Dithiophosphate S-esters

Imidan, SPEX CertiPrep™

CAS: 732-11-6 Molecular Formula: C11H12NO4PS2 Molecular Weight (g/mol): 317.314 InChI Key: LMNZTLDVJIUSHT-UHFFFAOYSA-N PubChem CID: 12901 ChEBI: CHEBI:38786 IUPAC Name: 2-(dimethoxyphosphinothioylsulfanylmethyl)isoindole-1,3-dione SMILES: COP(=S)(OC)SCN1C(=O)C2=CC=CC=C2C1=O

  spinner