Keto fatty acids

Alfa Aesar™ 6-Ketoprostaglandin F1alpha, 98%

CAS: 58962-34-8 Molecular Formula: C20H34O6 Molecular Weight (g/mol): 370.486 MDL Number: MFCD00135222 InChI Key: KFGOFTHODYBSGM-ZUNNJUQCSA-N Synonym: 6-keto-prostaglandin f1alpha, 6-keto-pgf1alpha, 6-oxo-pgf1alpha, 6-ketoprostaglandin f1alpha, 6-keto-prostaglandin f1a, 6-oxoprostaglandin f1alpha, 6-oxo-prostaglandin f1alpha, 6-ketoprostaglandin f1 alpha, 6-keto-pgf1a, unii-8urb805jjj PubChem CID: 5280888 ChEBI: CHEBI:28158 IUPAC Name: 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoic acid SMILES: CCCCCC(C=CC1C(CC(C1CC(=O)CCCCC(=O)O)O)O)O

  spinner