Benzene and substituted derivatives
Filtered Search Results
o-Toluic acid, 98+%
CAS: 118-90-1 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002477 InChI Key: ZWLPBLYKEWSWPD-UHFFFAOYSA-N Synonym: o-toluic acid,o-toluylic acid,orthotoluic acid,2-toluic acid,toluic acid,benzoic acid, 2-methyl,o-methylbenzoic acid,2-methyl-benzoic acid,benzoic acid, methyl,o-toluate PubChem CID: 8373 ChEBI: CHEBI:36632 IUPAC Name: 2-methylbenzoic acid SMILES: CC1=CC=CC=C1C(=O)O
| PubChem CID | 8373 |
|---|---|
| CAS | 118-90-1 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:36632 |
| MDL Number | MFCD00002477 |
| SMILES | CC1=CC=CC=C1C(=O)O |
| Synonym | o-toluic acid,o-toluylic acid,orthotoluic acid,2-toluic acid,toluic acid,benzoic acid, 2-methyl,o-methylbenzoic acid,2-methyl-benzoic acid,benzoic acid, methyl,o-toluate |
| IUPAC Name | 2-methylbenzoic acid |
| InChI Key | ZWLPBLYKEWSWPD-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
N-Benzylmethylamine, 97%
CAS: 103-67-3 Molecular Formula: C8H11N Molecular Weight (g/mol): 121.18 MDL Number: MFCD00008289 InChI Key: RIWRFSMVIUAEBX-UHFFFAOYSA-N Synonym: n-methylbenzylamine,methylbenzylamine,n-benzylmethylamine,benzyl methyl amine,benzenemethanamine, n-methyl,benzylmethylamine,n-methy-n-benzylamine,n-benzyl-n-methylamine,benzylamine, n-methyl,n-methyl phenyl methanamine PubChem CID: 7669 IUPAC Name: N-methyl-1-phenylmethanamine SMILES: CNCC1=CC=CC=C1
| PubChem CID | 7669 |
|---|---|
| CAS | 103-67-3 |
| Molecular Weight (g/mol) | 121.18 |
| MDL Number | MFCD00008289 |
| SMILES | CNCC1=CC=CC=C1 |
| Synonym | n-methylbenzylamine,methylbenzylamine,n-benzylmethylamine,benzyl methyl amine,benzenemethanamine, n-methyl,benzylmethylamine,n-methy-n-benzylamine,n-benzyl-n-methylamine,benzylamine, n-methyl,n-methyl phenyl methanamine |
| IUPAC Name | N-methyl-1-phenylmethanamine |
| InChI Key | RIWRFSMVIUAEBX-UHFFFAOYSA-N |
| Molecular Formula | C8H11N |
2-Fluoro-N-methylbenzylamine, 95%
CAS: 399-30-4 Molecular Formula: C8H10FN Molecular Weight (g/mol): 139.173 MDL Number: MFCD04629633 InChI Key: AHIHZCXUWGORQO-UHFFFAOYSA-N Synonym: n-methyl-2-fluorobenzylamine,2-fluorobenzyl methylamine,2-fluoro-n-methylbenzylamine,2-fluorophenyl methyl methyl amine,1-2-fluorophenyl-n-methylmethanamine,n-2-fluorobenzyl-n-methylamine,n-methyl-o-fluorobenzylamine,benzenemethanamine, 2-fluoro-n-methyl,1-2-fluorophenyl-n-methyl-methanamine,acmc-209zio PubChem CID: 2060842 IUPAC Name: 1-(2-fluorophenyl)-N-methylmethanamine SMILES: CNCC1=CC=CC=C1F
| PubChem CID | 2060842 |
|---|---|
| CAS | 399-30-4 |
| Molecular Weight (g/mol) | 139.173 |
| MDL Number | MFCD04629633 |
| SMILES | CNCC1=CC=CC=C1F |
| Synonym | n-methyl-2-fluorobenzylamine,2-fluorobenzyl methylamine,2-fluoro-n-methylbenzylamine,2-fluorophenyl methyl methyl amine,1-2-fluorophenyl-n-methylmethanamine,n-2-fluorobenzyl-n-methylamine,n-methyl-o-fluorobenzylamine,benzenemethanamine, 2-fluoro-n-methyl,1-2-fluorophenyl-n-methyl-methanamine,acmc-209zio |
| IUPAC Name | 1-(2-fluorophenyl)-N-methylmethanamine |
| InChI Key | AHIHZCXUWGORQO-UHFFFAOYSA-N |
| Molecular Formula | C8H10FN |
Benzhydryl chloride, 98%
CAS: 90-99-3 Molecular Formula: C13H11Cl Molecular Weight (g/mol): 202.681 MDL Number: MFCD00000855 InChI Key: ZDVDCDLBOLSVGM-UHFFFAOYSA-N Synonym: benzhydryl chloride,chlorodiphenylmethane,chloromethylene dibenzene,diphenylchloromethane,diphenylmethyl chloride,benzene, 1,1'-chloromethylene bis,chloro phenyl methyl benzene,methane, chlorodiphenyl,unii-cn9n9ayv4b,1,1'-chloromethylene bisbenzene PubChem CID: 7035 IUPAC Name: [chloro(phenyl)methyl]benzene SMILES: C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl
| PubChem CID | 7035 |
|---|---|
| CAS | 90-99-3 |
| Molecular Weight (g/mol) | 202.681 |
| MDL Number | MFCD00000855 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl |
| Synonym | benzhydryl chloride,chlorodiphenylmethane,chloromethylene dibenzene,diphenylchloromethane,diphenylmethyl chloride,benzene, 1,1'-chloromethylene bis,chloro phenyl methyl benzene,methane, chlorodiphenyl,unii-cn9n9ayv4b,1,1'-chloromethylene bisbenzene |
| IUPAC Name | [chloro(phenyl)methyl]benzene |
| InChI Key | ZDVDCDLBOLSVGM-UHFFFAOYSA-N |
| Molecular Formula | C13H11Cl |
4-Nitroanisole, 99+%
CAS: 100-17-4 Molecular Formula: C7H7NO3 Molecular Weight (g/mol): 153.14 MDL Number: MFCD00007327 InChI Key: BNUHAJGCKIQFGE-UHFFFAOYSA-N Synonym: 4-nitroanisole,p-nitroanisole,4-methoxynitrobenzene,p-methoxynitrobenzene,benzene, 1-methoxy-4-nitro,nitroanisole,p-nitroanisol,anisole, p-nitro,4-nitrophenyl methyl ether,unii-g989z7wolh PubChem CID: 7485 ChEBI: CHEBI:1911 IUPAC Name: 1-methoxy-4-nitrobenzene SMILES: COC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 7485 |
|---|---|
| CAS | 100-17-4 |
| Molecular Weight (g/mol) | 153.14 |
| ChEBI | CHEBI:1911 |
| MDL Number | MFCD00007327 |
| SMILES | COC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | 4-nitroanisole,p-nitroanisole,4-methoxynitrobenzene,p-methoxynitrobenzene,benzene, 1-methoxy-4-nitro,nitroanisole,p-nitroanisol,anisole, p-nitro,4-nitrophenyl methyl ether,unii-g989z7wolh |
| IUPAC Name | 1-methoxy-4-nitrobenzene |
| InChI Key | BNUHAJGCKIQFGE-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO3 |
Ribonucleic acid from Baker's yeast
CAS: 63231-63-0 MDL Number: MFCD00132196 IUPAC Name: Ribonucleic acid
| CAS | 63231-63-0 |
|---|---|
| MDL Number | MFCD00132196 |
| IUPAC Name | Ribonucleic acid |
alpha,alpha'-Dibromo-m-xylene, 97%
CAS: 626-15-3 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.95 InChI Key: OXHOPZLBSSTTBU-UHFFFAOYSA-N Synonym: 1,3-bis bromomethyl benzene,m-xylylene dibromide,alpha,alpha'-dibromo-m-xylene,benzene, 1,3-bis bromomethyl,m-bis bromomethyl benzene,m-xylylene bromide,ccris 1777,m-xylyene dibromide,m-xylene, .alpha.,.alpha.'-dibromo,m-.alpha.,.alpha.'-dibromoxylene PubChem CID: 69373 IUPAC Name: 1,3-bis(bromomethyl)benzene SMILES: C1=CC(=CC(=C1)CBr)CBr
