Pyrrolidine-3-ones

1-Carbobenzoxy-3-pyrrolidone 98.0+%, TCI America™

CAS: 130312-02-6 Molecular Formula: C12H13NO3 Molecular Weight (g/mol): 219.24 MDL Number: MFCD03001711 InChI Key: LMHWEUQNJRXMCD-UHFFFAOYSA-N Synonym: 1-benzyloxycarbonyl-3-pyrrolidinone PubChem CID: 561203 IUPAC Name: benzyl 3-oxopyrrolidine-1-carboxylate SMILES: C1CN(CC1=O)C(=O)OCC2=CC=CC=C2

  spinner