Pyrazolidines

DQP 1105, Tocris Bioscience™

CAS: 380560-89-4 Molecular Formula: C29H24BrN3O4 Molecular Weight (g/mol): 558.432 InChI Key: CADIBCWPGCNUBD-WEMUOSSPSA-N Synonym: 4-5-4-bromophenyl-3-2-hydroxy-6-methyl-4-phenylquinolin-3-yl-4,5-dihydro-1h-pyrazol-1-yl-4-oxobutanoic acid PubChem CID: 44657732 IUPAC Name: 4-[(3E)-5-(4-bromophenyl)-3-(6-methyl-2-oxo-4-phenylquinolin-3-ylidene)pyrazolidin-1-yl]-4-oxobutanoic acid SMILES: CC1=CC2=C(C(=C3CC(N(N3)C(=O)CCC(=O)O)C4=CC=C(C=C4)Br)C(=O)N=C2C=C1)C5=CC=CC=C5

  spinner