| PubChem CID | 69373 |
|---|---|
| CAS | 626-15-3 |
| Molecular Weight (g/mol) | 263.95 |
| SMILES | C1=CC(=CC(=C1)CBr)CBr |
| Synonym | 1,3-bis bromomethyl benzene,m-xylylene dibromide,alpha,alpha'-dibromo-m-xylene,benzene, 1,3-bis bromomethyl,m-bis bromomethyl benzene,m-xylylene bromide,ccris 1777,m-xylyene dibromide,m-xylene, .alpha.,.alpha.'-dibromo,m-.alpha.,.alpha.'-dibromoxylene |
| IUPAC Name | 1,3-bis(bromomethyl)benzene |
| InChI Key | OXHOPZLBSSTTBU-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
trans-beta-Nitrostyrene, 97+%
CAS: 5153-67-3 Molecular Formula: C8H7NO2 Molecular Weight (g/mol): 149.15 MDL Number: MFCD00007402 InChI Key: PIAOLBVUVDXHHL-VOTSOKGWSA-N Synonym: trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl PubChem CID: 5284459 IUPAC Name: [(E)-2-nitroethenyl]benzene SMILES: [O-][N+](=O)\C=C\C1=CC=CC=C1
| PubChem CID | 5284459 |
|---|---|
| CAS | 5153-67-3 |
| Molecular Weight (g/mol) | 149.15 |
| MDL Number | MFCD00007402 |
| SMILES | [O-][N+](=O)\C=C\C1=CC=CC=C1 |
| Synonym | trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl |
| IUPAC Name | [(E)-2-nitroethenyl]benzene |
| InChI Key | PIAOLBVUVDXHHL-VOTSOKGWSA-N |
| Molecular Formula | C8H7NO2 |
5-Sulfosalicylic acid dihydrate, ACS reagent
CAS: 5965-83-3 Molecular Formula: C9H14O6S Molecular Weight (g/mol): 250.27 MDL Number: MFCD00007508,MFCD00149540 InChI Key: NFYHZVWMQHQKRU-UHFFFAOYSA-N Synonym: 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd PubChem CID: 2723734 IUPAC Name: 2-hydroxy-5-sulfobenzoic acid;dihydrate SMILES: C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O
| PubChem CID | 2723734 |
|---|---|
| CAS | 5965-83-3 |
| Molecular Weight (g/mol) | 250.27 |
| MDL Number | MFCD00007508,MFCD00149540 |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| IUPAC Name | 2-hydroxy-5-sulfobenzoic acid;dihydrate |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| Molecular Formula | C9H14O6S |
4-Fluoro-alpha-methylstyrene, 95%
CAS: 350-40-3 Molecular Formula: C9H9F Molecular Weight (g/mol): 136.169 MDL Number: MFCD00042297 InChI Key: VIXHMBLBLJSGIB-UHFFFAOYSA-N Synonym: 4-fluoro-alpha-methylstyrene,1-fluoro-4-1-methylethenyl benzene,1-fluoro-4-prop-1-en-2-yl benzene,2-4-fluorophenyl-1-propene,2-4-fluorophenyl propene,benzene, 1-fluoro-4-1-methylethenyl,4-fluoro-.alpha.-methylstyrene,1-fluoro-4-isopropenyl benzene,1-fluoro-4-isopropenylbenzene,p-fluoro-.alpha.-methylstyrene PubChem CID: 67690 IUPAC Name: 1-fluoro-4-prop-1-en-2-ylbenzene SMILES: CC(=C)C1=CC=C(C=C1)F
| PubChem CID | 67690 |
|---|---|
| CAS | 350-40-3 |
| Molecular Weight (g/mol) | 136.169 |
| MDL Number | MFCD00042297 |
| SMILES | CC(=C)C1=CC=C(C=C1)F |
