3'-O-methylated flavonoids

Alfa Aesar™ 2'-Amino-3'-methoxyflavone, 99%

CAS: 167869-21-8 Molecular Formula: C16H13NO3 Molecular Weight (g/mol): 267.284 MDL Number: MFCD00671789 InChI Key: QFWCYNPOPKQOKV-UHFFFAOYSA-N Synonym: 2′-amino-3′-methoxyflavone PubChem CID: 4713 ChEBI: CHEBI:77954 IUPAC Name: 2-(2-amino-3-methoxyphenyl)chromen-4-one SMILES: COC1=CC=CC(=C1N)C2=CC(=O)C3=CC=CC=C3O2

  spinner