Benzene and substituted derivatives
Filtered Search Results
3-Chloroperoxybenzoic Acid, 70-75%, balance 3-Chlorobenzoic Acid and water
3-Chloroperoxybenzoic acid, 70-75%, C7H5ClO3, CAS Number-937-14-4, 535-80-8, 7732-18-5 | CAS: 937-14-4 | C7H5ClO3 | 172.56 g/mol
| Linear Formula | ClC6H4CO3H |
|---|---|
| Molecular Weight (g/mol) | 172.56 |
| ChEBI | CHEBI:52091 |
| CAS Min % | 25.0 |
| InChI Key | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| Density | 0.5600g/mL |
| PubChem CID | 70297 |
| Name Note | 70 - 75% |
| Percent Purity | 70-75% |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| RTECS Number | SD9470000 |
| Formula Weight | 172.57 |
| Melting Point | 92.0°C to 94.0°C |
| CAS Max % | 30.0 |
| Color | White |
| Physical Form | Moist Powder |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| Assay Percent Range | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep/Store away from clothing/ combustible materials. IF SWALLOWED: rin |
| MDL Number | MFCD00002127 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. Heating may cause a fire. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid |
| Beilstein | 09,IV,972 |
| Molecular Formula | C7H5ClO3 |
| EINECS Number | 213-322-3 |
| Specific Gravity | 0.56 |
Divinylbenzene, 80%, mixture of isomers, stab. with 1000ppm 4-tert-butylcatechol
CAS: 1321-74-0 Molecular Formula: C10H10 Molecular Weight (g/mol): 130.19 MDL Number: MFCD01778656,MFCD00010654 InChI Key: MYRTYDVEIRVNKP-UHFFFAOYSA-N Synonym: divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb PubChem CID: 66666 IUPAC Name: 1,2-bis(ethenyl)benzene SMILES: C=CC1=CC=CC=C1C=C
| PubChem CID | 66666 |
|---|---|
| CAS | 1321-74-0 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD01778656,MFCD00010654 |
| SMILES | C=CC1=CC=CC=C1C=C |
| Synonym | divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb |
| IUPAC Name | 1,2-bis(ethenyl)benzene |
| InChI Key | MYRTYDVEIRVNKP-UHFFFAOYSA-N |
| Molecular Formula | C10H10 |
Bis(2-ethylhexyl) terephthalate, 97%
CAS: 6422-86-2 Molecular Formula: C24H38O4 Molecular Weight (g/mol): 390.55 MDL Number: MFCD00072256 InChI Key: RWPICVVBGZBXNA-UHFFFAOYSA-N Synonym: bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester PubChem CID: 22932 IUPAC Name: bis(2-ethylhexyl) benzene-1,4-dicarboxylate SMILES: CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC
| PubChem CID | 22932 |
|---|---|
| CAS | 6422-86-2 |
| Molecular Weight (g/mol) | 390.55 |
| MDL Number | MFCD00072256 |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| InChI Key | RWPICVVBGZBXNA-UHFFFAOYSA-N |
| Molecular Formula | C24H38O4 |
Bromobenzene, 99%, pure
CAS: 108-86-1 Molecular Formula: C6H5Br Molecular Weight (g/mol): 157.01 MDL Number: MFCD00000055 InChI Key: QARVLSVVCXYDNA-UHFFFAOYSA-N Synonym: benzene, bromo,monobromobenzene,phenyl bromide,bromo-benzene,1-bromobenzene,phbr,bromo benzene,4-bromobenzene,unii-co4d5j547l,hsdb 47 PubChem CID: 7961 ChEBI: CHEBI:3179 IUPAC Name: bromobenzene SMILES: BrC1=CC=CC=C1
| PubChem CID | 7961 |
|---|---|
| CAS | 108-86-1 |
| Molecular Weight (g/mol) | 157.01 |
| ChEBI | CHEBI:3179 |
| MDL Number | MFCD00000055 |
| SMILES | BrC1=CC=CC=C1 |
| Synonym | benzene, bromo,monobromobenzene,phenyl bromide,bromo-benzene,1-bromobenzene,phbr,bromo benzene,4-bromobenzene,unii-co4d5j547l,hsdb 47 |
| IUPAC Name | bromobenzene |
| InChI Key | QARVLSVVCXYDNA-UHFFFAOYSA-N |
| Molecular Formula | C6H5Br |
Sodium phenoxide, 98%
CAS: 139-02-6 Molecular Formula: C6H5NaO Molecular Weight (g/mol): 116.10 MDL Number: MFCD00013134 InChI Key: NESLWCLHZZISNB-UHFFFAOYSA-M Synonym: sodium phenoxide,sodium phenolate,sodium phenate,phenolate sodium,sodium benzenolate,sodium carbolate,phenol sodium,phenol sodium salt,phenol, sodium salt,naoph PubChem CID: 4445035 ChEBI: CHEBI:52476 SMILES: [Na+].[O-]C1=CC=CC=C1
| PubChem CID | 4445035 |
|---|---|
| CAS | 139-02-6 |
| Molecular Weight (g/mol) | 116.10 |
| ChEBI | CHEBI:52476 |
| MDL Number | MFCD00013134 |
| SMILES | [Na+].[O-]C1=CC=CC=C1 |
| Synonym | sodium phenoxide,sodium phenolate,sodium phenate,phenolate sodium,sodium benzenolate,sodium carbolate,phenol sodium,phenol sodium salt,phenol, sodium salt,naoph |
| InChI Key | NESLWCLHZZISNB-UHFFFAOYSA-M |
| Molecular Formula | C6H5NaO |
Dibenzoyl peroxide, 97% (dry wt.), wet with 25% water
CAS: 94-36-0 Molecular Formula: C14H10O4 Molecular Weight (g/mol): 242.23 MDL Number: MFCD00003071 InChI Key: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC Name: benzoyl benzenecarboperoxoate SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2
| PubChem CID | 7187 |
|---|---|
| CAS | 94-36-0 |
| Molecular Weight (g/mol) | 242.23 |
| ChEBI | CHEBI:82405 |
| MDL Number | MFCD00003071 |
| SMILES | C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
| Synonym | benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide |
| IUPAC Name | benzoyl benzenecarboperoxoate |
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Molecular Formula | C14H10O4 |
m-Tolyl acetate, 97%
CAS: 111072-31-2 Molecular Formula: C22H16N7NaO13S2 Molecular Weight (g/mol): 673.52 MDL Number: MFCD00083517 InChI Key: JACYMBNQPPWQML-UHFFFAOYSA-M Synonym: xtt PubChem CID: 131668615 IUPAC Name: sodium;2-(2-methoxy-4-nitro-5-sulfonatophenyl)-3-(2-methoxy-4-nitro-5-sulfophenyl)-N-phenyltetrazol-3-ium-5-carboximidate SMILES: [Na+].COC1=C(C=C(C(=C1)[N+]([O-])=O)S([O-])(=O)=O)N1N=C(N=[N+]1C1=C(OC)C=C(C(=C1)S([O-])(=O)=O)[N+]([O-])=O)C(=O)NC1=CC=CC=C1
| PubChem CID | 131668615 |
|---|---|
| CAS | 111072-31-2 |
| Molecular Weight (g/mol) | 673.52 |
| MDL Number | MFCD00083517 |
| SMILES | [Na+].COC1=C(C=C(C(=C1)[N+]([O-])=O)S([O-])(=O)=O)N1N=C(N=[N+]1C1=C(OC)C=C(C(=C1)S([O-])(=O)=O)[N+]([O-])=O)C(=O)NC1=CC=CC=C1 |
| Synonym | xtt |
| IUPAC Name | sodium;2-(2-methoxy-4-nitro-5-sulfonatophenyl)-3-(2-methoxy-4-nitro-5-sulfophenyl)-N-phenyltetrazol-3-ium-5-carboximidate |
| InChI Key | JACYMBNQPPWQML-UHFFFAOYSA-M |
| Molecular Formula | C22H16N7NaO13S2 |
Phenylhydrazine Hydrochloride, 99+%
CAS: 59-88-1 Molecular Formula: C6H9ClN2 Molecular Weight (g/mol): 144.60 MDL Number: MFCD00012924 InChI Key: JOVOSQBPPZZESK-UHFFFAOYSA-N Synonym: phenylhydrazine hydrochloride,phenylhydrazinium chloride,phenylhydrazine-hcl,phenylhydrazine monohydrochloride,phenylhydrazine hcl,hydrazine, phenyl-, monohydrochloride,unii-h7qfk49svd,phenylhydrazin hydrochlorid,phenylhydrazine.hcl,ccris 5707 PubChem CID: 60962 IUPAC Name: phenylhydrazine;hydrochloride SMILES: [H+].[Cl-].NNC1=CC=CC=C1
| PubChem CID | 60962 |
|---|---|
| CAS | 59-88-1 |
| Molecular Weight (g/mol) | 144.60 |
| MDL Number | MFCD00012924 |
| SMILES | [H+].[Cl-].NNC1=CC=CC=C1 |
| Synonym | phenylhydrazine hydrochloride,phenylhydrazinium chloride,phenylhydrazine-hcl,phenylhydrazine monohydrochloride,phenylhydrazine hcl,hydrazine, phenyl-, monohydrochloride,unii-h7qfk49svd,phenylhydrazin hydrochlorid,phenylhydrazine.hcl,ccris 5707 |
| IUPAC Name | phenylhydrazine;hydrochloride |
| InChI Key | JOVOSQBPPZZESK-UHFFFAOYSA-N |
| Molecular Formula | C6H9ClN2 |
5,5'-Dithiobis(2-nitrobenzoic acid), 99%
CAS: 69-78-3 Molecular Formula: C14H8N2O8S2 Molecular Weight (g/mol): 396.34 MDL Number: MFCD00007140 InChI Key: KIUMMUBSPKGMOY-UHFFFAOYSA-N Synonym: dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid PubChem CID: 6254 ChEBI: CHEBI:86228 IUPAC Name: 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid SMILES: OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O
| PubChem CID | 6254 |
|---|---|
| CAS | 69-78-3 |
| Molecular Weight (g/mol) | 396.34 |
| ChEBI | CHEBI:86228 |
| MDL Number | MFCD00007140 |
| SMILES | OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
| Synonym | dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid |
| IUPAC Name | 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| InChI Key | KIUMMUBSPKGMOY-UHFFFAOYSA-N |
| Molecular Formula | C14H8N2O8S2 |
o-Tolidine, 98%
CAS: 119-93-7 Molecular Formula: C14H16N2 Molecular Weight (g/mol): 212.296 MDL Number: MFCD00014773 InChI Key: NUIURNJTPRWVAP-UHFFFAOYSA-N Synonym: o-tolidine,3,3'-dimethylbenzidine,orthotolidine,diaminoditolyl,2-tolidine,diaminotolyl,bianisidine,3,3'-tolidine,3,3'-dimethylbiphenyl-4,4'-diamine,4,4'-bi-o-toluidine PubChem CID: 8413 ChEBI: CHEBI:34320 IUPAC Name: 4-(4-amino-3-methylphenyl)-2-methylaniline SMILES: CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N
| PubChem CID | 8413 |
|---|---|
| CAS | 119-93-7 |
| Molecular Weight (g/mol) | 212.296 |
| ChEBI | CHEBI:34320 |
| MDL Number | MFCD00014773 |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
| Synonym | o-tolidine,3,3'-dimethylbenzidine,orthotolidine,diaminoditolyl,2-tolidine,diaminotolyl,bianisidine,3,3'-tolidine,3,3'-dimethylbiphenyl-4,4'-diamine,4,4'-bi-o-toluidine |
| IUPAC Name | 4-(4-amino-3-methylphenyl)-2-methylaniline |
| InChI Key | NUIURNJTPRWVAP-UHFFFAOYSA-N |
| Molecular Formula | C14H16N2 |
p-Anisidine, 99%
CAS: 104-94-9 Molecular Formula: C7H9NO Molecular Weight (g/mol): 123.155 MDL Number: MFCD00007864 InChI Key: BHAAPTBBJKJZER-UHFFFAOYSA-N Synonym: p-anisidine,4-anisidine,4-methoxybenzenamine,4-aminoanisole,p-aminoanisole,para-anisidine,p-methoxyaniline,benzenamine, 4-methoxy,4-methoxybenzeneamine,p-anisylamine PubChem CID: 7732 ChEBI: CHEBI:82388 IUPAC Name: 4-methoxyaniline SMILES: COC1=CC=C(C=C1)N
| PubChem CID | 7732 |
|---|---|
| CAS | 104-94-9 |
| Molecular Weight (g/mol) | 123.155 |
| ChEBI | CHEBI:82388 |
| MDL Number | MFCD00007864 |
| SMILES | COC1=CC=C(C=C1)N |
| Synonym | p-anisidine,4-anisidine,4-methoxybenzenamine,4-aminoanisole,p-aminoanisole,para-anisidine,p-methoxyaniline,benzenamine, 4-methoxy,4-methoxybenzeneamine,p-anisylamine |
| IUPAC Name | 4-methoxyaniline |
| InChI Key | BHAAPTBBJKJZER-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO |
p-Toluenesulfonyl chloride, 98%
CAS: 98-59-9 Molecular Formula: C7H7ClO2S Molecular Weight (g/mol): 190.64 MDL Number: MFCD00007450 InChI Key: YYROPELSRYBVMQ-UHFFFAOYSA-N Synonym: tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride PubChem CID: 7397 IUPAC Name: 4-methylbenzenesulfonyl chloride SMILES: CC1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 7397 |
|---|---|
| CAS | 98-59-9 |
| Molecular Weight (g/mol) | 190.64 |
| MDL Number | MFCD00007450 |
| SMILES | CC1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride |
| IUPAC Name | 4-methylbenzenesulfonyl chloride |
| InChI Key | YYROPELSRYBVMQ-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO2S |
Triphenylphosphine, 99%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
Benzyl bromide, 99%
CAS: 100-39-0 Molecular Formula: C7H7Br Molecular Weight (g/mol): 171.037 MDL Number: MFCD00000172 InChI Key: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC Name: bromomethylbenzene SMILES: C1=CC=C(C=C1)CBr
| PubChem CID | 7498 |
|---|---|
| CAS | 100-39-0 |
| Molecular Weight (g/mol) | 171.037 |
| ChEBI | CHEBI:59858 |
| MDL Number | MFCD00000172 |
| SMILES | C1=CC=C(C=C1)CBr |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
| IUPAC Name | bromomethylbenzene |
| InChI Key | AGEZXYOZHKGVCM-UHFFFAOYSA-N |
| Molecular Formula | C7H7Br |
Diphenyl ether, 99%
CAS: 101-84-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.211 MDL Number: MFCD00003034 InChI Key: USIUVYZYUHIAEV-UHFFFAOYSA-N Synonym: diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl PubChem CID: 7583 ChEBI: CHEBI:39258 IUPAC Name: phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 7583 |
|---|---|
| CAS | 101-84-8 |
| Molecular Weight (g/mol) | 170.211 |
| ChEBI | CHEBI:39258 |
| MDL Number | MFCD00003034 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl |
| IUPAC Name | phenoxybenzene |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |