Benzene and substituted derivatives
Filtered Search Results
2-Phenyl-2-propanol, 99%
CAS: 617-94-7 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.19 MDL Number: MFCD00004456 InChI Key: BDCFWIDZNLCTMF-UHFFFAOYSA-N Synonym: 2-phenyl-2-propanol,dimethylphenylcarbinol,1-hydroxycumene,dimethylphenylmethanol,alpha-cumyl alcohol,phenyldimethylcarbinol,2-propanol, 2-phenyl,2-phenylisopropanol,alpha,alpha-dimethylbenzyl alcohol,2-phenyl-propan-2-ol PubChem CID: 12053 IUPAC Name: 2-phenylpropan-2-ol SMILES: CC(C)(O)C1=CC=CC=C1
| PubChem CID | 12053 |
|---|---|
| CAS | 617-94-7 |
| Molecular Weight (g/mol) | 136.19 |
| MDL Number | MFCD00004456 |
| SMILES | CC(C)(O)C1=CC=CC=C1 |
| Synonym | 2-phenyl-2-propanol,dimethylphenylcarbinol,1-hydroxycumene,dimethylphenylmethanol,alpha-cumyl alcohol,phenyldimethylcarbinol,2-propanol, 2-phenyl,2-phenylisopropanol,alpha,alpha-dimethylbenzyl alcohol,2-phenyl-propan-2-ol |
| IUPAC Name | 2-phenylpropan-2-ol |
| InChI Key | BDCFWIDZNLCTMF-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
3-Bromobenzyl bromide, 95%
CAS: 823-78-9 Molecular Formula: C7H6Br2 Molecular Weight (g/mol): 249.93 MDL Number: MFCD00000176 InChI Key: ZPCJPJQUVRIILS-UHFFFAOYSA-N Synonym: 3-bromobenzyl bromide,1-bromo-3-bromomethyl benzene,m-bromobenzyl bromide,3-bromobenzylbromide,benzene, 1-bromo-3-bromomethyl,alpha,3-dibromotoluene,alpha,m-dibromotoluene,3-bromo benzyl bromide,1-bromo-3-bromomethyl-benzene,alpha-3-dibromotoluene PubChem CID: 69979 IUPAC Name: 1-bromo-3-(bromomethyl)benzene SMILES: C1=CC(=CC(=C1)Br)CBr
| PubChem CID | 69979 |
|---|---|
| CAS | 823-78-9 |
| Molecular Weight (g/mol) | 249.93 |
| MDL Number | MFCD00000176 |
| SMILES | C1=CC(=CC(=C1)Br)CBr |
| Synonym | 3-bromobenzyl bromide,1-bromo-3-bromomethyl benzene,m-bromobenzyl bromide,3-bromobenzylbromide,benzene, 1-bromo-3-bromomethyl,alpha,3-dibromotoluene,alpha,m-dibromotoluene,3-bromo benzyl bromide,1-bromo-3-bromomethyl-benzene,alpha-3-dibromotoluene |
| IUPAC Name | 1-bromo-3-(bromomethyl)benzene |
| InChI Key | ZPCJPJQUVRIILS-UHFFFAOYSA-N |
| Molecular Formula | C7H6Br2 |
4-(Bromomethyl)benzeneboronic acid, tech. 85%
CAS: 68162-47-0 Molecular Formula: C7H8BBrO2 Molecular Weight (g/mol): 214.85 MDL Number: MFCD01318113 InChI Key: PDNOURKEZJZJNZ-UHFFFAOYSA-N Synonym: 4-bromomethyl phenylboronic acid,4-bromomethylphenylboronic acid,4-bromomethyl phenyl boronic acid,4-bromomethyl benzeneboronic acid,4-boronobenzyl bromide,p-bromomethyl phenylboronic acid,4-bromomethylphenyl boronic acid,4-bromomethylbenzeneboronic acid,boronic acid, 4-bromomethyl phenyl PubChem CID: 2735593 IUPAC Name: [4-(bromomethyl)phenyl]boronic acid SMILES: OB(O)C1=CC=C(CBr)C=C1
| PubChem CID | 2735593 |
|---|---|
| CAS | 68162-47-0 |
| Molecular Weight (g/mol) | 214.85 |
| MDL Number | MFCD01318113 |
| SMILES | OB(O)C1=CC=C(CBr)C=C1 |
| Synonym | 4-bromomethyl phenylboronic acid,4-bromomethylphenylboronic acid,4-bromomethyl phenyl boronic acid,4-bromomethyl benzeneboronic acid,4-boronobenzyl bromide,p-bromomethyl phenylboronic acid,4-bromomethylphenyl boronic acid,4-bromomethylbenzeneboronic acid,boronic acid, 4-bromomethyl phenyl |
| IUPAC Name | [4-(bromomethyl)phenyl]boronic acid |
| InChI Key | PDNOURKEZJZJNZ-UHFFFAOYSA-N |
| Molecular Formula | C7H8BBrO2 |
alpha,alpha'-Dibromo-p-xylene, 97%
CAS: 623-24-5 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.95 MDL Number: MFCD00000182 InChI Key: RBZMSGOBSOCYHR-UHFFFAOYSA-N Synonym: 1,4-bis bromomethyl benzene,p-xylylene dibromide,alpha,alpha'-dibromo-p-xylene,benzene, 1,4-bis bromomethyl,p-xylylene bromide,p-bromomethyl benzene,1,4-dibromomethylbenzene,p-bis bromomethyl benzene,1,4-bis-bromomethyl-benzene,ccris 1775 PubChem CID: 69335 IUPAC Name: 1,4-bis(bromomethyl)benzene SMILES: C1=CC(=CC=C1CBr)CBr
| PubChem CID | 69335 |
|---|---|
| CAS | 623-24-5 |
| Molecular Weight (g/mol) | 263.95 |
| MDL Number | MFCD00000182 |
| SMILES | C1=CC(=CC=C1CBr)CBr |
| Synonym | 1,4-bis bromomethyl benzene,p-xylylene dibromide,alpha,alpha'-dibromo-p-xylene,benzene, 1,4-bis bromomethyl,p-xylylene bromide,p-bromomethyl benzene,1,4-dibromomethylbenzene,p-bis bromomethyl benzene,1,4-bis-bromomethyl-benzene,ccris 1775 |
| IUPAC Name | 1,4-bis(bromomethyl)benzene |
| InChI Key | RBZMSGOBSOCYHR-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
alpha,alpha'-Dibromo-o-xylene, 96%
CAS: 91-13-4 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.95 MDL Number: MFCD00000175 InChI Key: KGKAYWMGPDWLQZ-UHFFFAOYSA-N Synonym: 1,2-bis bromomethyl benzene,o-xylylene dibromide,alpha,alpha'-dibromo-o-xylene,benzene, 1,2-bis bromomethyl,o-bis bromomethyl benzene,o-xylylene bromide,1,2-dibenzyl bromide,alpha,alpha'-dibromo-o-xylol,a,a'-dibromo-o-xylene,ccris 1776 PubChem CID: 66665 IUPAC Name: 1,2-bis(bromomethyl)benzene SMILES: C1=CC=C(C(=C1)CBr)CBr
| PubChem CID | 66665 |
|---|---|
| CAS | 91-13-4 |
| Molecular Weight (g/mol) | 263.95 |
| MDL Number | MFCD00000175 |
| SMILES | C1=CC=C(C(=C1)CBr)CBr |
| Synonym | 1,2-bis bromomethyl benzene,o-xylylene dibromide,alpha,alpha'-dibromo-o-xylene,benzene, 1,2-bis bromomethyl,o-bis bromomethyl benzene,o-xylylene bromide,1,2-dibenzyl bromide,alpha,alpha'-dibromo-o-xylol,a,a'-dibromo-o-xylene,ccris 1776 |
| IUPAC Name | 1,2-bis(bromomethyl)benzene |
| InChI Key | KGKAYWMGPDWLQZ-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
p-Tolylhydrazine hydrochloride, 98%
CAS: 637-60-5 Molecular Formula: C7H10N2·HCl Molecular Weight (g/mol): 158.63 MDL Number: MFCD00012940 InChI Key: HMHWNJGOHUYVMD-UHFFFAOYSA-N Synonym: p-tolylhydrazine hydrochloride,4-methylphenylhydrazine hydrochloride,4-methylphenyl hydrazine hydrochloride,4-tolylhydrazine hydrochloride,hydrazine, 4-methylphenyl-, monohydrochloride,p-tolylhydrazinium 1+ chloride,hydrazine, p-tolyl-, hydrochloride,4-methylphenylhydrazine hcl,1-4-methylphenyl hydrazine hydrochloride,p-tolyl-hydrazine hydrochloride PubChem CID: 12504 IUPAC Name: (4-methylphenyl)hydrazine;hydrochloride SMILES: CC1=CC=C(C=C1)NN.Cl
| PubChem CID | 12504 |
|---|---|
| CAS | 637-60-5 |
| Molecular Weight (g/mol) | 158.63 |
| MDL Number | MFCD00012940 |
| SMILES | CC1=CC=C(C=C1)NN.Cl |
| Synonym | p-tolylhydrazine hydrochloride,4-methylphenylhydrazine hydrochloride,4-methylphenyl hydrazine hydrochloride,4-tolylhydrazine hydrochloride,hydrazine, 4-methylphenyl-, monohydrochloride,p-tolylhydrazinium 1+ chloride,hydrazine, p-tolyl-, hydrochloride,4-methylphenylhydrazine hcl,1-4-methylphenyl hydrazine hydrochloride,p-tolyl-hydrazine hydrochloride |
| IUPAC Name | (4-methylphenyl)hydrazine;hydrochloride |
| InChI Key | HMHWNJGOHUYVMD-UHFFFAOYSA-N |
| Molecular Formula | C7H10N2·HCl |
Hippuric Acid Analytical Standard, MilliporeSigma™ Supelco™
Hippuric acid, the glycine conjugate of benzoic acid, is formed via a biotransformation process. From scientific literature, it is reported to be found as an excretory product in urine. Hippuric acid is also known to be catabolically synthesized from benzene-type aromatic compounds.
| Percent Purity | ≥97.5% (GC) |
|---|---|
| CAS | 495-69-2 |
| MDL Number | MFCD00002692 |
| UN Number | NONH for all modes of transport |
| Synonym | N-Benzoylglycine; Benzoylaminoacetic Acid |
| RTECS Number | MR8150000 |
| Grade | Analytical Standard |
| Shelf Life | Limited shelf life, expiry date on the label |
| Molecular Formula | C9H9NO3 |
| Formula Weight | 179.17 |
| Melting Point | 187°C to 191°C (literature) |
Carnosic Acid, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
4-Aminosalicylic acid, 99%
CAS: 65-49-6 Molecular Formula: C7H7NO3 Molecular Weight (g/mol): 153.14 MDL Number: MFCD00007789 InChI Key: WUBBRNOQWQTFEX-UHFFFAOYSA-N Synonym: 4-aminosalicylic acid,aminosalicylic acid,p-aminosalicylic acid,rezipas,pamisyl,parasalindon,aminopar,deapasil,ferrosan,apacil PubChem CID: 4649 ChEBI: CHEBI:27565 IUPAC Name: 4-amino-2-hydroxybenzoic acid SMILES: C1=CC(=C(C=C1N)O)C(=O)O
| PubChem CID | 4649 |
|---|---|
| CAS | 65-49-6 |
| Molecular Weight (g/mol) | 153.14 |
| ChEBI | CHEBI:27565 |
| MDL Number | MFCD00007789 |
| SMILES | C1=CC(=C(C=C1N)O)C(=O)O |
| Synonym | 4-aminosalicylic acid,aminosalicylic acid,p-aminosalicylic acid,rezipas,pamisyl,parasalindon,aminopar,deapasil,ferrosan,apacil |
| IUPAC Name | 4-amino-2-hydroxybenzoic acid |
| InChI Key | WUBBRNOQWQTFEX-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO3 |
Methyl 4-iodo-3-methylbenzoate, 98%
CAS: 5471-81-8 Molecular Formula: C9H9IO2 Molecular Weight (g/mol): 276.073 MDL Number: MFCD02683863 InChI Key: HCSGWQGKCVQIRM-UHFFFAOYSA-N Synonym: 4-iodo-3-methylbenzoic acid methyl ester,methyl 4-iodo-3-methyl-benzoate,4-iodo-m-toluic acid methyl ester,benzoic acid, 4-iodo-3-methyl-, methyl ester,methyl4-iodo-3-methylbenzoate,acmc-1anqa,methyl 4-iodo-m-toluate,methyl 3methyl-4-iodobenzoate,methyl 3-methyl-4-iodobenzoate,4-iodo-m-toluic acid, methyl ester PubChem CID: 231757 IUPAC Name: methyl 4-iodo-3-methylbenzoate SMILES: CC1=C(C=CC(=C1)C(=O)OC)I
| PubChem CID | 231757 |
|---|---|
| CAS | 5471-81-8 |
| Molecular Weight (g/mol) | 276.073 |
| MDL Number | MFCD02683863 |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)I |
| Synonym | 4-iodo-3-methylbenzoic acid methyl ester,methyl 4-iodo-3-methyl-benzoate,4-iodo-m-toluic acid methyl ester,benzoic acid, 4-iodo-3-methyl-, methyl ester,methyl4-iodo-3-methylbenzoate,acmc-1anqa,methyl 4-iodo-m-toluate,methyl 3methyl-4-iodobenzoate,methyl 3-methyl-4-iodobenzoate,4-iodo-m-toluic acid, methyl ester |
| IUPAC Name | methyl 4-iodo-3-methylbenzoate |
| InChI Key | HCSGWQGKCVQIRM-UHFFFAOYSA-N |
| Molecular Formula | C9H9IO2 |
3-Bromobenzoyl chloride, 97%
CAS: 1711-09-7 Molecular Formula: C7H4BrClO Molecular Weight (g/mol): 219.46 MDL Number: MFCD00000669 InChI Key: PBOOZQFGWNZNQE-UHFFFAOYSA-N Synonym: m-bromobenzoyl chloride,benzoyl chloride, 3-bromo,3-bromobenzoylchloride,benzoyl chloride, m-bromo,3-bromobenzoic acid chloride,attercop-chm at106527,3-brom-benzoylchlorid,3-bromo-benzoylchlorid,3-bromobenzoic chloride,pubchem13574 PubChem CID: 74377 IUPAC Name: 3-bromobenzoyl chloride SMILES: C1=CC(=CC(=C1)Br)C(=O)Cl
| PubChem CID | 74377 |
|---|---|
| CAS | 1711-09-7 |
| Molecular Weight (g/mol) | 219.46 |
| MDL Number | MFCD00000669 |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)Cl |
| Synonym | m-bromobenzoyl chloride,benzoyl chloride, 3-bromo,3-bromobenzoylchloride,benzoyl chloride, m-bromo,3-bromobenzoic acid chloride,attercop-chm at106527,3-brom-benzoylchlorid,3-bromo-benzoylchlorid,3-bromobenzoic chloride,pubchem13574 |
| IUPAC Name | 3-bromobenzoyl chloride |
| InChI Key | PBOOZQFGWNZNQE-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrClO |
2-Fluorobenzoyl chloride, 97%
CAS: 393-52-2 Molecular Formula: C7H4ClFO Molecular Weight (g/mol): 158.556 MDL Number: MFCD00000656 InChI Key: RAAGZOYMEQDCTD-UHFFFAOYSA-N Synonym: o-fluorobenzoyl chloride,benzoyl chloride, 2-fluoro,benzoyl chloride, o-fluoro,2-fluorobenzoylchloride,2-fluoro benzoyl chloride,unii-z4h017n76s,ccris 5914,fluorobenzoyl chloride,benzoyl chloride, fluoro,2-fluorobenzoic acid chloride PubChem CID: 9808 IUPAC Name: 2-fluorobenzoyl chloride SMILES: C1=CC=C(C(=C1)C(=O)Cl)F
| PubChem CID | 9808 |
|---|---|
| CAS | 393-52-2 |
| Molecular Weight (g/mol) | 158.556 |
| MDL Number | MFCD00000656 |
| SMILES | C1=CC=C(C(=C1)C(=O)Cl)F |
| Synonym | o-fluorobenzoyl chloride,benzoyl chloride, 2-fluoro,benzoyl chloride, o-fluoro,2-fluorobenzoylchloride,2-fluoro benzoyl chloride,unii-z4h017n76s,ccris 5914,fluorobenzoyl chloride,benzoyl chloride, fluoro,2-fluorobenzoic acid chloride |
| IUPAC Name | 2-fluorobenzoyl chloride |
| InChI Key | RAAGZOYMEQDCTD-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClFO |
4-Fluorobenzonitrile, 99%
CAS: 1194-02-1 Molecular Formula: C7H4FN Molecular Weight (g/mol): 121.11 MDL Number: MFCD00001812 InChI Key: AEKVBBNGWBBYLL-UHFFFAOYSA-N Synonym: p-fluorobenzonitrile,benzonitrile, 4-fluoro,4-cyanofluorobenzene,p-cyanofluorobenzene,benzonitrile, p-fluoro,4-fluoro-benzonitrile,4-fluorobenzenecarbonitrile,4-fluorobenzonitril,pfbn,1-cyano-4-fluorobenzene PubChem CID: 14517 IUPAC Name: 4-fluorobenzonitrile SMILES: C1=CC(=CC=C1C#N)F
| PubChem CID | 14517 |
|---|---|
| CAS | 1194-02-1 |
| Molecular Weight (g/mol) | 121.11 |
| MDL Number | MFCD00001812 |
| SMILES | C1=CC(=CC=C1C#N)F |
| Synonym | p-fluorobenzonitrile,benzonitrile, 4-fluoro,4-cyanofluorobenzene,p-cyanofluorobenzene,benzonitrile, p-fluoro,4-fluoro-benzonitrile,4-fluorobenzenecarbonitrile,4-fluorobenzonitril,pfbn,1-cyano-4-fluorobenzene |
| IUPAC Name | 4-fluorobenzonitrile |
| InChI Key | AEKVBBNGWBBYLL-UHFFFAOYSA-N |
| Molecular Formula | C7H4FN |
Trityl Tetrakis(pentafluorophenyl)borate, 97%
CAS: 136040-19-2 Molecular Formula: C43H15BF20 Molecular Weight (g/mol): 922.37 MDL Number: MFCD03426981 InChI Key: TZOSNOQHGGONMD-UHFFFAOYSA-N Synonym: triphenylmethylium tetrakis perfluorophenyl borate,trityl tetrakis pentafluorophenyl borate,trityl tetrapentafluorophenyl borate,methylium, triphenyl-, tetrakis pentafluorophenyl borate 1-,triphenylcarbenium tetrakis pentafluorophenyl borate,methylium, triphenyl-, tetrakis 2,3,4,5,6-pentafluorophenyl borate 1-1:1,tetrakis 2,3,4,5,6-pentafluorophenyl boranuide; triphenylmethylium,methylium, triphenyl-, tetrakis pentafluorophenyl borate 1-1:1,tritylium tetrakis pentafluorophenyl borate,triphenylmethyliumtetrakis pentafluorophenyl borate PubChem CID: 9832824 SMILES: C1=CC=C(C=C1)[C+](C1=CC=CC=C1)C1=CC=CC=C1.FC1=C(F)C(F)=C(C(F)=C1F)[B-](C1=C(F)C(F)=C(F)C(F)=C1F)(C1=C(F)C(F)=C(F)C(F)=C1F)C1=C(F)C(F)=C(F)C(F)=C1F
| PubChem CID | 9832824 |
|---|---|
| CAS | 136040-19-2 |
| Molecular Weight (g/mol) | 922.37 |
| MDL Number | MFCD03426981 |
| SMILES | C1=CC=C(C=C1)[C+](C1=CC=CC=C1)C1=CC=CC=C1.FC1=C(F)C(F)=C(C(F)=C1F)[B-](C1=C(F)C(F)=C(F)C(F)=C1F)(C1=C(F)C(F)=C(F)C(F)=C1F)C1=C(F)C(F)=C(F)C(F)=C1F |
| Synonym | triphenylmethylium tetrakis perfluorophenyl borate,trityl tetrakis pentafluorophenyl borate,trityl tetrapentafluorophenyl borate,methylium, triphenyl-, tetrakis pentafluorophenyl borate 1-,triphenylcarbenium tetrakis pentafluorophenyl borate,methylium, triphenyl-, tetrakis 2,3,4,5,6-pentafluorophenyl borate 1-1:1,tetrakis 2,3,4,5,6-pentafluorophenyl boranuide; triphenylmethylium,methylium, triphenyl-, tetrakis pentafluorophenyl borate 1-1:1,tritylium tetrakis pentafluorophenyl borate,triphenylmethyliumtetrakis pentafluorophenyl borate |
| InChI Key | TZOSNOQHGGONMD-UHFFFAOYSA-N |
| Molecular Formula | C43H15BF20 |