Aminothiazoles

3-Amino-5-nitrobenz[d]isothiazole 93.0+%, TCI America™

CAS: 84387-89-3 Molecular Formula: C7H5N3O2S Molecular Weight (g/mol): 195.196 MDL Number: MFCD00270828 InChI Key: LDTCWISGJYTXDC-UHFFFAOYSA-N Synonym: 1,2-benzisothiazol-3-amine, 5-nitro PubChem CID: 158638 IUPAC Name: 5-nitro-1,2-benzothiazol-3-amine SMILES: C1=CC2=C(C=C1[N+](=O)[O-])C(=NS2)N

  spinner