Benzene and substituted derivatives
Filtered Search Results
Ethyl p-Anisate 99.0+%, TCI America™
CAS: 94-30-4 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00015151 InChI Key: FHUODBDRWMIBQP-UHFFFAOYSA-N Synonym: ethyl p-anisate,ethyl anisate,ethyl p-methoxybenzoate,p-anisic acid, ethyl ester,benzoic acid, 4-methoxy-, ethyl ester,4-methoxybenzoic acid ethyl ester,benzoic acid, p-methoxy-, ethyl ester,ethyl p-anisoate,unii-kj95h2s7nm,p-anisic acid ethyl ester PubChem CID: 60979 IUPAC Name: ethyl 4-methoxybenzoate SMILES: CCOC(=O)C1=CC=C(C=C1)OC
| PubChem CID | 60979 |
|---|---|
| CAS | 94-30-4 |
| Molecular Weight (g/mol) | 180.203 |
| MDL Number | MFCD00015151 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)OC |
| Synonym | ethyl p-anisate,ethyl anisate,ethyl p-methoxybenzoate,p-anisic acid, ethyl ester,benzoic acid, 4-methoxy-, ethyl ester,4-methoxybenzoic acid ethyl ester,benzoic acid, p-methoxy-, ethyl ester,ethyl p-anisoate,unii-kj95h2s7nm,p-anisic acid ethyl ester |
| IUPAC Name | ethyl 4-methoxybenzoate |
| InChI Key | FHUODBDRWMIBQP-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
2,4-Dimethoxybenzoic Acid 99.0+%, TCI America™
CAS: 91-52-1 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.175 MDL Number: MFCD00002434 InChI Key: GPVDHNVGGIAOQT-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethoxy,2,4-dimethoxybenzoicacid,2,4-dimethoxy benzoic acid,2,4-dimethoxybenzoic,pubchem4949,rarechem al bo 0028,2,4-dimethoxy-benzoicaci,2,4 dimethoxybenzoic acid,2.4-dimethoxybenzoic acid,dimethoxybenzoic-2,4 acid PubChem CID: 7052 IUPAC Name: 2,4-dimethoxybenzoic acid SMILES: COC1=CC(=C(C=C1)C(=O)O)OC
| PubChem CID | 7052 |
|---|---|
| CAS | 91-52-1 |
| Molecular Weight (g/mol) | 182.175 |
| MDL Number | MFCD00002434 |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)OC |
| Synonym | benzoic acid, 2,4-dimethoxy,2,4-dimethoxybenzoicacid,2,4-dimethoxy benzoic acid,2,4-dimethoxybenzoic,pubchem4949,rarechem al bo 0028,2,4-dimethoxy-benzoicaci,2,4 dimethoxybenzoic acid,2.4-dimethoxybenzoic acid,dimethoxybenzoic-2,4 acid |
| IUPAC Name | 2,4-dimethoxybenzoic acid |
| InChI Key | GPVDHNVGGIAOQT-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
N-(tert-Butoxycarbonyl)-1,4-phenylenediamine 95.0+%, TCI America™
CAS: 71026-66-9 Molecular Formula: C11H16N2O2 Molecular Weight (g/mol): 208.261 MDL Number: MFCD00043022 InChI Key: WIVYTYZCVWHWSH-UHFFFAOYSA-N Synonym: tert-butyl 4-aminophenyl carbamate,4-tert-butoxycarbonylamino aniline,tert-butyl 4-aminophenylcarbamate,tert-butyl n-4-aminophenyl carbamate,n-boc-p-phenylenediamine,n-boc-1,4-phenylene diamine,n-boc-1,4-phenylenediamine,4-amino-phenyl-carbamic acid tert-butyl ester,tert-butyl4-aminophenylcarbamate,4-t-butyloxycarbonylamino aniline PubChem CID: 688611 IUPAC Name: tert-butyl N-(4-aminophenyl)carbamate SMILES: CC(C)(C)OC(=O)NC1=CC=C(C=C1)N
| PubChem CID | 688611 |
|---|---|
| CAS | 71026-66-9 |
| Molecular Weight (g/mol) | 208.261 |
| MDL Number | MFCD00043022 |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)N |
| Synonym | tert-butyl 4-aminophenyl carbamate,4-tert-butoxycarbonylamino aniline,tert-butyl 4-aminophenylcarbamate,tert-butyl n-4-aminophenyl carbamate,n-boc-p-phenylenediamine,n-boc-1,4-phenylene diamine,n-boc-1,4-phenylenediamine,4-amino-phenyl-carbamic acid tert-butyl ester,tert-butyl4-aminophenylcarbamate,4-t-butyloxycarbonylamino aniline |
| IUPAC Name | tert-butyl N-(4-aminophenyl)carbamate |
| InChI Key | WIVYTYZCVWHWSH-UHFFFAOYSA-N |
| Molecular Formula | C11H16N2O2 |
Potassium p-Toluenethiosulfonate 98.0+%, TCI America™
CAS: 28519-50-8 Molecular Formula: C7H7KO2S2 Molecular Weight (g/mol): 226.349 MDL Number: MFCD00003547 InChI Key: RUDNWZFWWJFUSF-UHFFFAOYSA-M Synonym: p-Toluenethiosulfonic Acid Potassium Salt PubChem CID: 23662126 IUPAC Name: potassium;(4-methylphenyl)-oxido-oxo-sulfanylidene-$l^{6}-sulfane SMILES: CC1=CC=C(C=C1)S(=O)(=S)[O-].[K+]
| PubChem CID | 23662126 |
|---|---|
| CAS | 28519-50-8 |
| Molecular Weight (g/mol) | 226.349 |
| MDL Number | MFCD00003547 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=S)[O-].[K+] |
| Synonym | p-Toluenethiosulfonic Acid Potassium Salt |
| IUPAC Name | potassium;(4-methylphenyl)-oxido-oxo-sulfanylidene-$l^{6}-sulfane |
| InChI Key | RUDNWZFWWJFUSF-UHFFFAOYSA-M |
| Molecular Formula | C7H7KO2S2 |
4-(Trifluoromethyl)benzenesulfonyl Chloride 98.0+%, TCI America™
CAS: 2991-42-6 Molecular Formula: C7H4ClF3O2S Molecular Weight (g/mol): 244.61 MDL Number: MFCD00042422 InChI Key: OZDCZHDOIBUGAJ-UHFFFAOYSA-N Synonym: 4-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzene-1-sulfonyl chloride,4-trifluoromethyl benzene sulfonyl chloride,p-trifluoromethylbenzenesulfonyl chloride,4-trifluoromethyl benzenesulfonylchloride,4-trifluoromethyl-benzenesulfonyl chloride,4-trifluoromethyl phenylsulfonyl chloride,p-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzenesulphonyl chloride,benzenesulfonyl chloride, 4-trifluoromethyl PubChem CID: 2777399 IUPAC Name: 4-(trifluoromethyl)benzene-1-sulfonyl chloride SMILES: FC(F)(F)C1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 2777399 |
|---|---|
| CAS | 2991-42-6 |
| Molecular Weight (g/mol) | 244.61 |
| MDL Number | MFCD00042422 |
| SMILES | FC(F)(F)C1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | 4-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzene-1-sulfonyl chloride,4-trifluoromethyl benzene sulfonyl chloride,p-trifluoromethylbenzenesulfonyl chloride,4-trifluoromethyl benzenesulfonylchloride,4-trifluoromethyl-benzenesulfonyl chloride,4-trifluoromethyl phenylsulfonyl chloride,p-trifluoromethyl benzenesulfonyl chloride,4-trifluoromethyl benzenesulphonyl chloride,benzenesulfonyl chloride, 4-trifluoromethyl |
| IUPAC Name | 4-(trifluoromethyl)benzene-1-sulfonyl chloride |
| InChI Key | OZDCZHDOIBUGAJ-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClF3O2S |
3,3',5,5'-Tetramethylbenzidine 98.0+%, TCI America™
CAS: 54827-17-7 Molecular Formula: C16H20N2 Molecular Weight (g/mol): 240.35 MDL Number: MFCD00007748 InChI Key: UAIUNKRWKOVEES-UHFFFAOYSA-N Synonym: 3,3',5,5'-tetramethylbenzidine,3,3',5,5'-tetramethyl-1,1'-biphenyl-4,4'-diamine,3,5,3',5'-tetramethylbenzidine,tmb,3,3',5,5'-tetramethyl benzidine,tmb substrate,bm blue,ccris 4727,tmb plus,tmb, insoluble PubChem CID: 41206 IUPAC Name: 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline SMILES: CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)N)C
| PubChem CID | 41206 |
|---|---|
| CAS | 54827-17-7 |
| Molecular Weight (g/mol) | 240.35 |
| MDL Number | MFCD00007748 |
| SMILES | CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)N)C |
| Synonym | 3,3',5,5'-tetramethylbenzidine,3,3',5,5'-tetramethyl-1,1'-biphenyl-4,4'-diamine,3,5,3',5'-tetramethylbenzidine,tmb,3,3',5,5'-tetramethyl benzidine,tmb substrate,bm blue,ccris 4727,tmb plus,tmb, insoluble |
| IUPAC Name | 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline |
| InChI Key | UAIUNKRWKOVEES-UHFFFAOYSA-N |
| Molecular Formula | C16H20N2 |
1,2,3,4-Tetrafluorobenzene 98.0+%, TCI America™
CAS: 551-62-2 Molecular Formula: C6H2F4 Molecular Weight (g/mol): 150.076 MDL Number: MFCD00000285 InChI Key: SOZFIIXUNAKEJP-UHFFFAOYSA-N Synonym: tetrafluorobenzene,1,2,3,4-tetrafluoro-benzene,unii-66365s2rfq,benzene, 1,2,3,4-tetrafluoro,2,3,4,5-tetrafluorobenzene,benzene, tetrafluoro,pubchem1061,acmc-1ao1z,1,3,4-tetrafluorobenzene PubChem CID: 11084 IUPAC Name: 1,2,3,4-tetrafluorobenzene SMILES: C1=CC(=C(C(=C1F)F)F)F
| PubChem CID | 11084 |
|---|---|
| CAS | 551-62-2 |
| Molecular Weight (g/mol) | 150.076 |
| MDL Number | MFCD00000285 |
| SMILES | C1=CC(=C(C(=C1F)F)F)F |
| Synonym | tetrafluorobenzene,1,2,3,4-tetrafluoro-benzene,unii-66365s2rfq,benzene, 1,2,3,4-tetrafluoro,2,3,4,5-tetrafluorobenzene,benzene, tetrafluoro,pubchem1061,acmc-1ao1z,1,3,4-tetrafluorobenzene |
| IUPAC Name | 1,2,3,4-tetrafluorobenzene |
| InChI Key | SOZFIIXUNAKEJP-UHFFFAOYSA-N |
| Molecular Formula | C6H2F4 |
p-Tolyldiethanolamine 96.0+%, TCI America™
CAS: 3077-12-1 Molecular Formula: C11H17NO2 Molecular Weight (g/mol): 195.26 MDL Number: MFCD00020580 InChI Key: JUVSRZCUMWZBFK-UHFFFAOYSA-N Synonym: N,N-Bis(2-hydroxyethyl)-p-toluidine, 2,2′C-(4-Methylphenylimino)diethanol, 2,2′C-(p-Tolylimino)diethanol PubChem CID: 76497 IUPAC Name: 2-[N-(2-hydroxyethyl)-4-methylanilino]ethanol SMILES: CC1=CC=C(C=C1)N(CCO)CCO
| PubChem CID | 76497 |
|---|---|
| CAS | 3077-12-1 |
| Molecular Weight (g/mol) | 195.26 |
| MDL Number | MFCD00020580 |
| SMILES | CC1=CC=C(C=C1)N(CCO)CCO |
| Synonym | N,N-Bis(2-hydroxyethyl)-p-toluidine, 2,2′C-(4-Methylphenylimino)diethanol, 2,2′C-(p-Tolylimino)diethanol |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-methylanilino]ethanol |
| InChI Key | JUVSRZCUMWZBFK-UHFFFAOYSA-N |
| Molecular Formula | C11H17NO2 |
(-)-Di-p-anisoyl-L-tartaric Acid 97.0+%, TCI America™
CAS: 50583-51-2 Molecular Formula: C20H18O10 Molecular Weight (g/mol): 418.354 MDL Number: MFCD02682986 InChI Key: KWWCVCFQHGKOMI-HZPDHXFCSA-N Synonym: (-)-Bis(4-methoxybenzoyl)-L-tartaric Acid PubChem CID: 11704418 IUPAC Name: (2R,3R)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid SMILES: COC1=CC=C(C=C1)C(=O)OC(C(C(=O)O)OC(=O)C2=CC=C(C=C2)OC)C(=O)O
| PubChem CID | 11704418 |
|---|---|
| CAS | 50583-51-2 |
| Molecular Weight (g/mol) | 418.354 |
| MDL Number | MFCD02682986 |
| SMILES | COC1=CC=C(C=C1)C(=O)OC(C(C(=O)O)OC(=O)C2=CC=C(C=C2)OC)C(=O)O |
| Synonym | (-)-Bis(4-methoxybenzoyl)-L-tartaric Acid |
| IUPAC Name | (2R,3R)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid |
| InChI Key | KWWCVCFQHGKOMI-HZPDHXFCSA-N |
| Molecular Formula | C20H18O10 |
2-Bromo-5-methoxybenzoic Acid 98.0+%, TCI America™
CAS: 22921-68-2 Molecular Formula: C8H7BrO3 Molecular Weight (g/mol): 231.045 MDL Number: MFCD00020214 InChI Key: ODHJOROUCITYNF-UHFFFAOYSA-N Synonym: 6-bromo-m-anisic acid,2-bromo-5-methoxybenzoicacid,benzoic acid, 2-bromo-5-methoxy,5-methoxy-2-bromobenzoic acid,2-bromo-5-methoxy-benzoic acid,pubchem2674,acmc-1clk6,ksc205k0l,rarechem al be 1111,2-bromo-5-methoxy benzoic acid PubChem CID: 89906 IUPAC Name: 2-bromo-5-methoxybenzoic acid SMILES: COC1=CC(=C(C=C1)Br)C(=O)O
| PubChem CID | 89906 |
|---|---|
| CAS | 22921-68-2 |
| Molecular Weight (g/mol) | 231.045 |
| MDL Number | MFCD00020214 |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)O |
| Synonym | 6-bromo-m-anisic acid,2-bromo-5-methoxybenzoicacid,benzoic acid, 2-bromo-5-methoxy,5-methoxy-2-bromobenzoic acid,2-bromo-5-methoxy-benzoic acid,pubchem2674,acmc-1clk6,ksc205k0l,rarechem al be 1111,2-bromo-5-methoxy benzoic acid |
| IUPAC Name | 2-bromo-5-methoxybenzoic acid |
| InChI Key | ODHJOROUCITYNF-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO3 |
Ethyl Vanillate 98.0+%, TCI America™
CAS: 617-05-0 Molecular Formula: C10H12O4 Molecular Weight (g/mol): 196.20 MDL Number: MFCD00017269 InChI Key: MWAYRGBWOVHDDZ-UHFFFAOYSA-N Synonym: ethyl vanillate,vanillic acid, ethyl ester,4-hydroxy-3-methoxybenzoic acid ethyl ester,benzoic acid, 4-hydroxy-3-methoxy-, ethyl ester,unii-v38jk4z93o,3-methoxy-4-hydroxybenzoic acid, ethyl ester,m-anisic acid, 4-hydroxy-, ethyl ester,vanilicacidethylester,ethyl 4-hydroxy-3-methoxy-benzoate,ethylvanillate PubChem CID: 12038 IUPAC Name: ethyl 4-hydroxy-3-methoxybenzoate SMILES: CCOC(=O)C1=CC=C(O)C(OC)=C1
| PubChem CID | 12038 |
|---|---|
| CAS | 617-05-0 |
| Molecular Weight (g/mol) | 196.20 |
| MDL Number | MFCD00017269 |
| SMILES | CCOC(=O)C1=CC=C(O)C(OC)=C1 |
| Synonym | ethyl vanillate,vanillic acid, ethyl ester,4-hydroxy-3-methoxybenzoic acid ethyl ester,benzoic acid, 4-hydroxy-3-methoxy-, ethyl ester,unii-v38jk4z93o,3-methoxy-4-hydroxybenzoic acid, ethyl ester,m-anisic acid, 4-hydroxy-, ethyl ester,vanilicacidethylester,ethyl 4-hydroxy-3-methoxy-benzoate,ethylvanillate |
| IUPAC Name | ethyl 4-hydroxy-3-methoxybenzoate |
| InChI Key | MWAYRGBWOVHDDZ-UHFFFAOYSA-N |
| Molecular Formula | C10H12O4 |
Vanillic Acid 98.0+%, TCI America™
CAS: 121-34-6 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002551 InChI Key: WKOLLVMJNQIZCI-UHFFFAOYSA-N Synonym: vanillic acid,acide vanillique,p-vanillic acid,benzoic acid, 4-hydroxy-3-methoxy,3-methoxy-4-hydroxybenzoic acid,vanillate,m-anisic acid, 4-hydroxy,protocatechuic acid, 3-methyl ester,4-hydroxy-3-methoxy-benzoic acid,unii-gm8q3jm2y8 PubChem CID: 8468 ChEBI: CHEBI:30816 IUPAC Name: 4-hydroxy-3-methoxybenzoic acid SMILES: COC1=CC(=CC=C1O)C(O)=O
| PubChem CID | 8468 |
|---|---|
| CAS | 121-34-6 |
| Molecular Weight (g/mol) | 168.15 |
| ChEBI | CHEBI:30816 |
| MDL Number | MFCD00002551 |
| SMILES | COC1=CC(=CC=C1O)C(O)=O |
| Synonym | vanillic acid,acide vanillique,p-vanillic acid,benzoic acid, 4-hydroxy-3-methoxy,3-methoxy-4-hydroxybenzoic acid,vanillate,m-anisic acid, 4-hydroxy,protocatechuic acid, 3-methyl ester,4-hydroxy-3-methoxy-benzoic acid,unii-gm8q3jm2y8 |
| IUPAC Name | 4-hydroxy-3-methoxybenzoic acid |
| InChI Key | WKOLLVMJNQIZCI-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
3,5-Dimethoxybenzoic Acid 98.0+%, TCI America™
CAS: 1132-21-4 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002502 InChI Key: IWPZKOJSYQZABD-UHFFFAOYSA-N Synonym: benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy PubChem CID: 14332 IUPAC Name: 3,5-dimethoxybenzoic acid SMILES: COC1=CC(=CC(OC)=C1)C(O)=O
| PubChem CID | 14332 |
|---|---|
| CAS | 1132-21-4 |
| Molecular Weight (g/mol) | 182.18 |
| MDL Number | MFCD00002502 |
| SMILES | COC1=CC(=CC(OC)=C1)C(O)=O |
| Synonym | benzoic acid, 3,5-dimethoxy,unii-38my78eckk,3,5-dimethoxy benzoic acid,38my78eckk,pubchem3121,3,5-dimethoxybenzoicacid,acmc-1c4zl,3,5-dimethoxy-benzoic acid,ksc176m0p,benzoicacid, 3,5-dimethoxy |
| IUPAC Name | 3,5-dimethoxybenzoic acid |
| InChI Key | IWPZKOJSYQZABD-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
2,3,6-Trimethoxybenzoic Acid 98.0+%, TCI America™
CAS: 60241-74-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.201 MDL Number: MFCD00092587 InChI Key: NSKSXYUOXAQHCH-UHFFFAOYSA-N PubChem CID: 611400 IUPAC Name: 2,3,6-trimethoxybenzoic acid SMILES: COC1=C(C(=C(C=C1)OC)OC)C(=O)O
| PubChem CID | 611400 |
|---|---|
| CAS | 60241-74-9 |
| Molecular Weight (g/mol) | 212.201 |
| MDL Number | MFCD00092587 |
| SMILES | COC1=C(C(=C(C=C1)OC)OC)C(=O)O |
| IUPAC Name | 2,3,6-trimethoxybenzoic acid |
| InChI Key | NSKSXYUOXAQHCH-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
3-Fluoro-4-methoxybenzoic Acid 98.0+%, TCI America™
CAS: 403-20-3 Molecular Formula: C8H6FO3 Molecular Weight (g/mol): 169.13 MDL Number: MFCD00060675 InChI Key: HYNNNQDQEORWEU-UHFFFAOYSA-M Synonym: 3-fluoro-4-methoxy-benzoic acid,3-fluoro-p-anisic acid,3-fluoro-4-methoxy benzoic acid,3-fluoro-4-methoxybenzoicacid,pubchem1393,opera_id_903,acmc-209jd1,ksc494s2f,3-fluoro-4-methoxy benzoicacid,rarechem al bo 0870 PubChem CID: 2733401 IUPAC Name: 3-fluoro-4-methoxybenzoate SMILES: COC1=CC=C(C=C1F)C([O-])=O
| PubChem CID | 2733401 |
|---|---|
| CAS | 403-20-3 |
| Molecular Weight (g/mol) | 169.13 |
| MDL Number | MFCD00060675 |
| SMILES | COC1=CC=C(C=C1F)C([O-])=O |
| Synonym | 3-fluoro-4-methoxy-benzoic acid,3-fluoro-p-anisic acid,3-fluoro-4-methoxy benzoic acid,3-fluoro-4-methoxybenzoicacid,pubchem1393,opera_id_903,acmc-209jd1,ksc494s2f,3-fluoro-4-methoxy benzoicacid,rarechem al bo 0870 |
| IUPAC Name | 3-fluoro-4-methoxybenzoate |
| InChI Key | HYNNNQDQEORWEU-UHFFFAOYSA-M |
| Molecular Formula | C8H6FO3 |