Benzene and substituted derivatives
Filtered Search Results
Bis(tri-o-tolylphosphine)palladium(0), Pd 14.9%
CAS: 69861-71-8 Molecular Formula: C42H42P2Pd Molecular Weight (g/mol): 715.166 MDL Number: MFCD12911908 InChI Key: CUBIJGNGGJBNOC-UHFFFAOYSA-N Synonym: bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium PubChem CID: 10952654 IUPAC Name: palladium;tris(2-methylphenyl)phosphane SMILES: CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd]
| PubChem CID | 10952654 |
|---|---|
| CAS | 69861-71-8 |
| Molecular Weight (g/mol) | 715.166 |
| MDL Number | MFCD12911908 |
| SMILES | CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd] |
| Synonym | bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium |
| IUPAC Name | palladium;tris(2-methylphenyl)phosphane |
| InChI Key | CUBIJGNGGJBNOC-UHFFFAOYSA-N |
| Molecular Formula | C42H42P2Pd |
Benzophenone hydrazone, 98+%
CAS: 5350-57-2 Molecular Formula: C13H12N2 Molecular Weight (g/mol): 196.253 MDL Number: MFCD00007624 InChI Key: QYCSNMDOZNUZIT-UHFFFAOYSA-N Synonym: benzophenone hydrazone,diphenylmethylene hydrazine,benzophenonehydrazone,methanone, diphenyl-, hydrazone,diphenylmethanone hydrazone,benzophenone, hydrazone,diphenylmethylidene hydrazine,diphenyl ketone hydrazone,benzophenone hydrozone,nsc 43 PubChem CID: 79304 IUPAC Name: benzhydrylidenehydrazine SMILES: C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2
| PubChem CID | 79304 |
|---|---|
| CAS | 5350-57-2 |
| Molecular Weight (g/mol) | 196.253 |
| MDL Number | MFCD00007624 |
| SMILES | C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 |
| Synonym | benzophenone hydrazone,diphenylmethylene hydrazine,benzophenonehydrazone,methanone, diphenyl-, hydrazone,diphenylmethanone hydrazone,benzophenone, hydrazone,diphenylmethylidene hydrazine,diphenyl ketone hydrazone,benzophenone hydrozone,nsc 43 |
| IUPAC Name | benzhydrylidenehydrazine |
| InChI Key | QYCSNMDOZNUZIT-UHFFFAOYSA-N |
| Molecular Formula | C13H12N2 |
1-n-Heptyl-4-iodobenzene, 98%
CAS: 131894-91-2 Molecular Formula: C13H19I Molecular Weight (g/mol): 302.20 MDL Number: MFCD07777084 InChI Key: NHXKOPSTJPLWPK-UHFFFAOYSA-N Synonym: 1-n-heptyl-4-iodobenzene,4-heptyl-1-iodobenzene PubChem CID: 15001646 IUPAC Name: 1-heptyl-4-iodobenzene SMILES: CCCCCCCC1=CC=C(I)C=C1
| PubChem CID | 15001646 |
|---|---|
| CAS | 131894-91-2 |
| Molecular Weight (g/mol) | 302.20 |
| MDL Number | MFCD07777084 |
| SMILES | CCCCCCCC1=CC=C(I)C=C1 |
| Synonym | 1-n-heptyl-4-iodobenzene,4-heptyl-1-iodobenzene |
| IUPAC Name | 1-heptyl-4-iodobenzene |
| InChI Key | NHXKOPSTJPLWPK-UHFFFAOYSA-N |
| Molecular Formula | C13H19I |
Benzyl Alcohol, NF, EP, BP, JP, bioCERTIFIED™, 500 mL, Spectrum Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
2-(Diphenylphosphino)benzaldehyde oxime, 95%, Thermo Scientific Chemicals
