Protein Modification Reagents
Chemscene ChemScene | Mal-PEG1-NHS ester | 250MG | CS-0107986 | 0.98 | 1807518-72-4| MFCD26127783 | 310.26
ChemScene | Mal-PEG1-NHS ester | 250MG | CS-0107986 | 0.98 | 1807518-72-4| MFCD26127783 | 310.26
STA PHARMACEUTICAL US LLC FmocNH-PEG8-CH2CH2COOH | 10 g | CAS 756526-02-0 | MDL MFCD11041143
FmocNH-PEG8-CH2CH2COOH is a Amino Acid reagent (Subcategory: PEG AA) sold by WuXi TIDES. Offered in 10 g. Store at 4 °C. SDS available for reference.
Specifications
- CAS: 756526-02-0
- MDL: MFCD11041143
- InChIKey: VYXGUCLTEWCVRY-UHFFFAOYSA-N
- Molecular Weight: 663.761
- Molecular Formula: C34H49NO12
- Purity: ≥95%
- Container Type: 60 mL HDPE
- Pack Size: 10 g
- Net Weight: 10 g
- Gross Weight: 25 g
- Commodity Code: 29242970
- Country Of Origin: China
- IUPAC: 1-(9H-fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid
- SMILES: O=C(CCOCCOCCOCCOCCOCCOCCOCCOCCNC(OCC1C2=CC=CC=C2C3=CC=CC=C31)=O)O
![eMolecules 1835759-88-0 | Azido-PEG1-methylamine | Broadpharm | MFCD29042337 | 144.178 | C5H12N4O | 98.000 | CNCCOCCN=[N+]=[N-] | 1g | 296213342](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502203278.JPG-250.jpg)
eMolecules 1835759-88-0 | Azido-PEG1-methylamine | Broadpharm | MFCD29042337 | 144.178 | C5H12N4O | 98.000 | CNCCOCCN=[N+]=[N-] | 1g | 296213342
Azido-PEG1-methylamine | Broadpharm | 1835759-88-0 | MFCD29042337 | 144.178 | C5H12N4O | 98.000 | CNCCOCCN=[N+]=[N-] | 1g | 296213342
Medchemexpress LLC DBCO-PEG4-C2-acid | 1537170-85-6 | 99.2% | 250 MG
DBCO-PEG4-C2-acid is a PEG-based PROTAC linker used in PROTAC synthesis. It is a click chemistry reagent with a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with azide-containing molecules. PROTACs, which contain two different ligands connected by a linker (one for an E3 ubiquitin ligase and one for the target protein), utilize the intracellular ubiquitin-proteasome system for selective target protein degradation.
- Utilized in the synthesis of PROTACs
- Functions as a click chemistry reagent
- Contains a DBCO group
- Facilitates strain-promoted alkyne-azide cycloaddition (SPAAC)
- Reacts with azide groups in molecules
![eMolecules 1883512-27-3 | endo-BCN-PEG3-amine | Broadpharm368.474 | C19H32N2O5 | 98.000 | NCCOCCOCCOCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 500mg | 528284354](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502203100.JPG-250.jpg)
eMolecules 1883512-27-3 | endo-BCN-PEG3-amine | Broadpharm368.474 | C19H32N2O5 | 98.000 | NCCOCCOCCOCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 500mg | 528284354
endo-BCN-PEG3-amine | Broadpharm | 1883512-27-3368.474 | C19H32N2O5 | 98.000 | NCCOCCOCCOCCNC(=O)OC[C@@H]1[C@@H]2CCC#CCC[C@H]12 | 500mg | 528284354
Medchemexpress LLC Phenol-amido-C1-PEG3-N3 | 1096439-18-7 | 99.9% | 10 MG
Phenol-amido-C1-PEG3-N3 (PROTAC Linker 21) is a PEG-based PROTAC linker utilized in the synthesis of PROTACs. It functions as a click chemistry reagent, containing an Azide group that facilitates copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with molecules possessing Alkyne groups. Additionally, it can engage in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
- PEG-based PROTAC linker
- Utilized in the synthesis of PROTACs
- Functions as a click chemistry reagent
- Contains an Azide group
- Facilitates copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with molecules possessing alkyne groups
- Engages in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups
Medchemexpress LLC Mal-amido-PEG6-acid | 1334177-79-5 | 99.3% | 100 MG
Mal-amido-PEG6-acid is a PEG-based PROTAC linker primarily used in the synthesis of PROTACs. These molecules exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins, making them suitable for research applications.
- PEG-based PROTAC linker
- Facilitates the synthesis of PROTACs
- Utilizes the intracellular ubiquitin-proteasome system
- Enables selective degradation of target proteins
- High purity (99.3%)
- Appears as an off-white to gray solid
eMolecules 1189112-05-7 | PEG15 | Broadpharm | MFCD09910394 | 634.757 | C28H58O15 | 98.000 | OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO | 1g | 229582486
PEG15 | Broadpharm | 1189112-05-7 | MFCD09910394 | 634.757 | C28H58O15 | 98.000 | OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO | 1g | 229582486
![eMolecules Fmoc-Lys (biotin-PEG12)-OH | Broadpharm |1194.440 | C58H91N5O19S | 95.000 | OC(=O)C(CCCCNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 500mg | 272383804](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502203190.JPG-250.jpg)
eMolecules Fmoc-Lys (biotin-PEG12)-OH | Broadpharm |1194.440 | C58H91N5O19S | 95.000 | OC(=O)C(CCCCNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 500mg | 272383804
Fmoc-Lys (biotin-PEG12)-OH | Broadpharm |1194.440 | C58H91N5O19S | 95.000 | OC(=O)C(CCCCNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)NC(=O)OCC1c2ccccc2-c2ccccc12 | 500mg | 272383804
eMolecules 2523025-40-1 | Tri(Amino-PEG3-amide)-amine | Broadpharm | MFCD28142446 | 755.952 | C33H69N7O12 | 0.000 | NCCOCCOCCOCCC(=O)NCCN(CCNC(=O)CCOCCOCCOCCN)CCNC(=O)CCOCCOCCOCCN | 500mg | 393649487
Tri(Amino-PEG3-amide)-amine | Broadpharm | 2523025-40-1 | MFCD28142446 | 755.952 | C33H69N7O12 | 0.000 | NCCOCCOCCOCCC(=O)NCCN(CCNC(=O)CCOCCOCCOCCN)CCNC(=O)CCOCCOCCOCCN | 500mg | 393649487