| Synonym | 4-fluoro-alpha-methylstyrene,1-fluoro-4-1-methylethenyl benzene,1-fluoro-4-prop-1-en-2-yl benzene,2-4-fluorophenyl-1-propene,2-4-fluorophenyl propene,benzene, 1-fluoro-4-1-methylethenyl,4-fluoro-.alpha.-methylstyrene,1-fluoro-4-isopropenyl benzene,1-fluoro-4-isopropenylbenzene,p-fluoro-.alpha.-methylstyrene |
| IUPAC Name | 1-fluoro-4-prop-1-en-2-ylbenzene |
| InChI Key | VIXHMBLBLJSGIB-UHFFFAOYSA-N |
| Molecular Formula | C9H9F |
4-Chlorobenzotrifluoride, 98+%
CAS: 98-56-6 Molecular Formula: C7H4ClF3 Molecular Weight (g/mol): 180.554 MDL Number: MFCD00000627 InChI Key: QULYNCCPRWKEMF-UHFFFAOYSA-N Synonym: 4-chlorobenzotrifluoride,p-chlorobenzotrifluoride,1-chloro-4-trifluoromethyl benzene,benzene, 1-chloro-4-trifluoromethyl,4-chloro-alpha,alpha,alpha-trifluorotoluene,para-chlorobenzotrifluoride,p-chlorophenyl trifluoromethane,p-chloro-a,a,a-trifluorotoluene,pcbtf,p-chlorotrifluoromethylbenzene PubChem CID: 7394 IUPAC Name: 1-chloro-4-(trifluoromethyl)benzene SMILES: C1=CC(=CC=C1C(F)(F)F)Cl
| PubChem CID | 7394 |
|---|---|
| CAS | 98-56-6 |
| Molecular Weight (g/mol) | 180.554 |
| MDL Number | MFCD00000627 |
| SMILES | C1=CC(=CC=C1C(F)(F)F)Cl |
| Synonym | 4-chlorobenzotrifluoride,p-chlorobenzotrifluoride,1-chloro-4-trifluoromethyl benzene,benzene, 1-chloro-4-trifluoromethyl,4-chloro-alpha,alpha,alpha-trifluorotoluene,para-chlorobenzotrifluoride,p-chlorophenyl trifluoromethane,p-chloro-a,a,a-trifluorotoluene,pcbtf,p-chlorotrifluoromethylbenzene |
| IUPAC Name | 1-chloro-4-(trifluoromethyl)benzene |
| InChI Key | QULYNCCPRWKEMF-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClF3 |
4-Nitroanisole, 97%
CAS: 100-17-4 Molecular Formula: C7H7NO3 Molecular Weight (g/mol): 153.14 MDL Number: MFCD00007327 InChI Key: BNUHAJGCKIQFGE-UHFFFAOYSA-N Synonym: 4-nitroanisole,p-nitroanisole,4-methoxynitrobenzene,p-methoxynitrobenzene,benzene, 1-methoxy-4-nitro,nitroanisole,p-nitroanisol,anisole, p-nitro,4-nitrophenyl methyl ether,unii-g989z7wolh PubChem CID: 7485 ChEBI: CHEBI:1911 IUPAC Name: 1-methoxy-4-nitrobenzene SMILES: COC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 7485 |
|---|---|
| CAS | 100-17-4 |
| Molecular Weight (g/mol) | 153.14 |
| ChEBI | CHEBI:1911 |
| MDL Number | MFCD00007327 |
| SMILES | COC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | 4-nitroanisole,p-nitroanisole,4-methoxynitrobenzene,p-methoxynitrobenzene,benzene, 1-methoxy-4-nitro,nitroanisole,p-nitroanisol,anisole, p-nitro,4-nitrophenyl methyl ether,unii-g989z7wolh |
| IUPAC Name | 1-methoxy-4-nitrobenzene |
| InChI Key | BNUHAJGCKIQFGE-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO3 |
Bromobenzene 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 108-86-1 Molecular Formula: C6H5Br Molecular Weight (g/mol): 157.01 MDL Number: MFCD00000055 InChI Key: QARVLSVVCXYDNA-UHFFFAOYSA-N Synonym: benzene, bromo,monobromobenzene,phenyl bromide,bromo-benzene,1-bromobenzene,phbr,bromo benzene,4-bromobenzene,unii-co4d5j547l,hsdb 47 PubChem CID: 7961 ChEBI: CHEBI:3179 IUPAC Name: bromobenzene SMILES: BrC1=CC=CC=C1
| PubChem CID | 7961 |
|---|---|
| CAS | 108-86-1 |
| Molecular Weight (g/mol) | 157.01 |
| ChEBI | CHEBI:3179 |
| MDL Number | MFCD00000055 |
| SMILES | BrC1=CC=CC=C1 |
| Synonym | benzene, bromo,monobromobenzene,phenyl bromide,bromo-benzene,1-bromobenzene,phbr,bromo benzene,4-bromobenzene,unii-co4d5j547l,hsdb 47 |
| IUPAC Name | bromobenzene |
| InChI Key | QARVLSVVCXYDNA-UHFFFAOYSA-N |
| Molecular Formula | C6H5Br |
Methyl 4-bromo-3-methylbenzoate, 97%
CAS: 148547-19-7 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.073 MDL Number: MFCD00673014 InChI Key: GTZTYNPAPQKIIR-UHFFFAOYSA-N Synonym: 4-bromo-3-methylbenzoic acid methyl ester,methyl4-bromo-3-methylbenzoate,methyl 4-bromo-m-toluate,4-bromo-3-methyl-benzoic acid methyl ester,methyl 4-bromo-3-methyl-benzoate,4-bromo-m-toluic acid methyl ester,benzoic acid, 4-bromo-3-methyl-, methyl ester,2-bromo-5-methoxycarbonyl toluene,3-methyl-4-bromobenzoic acid methyl ester,pubchem3970 PubChem CID: 3294148 IUPAC Name: methyl 4-bromo-3-methylbenzoate SMILES: CC1=C(C=CC(=C1)C(=O)OC)Br
| PubChem CID | 3294148 |
|---|---|
| CAS | 148547-19-7 |
| Molecular Weight (g/mol) | 229.073 |
| MDL Number | MFCD00673014 |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)Br |
| Synonym | 4-bromo-3-methylbenzoic acid methyl ester,methyl4-bromo-3-methylbenzoate,methyl 4-bromo-m-toluate,4-bromo-3-methyl-benzoic acid methyl ester,methyl 4-bromo-3-methyl-benzoate,4-bromo-m-toluic acid methyl ester,benzoic acid, 4-bromo-3-methyl-, methyl ester,2-bromo-5-methoxycarbonyl toluene,3-methyl-4-bromobenzoic acid methyl ester,pubchem3970 |
| IUPAC Name | methyl 4-bromo-3-methylbenzoate |
| InChI Key | GTZTYNPAPQKIIR-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
Diphenylacetic Acid, 99+%
CAS: 117-34-0 MDL Number: MFCD00004251 InChI Key: PYHXGXCGESYPCW-UHFFFAOYSA-N Synonym: diphenylacetic acid,diphenylethanoic acid,acetic acid, diphenyl,benzeneacetic acid, .alpha.-phenyl,1,1-diphenylacetic acid,unii-658ncz0nko,diphenyl-acetic acid,alpha-toluic acid, alpha-phenyl,658ncz0nko,benzeneacetic acid, alpha-phenyl PubChem CID: 8333 ChEBI: CHEBI:41967 IUPAC Name: 2,2-diphenylacetic acid SMILES: C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O
| PubChem CID | 8333 |
|---|---|
| CAS | 117-34-0 |
| ChEBI | CHEBI:41967 |
| MDL Number | MFCD00004251 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O |
| Synonym | diphenylacetic acid,diphenylethanoic acid,acetic acid, diphenyl,benzeneacetic acid, .alpha.-phenyl,1,1-diphenylacetic acid,unii-658ncz0nko,diphenyl-acetic acid,alpha-toluic acid, alpha-phenyl,658ncz0nko,benzeneacetic acid, alpha-phenyl |
| IUPAC Name | 2,2-diphenylacetic acid |
| InChI Key | PYHXGXCGESYPCW-UHFFFAOYSA-N |