Carboxylic acids and derivatives
Filtered Search Results
Cyanoacetic acid, 97%
CAS: 372-09-8 Molecular Formula: C3H3NO2 Molecular Weight (g/mol): 85.062 MDL Number: MFCD00002677 InChI Key: MLIREBYILWEBDM-UHFFFAOYSA-N Synonym: cyanoacetic acid,acetic acid, cyano,malonic mononitrile,acide cyanacetique,cyanessigsaeure,monocyanoacetic acid,malonic acid mononitrile,usaf kf-17,cyanoethanoic acid,kyselina kyanoctova PubChem CID: 9740 ChEBI: CHEBI:51889 IUPAC Name: 2-cyanoacetic acid SMILES: C(C#N)C(=O)O
| PubChem CID | 9740 |
|---|---|
| CAS | 372-09-8 |
| Molecular Weight (g/mol) | 85.062 |
| ChEBI | CHEBI:51889 |
| MDL Number | MFCD00002677 |
| SMILES | C(C#N)C(=O)O |
| Synonym | cyanoacetic acid,acetic acid, cyano,malonic mononitrile,acide cyanacetique,cyanessigsaeure,monocyanoacetic acid,malonic acid mononitrile,usaf kf-17,cyanoethanoic acid,kyselina kyanoctova |
| IUPAC Name | 2-cyanoacetic acid |
| InChI Key | MLIREBYILWEBDM-UHFFFAOYSA-N |
| Molecular Formula | C3H3NO2 |
n-Butyl acetate, 99+%, Extra Dry, AcroSeal™
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Methyl Methacrylate (stabilized with 6-tert-Butyl-2,4-xylenol) 99.8+%, TCI America™
CAS: 80-62-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.117 MDL Number: MFCD00008587 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| Molecular Weight (g/mol) | 100.117 |
| ChEBI | CHEBI:34840 |
| MDL Number | MFCD00008587 |
| SMILES | CC(=C)C(=O)OC |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
4-Hydroxybenzoic Acid Hydrazide, 98%
CAS: 5351-23-5 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00007605 InChI Key: ZMZGIVVRBMFZSG-UHFFFAOYSA-N Synonym: 4-hydroxybenzhydrazide,4-hydroxybenzoic acid hydrazide,4-hydroxybenzoic hydrazide,p-hydroxybenzhydrazide,p-hydroxybenzoic acid hydrazide,4-hydroxybenzoylhydrazine,benzoic acid, 4-hydroxy-, hydrazide,p-hydroxybenzoic hydrazide,p-hydroxybenzoyl hydrazine,4-hydroxy-benzoic acid hydrazide PubChem CID: 1742 IUPAC Name: 4-hydroxybenzohydrazide SMILES: C1=CC(=CC=C1C(=O)NN)O
| PubChem CID | 1742 |
|---|---|
| CAS | 5351-23-5 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00007605 |
| SMILES | C1=CC(=CC=C1C(=O)NN)O |
| Synonym | 4-hydroxybenzhydrazide,4-hydroxybenzoic acid hydrazide,4-hydroxybenzoic hydrazide,p-hydroxybenzhydrazide,p-hydroxybenzoic acid hydrazide,4-hydroxybenzoylhydrazine,benzoic acid, 4-hydroxy-, hydrazide,p-hydroxybenzoic hydrazide,p-hydroxybenzoyl hydrazine,4-hydroxy-benzoic acid hydrazide |
| IUPAC Name | 4-hydroxybenzohydrazide |
| InChI Key | ZMZGIVVRBMFZSG-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |
Dimethyl acetylenedicarboxylate, 95%
CAS: 762-42-5 Molecular Formula: C6H6O4 Molecular Weight (g/mol): 142.11 MDL Number: MFCD00008456 InChI Key: VHILMKFSCRWWIJ-UHFFFAOYSA-N Synonym: dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene PubChem CID: 12980 IUPAC Name: dimethyl but-2-ynedioate SMILES: COC(=O)C#CC(=O)OC
| PubChem CID | 12980 |
|---|---|
| CAS | 762-42-5 |
| Molecular Weight (g/mol) | 142.11 |
| MDL Number | MFCD00008456 |
| SMILES | COC(=O)C#CC(=O)OC |
| Synonym | dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene |
| IUPAC Name | dimethyl but-2-ynedioate |
| InChI Key | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O4 |
Methyl methacrylate, 99%, stab.
CAS: 80-62-6 Molecular Formula: C5H8O2 MDL Number: MFCD00008587 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| ChEBI | CHEBI:34840 |
| MDL Number | MFCD00008587 |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Methyl 2-methoxybenzoate, 98+%
CAS: 606-45-1 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00008423 InChI Key: PFYHAAAQPNMZHO-UHFFFAOYSA-N Synonym: methyl o-anisate,dimethyl salicylate,o-anisic acid, methyl ester,methyl o-methoxybenzoate,o-methoxy methyl benzoate,o-methoxybenzoic acid methyl ester,methylsalicylate methyl ether,2-methoxybenzoic acid methyl ester,benzoic acid, 2-methoxy-, methyl ester,2-methoxybenzoic acid, methyl ester PubChem CID: 61151 IUPAC Name: methyl 2-methoxybenzoate SMILES: COC1=CC=CC=C1C(=O)OC
| PubChem CID | 61151 |
|---|---|
| CAS | 606-45-1 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00008423 |
| SMILES | COC1=CC=CC=C1C(=O)OC |
| Synonym | methyl o-anisate,dimethyl salicylate,o-anisic acid, methyl ester,methyl o-methoxybenzoate,o-methoxy methyl benzoate,o-methoxybenzoic acid methyl ester,methylsalicylate methyl ether,2-methoxybenzoic acid methyl ester,benzoic acid, 2-methoxy-, methyl ester,2-methoxybenzoic acid, methyl ester |
| IUPAC Name | methyl 2-methoxybenzoate |
| InChI Key | PFYHAAAQPNMZHO-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Propionic acid, sodium salt, 99.0-100.5%
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.06 MDL Number: MFCD00002759 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M Synonym: sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar PubChem CID: 2723816 IUPAC Name: sodium;propanoate SMILES: CCC(=O)[O-].[Na+]
| PubChem CID | 2723816 |
|---|---|
| CAS | 137-40-6 |
| Molecular Weight (g/mol) | 96.06 |
| MDL Number | MFCD00002759 |
| SMILES | CCC(=O)[O-].[Na+] |
| Synonym | sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar |
| IUPAC Name | sodium;propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |
3-(4-Hydroxyphenyl)propionic acid, 99%
CAS: 501-97-3 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00002778 InChI Key: NMHMNPHRMNGLLB-UHFFFAOYSA-N Synonym: 3-4-hydroxyphenyl propionic acid,phloretic acid,3-4-hydroxyphenyl propanoic acid,desaminotyrosine,hydro-p-coumaric acid,dihydro-p-coumaric acid,benzenepropanoic acid, 4-hydroxy,4-hydroxyphenylpropionic acid,p-hydroxyhydrocinnamic acid,3-p-hydroxyphenyl propionic acid PubChem CID: 10394 ChEBI: CHEBI:32980 IUPAC Name: 3-(4-hydroxyphenyl)propanoic acid SMILES: C1=CC(=CC=C1CCC(=O)O)O
| PubChem CID | 10394 |
|---|---|
| CAS | 501-97-3 |
| Molecular Weight (g/mol) | 166.176 |
| ChEBI | CHEBI:32980 |
| MDL Number | MFCD00002778 |
| SMILES | C1=CC(=CC=C1CCC(=O)O)O |
| Synonym | 3-4-hydroxyphenyl propionic acid,phloretic acid,3-4-hydroxyphenyl propanoic acid,desaminotyrosine,hydro-p-coumaric acid,dihydro-p-coumaric acid,benzenepropanoic acid, 4-hydroxy,4-hydroxyphenylpropionic acid,p-hydroxyhydrocinnamic acid,3-p-hydroxyphenyl propionic acid |
| IUPAC Name | 3-(4-hydroxyphenyl)propanoic acid |
| InChI Key | NMHMNPHRMNGLLB-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Diallyl maleate, 95%
CAS: 999-21-3 Molecular Formula: C10H12O4 Molecular Weight (g/mol): 196.202 MDL Number: MFCD00010763 InChI Key: ZPOLOEWJWXZUSP-WAYWQWQTSA-N Synonym: diallyl fumarate,fumaric acid, diallyl ester,unii-k852lk4c5p,2-butenedioic acid e-, di-2-propenyl ester,2-butenedioic acid 2e-, di-2-propenyl ester,butenedioic acid diallyl ester,1,4-bis prop-2-en-1-yl 2e-but-2-enedioate,2-butenedioic acid 2e-, 1,4-di-2-propen-1-yl ester,diallyl malleate,1,4-bis prop-2-en-1-yl but-2-enedioate PubChem CID: 5354266 IUPAC Name: bis(prop-2-enyl) (Z)-but-2-enedioate SMILES: C=CCOC(=O)C=CC(=O)OCC=C
| PubChem CID | 5354266 |
|---|---|
| CAS | 999-21-3 |
| Molecular Weight (g/mol) | 196.202 |
| MDL Number | MFCD00010763 |
| SMILES | C=CCOC(=O)C=CC(=O)OCC=C |
| Synonym | diallyl fumarate,fumaric acid, diallyl ester,unii-k852lk4c5p,2-butenedioic acid e-, di-2-propenyl ester,2-butenedioic acid 2e-, di-2-propenyl ester,butenedioic acid diallyl ester,1,4-bis prop-2-en-1-yl 2e-but-2-enedioate,2-butenedioic acid 2e-, 1,4-di-2-propen-1-yl ester,diallyl malleate,1,4-bis prop-2-en-1-yl but-2-enedioate |
| IUPAC Name | bis(prop-2-enyl) (Z)-but-2-enedioate |
| InChI Key | ZPOLOEWJWXZUSP-WAYWQWQTSA-N |
| Molecular Formula | C10H12O4 |
Mannose triflate, 98%
CAS: 92051-23-5 Molecular Formula: C15H19F3O12S Molecular Weight (g/mol): 480.36 InChI Key: OIBDVHSTOUGZTJ-PEBLQZBPSA-N Synonym: tatm,mannose triflate,1,3,4,6-tetra-o-acetyl-2-o-trifluoromethanesulfonyl-beta-d-mannopyranose,1,3,4,6-tetra-o-acetyl-2-o-trifluoromethanesulfonyl-b-d-mannopyranose,unii-0ki8ffq6tt,0ki8ffq6tt,beta-d-mannopyranose 1,3,4,6-tetra-o-acetate 2-o-trifluoromethanesulfonate,2r,3r,4s,5s,6s-3,4,6-tris acetyloxy-5-trifluoromethanesulfonyloxy oxan-2-yl methyl acetate,mannose trilfate PubChem CID: 11113597 IUPAC Name: [(2R,3R,4S,5S,6S)-3,4,6-triacetyloxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate SMILES: CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OS(=O)(=O)C(F)(F)F)OC(=O)C)OC(=O)C
| PubChem CID | 11113597 |
|---|---|
| CAS | 92051-23-5 |
| Molecular Weight (g/mol) | 480.36 |
| SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OS(=O)(=O)C(F)(F)F)OC(=O)C)OC(=O)C |
| Synonym | tatm,mannose triflate,1,3,4,6-tetra-o-acetyl-2-o-trifluoromethanesulfonyl-beta-d-mannopyranose,1,3,4,6-tetra-o-acetyl-2-o-trifluoromethanesulfonyl-b-d-mannopyranose,unii-0ki8ffq6tt,0ki8ffq6tt,beta-d-mannopyranose 1,3,4,6-tetra-o-acetate 2-o-trifluoromethanesulfonate,2r,3r,4s,5s,6s-3,4,6-tris acetyloxy-5-trifluoromethanesulfonyloxy oxan-2-yl methyl acetate,mannose trilfate |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,6-triacetyloxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate |
| InChI Key | OIBDVHSTOUGZTJ-PEBLQZBPSA-N |
