benzoic acid, 3,5-diamino,1-carboxy-3,5-diaminobenzene,ccris 2885,3,5-diamino benzoic acid,3,5-diaminobenzoicacid,dabz,pubchem21025,3,5-diaminebenzoicacid,acmc-1awxi,3,5-diamino-benzoic acid PubChem CID: 12062 IUPAC Name: 3,5-diaminobenzoic acid SMILES: C1=C(C=C(C=C1N)N)C(=O)O
| PubChem CID | 12062 |
|---|---|
| CAS | 535-87-5 |
| Molecular Weight (g/mol) | 152.153 |
| MDL Number | MFCD00007807 |
| SMILES | C1=C(C=C(C=C1N)N)C(=O)O |
| Synonym | benzoic acid, 3,5-diamino,1-carboxy-3,5-diaminobenzene,ccris 2885,3,5-diamino benzoic acid,3,5-diaminobenzoicacid,dabz,pubchem21025,3,5-diaminebenzoicacid,acmc-1awxi,3,5-diamino-benzoic acid |
| IUPAC Name | 3,5-diaminobenzoic acid |
| InChI Key | UENRXLSRMCSUSN-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |
4-Bromoaniline, 96%, pract.
CAS: 106-40-1 Molecular Formula: C6H6BrN Molecular Weight (g/mol): 172.02 MDL Number: MFCD00007822 InChI Key: WDFQBORIUYODSI-UHFFFAOYSA-N Synonym: p-bromoaniline,4-bromobenzenamine,benzenamine, 4-bromo,p-bromophenylamine,aniline, p-bromo,4-bromo-aniline,4-bromobenzeneamine,p-bromo aniline,4-bromanilinu,4-bromo-phenylamine PubChem CID: 7807 IUPAC Name: 4-bromoaniline SMILES: C1=CC(=CC=C1N)Br
| PubChem CID | 7807 |
|---|---|
| CAS | 106-40-1 |
| Molecular Weight (g/mol) | 172.02 |
| MDL Number | MFCD00007822 |
| SMILES | C1=CC(=CC=C1N)Br |
| Synonym | p-bromoaniline,4-bromobenzenamine,benzenamine, 4-bromo,p-bromophenylamine,aniline, p-bromo,4-bromo-aniline,4-bromobenzeneamine,p-bromo aniline,4-bromanilinu,4-bromo-phenylamine |
| IUPAC Name | 4-bromoaniline |
| InChI Key | WDFQBORIUYODSI-UHFFFAOYSA-N |
| Molecular Formula | C6H6BrN |
Thermo Scientific Chemicals 5-Sulfosalicylic acid dihydrate, 99+%
CAS: 5965-83-3 | C9H14O6S | 250.27 g/mol
| Molecular Weight (g/mol) | 250.27 |
|---|---|
| CAS Min % | 99.0 |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| PubChem CID | 2723734 |
| Name Note | p.a. |
| Percent Purity | 99+% |
| Fieser | 01,1118 |
| Infrared Spectrum | Authentic |
| Formula Weight | 254.22 |
| Melting Point | 106.0°C to 110.0°C |
| CAS Max % | 100.0 |
| Color | White |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | 5-Sulfosalicylic acid dihydrate |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Merck Index | 15, 9094 |
| Assay Percent Range | 99+% |
| CAS | 97-05-2 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00007508,MFCD00149540 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: 127g/L (20°C). Other solubilities: soluble in alcohol and ether |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| Beilstein | 11, 411 |
| Molecular Formula | C9H14O6S |
Methyl 4-hydroxybenzoate, 99%
CAS: 99-76-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002352 InChI Key: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC Name: methyl 4-hydroxybenzoate SMILES: COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7456 |
|---|---|
| CAS | 99-76-3 |
| Molecular Weight (g/mol) | 152.149 |
| ChEBI | CHEBI:31835 |
| MDL Number | MFCD00002352 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| IUPAC Name | methyl 4-hydroxybenzoate |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
m-Toluic acid, 99%
CAS: 99-04-7 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002523 InChI Key: GPSDUZXPYCFOSQ-UHFFFAOYSA-N Synonym: m-toluic acid,m-toluylic acid,3-toluic acid,benzoic acid, 3-methyl,meta-toluic acid,m-methylbenzoic acid,beta-methylbenzoic acid,3-methyl-benzoic acid,beta-bethylbenzoic acid,unii-1ua7k8eext PubChem CID: 7418 ChEBI: CHEBI:10589 IUPAC Name: 3-methylbenzoic acid SMILES: CC1=CC=CC(=C1)C(O)=O
| PubChem CID | 7418 |
|---|---|
| CAS | 99-04-7 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:10589 |
| MDL Number | MFCD00002523 |
| SMILES | CC1=CC=CC(=C1)C(O)=O |
| Synonym | m-toluic acid,m-toluylic acid,3-toluic acid,benzoic acid, 3-methyl,meta-toluic acid,m-methylbenzoic acid,beta-methylbenzoic acid,3-methyl-benzoic acid,beta-bethylbenzoic acid,unii-1ua7k8eext |
| IUPAC Name | 3-methylbenzoic acid |
| InChI Key | GPSDUZXPYCFOSQ-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |