Carboxylic acids and derivatives
Filtered Search Results
Cyanoacetic acid, 97%
CAS: 372-09-8 Molecular Formula: C3H3NO2 Molecular Weight (g/mol): 85.06 InChI Key: MLIREBYILWEBDM-UHFFFAOYSA-N Synonym: cyanoacetic acid,acetic acid, cyano,malonic mononitrile,acide cyanacetique,cyanessigsaeure,monocyanoacetic acid,malonic acid mononitrile,usaf kf-17,cyanoethanoic acid,kyselina kyanoctova PubChem CID: 9740 ChEBI: CHEBI:51889 IUPAC Name: 2-cyanoacetic acid SMILES: C(C#N)C(=O)O
| PubChem CID | 9740 |
|---|---|
| CAS | 372-09-8 |
| Molecular Weight (g/mol) | 85.06 |
| ChEBI | CHEBI:51889 |
| SMILES | C(C#N)C(=O)O |
| Synonym | cyanoacetic acid,acetic acid, cyano,malonic mononitrile,acide cyanacetique,cyanessigsaeure,monocyanoacetic acid,malonic acid mononitrile,usaf kf-17,cyanoethanoic acid,kyselina kyanoctova |
| IUPAC Name | 2-cyanoacetic acid |
| InChI Key | MLIREBYILWEBDM-UHFFFAOYSA-N |
| Molecular Formula | C3H3NO2 |
Isopropenyl acetate, 99%
CAS: 108-22-5 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00008709 InChI Key: HETCEOQFVDFGSY-UHFFFAOYSA-N Synonym: isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate PubChem CID: 7916 IUPAC Name: prop-1-en-2-yl acetate SMILES: CC(=C)OC(C)=O
| PubChem CID | 7916 |
|---|---|
| CAS | 108-22-5 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00008709 |
| SMILES | CC(=C)OC(C)=O |
| Synonym | isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate |
| IUPAC Name | prop-1-en-2-yl acetate |
| InChI Key | HETCEOQFVDFGSY-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Naproxen sodium, 98%
CAS: 26159-34-2 Molecular Formula: C14H13NaO3 Molecular Weight (g/mol): 252.25 MDL Number: MFCD00058507 InChI Key: CDBRNDSHEYLDJV-FVGYRXGTSA-M Synonym: naproxen sodium,anaprox,miranax,naprelan,naproxen sodium salt,anapran,anaprotab,aprowell,floginex,flogogin PubChem CID: 23681059 ChEBI: CHEBI:7477 IUPAC Name: sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate SMILES: [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O
| PubChem CID | 23681059 |
|---|---|
| CAS | 26159-34-2 |
| Molecular Weight (g/mol) | 252.25 |
| ChEBI | CHEBI:7477 |
| MDL Number | MFCD00058507 |
| SMILES | [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O |
| Synonym | naproxen sodium,anaprox,miranax,naprelan,naproxen sodium salt,anapran,anaprotab,aprowell,floginex,flogogin |
| IUPAC Name | sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChI Key | CDBRNDSHEYLDJV-FVGYRXGTSA-M |
| Molecular Formula | C14H13NaO3 |
3-Methylvaleric acid, 99%
CAS: 105-43-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00002729,MFCD02262177 InChI Key: IGIDLTISMCAULB-UHFFFAOYNA-N Synonym: 3-methylvaleric acid,3-methyl-pentanoic acid,pentanoic acid, 3-methyl,3-methyl valeric acid,dl-3-methylvaleric acid,3-methyl pentanoic acid,sec-butylacetic acid,valeric acid, 3-methyl,beta-methylvaleric acid,3-methyl-n-valeric acid PubChem CID: 7755 IUPAC Name: 3-methylpentanoic acid SMILES: CCC(C)CC(O)=O
| PubChem CID | 7755 |
|---|---|
| CAS | 105-43-1 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00002729,MFCD02262177 |
| SMILES | CCC(C)CC(O)=O |
| Synonym | 3-methylvaleric acid,3-methyl-pentanoic acid,pentanoic acid, 3-methyl,3-methyl valeric acid,dl-3-methylvaleric acid,3-methyl pentanoic acid,sec-butylacetic acid,valeric acid, 3-methyl,beta-methylvaleric acid,3-methyl-n-valeric acid |
| IUPAC Name | 3-methylpentanoic acid |
| InChI Key | IGIDLTISMCAULB-UHFFFAOYNA-N |
| Molecular Formula | C6H12O2 |
Methacrylamide, 98%
CAS: 79-39-0 Molecular Formula: C4H7NO Molecular Weight (g/mol): 85.106 MDL Number: MFCD00008018 InChI Key: FQPSGWSUVKBHSU-UHFFFAOYSA-N Synonym: methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide PubChem CID: 6595 ChEBI: CHEBI:51759 IUPAC Name: 2-methylprop-2-enamide SMILES: CC(=C)C(=O)N
| PubChem CID | 6595 |
|---|---|
| CAS | 79-39-0 |
| Molecular Weight (g/mol) | 85.106 |
| ChEBI | CHEBI:51759 |
| MDL Number | MFCD00008018 |
| SMILES | CC(=C)C(=O)N |
| Synonym | methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide |
| IUPAC Name | 2-methylprop-2-enamide |
| InChI Key | FQPSGWSUVKBHSU-UHFFFAOYSA-N |
| Molecular Formula | C4H7NO |
Ethyl formate, 98+%, pure
CAS: 109-94-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00003294 InChI Key: WBJINCZRORDGAQ-UHFFFAOYSA-N Synonym: areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat PubChem CID: 8025 ChEBI: CHEBI:52342 IUPAC Name: ethyl formate SMILES: CCOC=O
| PubChem CID | 8025 |
|---|---|
| CAS | 109-94-4 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:52342 |
| MDL Number | MFCD00003294 |
| SMILES | CCOC=O |
| Synonym | areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat |
| IUPAC Name | ethyl formate |
| InChI Key | WBJINCZRORDGAQ-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Dihydrofluorescein diacetate, 97%
CAS: 35340-49-9 Molecular Formula: C24H18O7 Molecular Weight (g/mol): 418.401 MDL Number: MFCD00005056 InChI Key: YKSJJXGQHSESKB-UHFFFAOYSA-N Synonym: dihydrofluorescein diacetate,2-3,6-diacetoxy-9h-xanthen-9-yl benzoic acid,diacetyldihydrofluorescein,2-3,6-diacetoxy-9h-xanth-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid,dihydrofluorescein diacetate h2fda,2-3,6-diacetyloxy-9h-xanthen-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid # PubChem CID: 629056 IUPAC Name: 2-(3,6-diacetyloxy-9H-xanthen-9-yl)benzoic acid SMILES: CC(=O)OC1=CC2=C(C=C1)C(C3=C(O2)C=C(C=C3)OC(=O)C)C4=CC=CC=C4C(=O)O
| PubChem CID | 629056 |
|---|---|
| CAS | 35340-49-9 |
| Molecular Weight (g/mol) | 418.401 |
| MDL Number | MFCD00005056 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C(C3=C(O2)C=C(C=C3)OC(=O)C)C4=CC=CC=C4C(=O)O |
| Synonym | dihydrofluorescein diacetate,2-3,6-diacetoxy-9h-xanthen-9-yl benzoic acid,diacetyldihydrofluorescein,2-3,6-diacetoxy-9h-xanth-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid,dihydrofluorescein diacetate h2fda,2-3,6-diacetyloxy-9h-xanthen-9-yl benzoic acid,2-3,6-bis acetyloxy-9h-xanthen-9-yl benzoic acid # |
| IUPAC Name | 2-(3,6-diacetyloxy-9H-xanthen-9-yl)benzoic acid |
| InChI Key | YKSJJXGQHSESKB-UHFFFAOYSA-N |
| Molecular Formula | C24H18O7 |
Octyl 4-methoxycinnamate, 98%, stabilized
CAS: 5466-77-3 Molecular Formula: C18H26O3 Molecular Weight (g/mol): 290.40 MDL Number: MFCD00072582 InChI Key: YBGZDTIWKVFICR-UHFFFAOYNA-N Synonym: bidd:er0152,octyl methoxy cinnamate omc,unii-4y5p7mud51 component,2s-2-ethylhexyl 2e-3-4-methoxyphenyl prop-2-enoate PubChem CID: 11044481 IUPAC Name: [(2S)-2-ethylhexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate SMILES: CCCCC(CC)COC(=O)C=CC1=CC=C(OC)C=C1
| PubChem CID | 11044481 |
|---|---|
| CAS | 5466-77-3 |
| Molecular Weight (g/mol) | 290.40 |
| MDL Number | MFCD00072582 |
| SMILES | CCCCC(CC)COC(=O)C=CC1=CC=C(OC)C=C1 |
| Synonym | bidd:er0152,octyl methoxy cinnamate omc,unii-4y5p7mud51 component,2s-2-ethylhexyl 2e-3-4-methoxyphenyl prop-2-enoate |
| IUPAC Name | [(2S)-2-ethylhexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| InChI Key | YBGZDTIWKVFICR-UHFFFAOYNA-N |
| Molecular Formula | C18H26O3 |
2-Hydroxyethyl methacrylate, 97%, stab. with 4-methoxyphenol
CAS: 868-77-9 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.143 MDL Number: MFCD00002863 InChI Key: WOBHKFSMXKNTIM-UHFFFAOYSA-N Synonym: 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 PubChem CID: 13360 ChEBI: CHEBI:34288 IUPAC Name: 2-hydroxyethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCO
| PubChem CID | 13360 |
|---|---|
| CAS | 868-77-9 |
| Molecular Weight (g/mol) | 130.143 |
| ChEBI | CHEBI:34288 |
| MDL Number | MFCD00002863 |
| SMILES | CC(=C)C(=O)OCCO |
| Synonym | 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate |
| InChI Key | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
Disodium Dihydrogen Ethylenediaminetetraacetate Dihydrate 99.5+%, TCI America™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Thermo Scientific Chemicals L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 MDL Number: MFCD00082340 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| PubChem CID | 131674100 |
|---|---|
| CAS | 134-03-2 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
1,2,3,4-Butanetetracarboxylic acid, 98+%
CAS: 1703-58-8 Molecular Formula: C8H10O8 Molecular Weight (g/mol): 234.16 MDL Number: MFCD00002722 InChI Key: GGAUUQHSCNMCAU-UHFFFAOYSA-N Synonym: 1,2,3,4-butanetetracarboxylic acid,butanetetracarboxylic acid,dsstox_cid_4670,dsstox_rid_77494,dsstox_gsid_24670,1,2,3,4-butanetetracarboxylic,meso-1,2,3,4-butanetetracarboxylic acid,acmc-20abw3,ksc176c1b,ggauuqhscnmcau-uhfffaoysa PubChem CID: 15560 IUPAC Name: butane-1,2,3,4-tetracarboxylic acid SMILES: C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O
| PubChem CID | 15560 |
|---|---|
| CAS | 1703-58-8 |
| Molecular Weight (g/mol) | 234.16 |
| MDL Number | MFCD00002722 |
| SMILES | C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| Synonym | 1,2,3,4-butanetetracarboxylic acid,butanetetracarboxylic acid,dsstox_cid_4670,dsstox_rid_77494,dsstox_gsid_24670,1,2,3,4-butanetetracarboxylic,meso-1,2,3,4-butanetetracarboxylic acid,acmc-20abw3,ksc176c1b,ggauuqhscnmcau-uhfffaoysa |
| IUPAC Name | butane-1,2,3,4-tetracarboxylic acid |
| InChI Key | GGAUUQHSCNMCAU-UHFFFAOYSA-N |
| Molecular Formula | C8H10O8 |
2-(Dimethylamino)ethyl methacrylate, 99%, stabilized
CAS: 2867-47-2 Molecular Formula: C8H15NO2 Molecular Weight (g/mol): 157.21 MDL Number: MFCD00008589 InChI Key: JKNCOURZONDCGV-UHFFFAOYSA-N Synonym: 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate PubChem CID: 17869 IUPAC Name: 2-(dimethylamino)ethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCN(C)C
| PubChem CID | 17869 |
|---|---|
| CAS | 2867-47-2 |
| Molecular Weight (g/mol) | 157.21 |
| MDL Number | MFCD00008589 |
| SMILES | CC(=C)C(=O)OCCN(C)C |
| Synonym | 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate |
| InChI Key | JKNCOURZONDCGV-UHFFFAOYSA-N |
| Molecular Formula | C8H15NO2 |
Cobalt(II) acetate tetrahydrate, 98%
CAS: 6147-53-1 Molecular Formula: C4H14CoO8 MDL Number: MFCD00149569 InChI Key: ZBYYWKJVSFHYJL-UHFFFAOYSA-L Synonym: cobalt ii acetate tetrahydrate,cobalt acetate tetrahydrate,cobaltous acetate tetrahydrate,cobalt diacetate tetrahydrate,bis acetato tetraquacobalt,octan kobaltnaty czech,acetic acid, cobalt 2+ salt, tetrahydrate,octan kobaltnaty,ccris 9441 PubChem CID: 61372
| PubChem CID | 61372 |
|---|---|
| CAS | 6147-53-1 |
| MDL Number | MFCD00149569 |
| Synonym | cobalt ii acetate tetrahydrate,cobalt acetate tetrahydrate,cobaltous acetate tetrahydrate,cobalt diacetate tetrahydrate,bis acetato tetraquacobalt,octan kobaltnaty czech,acetic acid, cobalt 2+ salt, tetrahydrate,octan kobaltnaty,ccris 9441 |
| InChI Key | ZBYYWKJVSFHYJL-UHFFFAOYSA-L |
| Molecular Formula | C4H14CoO8 |
Ammonium citrate tribasic, 97+%
CAS: 3458-72-8 Molecular Formula: C6H20N3O7+3 Molecular Weight (g/mol): 246.24 MDL Number: MFCD00036406 InChI Key: YWYZEGXAUVWDED-UHFFFAOYSA-Q Synonym: ammonium citrate PubChem CID: 131675891 IUPAC Name: azane;[3-carboxy-1,3-dihydroxy-4-[oxonio(oxoniumylidene)methyl]butylidene]oxidanium SMILES: C(C(=[OH+])[OH2+])C(CC(=[OH+])O)(C(=O)O)O.N.N.N
| PubChem CID | 131675891 |
|---|---|
| CAS | 3458-72-8 |
| Molecular Weight (g/mol) | 246.24 |
| MDL Number | MFCD00036406 |
| SMILES | C(C(=[OH+])[OH2+])C(CC(=[OH+])O)(C(=O)O)O.N.N.N |
| Synonym | ammonium citrate |
| IUPAC Name | azane;[3-carboxy-1,3-dihydroxy-4-[oxonio(oxoniumylidene)methyl]butylidene]oxidanium |
| InChI Key | YWYZEGXAUVWDED-UHFFFAOYSA-Q |
| Molecular Formula | C6H20N3O7+3 |