CAS: 153358-05-5 Molecular Formula: C19H16NOP Molecular Weight (g/mol): 305.32 MDL Number: MFCD16251585 InChI Key: XHIVESUSSLEMGJ-UHFFFAOYSA-N Synonym: 2-diphenylphosphino benzaldehyde oxime,n-2-diphenylphosphino benzylidene hydroxylamine,e-n-2-diphenylphosphanyl phenyl methylidene hydroxylamine PubChem CID: 98043674 IUPAC Name: (NZ)-N-[(2-diphenylphosphanylphenyl)methylidene]hydroxylamine SMILES: ON=CC1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 98043674 |
|---|---|
| CAS | 153358-05-5 |
| Molecular Weight (g/mol) | 305.32 |
| MDL Number | MFCD16251585 |
| SMILES | ON=CC1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-diphenylphosphino benzaldehyde oxime,n-2-diphenylphosphino benzylidene hydroxylamine,e-n-2-diphenylphosphanyl phenyl methylidene hydroxylamine |
| IUPAC Name | (NZ)-N-[(2-diphenylphosphanylphenyl)methylidene]hydroxylamine |
| InChI Key | XHIVESUSSLEMGJ-UHFFFAOYSA-N |
| Molecular Formula | C19H16NOP |
4-Bromo-2-fluorotoluene, 99%
CAS: 51436-99-8 Molecular Formula: C7H6BrF Molecular Weight (g/mol): 189.027 MDL Number: MFCD00013551 InChI Key: YZFVUQSAJMLFOZ-UHFFFAOYSA-N Synonym: 4-bromo-2-fluorotoluene,2-fluoro-4-bromotoluene,benzene, 4-bromo-2-fluoro-1-methyl,toluene,2-fluoro-4-bromo,4-bromo-2-fluoro-1-methyl-benzene,pubchem1601,acmc-1an2v,2-fluoro-4-bromo toluene,4-bromo-2-fluoro-toluene PubChem CID: 171040 IUPAC Name: 4-bromo-2-fluoro-1-methylbenzene SMILES: CC1=C(C=C(C=C1)Br)F
| PubChem CID | 171040 |
|---|---|
| CAS | 51436-99-8 |
| Molecular Weight (g/mol) | 189.027 |
| MDL Number | MFCD00013551 |
| SMILES | CC1=C(C=C(C=C1)Br)F |
| Synonym | 4-bromo-2-fluorotoluene,2-fluoro-4-bromotoluene,benzene, 4-bromo-2-fluoro-1-methyl,toluene,2-fluoro-4-bromo,4-bromo-2-fluoro-1-methyl-benzene,pubchem1601,acmc-1an2v,2-fluoro-4-bromo toluene,4-bromo-2-fluoro-toluene |
| IUPAC Name | 4-bromo-2-fluoro-1-methylbenzene |
| InChI Key | YZFVUQSAJMLFOZ-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrF |
Toluene-2,6-diisocyanate, 97%
CAS: 91-08-7 Molecular Formula: C9H6N2O2 Molecular Weight (g/mol): 174.159 MDL Number: MFCD00002010 InChI Key: RUELTTOHQODFPA-UHFFFAOYSA-N Synonym: 2,6-diisocyanatotoluene,toluene-2,6-diisocyanate,2,6-toluene diisocyanate,2-methyl-m-phenylene diisocyanate,2,6-tdi,m-tolylene diisocyanate,meta-tolylene diisocyanate,toluene 2,6-diisocyanate,benzene, 1,3-diisocyanato-2-methyl,2,6-diisocyanato-1-methylbenzene PubChem CID: 7040 ChEBI: CHEBI:53557 IUPAC Name: 1,3-diisocyanato-2-methylbenzene SMILES: CC1=C(C=CC=C1N=C=O)N=C=O
| PubChem CID | 7040 |
|---|---|
| CAS | 91-08-7 |
| Molecular Weight (g/mol) | 174.159 |
| ChEBI | CHEBI:53557 |
| MDL Number | MFCD00002010 |
| SMILES | CC1=C(C=CC=C1N=C=O)N=C=O |
| Synonym | 2,6-diisocyanatotoluene,toluene-2,6-diisocyanate,2,6-toluene diisocyanate,2-methyl-m-phenylene diisocyanate,2,6-tdi,m-tolylene diisocyanate,meta-tolylene diisocyanate,toluene 2,6-diisocyanate,benzene, 1,3-diisocyanato-2-methyl,2,6-diisocyanato-1-methylbenzene |
| IUPAC Name | 1,3-diisocyanato-2-methylbenzene |
| InChI Key | RUELTTOHQODFPA-UHFFFAOYSA-N |
| Molecular Formula | C9H6N2O2 |
4-Amino-3-iodobenzonitrile, 97%
CAS: 33348-34-4 Molecular Formula: C7H5IN2 Molecular Weight (g/mol): 244.035 MDL Number: MFCD04039964 InChI Key: UOWVTQFTEAYDLM-UHFFFAOYSA-N Synonym: 4-cyano-2-iodoaniline,1-amino-2-iodo-4-cyanobenzene,benzonitrile, 4-amino-3-iodo,4-amino-2-iodobenzonitrile 98,4-amino-3-iodobenzenecarbonitrile,2-iodo-4-cyanoaniline,4-cyano-6-iodoaniline,pubchem18486,acmc-20a6lw,3-iodo-4-aminobenzonitrile PubChem CID: 4416395 IUPAC Name: 4-amino-3-iodobenzonitrile SMILES: C1=CC(=C(C=C1C#N)I)N
| PubChem CID | 4416395 |
|---|---|
| CAS | 33348-34-4 |
| Molecular Weight (g/mol) | 244.035 |
| MDL Number | MFCD04039964 |
| SMILES | C1=CC(=C(C=C1C#N)I)N |
| Synonym | 4-cyano-2-iodoaniline,1-amino-2-iodo-4-cyanobenzene,benzonitrile, 4-amino-3-iodo,4-amino-2-iodobenzonitrile 98,4-amino-3-iodobenzenecarbonitrile,2-iodo-4-cyanoaniline,4-cyano-6-iodoaniline,pubchem18486,acmc-20a6lw,3-iodo-4-aminobenzonitrile |
| IUPAC Name | 4-amino-3-iodobenzonitrile |
| InChI Key | UOWVTQFTEAYDLM-UHFFFAOYSA-N |
| Molecular Formula | C7H5IN2 |
4-Cyanobenzoic acid, 99%
CAS: 619-65-8 Molecular Formula: C8H5NO2 Molecular Weight (g/mol): 147.13 MDL Number: MFCD00002528 InChI Key: ADCUEPOHPCPMCE-UHFFFAOYSA-N Synonym: p-cyanobenzoic acid,benzoic acid, 4-cyano,p-carboxybenzonitrile,4-carboxybenzonitrile,benzoic acid, p-cyano,4-cyano-benzoic acid,4-cyano benzoic acid,benzoicacid, 4-cyano,4-cyanobenzoicacid,para-cyanobenzoic acid PubChem CID: 12087 IUPAC Name: 4-cyanobenzoic acid SMILES: C1=CC(=CC=C1C#N)C(=O)O
| PubChem CID | 12087 |
|---|---|
| CAS | 619-65-8 |
| Molecular Weight (g/mol) | 147.13 |
| MDL Number | MFCD00002528 |
| SMILES | C1=CC(=CC=C1C#N)C(=O)O |
| Synonym | p-cyanobenzoic acid,benzoic acid, 4-cyano,p-carboxybenzonitrile,4-carboxybenzonitrile,benzoic acid, p-cyano,4-cyano-benzoic acid,4-cyano benzoic acid,benzoicacid, 4-cyano,4-cyanobenzoicacid,para-cyanobenzoic acid |
| IUPAC Name | 4-cyanobenzoic acid |
| InChI Key | ADCUEPOHPCPMCE-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO2 |
Methyl 3,5-dibromo-4-hydroxybenzoate, 98%
CAS: 41727-47-3 Molecular Formula: C8H6Br2O3 Molecular Weight (g/mol): 309.941 MDL Number: MFCD00016416 InChI Key: NVGJGYZKXBLIKY-UHFFFAOYSA-N Synonym: 3,5-dibromo-4-hydroxybenzoic acid methyl ester,3,5-dibromo-4-hydroxy-benzoic acid methyl ester,methyl 3,5-bis bromanyl-4-oxidanyl-benzoate,acmc-20akhs,pubchem3978,methyl dibromosalicylate,rarechem al bf 0231,timtec-bb sbb012530,labotest-bb lt00455670,labotest-bb lt03332530 PubChem CID: 726975 IUPAC Name: methyl 3,5-dibromo-4-hydroxybenzoate SMILES: COC(=O)C1=CC(=C(C(=C1)Br)O)Br
| PubChem CID | 726975 |
|---|---|
| CAS | 41727-47-3 |
| Molecular Weight (g/mol) | 309.941 |
| MDL Number | MFCD00016416 |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)O)Br |
| Synonym | 3,5-dibromo-4-hydroxybenzoic acid methyl ester,3,5-dibromo-4-hydroxy-benzoic acid methyl ester,methyl 3,5-bis bromanyl-4-oxidanyl-benzoate,acmc-20akhs,pubchem3978,methyl dibromosalicylate,rarechem al bf 0231,timtec-bb sbb012530,labotest-bb lt00455670,labotest-bb lt03332530 |
| IUPAC Name | methyl 3,5-dibromo-4-hydroxybenzoate |
| InChI Key | NVGJGYZKXBLIKY-UHFFFAOYSA-N |
| Molecular Formula | C8H6Br2O3 |
3-(Trifluoromethyl)phenylhydrazine, 95%
CAS: 368-78-5 Molecular Formula: C7H7F3N2 Molecular Weight (g/mol): 176.142 MDL Number: MFCD00025093 InChI Key: RSESUCWJKLHXEZ-UHFFFAOYSA-N Synonym: 3-trifluoromethyl phenylhydrazine,3-trifluoromethyl phenyl hydrazine,3-trifluoromethylphenylhydrazine,hydrazine, 3-trifluoromethyl phenyl,3-trifloromethylphenylhydrazine,3-trifluouromethyl phenylhydrazinehydrochloride,3-trifluoromethyl phenylhydrazine hydrochioride,pubchem3280,enamine_001261 PubChem CID: 98650 IUPAC Name: [3-(trifluoromethyl)phenyl]hydrazine SMILES: C1=CC(=CC(=C1)NN)C(F)(F)F
| PubChem CID | 98650 |
|---|---|
| CAS | 368-78-5 |
| Molecular Weight (g/mol) | 176.142 |
| MDL Number | MFCD00025093 |
| SMILES | C1=CC(=CC(=C1)NN)C(F)(F)F |
| Synonym | 3-trifluoromethyl phenylhydrazine,3-trifluoromethyl phenyl hydrazine,3-trifluoromethylphenylhydrazine,hydrazine, 3-trifluoromethyl phenyl,3-trifloromethylphenylhydrazine,3-trifluouromethyl phenylhydrazinehydrochloride,3-trifluoromethyl phenylhydrazine hydrochioride,pubchem3280,enamine_001261 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]hydrazine |
| InChI Key | RSESUCWJKLHXEZ-UHFFFAOYSA-N |
| Molecular Formula | C7H7F3N2 |
Thermo Scientific Chemicals 5-Sulfosalicylic acid dihydrate, 99+%
CAS: 5965-83-3 | C9H14O6S | 250.27 g/mol
| Molecular Weight (g/mol) | 250.27 |
|---|---|
| CAS Min % | 99.0 |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| PubChem CID | 2723734 |
| Name Note | p.a. |
| Percent Purity | 99+% |
| Fieser | 01,1118 |
| Infrared Spectrum | Authentic |
| Formula Weight | 254.22 |
| Melting Point | 106.0°C to 110.0°C |
| CAS Max % | 100.0 |
| Color | White |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | 5-Sulfosalicylic acid dihydrate |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Merck Index | 15, 9094 |
| Assay Percent Range | 99+% |
| CAS | 97-05-2 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00007508,MFCD00149540 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: 127g/L (20°C). Other solubilities: soluble in alcohol and ether |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| Beilstein | 11, 411 |
| Molecular Formula | C9H14O6S |
Triphenylphosphonium bromide, 99%
CAS: 6399-81-1 Molecular Formula: C18H16BrP Molecular Weight (g/mol): 343.20 MDL Number: MFCD00035107 InChI Key: CMSYDJVRTHCWFP-UHFFFAOYSA-N Synonym: triphenylphosphine hydrobromide,triphenylphosphonium bromide,phosphine, triphenyl-, hydrobromide,triphenylphosphane hydrobromide,triphenylphosphine bromine,pubchem13868,ph3p hbr,ph3p . hbr,unappfzuzwmopv-uhfffaoysa-n PubChem CID: 80811 IUPAC Name: triphenylphosphane;hydrobromide SMILES: Br.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 80811 |
|---|---|
| CAS | 6399-81-1 |
| Molecular Weight (g/mol) | 343.20 |
| MDL Number | MFCD00035107 |
| SMILES | Br.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine hydrobromide,triphenylphosphonium bromide,phosphine, triphenyl-, hydrobromide,triphenylphosphane hydrobromide,triphenylphosphine bromine,pubchem13868,ph3p hbr,ph3p . hbr,unappfzuzwmopv-uhfffaoysa-n |
| IUPAC Name | triphenylphosphane;hydrobromide |
| InChI Key | CMSYDJVRTHCWFP-UHFFFAOYSA-N |
| Molecular Formula | C18H16BrP |
(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidindiol, 97%, Thermo Scientific Chemicals
CAS: 90365-74-5 MDL Number: MFCD01073893 InChI Key: QJRIUWQPJVPYSO-QWRGUYRKSA-N Synonym: 3s,4s-1-benzylpyrrolidine-3,4-diol,3s,4s-+-1-benzyl-3,4-pyrrolidindiol,3s,4s-+-1-benzyl-3,4-pyrrolidinediol,3s,4s-1-benzyl-3,4-pyrrolidinediol,3s,4s---1-benzyl-3,4-pyrrolidindiol,3,4-pyrrolidinediol, 1-phenylmethyl-, 3s,4s,pubchem18732,3s,4s-1-benzyl-3,4-dihydroxypyrrolidine,3s,4s-1-phenylmethyl-3,4-pyrrolidinediol,3s,4s-+-1-benzyl-3,4-pyrrolidinediol sum of enantiomers, hplc PubChem CID: 2734057 IUPAC Name: (3S,4S)-1-benzylpyrrolidine-3,4-diol SMILES: C1C(C(CN1CC2=CC=CC=C2)O)O
| PubChem CID | 2734057 |
|---|---|
| CAS | 90365-74-5 |
| MDL Number | MFCD01073893 |
| SMILES | C1C(C(CN1CC2=CC=CC=C2)O)O |
| Synonym | 3s,4s-1-benzylpyrrolidine-3,4-diol,3s,4s-+-1-benzyl-3,4-pyrrolidindiol,3s,4s-+-1-benzyl-3,4-pyrrolidinediol,3s,4s-1-benzyl-3,4-pyrrolidinediol,3s,4s---1-benzyl-3,4-pyrrolidindiol,3,4-pyrrolidinediol, 1-phenylmethyl-, 3s,4s,pubchem18732,3s,4s-1-benzyl-3,4-dihydroxypyrrolidine,3s,4s-1-phenylmethyl-3,4-pyrrolidinediol,3s,4s-+-1-benzyl-3,4-pyrrolidinediol sum of enantiomers, hplc |
| IUPAC Name | (3S,4S)-1-benzylpyrrolidine-3,4-diol |
| InChI Key | QJRIUWQPJVPYSO-QWRGUYRKSA-N |
2,4,6-Trichlorobenzoyl chloride, 98%
CAS: 4136-95-2 Molecular Formula: C7H2Cl4O Molecular Weight (g/mol): 243.89 MDL Number: MFCD00075323 InChI Key: OZGSEIVTQLXWRO-UHFFFAOYSA-N Synonym: 2,4,6-trichlorobenzoylchloride,benzoyl chloride, 2,4,6-trichloro,mi,acmc-209jk3,ksc494s2p,2,4,6-cl3c6h2cocl,2,4,6-ttrichlorobenzoyl chloride,2,4,6-trichloro benzoyl chloride,2,4,6-trichlorobenzoic acid chloride,2,4,6-tris chloranyl benzoyl chloride PubChem CID: 2733703 IUPAC Name: 2,4,6-trichlorobenzoyl chloride SMILES: ClC(=O)C1=C(Cl)C=C(Cl)C=C1Cl
| PubChem CID | 2733703 |
|---|---|
| CAS | 4136-95-2 |
| Molecular Weight (g/mol) | 243.89 |
| MDL Number | MFCD00075323 |
| SMILES | ClC(=O)C1=C(Cl)C=C(Cl)C=C1Cl |
| Synonym | 2,4,6-trichlorobenzoylchloride,benzoyl chloride, 2,4,6-trichloro,mi,acmc-209jk3,ksc494s2p,2,4,6-cl3c6h2cocl,2,4,6-ttrichlorobenzoyl chloride,2,4,6-trichloro benzoyl chloride,2,4,6-trichlorobenzoic acid chloride,2,4,6-tris chloranyl benzoyl chloride |
| IUPAC Name | 2,4,6-trichlorobenzoyl chloride |
| InChI Key | OZGSEIVTQLXWRO-UHFFFAOYSA-N |
| Molecular Formula | C7H2Cl4O |