Non Cyclic olefins

Lycopene, >90%, MP Biomedicals™

CAS: 502-65-8 Molecular Formula: C40H56 Molecular Weight (g/mol): 536.888 InChI Key: OAIJSZIZWZSQBC-GYZMGTAESA-N Synonym: all-trans-lycopene PubChem CID: 446925 ChEBI: CHEBI:15948 IUPAC Name: (6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene SMILES: CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C)C

  spinner