Benzene and substituted derivatives
Filtered Search Results
4-Cumylphenol, 97%
CAS: 599-64-4 Molecular Formula: C15H16O Molecular Weight (g/mol): 212.292 MDL Number: MFCD00002365 InChI Key: QBDSZLJBMIMQRS-UHFFFAOYSA-N Synonym: 4-cumylphenol,p-cumylphenol,4-2-phenylpropan-2-yl phenol,p-cumyl phenol,phenol, 4-1-methyl-1-phenylethyl,4-1-methyl-1-phenylethyl phenol,4-alpha-cumylphenol,4-dimethylphenylmethyl phenol,4-hydroxydiphenyldimethylmethane,2-phenyl-2-4-hydroxyphenyl propane PubChem CID: 11742 ChEBI: CHEBI:35092 IUPAC Name: 4-(2-phenylpropan-2-yl)phenol SMILES: CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)O
| PubChem CID | 11742 |
|---|---|
| CAS | 599-64-4 |
| Molecular Weight (g/mol) | 212.292 |
| ChEBI | CHEBI:35092 |
| MDL Number | MFCD00002365 |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)O |
| Synonym | 4-cumylphenol,p-cumylphenol,4-2-phenylpropan-2-yl phenol,p-cumyl phenol,phenol, 4-1-methyl-1-phenylethyl,4-1-methyl-1-phenylethyl phenol,4-alpha-cumylphenol,4-dimethylphenylmethyl phenol,4-hydroxydiphenyldimethylmethane,2-phenyl-2-4-hydroxyphenyl propane |
| IUPAC Name | 4-(2-phenylpropan-2-yl)phenol |
| InChI Key | QBDSZLJBMIMQRS-UHFFFAOYSA-N |
| Molecular Formula | C15H16O |
Methyl 3-bromo-5-fluorobenzoate, 98%
CAS: 334792-52-8 Molecular Formula: C8H6BrFO2 Molecular Weight (g/mol): 233.04 MDL Number: MFCD07780735 InChI Key: JERAACCIOWRRQA-UHFFFAOYSA-N Synonym: 3-bromo-5-fluorobenzoic acid methyl ester,benzoic acid, 3-bromo-5-fluoro-, methyl ester,acmc-209i1c,methyl 5-bromo-3-fluorobenzoate,methyl-3-bromo-5-fluorobenzoate,3-bromo-5-fluoro-benzoic acid methyl ester,benzoicacid, 3-bromo-5-fluoro-, methyl ester PubChem CID: 21942598 IUPAC Name: methyl 3-bromo-5-fluorobenzoate SMILES: COC(=O)C1=CC(F)=CC(Br)=C1
| PubChem CID | 21942598 |
|---|---|
| CAS | 334792-52-8 |
| Molecular Weight (g/mol) | 233.04 |
| MDL Number | MFCD07780735 |
| SMILES | COC(=O)C1=CC(F)=CC(Br)=C1 |
| Synonym | 3-bromo-5-fluorobenzoic acid methyl ester,benzoic acid, 3-bromo-5-fluoro-, methyl ester,acmc-209i1c,methyl 5-bromo-3-fluorobenzoate,methyl-3-bromo-5-fluorobenzoate,3-bromo-5-fluoro-benzoic acid methyl ester,benzoicacid, 3-bromo-5-fluoro-, methyl ester |
| IUPAC Name | methyl 3-bromo-5-fluorobenzoate |
| InChI Key | JERAACCIOWRRQA-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrFO2 |
4-(Ethylsulfonyl)benzeneboronic acid, 98+%
CAS: 352530-24-6 Molecular Formula: C8H11BO4S Molecular Weight (g/mol): 214.042 MDL Number: MFCD02093076 InChI Key: CVBNDDGEVPNUNA-UHFFFAOYSA-N Synonym: 4-ethylsulfonyl phenylboronic acid,4-ethylsulfonyl phenyl boronic acid,4-ethanesulfonyl benzeneboronic acid,4-ethanesulfonyl phenylboronic acid,4-ethylsulfonylphenyl boronic acid,4-ethylsulphonyl benzeneboronic acid,boronic acid, 4-ethylsulfonyl phenyl,4-ethanesulfonyl phenyl boranediol,4-ethanesulphonyl benzeneboronic acid PubChem CID: 2773420 IUPAC Name: (4-ethylsulfonylphenyl)boronic acid SMILES: B(C1=CC=C(C=C1)S(=O)(=O)CC)(O)O
| PubChem CID | 2773420 |
|---|---|
| CAS | 352530-24-6 |
| Molecular Weight (g/mol) | 214.042 |
| MDL Number | MFCD02093076 |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)CC)(O)O |
| Synonym | 4-ethylsulfonyl phenylboronic acid,4-ethylsulfonyl phenyl boronic acid,4-ethanesulfonyl benzeneboronic acid,4-ethanesulfonyl phenylboronic acid,4-ethylsulfonylphenyl boronic acid,4-ethylsulphonyl benzeneboronic acid,boronic acid, 4-ethylsulfonyl phenyl,4-ethanesulfonyl phenyl boranediol,4-ethanesulphonyl benzeneboronic acid |
| IUPAC Name | (4-ethylsulfonylphenyl)boronic acid |
| InChI Key | CVBNDDGEVPNUNA-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4S |
2-Iodobenzoic acid, 98%
CAS: 88-67-5 Molecular Formula: C7H5IO2 Molecular Weight (g/mol): 248.01 InChI Key: CJNZAXGUTKBIHP-UHFFFAOYSA-N Synonym: o-iodobenzoic acid,benzoic acid, 2-iodo,iodobenzoic acid,benzoic acid, o-iodo,usaf ek-572,2-iodo benzoic acid,2-iodo-benzoic acid,benzoic acid, iodo,kyselina o-jodbenzoova,o-jod-benzoesaeure PubChem CID: 6941 ChEBI: CHEBI:287979 IUPAC Name: 2-iodobenzoic acid SMILES: C1=CC=C(C(=C1)C(=O)O)I
| PubChem CID | 6941 |
|---|---|
| CAS | 88-67-5 |
| Molecular Weight (g/mol) | 248.01 |
| ChEBI | CHEBI:287979 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)I |
| Synonym | o-iodobenzoic acid,benzoic acid, 2-iodo,iodobenzoic acid,benzoic acid, o-iodo,usaf ek-572,2-iodo benzoic acid,2-iodo-benzoic acid,benzoic acid, iodo,kyselina o-jodbenzoova,o-jod-benzoesaeure |
| IUPAC Name | 2-iodobenzoic acid |
| InChI Key | CJNZAXGUTKBIHP-UHFFFAOYSA-N |
| Molecular Formula | C7H5IO2 |
Thermo Scientific Chemicals Fexofenadine hydrochloride
CAS: 153439-40-8 Molecular Formula: C32H40ClNO4 Molecular Weight (g/mol): 538.13 MDL Number: MFCD00865710 InChI Key: RRJFVPUCXDGFJB-UHFFFAOYNA-N IUPAC Name: hydrogen 2-(4-{1-hydroxy-4-[4-(hydroxydiphenylmethyl)piperidin-1-yl]butyl}phenyl)-2-methylpropanoic acid chloride SMILES: [H+].[Cl-].CC(C)(C(O)=O)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1
| CAS | 153439-40-8 |
|---|---|
| Molecular Weight (g/mol) | 538.13 |
| MDL Number | MFCD00865710 |
| SMILES | [H+].[Cl-].CC(C)(C(O)=O)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC Name | hydrogen 2-(4-{1-hydroxy-4-[4-(hydroxydiphenylmethyl)piperidin-1-yl]butyl}phenyl)-2-methylpropanoic acid chloride |
| InChI Key | RRJFVPUCXDGFJB-UHFFFAOYNA-N |
| Molecular Formula | C32H40ClNO4 |
2,2-Diphenylpropylamine hydrochloride, 98+%
CAS: 40691-66-5 Molecular Formula: C15H18ClN Molecular Weight (g/mol): 247.766 MDL Number: MFCD00008133 InChI Key: AASCJSPDUDWGGQ-UHFFFAOYSA-N Synonym: 2,2-diphenylpropylamine hydrochloride,2,2-diphenylpropan-1-amine hydrochloride,beta-methyl-beta-phenylphenethylamine hydrochloride,acmc-20aojd,diphenylpropylamine hci,beta-methyl-beta-phenylphenethylamine hcl PubChem CID: 3084798 IUPAC Name: 2,2-diphenylpropan-1-amine;hydrochloride SMILES: CC(CN)(C1=CC=CC=C1)C2=CC=CC=C2.Cl
| PubChem CID | 3084798 |
|---|---|
| CAS | 40691-66-5 |
| Molecular Weight (g/mol) | 247.766 |
| MDL Number | MFCD00008133 |
| SMILES | CC(CN)(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
| Synonym | 2,2-diphenylpropylamine hydrochloride,2,2-diphenylpropan-1-amine hydrochloride,beta-methyl-beta-phenylphenethylamine hydrochloride,acmc-20aojd,diphenylpropylamine hci,beta-methyl-beta-phenylphenethylamine hcl |
| IUPAC Name | 2,2-diphenylpropan-1-amine;hydrochloride |
| InChI Key | AASCJSPDUDWGGQ-UHFFFAOYSA-N |
| Molecular Formula | C15H18ClN |
Sodium Salicylate, Crystal, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.10 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M IUPAC Name: sodium 2-hydroxybenzoate SMILES: [Na+].OC1=CC=CC=C1C([O-])=O
| CAS | 54-21-7 |
|---|---|
| Molecular Weight (g/mol) | 160.10 |
| SMILES | [Na+].OC1=CC=CC=C1C([O-])=O |
| IUPAC Name | sodium 2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
Pararosaniline hydrochloride, 90+%, Thermo Scientific Chemicals
CAS: 569-61-9 Molecular Formula: C19H18ClN3 Molecular Weight (g/mol): 323.824 MDL Number: MFCD00001657 InChI Key: JUQPZRLQQYSMEQ-UHFFFAOYSA-N Synonym: basic red 9,pararosaniline hydrochloride,parafuchsin,pararosaniline chloride,parafuchsine,p-fuchsin,basic fuchsin,ci basic red 9,c.i. basic red 9,parafuksin PubChem CID: 11292 ChEBI: CHEBI:87663 IUPAC Name: 4-[(4-aminophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride SMILES: C1=CC(=N)C=CC1=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N.Cl
| PubChem CID | 11292 |
|---|---|
| CAS | 569-61-9 |
| Molecular Weight (g/mol) | 323.824 |
| ChEBI | CHEBI:87663 |
| MDL Number | MFCD00001657 |
| SMILES | C1=CC(=N)C=CC1=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N.Cl |
| Synonym | basic red 9,pararosaniline hydrochloride,parafuchsin,pararosaniline chloride,parafuchsine,p-fuchsin,basic fuchsin,ci basic red 9,c.i. basic red 9,parafuksin |
| IUPAC Name | 4-[(4-aminophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride |
| InChI Key | JUQPZRLQQYSMEQ-UHFFFAOYSA-N |
| Molecular Formula | C19H18ClN3 |
Ambrisentan, Thermo Scientific Chemicals
CAS: 177036-94-1 Molecular Formula: C22H22N2O4 Molecular Weight (g/mol): 378.43 InChI Key: OUJTZYPIHDYQMC-UHFFFAOYNA-N IUPAC Name: 2-[(4,6-dimethylpyrimidin-2-yl)oxy]-3-methoxy-3,3-diphenylpropanoic acid SMILES: COC(C(OC1=NC(C)=CC(C)=N1)C(O)=O)(C1=CC=CC=C1)C1=CC=CC=C1
| CAS | 177036-94-1 |
|---|---|
| Molecular Weight (g/mol) | 378.43 |
| SMILES | COC(C(OC1=NC(C)=CC(C)=N1)C(O)=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC Name | 2-[(4,6-dimethylpyrimidin-2-yl)oxy]-3-methoxy-3,3-diphenylpropanoic acid |
| InChI Key | OUJTZYPIHDYQMC-UHFFFAOYNA-N |
| Molecular Formula | C22H22N2O4 |
3,3'-Diaminodiphenyl sulfone, 98%
CAS: 599-61-1 Molecular Formula: C12H12N2O2S Molecular Weight (g/mol): 248.30 MDL Number: MFCD00007792 InChI Key: LJGHYPLBDBRCRZ-UHFFFAOYSA-N Synonym: 3,3'-sulfonyldianiline,3,3'-diaminodiphenyl sulfone,3-aminophenyl sulfone,benzenamine, 3,3'-sulfonylbis,3,3'-sulphonyldianiline,bis m-aminophenyl sulfone,3-aminophenyl-sulfone,3,3'-diaminophenyl sulfone,3,3'-sulfonylbis aniline,sulfone, bis m-aminophenyl PubChem CID: 11741 IUPAC Name: 3-(3-aminophenyl)sulfonylaniline SMILES: NC1=CC(=CC=C1)S(=O)(=O)C1=CC(N)=CC=C1
| PubChem CID | 11741 |
|---|---|
| CAS | 599-61-1 |
| Molecular Weight (g/mol) | 248.30 |
| MDL Number | MFCD00007792 |
| SMILES | NC1=CC(=CC=C1)S(=O)(=O)C1=CC(N)=CC=C1 |
| Synonym | 3,3'-sulfonyldianiline,3,3'-diaminodiphenyl sulfone,3-aminophenyl sulfone,benzenamine, 3,3'-sulfonylbis,3,3'-sulphonyldianiline,bis m-aminophenyl sulfone,3-aminophenyl-sulfone,3,3'-diaminophenyl sulfone,3,3'-sulfonylbis aniline,sulfone, bis m-aminophenyl |
| IUPAC Name | 3-(3-aminophenyl)sulfonylaniline |
| InChI Key | LJGHYPLBDBRCRZ-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O2S |
N-(Diphenylmethylene)glycine tert-butyl ester, 98%
CAS: 81477-94-3 Molecular Formula: C19H21NO2 Molecular Weight (g/mol): 295.38 MDL Number: MFCD00134280 InChI Key: YSHDPXQDVKNPKA-UHFFFAOYSA-N Synonym: n-diphenylmethylene glycine tert-butyl ester,diphenylmethylene-glycine t-butyl ester,tert-butyl 2-diphenylmethylene amino acetate,n-diphenylmethylene glycerine tert-butyl ester,tert-butyl 2-diphenylmethyleneamino acetate,diphenylmethyleneamino acetic acid tert-butyl ester,tert-butyl diphenylmethyleneamino acetate,n-diphenylmethylene glycinetert-butylester,tert-butyl 2-benzhydrylideneamino acetate,glycine, n-diphenylmethylene-, 1,1-dimethylethyl ester PubChem CID: 688171 IUPAC Name: tert-butyl 2-(benzhydrylideneamino)acetate SMILES: CC(C)(C)OC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2
| PubChem CID | 688171 |
|---|---|
| CAS | 81477-94-3 |
| Molecular Weight (g/mol) | 295.38 |
| MDL Number | MFCD00134280 |
| SMILES | CC(C)(C)OC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2 |
| Synonym | n-diphenylmethylene glycine tert-butyl ester,diphenylmethylene-glycine t-butyl ester,tert-butyl 2-diphenylmethylene amino acetate,n-diphenylmethylene glycerine tert-butyl ester,tert-butyl 2-diphenylmethyleneamino acetate,diphenylmethyleneamino acetic acid tert-butyl ester,tert-butyl diphenylmethyleneamino acetate,n-diphenylmethylene glycinetert-butylester,tert-butyl 2-benzhydrylideneamino acetate,glycine, n-diphenylmethylene-, 1,1-dimethylethyl ester |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)acetate |
| InChI Key | YSHDPXQDVKNPKA-UHFFFAOYSA-N |
| Molecular Formula | C19H21NO2 |
Ethyl 3-bromobenzoate, 98+%
CAS: 24398-88-7 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.073 MDL Number: MFCD00013529 InChI Key: QAUASTLEZAPQTB-UHFFFAOYSA-N PubChem CID: 90488 IUPAC Name: ethyl 3-bromobenzoate SMILES: CCOC(=O)C1=CC(=CC=C1)Br
| PubChem CID | 90488 |
|---|---|
| CAS | 24398-88-7 |
| Molecular Weight (g/mol) | 229.073 |
| MDL Number | MFCD00013529 |
| SMILES | CCOC(=O)C1=CC(=CC=C1)Br |
| IUPAC Name | ethyl 3-bromobenzoate |
| InChI Key | QAUASTLEZAPQTB-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
2,3,4-Trifluorobenzoic acid, 98%
CAS: 61079-72-9 Molecular Formula: C7H3F3O2 Molecular Weight (g/mol): 176.09 MDL Number: MFCD00061232 InChI Key: WEPXLRANFJEOFZ-UHFFFAOYSA-N Synonym: 2,3,4-trifluorobenzoicacid,pubchem1345,acmc-209mos,ksc354m6t,2,3 4-trifluorobenzoic acid,2,3,4-trifluoro-benzoic acid,rarechem al bo 0257,timtec-bb sbb006557,attercop-chm at111721,buttpark 30\01-45 PubChem CID: 302932 IUPAC Name: 2,3,4-trifluorobenzoic acid SMILES: OC(=O)C1=CC=C(F)C(F)=C1F
| PubChem CID | 302932 |
|---|---|
| CAS | 61079-72-9 |
| Molecular Weight (g/mol) | 176.09 |
| MDL Number | MFCD00061232 |
| SMILES | OC(=O)C1=CC=C(F)C(F)=C1F |
| Synonym | 2,3,4-trifluorobenzoicacid,pubchem1345,acmc-209mos,ksc354m6t,2,3 4-trifluorobenzoic acid,2,3,4-trifluoro-benzoic acid,rarechem al bo 0257,timtec-bb sbb006557,attercop-chm at111721,buttpark 30\01-45 |
| IUPAC Name | 2,3,4-trifluorobenzoic acid |
| InChI Key | WEPXLRANFJEOFZ-UHFFFAOYSA-N |
| Molecular Formula | C7H3F3O2 |
4-Fluoro-2-methoxybenzoic acid, 99%
CAS: 395-82-4 Molecular Formula: C8H7FO3 Molecular Weight (g/mol): 170.14 MDL Number: MFCD00673010 InChI Key: UUQDNAPKWPKHMK-UHFFFAOYSA-N Synonym: 2-methoxy-4-fluorobenzoic acid,4-fluoro-2-methoxy-benzoic acid,4-fluoro-o-anisic acid,benzoic acid, 4-fluoro-2-methoxy,pubchem4969,acmc-209j6b,ksc494s1h,4-fluoro-2-methoxybenzoicacid,rarechem al be 1023,4-fluoro-2-methoxy benzoic acid PubChem CID: 2774545 IUPAC Name: 4-fluoro-2-methoxybenzoic acid SMILES: COC1=CC(F)=CC=C1C(O)=O
| PubChem CID | 2774545 |
|---|---|
| CAS | 395-82-4 |
| Molecular Weight (g/mol) | 170.14 |
| MDL Number | MFCD00673010 |
| SMILES | COC1=CC(F)=CC=C1C(O)=O |
| Synonym | 2-methoxy-4-fluorobenzoic acid,4-fluoro-2-methoxy-benzoic acid,4-fluoro-o-anisic acid,benzoic acid, 4-fluoro-2-methoxy,pubchem4969,acmc-209j6b,ksc494s1h,4-fluoro-2-methoxybenzoicacid,rarechem al be 1023,4-fluoro-2-methoxy benzoic acid |
| IUPAC Name | 4-fluoro-2-methoxybenzoic acid |
| InChI Key | UUQDNAPKWPKHMK-UHFFFAOYSA-N |
| Molecular Formula | C8H7FO3 |
Methyl 4-fluoro-2-methylbenzoate, 98%
CAS: 174403-69-1 Molecular Formula: C9H9FO2 Molecular Weight (g/mol): 168.17 MDL Number: MFCD06203790 InChI Key: ZQFCTCYDRQFPBU-UHFFFAOYSA-N Synonym: benzoic acid, 4-fluoro-2-methyl-, methyl ester,4-fluoro-2-methylbenzoic acid methyl ester,rarechem al bf 0506,methyl=4-fluoro-2-methylbenzoate,4-fluoro-2-methyl benzoic acid methyl ester,4-fluoro-2-methyl-benzoic acid methyl ester,benzoic acid,4-fluoro-2-methyl-,methyl ester PubChem CID: 2782181 IUPAC Name: methyl 4-fluoro-2-methylbenzoate SMILES: COC(=O)C1=C(C)C=C(F)C=C1
| PubChem CID | 2782181 |
|---|---|
| CAS | 174403-69-1 |
| Molecular Weight (g/mol) | 168.17 |
| MDL Number | MFCD06203790 |
| SMILES | COC(=O)C1=C(C)C=C(F)C=C1 |
| Synonym | benzoic acid, 4-fluoro-2-methyl-, methyl ester,4-fluoro-2-methylbenzoic acid methyl ester,rarechem al bf 0506,methyl=4-fluoro-2-methylbenzoate,4-fluoro-2-methyl benzoic acid methyl ester,4-fluoro-2-methyl-benzoic acid methyl ester,benzoic acid,4-fluoro-2-methyl-,methyl ester |
| IUPAC Name | methyl 4-fluoro-2-methylbenzoate |
| InChI Key | ZQFCTCYDRQFPBU-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO2 |