| Molecular Formula | C15H19F3O12S |
Glycidyl methacrylate, 97%, stabilized
CAS: 106-91-2 InChI Key: VOZRXNHHFUQHIL-UHFFFAOYSA-N Synonym: glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane PubChem CID: 7837 IUPAC Name: oxiran-2-ylmethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC1CO1
| PubChem CID | 7837 |
|---|---|
| CAS | 106-91-2 |
| SMILES | CC(=C)C(=O)OCC1CO1 |
| Synonym | glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate |
| InChI Key | VOZRXNHHFUQHIL-UHFFFAOYSA-N |
Ethylenediaminetetraacetic Acid Dipotassium Salt Dihydrate, 99%
CAS: 25102-12-9 Molecular Formula: C10H18K2N2O10 Molecular Weight (g/mol): 404.455 MDL Number: MFCD00150036 InChI Key: JFROQFOCFOKDKU-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx PubChem CID: 53486451 IUPAC Name: dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+]
| PubChem CID | 53486451 |
|---|---|
| CAS | 25102-12-9 |
| Molecular Weight (g/mol) | 404.455 |
| MDL Number | MFCD00150036 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+] |
| Synonym | ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx |
| IUPAC Name | dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | JFROQFOCFOKDKU-UHFFFAOYSA-L |
| Molecular Formula | C10H18K2N2O10 |
Glycine anhydride, 98%
CAS: 106-57-0 Molecular Formula: C4H6N2O2 Molecular Weight (g/mol): 114.1 MDL Number: MFCD00006009 InChI Key: BXRNXXXXHLBUKK-UHFFFAOYSA-N Synonym: 2,5-piperazinedione,2,5-dioxopiperazine,2,5-diketopiperazine,cyclodiglycine,cycloglycylglycine,cyclo glycylglycyl,glycylglycine lactam,diglycolyl diamide,glycine, bimol. cyclic peptide,alpha,gamma-diacipiperazine PubChem CID: 7817 ChEBI: CHEBI:16535 IUPAC Name: piperazine-2,5-dione SMILES: C1C(=O)NCC(=O)N1
| PubChem CID | 7817 |
|---|---|
| CAS | 106-57-0 |
| Molecular Weight (g/mol) | 114.1 |
| ChEBI | CHEBI:16535 |
| MDL Number | MFCD00006009 |
| SMILES | C1C(=O)NCC(=O)N1 |
| Synonym | 2,5-piperazinedione,2,5-dioxopiperazine,2,5-diketopiperazine,cyclodiglycine,cycloglycylglycine,cyclo glycylglycyl,glycylglycine lactam,diglycolyl diamide,glycine, bimol. cyclic peptide,alpha,gamma-diacipiperazine |
| IUPAC Name | piperazine-2,5-dione |
| InChI Key | BXRNXXXXHLBUKK-UHFFFAOYSA-N |
| Molecular Formula | C4H6N2O2 |
2-Hydroxyethyl methacrylate, 97%, stabilized
CAS: 868-77-9 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD00002863 InChI Key: WOBHKFSMXKNTIM-UHFFFAOYSA-N Synonym: 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 PubChem CID: 13360 ChEBI: CHEBI:34288 IUPAC Name: 2-hydroxyethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCO
| PubChem CID | 13360 |
|---|---|
| CAS | 868-77-9 |
| Molecular Weight (g/mol) | 130.14 |
| ChEBI | CHEBI:34288 |
| MDL Number | MFCD00002863 |
| SMILES | CC(=C)C(=O)OCCO |
| Synonym | 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate |
| InChI Key | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |