Benzene and substituted derivatives
Filtered Search Results
| CAS | 11-8-4940 |
|---|---|
| Molecular Weight (g/mol) | 140.14 |
| Molecular Formula | C7H8O3 |
Ethyl 4-hydroxybenzoate, 99%
CAS: 120-47-8 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00002353 InChI Key: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC Name: ethyl 4-hydroxybenzoate SMILES: CCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 8434 |
|---|---|
| CAS | 120-47-8 |
| Molecular Weight (g/mol) | 166.18 |
| ChEBI | CHEBI:86616 |
| MDL Number | MFCD00002353 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| IUPAC Name | ethyl 4-hydroxybenzoate |
| InChI Key | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
2-Chlorophenylacetonitrile, 98+%
CAS: 2856-63-5 Molecular Formula: C8H6ClN Molecular Weight (g/mol): 151.593 MDL Number: MFCD00001898 InChI Key: MRDUURPIPLIGQX-UHFFFAOYSA-N Synonym: 2-chlorobenzyl cyanide,2-chlorophenylacetonitrile,2-2-chlorophenyl acetonitrile,o-chlorobenzyl cyanide,benzeneacetonitrile, 2-chloro,2-chlorobenzeneacetonitrile,2-chlorobenzylcyanide,2-chlorophenyl acetonitrile,o-chlorophenyl acetonitrile,acetonitrile, o-chlorophenyl PubChem CID: 76112 IUPAC Name: 2-(2-chlorophenyl)acetonitrile SMILES: C1=CC=C(C(=C1)CC#N)Cl
| PubChem CID | 76112 |
|---|---|
| CAS | 2856-63-5 |
| Molecular Weight (g/mol) | 151.593 |
| MDL Number | MFCD00001898 |
| SMILES | C1=CC=C(C(=C1)CC#N)Cl |
| Synonym | 2-chlorobenzyl cyanide,2-chlorophenylacetonitrile,2-2-chlorophenyl acetonitrile,o-chlorobenzyl cyanide,benzeneacetonitrile, 2-chloro,2-chlorobenzeneacetonitrile,2-chlorobenzylcyanide,2-chlorophenyl acetonitrile,o-chlorophenyl acetonitrile,acetonitrile, o-chlorophenyl |
| IUPAC Name | 2-(2-chlorophenyl)acetonitrile |
| InChI Key | MRDUURPIPLIGQX-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClN |
3-Bromoanisole, 98+%
CAS: 2398-37-0 Molecular Formula: C7H7BrO Molecular Weight (g/mol): 187.04 MDL Number: MFCD00000081 InChI Key: PLDWAJLZAAHOGG-UHFFFAOYSA-N Synonym: 3-bromoanisole,m-bromoanisole,3-methoxybromobenzene,3-bromo anisole,m-bromomethoxybenzene,benzene, 1-bromo-3-methoxy,anisole, m-bromo,3-methoxy-1-bromobenzene,m-methoxybromobenzene,meta-bromoanisole PubChem CID: 16971 IUPAC Name: 1-bromo-3-methoxybenzene SMILES: COC1=CC=CC(Br)=C1
| PubChem CID | 16971 |
|---|---|
| CAS | 2398-37-0 |
| Molecular Weight (g/mol) | 187.04 |
| MDL Number | MFCD00000081 |
| SMILES | COC1=CC=CC(Br)=C1 |
| Synonym | 3-bromoanisole,m-bromoanisole,3-methoxybromobenzene,3-bromo anisole,m-bromomethoxybenzene,benzene, 1-bromo-3-methoxy,anisole, m-bromo,3-methoxy-1-bromobenzene,m-methoxybromobenzene,meta-bromoanisole |
| IUPAC Name | 1-bromo-3-methoxybenzene |
| InChI Key | PLDWAJLZAAHOGG-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrO |
Phenylhydrazine, 97%
CAS: 100-63-0 Molecular Formula: C6H8N2 Molecular Weight (g/mol): 108.14 MDL Number: MFCD00007573 InChI Key: HKOOXMFOFWEVGF-UHFFFAOYSA-N Synonym: hydrazinobenzene,hydrazine, phenyl,phenylhydrazin,monophenylhydrazine,phenyl hydrazine,1-phenylhydrazine,hydrazine-benzene,fenilidrazina,fenylhydrazine,fenylhydrazine dutch PubChem CID: 7516 ChEBI: CHEBI:27924 IUPAC Name: phenylhydrazine SMILES: NNC1=CC=CC=C1
| PubChem CID | 7516 |
|---|---|
| CAS | 100-63-0 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:27924 |
| MDL Number | MFCD00007573 |
| SMILES | NNC1=CC=CC=C1 |
| Synonym | hydrazinobenzene,hydrazine, phenyl,phenylhydrazin,monophenylhydrazine,phenyl hydrazine,1-phenylhydrazine,hydrazine-benzene,fenilidrazina,fenylhydrazine,fenylhydrazine dutch |
| IUPAC Name | phenylhydrazine |
| InChI Key | HKOOXMFOFWEVGF-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2 |
p-Toluic Acid 98.0+%, TCI America™
CAS: 99-94-5 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002565 InChI Key: LPNBBFKOUUSUDB-UHFFFAOYSA-N Synonym: p-toluic acid,4-toluic acid,crithminic acid,p-methylbenzoic acid,p-toluylic acid,benzoic acid, 4-methyl,p-carboxytoluene,para-toluic acid,4-methyl-benzoic acid,toluenecarboxylic acid PubChem CID: 7470 ChEBI: CHEBI:36635 IUPAC Name: 4-methylbenzoic acid SMILES: CC1=CC=C(C=C1)C(O)=O
| PubChem CID | 7470 |
|---|---|
| CAS | 99-94-5 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:36635 |
| MDL Number | MFCD00002565 |
| SMILES | CC1=CC=C(C=C1)C(O)=O |
| Synonym | p-toluic acid,4-toluic acid,crithminic acid,p-methylbenzoic acid,p-toluylic acid,benzoic acid, 4-methyl,p-carboxytoluene,para-toluic acid,4-methyl-benzoic acid,toluenecarboxylic acid |
| IUPAC Name | 4-methylbenzoic acid |
| InChI Key | LPNBBFKOUUSUDB-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
Triphenylphosphine 95.0+%, TCI America™
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
| Molecular Weight (g/mol) | 407.99 |
|---|---|
| ChEBI | CHEBI:41688 |
| Grade | ACS Reagent |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |
| Merck Index | 15,443 |
| InChI Key | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| PubChem CID | 11057 |
| CAS | 90-94-8 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER |
| Health Hazard 2 | GHS H Statement Very toxic to aquatic life with long lasting effects. Harmful if swallowed. Causes serious eye damage. Suspected of causing cancer. |
| Solubility Information | Solubility in water: 16g/L (25°C). Other solubilities: soluble in chloroform,1g/10 mL alcohol,1g/15 mL glycerin,practically insoluble in ether |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | crystal violet,gentian violet,basic violet 3,methylrosaniline chloride,aniline violet,hexamethyl violet,gentiaverm,hexamethylpararosaniline chloride,pyoktanin,adergon |
| IUPAC Name | [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| Molecular Formula | C25H30ClN3 |
| EINECS Number | 208-953-6 |
| Formula Weight | 407.99 |
| Melting Point | 173°C |
Benzyl bromide, 98%
CAS: 100-39-0 MDL Number: MFCD00000172 InChI Key: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC Name: bromomethylbenzene SMILES: C1=CC=C(C=C1)CBr
| PubChem CID | 7498 |
|---|---|
| CAS | 100-39-0 |
| ChEBI | CHEBI:59858 |
| MDL Number | MFCD00000172 |
| SMILES | C1=CC=C(C=C1)CBr |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
| IUPAC Name | bromomethylbenzene |
| InChI Key | AGEZXYOZHKGVCM-UHFFFAOYSA-N |
trans-beta-Nitrostyrene, 97+%
CAS: 5153-67-3 Molecular Formula: C8H7NO2 Molecular Weight (g/mol): 149.15 MDL Number: MFCD00007402 InChI Key: PIAOLBVUVDXHHL-VOTSOKGWSA-N Synonym: trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl PubChem CID: 5284459 IUPAC Name: [(E)-2-nitroethenyl]benzene SMILES: [O-][N+](=O)\C=C\C1=CC=CC=C1
| PubChem CID | 5284459 |
|---|---|
| CAS | 5153-67-3 |
| Molecular Weight (g/mol) | 149.15 |
| MDL Number | MFCD00007402 |
| SMILES | [O-][N+](=O)\C=C\C1=CC=CC=C1 |
| Synonym | trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl |
| IUPAC Name | [(E)-2-nitroethenyl]benzene |
| InChI Key | PIAOLBVUVDXHHL-VOTSOKGWSA-N |
| Molecular Formula | C8H7NO2 |
3-Fluorobenzyl alcohol, 98%
CAS: 456-47-3 Molecular Formula: C7H7FO Molecular Weight (g/mol): 126.13 MDL Number: MFCD00004631 InChI Key: QDHRSLFSDGCJFX-UHFFFAOYSA-N Synonym: 3-fluorobenzyl alcohol,3-fluorophenyl methanol,m-fluorobenzyl alcohol,benzenemethanol, 3-fluoro,3-fluorobenzylalcohol,3-fluorobenzylic alcohol,benzyl alcohol, m-fluoro,3-fluorophenyl methan-1-ol,3-florobenzyl alcohol,pubchem3486 PubChem CID: 68008 IUPAC Name: (3-fluorophenyl)methanol SMILES: C1=CC(=CC(=C1)F)CO
| PubChem CID | 68008 |
|---|---|
| CAS | 456-47-3 |
| Molecular Weight (g/mol) | 126.13 |
| MDL Number | MFCD00004631 |
| SMILES | C1=CC(=CC(=C1)F)CO |
| Synonym | 3-fluorobenzyl alcohol,3-fluorophenyl methanol,m-fluorobenzyl alcohol,benzenemethanol, 3-fluoro,3-fluorobenzylalcohol,3-fluorobenzylic alcohol,benzyl alcohol, m-fluoro,3-fluorophenyl methan-1-ol,3-florobenzyl alcohol,pubchem3486 |
| IUPAC Name | (3-fluorophenyl)methanol |
| InChI Key | QDHRSLFSDGCJFX-UHFFFAOYSA-N |
| Molecular Formula | C7H7FO |
alpha,alpha,alpha-Trifluoro-m-cresol, 98+%
CAS: 98-17-9 Molecular Formula: C7H5F3O Molecular Weight (g/mol): 162.11 MDL Number: MFCD00002299 InChI Key: UGEJOEBBMPOJMT-UHFFFAOYSA-N Synonym: 3-trifluoromethyl phenol,3-hydroxybenzotrifluoride,m-trifluoromethylphenol,m-hydroxybenzotrifluoride,phenol, 3-trifluoromethyl,m-trifluoromethyl phenol,alpha,alpha,alpha-trifluoro-m-cresol,a,a,a-trifluoro-m-cresol PubChem CID: 7376 IUPAC Name: 3-(trifluoromethyl)phenol SMILES: C1=CC(=CC(=C1)O)C(F)(F)F
| PubChem CID | 7376 |
|---|---|
| CAS | 98-17-9 |
| Molecular Weight (g/mol) | 162.11 |
| MDL Number | MFCD00002299 |
| SMILES | C1=CC(=CC(=C1)O)C(F)(F)F |
| Synonym | 3-trifluoromethyl phenol,3-hydroxybenzotrifluoride,m-trifluoromethylphenol,m-hydroxybenzotrifluoride,phenol, 3-trifluoromethyl,m-trifluoromethyl phenol,alpha,alpha,alpha-trifluoro-m-cresol,a,a,a-trifluoro-m-cresol |
| IUPAC Name | 3-(trifluoromethyl)phenol |
| InChI Key | UGEJOEBBMPOJMT-UHFFFAOYSA-N |
| Molecular Formula | C7H5F3O |
2-Aminoterephthalic acid, 99%
CAS: 10312-55-7 Molecular Formula: C8H5NO4 Molecular Weight (g/mol): 179.13 MDL Number: MFCD00134536 InChI Key: GPNNOCMCNFXRAO-UHFFFAOYSA-L Synonym: aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 PubChem CID: 2724822 IUPAC Name: 2-aminoterephthalic acid SMILES: NC1=CC(=CC=C1C([O-])=O)C([O-])=O
| PubChem CID | 2724822 |
|---|---|
| CAS | 10312-55-7 |
| Molecular Weight (g/mol) | 179.13 |
| MDL Number | MFCD00134536 |
| SMILES | NC1=CC(=CC=C1C([O-])=O)C([O-])=O |
| Synonym | aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 |
| IUPAC Name | 2-aminoterephthalic acid |
| InChI Key | GPNNOCMCNFXRAO-UHFFFAOYSA-L |
| Molecular Formula | C8H5NO4 |
Phenylpyruvic acid, sodium salt monohydrate, 98%
CAS: 122049-54-1 Molecular Formula: C9H7O3 Molecular Weight (g/mol): 163.15 MDL Number: MFCD00149109 InChI Key: BTNMPGBKDVTSJY-UHFFFAOYSA-M Synonym: sodium phenylpyruvate monohydrate,sodium 2-oxo-3-phenylpropanoate hydrate,phenylpyruvic acid sodium salt monohydrate,phenylpyruvic acid, sodium salt,sodium hydrate ?-phenylpyruvate,l-phenyl pyruvic acid sodium salt,beta-phenylpyruvic acid sodium salt,acmc-2099lh,phenylpyruvic acid sodium hydrate,beta-phenylpyruvic acid, sodium salt PubChem CID: 23666336 IUPAC Name: sodium;2-oxo-3-phenylpropanoate;hydrate SMILES: [O-]C(=O)C(=O)CC1=CC=CC=C1
| PubChem CID | 23666336 |
|---|---|
| CAS | 122049-54-1 |
| Molecular Weight (g/mol) | 163.15 |
| MDL Number | MFCD00149109 |
| SMILES | [O-]C(=O)C(=O)CC1=CC=CC=C1 |
| Synonym | sodium phenylpyruvate monohydrate,sodium 2-oxo-3-phenylpropanoate hydrate,phenylpyruvic acid sodium salt monohydrate,phenylpyruvic acid, sodium salt,sodium hydrate ?-phenylpyruvate,l-phenyl pyruvic acid sodium salt,beta-phenylpyruvic acid sodium salt,acmc-2099lh,phenylpyruvic acid sodium hydrate,beta-phenylpyruvic acid, sodium salt |
| IUPAC Name | sodium;2-oxo-3-phenylpropanoate;hydrate |
| InChI Key | BTNMPGBKDVTSJY-UHFFFAOYSA-M |
| Molecular Formula | C9H7O3 |
Hexakis(bromomethyl)benzene, 98%
CAS: 3095-73-6 Molecular Formula: C12H12Br6 Molecular Weight (g/mol): 635.652 MDL Number: MFCD00182539 InChI Key: XJOUCILNLRXRTF-UHFFFAOYSA-N Synonym: hexakis bromomethyl benzene,hexa bromomethyl benzene,1,2,3,4,5,6-hexakis bromomethyl benzene,benzene, hexakis bromomethyl,acmc-1aijn,10.14272/xjoucilnlrxrtf-uhfffaoysa-n,benzene,1,2,3,4,5,6-hexakis bromomethyl,doi:10.14272/xjoucilnlrxrtf-uhfffaoysa-n PubChem CID: 76540 IUPAC Name: 1,2,3,4,5,6-hexakis(bromomethyl)benzene SMILES: C(C1=C(C(=C(C(=C1CBr)CBr)CBr)CBr)CBr)Br
| PubChem CID | 76540 |
|---|---|
| CAS | 3095-73-6 |
| Molecular Weight (g/mol) | 635.652 |
| MDL Number | MFCD00182539 |
| SMILES | C(C1=C(C(=C(C(=C1CBr)CBr)CBr)CBr)CBr)Br |
| Synonym | hexakis bromomethyl benzene,hexa bromomethyl benzene,1,2,3,4,5,6-hexakis bromomethyl benzene,benzene, hexakis bromomethyl,acmc-1aijn,10.14272/xjoucilnlrxrtf-uhfffaoysa-n,benzene,1,2,3,4,5,6-hexakis bromomethyl,doi:10.14272/xjoucilnlrxrtf-uhfffaoysa-n |
| IUPAC Name | 1,2,3,4,5,6-hexakis(bromomethyl)benzene |
| InChI Key | XJOUCILNLRXRTF-UHFFFAOYSA-N |
| Molecular Formula | C12H12Br6 |